Content-Type: multipart/mixed; boundary="-------------0110080658492" This is a multi-part message in MIME format. ---------------0110080658492 Content-Type: text/plain; name="01-358.keywords" Content-Transfer-Encoding: 7bit Content-Disposition: attachment; filename="01-358.keywords" Random operators, localization, weak disorder, Lifshitz tails ---------------0110080658492 Content-Type: application/postscript; name="weak-dis-cont.ps" Content-Transfer-Encoding: 7bit Content-Disposition: inline; filename="weak-dis-cont.ps" %!PS-Adobe-2.0 %%Creator: dvips(k) 5.86 Copyright 1999 Radical Eye Software %%Title: weak-dis-cont.dvi %%Pages: 20 %%PageOrder: Ascend %%BoundingBox: 0 0 596 842 %%EndComments %DVIPSWebPage: (www.radicaleye.com) %DVIPSCommandLine: dvips weak-dis-cont.dvi -o weak-dis-cont.ps %DVIPSParameters: dpi=600, compressed %DVIPSSource: TeX output 2001.10.08:1338 %%BeginProcSet: texc.pro %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) (LaserWriter 16/600)]{A length product length le{A length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end %%EndProcSet %%BeginProcSet: pstricks.pro %! % PostScript prologue for pstricks.tex. % Version 97 patch 3, 98/06/01 % For distribution, see pstricks.tex. % /tx@Dict 200 dict def tx@Dict begin /ADict 25 dict def /CM { matrix currentmatrix } bind def /SLW /setlinewidth load def /CLW /currentlinewidth load def /CP /currentpoint load def /ED { exch def } bind def /L /lineto load def /T /translate load def /TMatrix { } def /RAngle { 0 } def /Atan { /atan load stopped { pop pop 0 } if } def /Div { dup 0 eq { pop } { div } ifelse } def /NET { neg exch neg exch T } def /Pyth { dup mul exch dup mul add sqrt } def /PtoC { 2 copy cos mul 3 1 roll sin mul } def /PathLength@ { /z z y y1 sub x x1 sub Pyth add def /y1 y def /x1 x def } def /PathLength { flattenpath /z 0 def { /y1 ED /x1 ED /y2 y1 def /x2 x1 def } { /y ED /x ED PathLength@ } {} { /y y2 def /x x2 def PathLength@ } /pathforall load stopped { pop pop pop pop } if z } def /STP { .996264 dup scale } def /STV { SDict begin normalscale end STP } def /DashLine { dup 0 gt { /a .5 def PathLength exch div } { pop /a 1 def PathLength } ifelse /b ED /x ED /y ED /z y x add def b a .5 sub 2 mul y mul sub z Div round z mul a .5 sub 2 mul y mul add b exch Div dup y mul /y ED x mul /x ED x 0 gt y 0 gt and { [ y x ] 1 a sub y mul } { [ 1 0 ] 0 } ifelse setdash stroke } def /DotLine { /b PathLength def /a ED /z ED /y CLW def /z y z add def a 0 gt { /b b a div def } { a 0 eq { /b b y sub def } { a -3 eq { /b b y add def } if } ifelse } ifelse [ 0 b b z Div round Div dup 0 le { pop 1 } if ] a 0 gt { 0 } { y 2 div a -2 gt { neg } if } ifelse setdash 1 setlinecap stroke } def /LineFill { gsave abs CLW add /a ED a 0 dtransform round exch round exch 2 copy idtransform exch Atan rotate idtransform pop /a ED .25 .25 % DG/SR modification begin - Dec. 12, 1997 - Patch 2 %itransform translate pathbbox /y2 ED a Div ceiling cvi /x2 ED /y1 ED a itransform pathbbox /y2 ED a Div ceiling cvi /x2 ED /y1 ED a % DG/SR modification end Div cvi /x1 ED /y2 y2 y1 sub def clip newpath 2 setlinecap systemdict /setstrokeadjust known { true setstrokeadjust } if x2 x1 sub 1 add { x1 % DG/SR modification begin - Jun. 1, 1998 - Patch 3 (from Michael Vulis) % a mul y1 moveto 0 y2 rlineto stroke /x1 x1 1 add def } repeat grestore } % def a mul y1 moveto 0 y2 rlineto stroke /x1 x1 1 add def } repeat grestore pop pop } def % DG/SR modification end /BeginArrow { ADict begin /@mtrx CM def gsave 2 copy T 2 index sub neg exch 3 index sub exch Atan rotate newpath } def /EndArrow { @mtrx setmatrix CP grestore end } def /Arrow { CLW mul add dup 2 div /w ED mul dup /h ED mul /a ED { 0 h T 1 -1 scale } if w neg h moveto 0 0 L w h L w neg a neg rlineto gsave fill grestore } def /Tbar { CLW mul add /z ED z -2 div CLW 2 div moveto z 0 rlineto stroke 0 CLW moveto } def /Bracket { CLW mul add dup CLW sub 2 div /x ED mul CLW add /y ED /z CLW 2 div def x neg y moveto x neg CLW 2 div L x CLW 2 div L x y L stroke 0 CLW moveto } def /RoundBracket { CLW mul add dup 2 div /x ED mul /y ED /mtrx CM def 0 CLW 2 div T x y mul 0 ne { x y scale } if 1 1 moveto .85 .5 .35 0 0 0 curveto -.35 0 -.85 .5 -1 1 curveto mtrx setmatrix stroke 0 CLW moveto } def /SD { 0 360 arc fill } def /EndDot { { /z DS def } { /z 0 def } ifelse /b ED 0 z DS SD b { 0 z DS CLW sub SD } if 0 DS z add CLW 4 div sub moveto } def /Shadow { [ { /moveto load } { /lineto load } { /curveto load } { /closepath load } /pathforall load stopped { pop pop pop pop CP /moveto load } if ] cvx newpath 3 1 roll T exec } def /NArray { aload length 2 div dup dup cvi eq not { exch pop } if /n exch cvi def } def /NArray { /f ED counttomark 2 div dup cvi /n ED n eq not { exch pop } if f { ] aload /Points ED } { n 2 mul 1 add -1 roll pop } ifelse } def /Line { NArray n 0 eq not { n 1 eq { 0 0 /n 2 def } if ArrowA /n n 2 sub def n { Lineto } repeat CP 4 2 roll ArrowB L pop pop } if } def /Arcto { /a [ 6 -2 roll ] cvx def a r /arcto load stopped { 5 } { 4 } ifelse { pop } repeat a } def /CheckClosed { dup n 2 mul 1 sub index eq 2 index n 2 mul 1 add index eq and { pop pop /n n 1 sub def } if } def /Polygon { NArray n 2 eq { 0 0 /n 3 def } if n 3 lt { n { pop pop } repeat } { n 3 gt { CheckClosed } if n 2 mul -2 roll /y0 ED /x0 ED /y1 ED /x1 ED x1 y1 /x1 x0 x1 add 2 div def /y1 y0 y1 add 2 div def x1 y1 moveto /n n 2 sub def n { Lineto } repeat x1 y1 x0 y0 6 4 roll Lineto Lineto pop pop closepath } ifelse } def /Diamond { /mtrx CM def T rotate /h ED /w ED dup 0 eq { pop } { CLW mul neg /d ED /a w h Atan def /h d a sin Div h add def /w d a cos Div w add def } ifelse mark w 2 div h 2 div w 0 0 h neg w neg 0 0 h w 2 div h 2 div /ArrowA { moveto } def /ArrowB { } def false Line closepath mtrx setmatrix } def % DG modification begin - Jan. 15, 1997 %/Triangle { /mtrx CM def translate rotate /h ED 2 div /w ED dup 0 eq { %pop } { CLW mul /d ED /h h d w h Atan sin Div sub def /w w d h w Atan 2 %div dup cos exch sin Div mul sub def } ifelse mark 0 d w neg d 0 h w d 0 %d /ArrowA { moveto } def /ArrowB { } def false Line closepath mtrx %setmatrix } def /Triangle { /mtrx CM def translate rotate /h ED 2 div /w ED dup CLW mul /d ED /h h d w h Atan sin Div sub def /w w d h w Atan 2 div dup cos exch sin Div mul sub def mark 0 d w neg d 0 h w d 0 d /ArrowA { moveto } def /ArrowB { } def false Line closepath mtrx % DG/SR modification begin - Jun. 1, 1998 - Patch 3 (from Michael Vulis) % setmatrix } def setmatrix pop } def % DG/SR modification end /CCA { /y ED /x ED 2 copy y sub /dy1 ED x sub /dx1 ED /l1 dx1 dy1 Pyth def } def /CCA { /y ED /x ED 2 copy y sub /dy1 ED x sub /dx1 ED /l1 dx1 dy1 Pyth def } def /CC { /l0 l1 def /x1 x dx sub def /y1 y dy sub def /dx0 dx1 def /dy0 dy1 def CCA /dx dx0 l1 c exp mul dx1 l0 c exp mul add def /dy dy0 l1 c exp mul dy1 l0 c exp mul add def /m dx0 dy0 Atan dx1 dy1 Atan sub 2 div cos abs b exp a mul dx dy Pyth Div 2 div def /x2 x l0 dx mul m mul sub def /y2 y l0 dy mul m mul sub def /dx l1 dx mul m mul neg def /dy l1 dy mul m mul neg def } def /IC { /c c 1 add def c 0 lt { /c 0 def } { c 3 gt { /c 3 def } if } ifelse /a a 2 mul 3 div 45 cos b exp div def CCA /dx 0 def /dy 0 def } def /BOC { IC CC x2 y2 x1 y1 ArrowA CP 4 2 roll x y curveto } def /NC { CC x1 y1 x2 y2 x y curveto } def /EOC { x dx sub y dy sub 4 2 roll ArrowB 2 copy curveto } def /BAC { IC CC x y moveto CC x1 y1 CP ArrowA } def /NAC { x2 y2 x y curveto CC x1 y1 } def /EAC { x2 y2 x y ArrowB curveto pop pop } def /OpenCurve { NArray n 3 lt { n { pop pop } repeat } { BOC /n n 3 sub def n { NC } repeat EOC } ifelse } def /AltCurve { { false NArray n 2 mul 2 roll [ n 2 mul 3 sub 1 roll ] aload /Points ED n 2 mul -2 roll } { false NArray } ifelse n 4 lt { n { pop pop } repeat } { BAC /n n 4 sub def n { NAC } repeat EAC } ifelse } def /ClosedCurve { NArray n 3 lt { n { pop pop } repeat } { n 3 gt { CheckClosed } if 6 copy n 2 mul 6 add 6 roll IC CC x y moveto n { NC } repeat closepath pop pop } ifelse } def /SQ { /r ED r r moveto r r neg L r neg r neg L r neg r L fill } def /ST { /y ED /x ED x y moveto x neg y L 0 x L fill } def /SP { /r ED gsave 0 r moveto 4 { 72 rotate 0 r L } repeat fill grestore } def /FontDot { DS 2 mul dup matrix scale matrix concatmatrix exch matrix rotate matrix concatmatrix exch findfont exch makefont setfont } def /Rect { x1 y1 y2 add 2 div moveto x1 y2 lineto x2 y2 lineto x2 y1 lineto x1 y1 lineto closepath } def /OvalFrame { x1 x2 eq y1 y2 eq or { pop pop x1 y1 moveto x2 y2 L } { y1 y2 sub abs x1 x2 sub abs 2 copy gt { exch pop } { pop } ifelse 2 div exch { dup 3 1 roll mul exch } if 2 copy lt { pop } { exch pop } ifelse /b ED x1 y1 y2 add 2 div moveto x1 y2 x2 y2 b arcto x2 y2 x2 y1 b arcto x2 y1 x1 y1 b arcto x1 y1 x1 y2 b arcto 16 { pop } repeat closepath } ifelse } def /Frame { CLW mul /a ED 3 -1 roll 2 copy gt { exch } if a sub /y2 ED a add /y1 ED 2 copy gt { exch } if a sub /x2 ED a add /x1 ED 1 index 0 eq { pop pop Rect } { OvalFrame } ifelse } def /BezierNArray { /f ED counttomark 2 div dup cvi /n ED n eq not { exch pop } if n 1 sub neg 3 mod 3 add 3 mod { 0 0 /n n 1 add def } repeat f { ] aload /Points ED } { n 2 mul 1 add -1 roll pop } ifelse } def /OpenBezier { BezierNArray n 1 eq { pop pop } { ArrowA n 4 sub 3 idiv { 6 2 roll 4 2 roll curveto } repeat 6 2 roll 4 2 roll ArrowB curveto } ifelse } def /ClosedBezier { BezierNArray n 1 eq { pop pop } { moveto n 1 sub 3 idiv { 6 2 roll 4 2 roll curveto } repeat closepath } ifelse } def /BezierShowPoints { gsave Points aload length 2 div cvi /n ED moveto n 1 sub { lineto } repeat CLW 2 div SLW [ 4 4 ] 0 setdash stroke grestore } def /Parab { /y0 exch def /x0 exch def /y1 exch def /x1 exch def /dx x0 x1 sub 3 div def /dy y0 y1 sub 3 div def x0 dx sub y0 dy add x1 y1 ArrowA x0 dx add y0 dy add x0 2 mul x1 sub y1 ArrowB curveto /Points [ x1 y1 x0 y0 x0 2 mul x1 sub y1 ] def } def /Grid { newpath /a 4 string def /b ED /c ED /n ED cvi dup 1 lt { pop 1 } if /s ED s div dup 0 eq { pop 1 } if /dy ED s div dup 0 eq { pop 1 } if /dx ED dy div round dy mul /y0 ED dx div round dx mul /x0 ED dy div round cvi /y2 ED dx div round cvi /x2 ED dy div round cvi /y1 ED dx div round cvi /x1 ED /h y2 y1 sub 0 gt { 1 } { -1 } ifelse def /w x2 x1 sub 0 gt { 1 } { -1 } ifelse def b 0 gt { /z1 b 4 div CLW 2 div add def /Helvetica findfont b scalefont setfont /b b .95 mul CLW 2 div add def } if systemdict /setstrokeadjust known { true setstrokeadjust /t { } def } { /t { transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform } bind def } ifelse gsave n 0 gt { 1 setlinecap [ 0 dy n div ] dy n div 2 div setdash } { 2 setlinecap } ifelse /i x1 def /f y1 dy mul n 0 gt { dy n div 2 div h mul sub } if def /g y2 dy mul n 0 gt { dy n div 2 div h mul add } if def x2 x1 sub w mul 1 add dup 1000 gt { pop 1000 } if { i dx mul dup y0 moveto b 0 gt { gsave c i a cvs dup stringwidth pop /z2 ED w 0 gt {z1} {z1 z2 add neg} ifelse h 0 gt {b neg} {z1} ifelse rmoveto show grestore } if dup t f moveto g t L stroke /i i w add def } repeat grestore gsave n 0 gt % DG/SR modification begin - Nov. 7, 1997 - Patch 1 %{ 1 setlinecap [ 0 dx n div ] dy n div 2 div setdash } { 1 setlinecap [ 0 dx n div ] dx n div 2 div setdash } % DG/SR modification end { 2 setlinecap } ifelse /i y1 def /f x1 dx mul n 0 gt { dx n div 2 div w mul sub } if def /g x2 dx mul n 0 gt { dx n div 2 div w mul add } if def y2 y1 sub h mul 1 add dup 1000 gt { pop 1000 } if { newpath i dy mul dup x0 exch moveto b 0 gt { gsave c i a cvs dup stringwidth pop /z2 ED w 0 gt {z1 z2 add neg} {z1} ifelse h 0 gt {z1} {b neg} ifelse rmoveto show grestore } if dup f exch t moveto g exch t L stroke /i i h add def } repeat grestore } def /ArcArrow { /d ED /b ED /a ED gsave newpath 0 -1000 moveto clip newpath 0 1 0 0 b grestore c mul /e ED pop pop pop r a e d PtoC y add exch x add exch r a PtoC y add exch x add exch b pop pop pop pop a e d CLW 8 div c mul neg d } def /Ellipse { /mtrx CM def T scale 0 0 1 5 3 roll arc mtrx setmatrix } def /Rot { CP CP translate 3 -1 roll neg rotate NET } def /RotBegin { tx@Dict /TMatrix known not { /TMatrix { } def /RAngle { 0 } def } if /TMatrix [ TMatrix CM ] cvx def /a ED a Rot /RAngle [ RAngle dup a add ] cvx def } def /RotEnd { /TMatrix [ TMatrix setmatrix ] cvx def /RAngle [ RAngle pop ] cvx def } def /PutCoor { gsave CP T CM STV exch exec moveto setmatrix CP grestore } def /PutBegin { /TMatrix [ TMatrix CM ] cvx def CP 4 2 roll T moveto } def /PutEnd { CP /TMatrix [ TMatrix setmatrix ] cvx def moveto } def /Uput { /a ED add 2 div /h ED 2 div /w ED /s a sin def /c a cos def /b s abs c abs 2 copy gt dup /q ED { pop } { exch pop } ifelse def /w1 c b div w mul def /h1 s b div h mul def q { w1 abs w sub dup c mul abs } { h1 abs h sub dup s mul abs } ifelse } def /UUput { /z ED abs /y ED /x ED q { x s div c mul abs y gt } { x c div s mul abs y gt } ifelse { x x mul y y mul sub z z mul add sqrt z add } { q { x s div } { x c div } ifelse abs } ifelse a PtoC h1 add exch w1 add exch } def /BeginOL { dup (all) eq exch TheOL eq or { IfVisible not { Visible /IfVisible true def } if } { IfVisible { Invisible /IfVisible false def } if } ifelse } def /InitOL { /OLUnit [ 3000 3000 matrix defaultmatrix dtransform ] cvx def /Visible { CP OLUnit idtransform T moveto } def /Invisible { CP OLUnit neg exch neg exch idtransform T moveto } def /BOL { BeginOL } def /IfVisible true def } def end % END pstricks.pro %%EndProcSet %%BeginProcSet: pst-dots.pro %!PS-Adobe-2.0 %%Title: Dot Font for PSTricks 97 - Version 97, 93/05/07. %%Creator: Timothy Van Zandt %%Creation Date: May 7, 1993 10 dict dup begin /FontType 3 def /FontMatrix [ .001 0 0 .001 0 0 ] def /FontBBox [ 0 0 0 0 ] def /Encoding 256 array def 0 1 255 { Encoding exch /.notdef put } for Encoding dup (b) 0 get /Bullet put dup (c) 0 get /Circle put dup (C) 0 get /BoldCircle put dup (u) 0 get /SolidTriangle put dup (t) 0 get /Triangle put dup (T) 0 get /BoldTriangle put dup (r) 0 get /SolidSquare put dup (s) 0 get /Square put dup (S) 0 get /BoldSquare put dup (q) 0 get /SolidPentagon put dup (p) 0 get /Pentagon put (P) 0 get /BoldPentagon put /Metrics 13 dict def Metrics begin /Bullet 1000 def /Circle 1000 def /BoldCircle 1000 def /SolidTriangle 1344 def /Triangle 1344 def /BoldTriangle 1344 def /SolidSquare 886 def /Square 886 def /BoldSquare 886 def /SolidPentagon 1093.2 def /Pentagon 1093.2 def /BoldPentagon 1093.2 def /.notdef 0 def end /BBoxes 13 dict def BBoxes begin /Circle { -550 -550 550 550 } def /BoldCircle /Circle load def /Bullet /Circle load def /Triangle { -571.5 -330 571.5 660 } def /BoldTriangle /Triangle load def /SolidTriangle /Triangle load def /Square { -450 -450 450 450 } def /BoldSquare /Square load def /SolidSquare /Square load def /Pentagon { -546.6 -465 546.6 574.7 } def /BoldPentagon /Pentagon load def /SolidPentagon /Pentagon load def /.notdef { 0 0 0 0 } def end /CharProcs 20 dict def CharProcs begin /Adjust { 2 copy dtransform floor .5 add exch floor .5 add exch idtransform 3 -1 roll div 3 1 roll exch div exch scale } def /CirclePath { 0 0 500 0 360 arc closepath } def /Bullet { 500 500 Adjust CirclePath fill } def /Circle { 500 500 Adjust CirclePath .9 .9 scale CirclePath eofill } def /BoldCircle { 500 500 Adjust CirclePath .8 .8 scale CirclePath eofill } def /BoldCircle { CirclePath .8 .8 scale CirclePath eofill } def /TrianglePath { 0 660 moveto -571.5 -330 lineto 571.5 -330 lineto closepath } def /SolidTriangle { TrianglePath fill } def /Triangle { TrianglePath .85 .85 scale TrianglePath eofill } def /BoldTriangle { TrianglePath .7 .7 scale TrianglePath eofill } def /SquarePath { -450 450 moveto 450 450 lineto 450 -450 lineto -450 -450 lineto closepath } def /SolidSquare { SquarePath fill } def /Square { SquarePath .89 .89 scale SquarePath eofill } def /BoldSquare { SquarePath .78 .78 scale SquarePath eofill } def /PentagonPath { -337.8 -465 moveto 337.8 -465 lineto 546.6 177.6 lineto 0 574.7 lineto -546.6 177.6 lineto closepath } def /SolidPentagon { PentagonPath fill } def /Pentagon { PentagonPath .89 .89 scale PentagonPath eofill } def /BoldPentagon { PentagonPath .78 .78 scale PentagonPath eofill } def /.notdef { } def end /BuildGlyph { exch begin Metrics 1 index get exec 0 BBoxes 3 index get exec setcachedevice CharProcs begin load exec end end } def /BuildChar { 1 index /Encoding get exch get 1 index /BuildGlyph get exec } bind def end /PSTricksDotFont exch definefont pop % END pst-dots.pro %%EndProcSet %%BeginProcSet: special.pro %! TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N /vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N /rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N /@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{ /hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B /@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{ /urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known {userdict/md get type/dicttype eq{userdict begin md length 10 add md maxlength ge{/md md dup length 20 add dict copy def}if end md begin /letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{ itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack} if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 -1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{ noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop 90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr 2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 -1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{ Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale }if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState save N userdict maxlength dict begin/magscale true def normalscale currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts /psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{ psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict begin/SpecialSave save N gsave normalscale currentpoint TR @SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{ CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR }{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N /@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end} repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N /@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X /yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc savematrix setmatrix}N end %%EndProcSet TeXDict begin 39158280 55380996 1000 600 600 (weak-dis-cont.dvi) @start %DVIPSBitmapFont: Fa cmtt10 10 26 /Fa 26 127 df<007FB6FCB71280A46C150021067B9B2C>45 D<121FEA3F80EA7FC0EAFF E0A5EA7FC0EA3F80EA1F000B0B708A2C>I<1507ED0F80151FA2153F16005D157E15FE5D 14015D14035DA214075D140F5D141F5D143F92C7FC5C147E14FE5CA213015C13035C1307 5C130F5C131F5CA2133F91C8FC5B137E13FE5B12015B12035B12075BA2120F5B121F5B12 3F90C9FC5A127E12FE5AA25A127821417BB92C>I<1307497EA2131FA2133F137F13FF5A 1207127FB5FC13DF139FEA7C1F1200B3AE007FB512E0B612F0A36C14E01C3477B32C>49 D51 D<121FEA3F80EA7FC0EAFFE0A5EA7FC0EA3F80EA1F00C7FCAE121FEA3F80EA 7FC0EAFFE0A5EA7FC0EA3F80EA1F000B2470A32C>58 D64 D<3801FFF0000713FE001F6D7E15E048809038C01FF81407EC01FC381F80000006C77EC8 127EA3ECFFFE131F90B5FC1203120F48EB807E383FF800EA7FC090C7FC12FE5AA47E007F 14FEEB8003383FE01F6CB612FC6C15FE6C14BF0001EBFE1F3A003FF007FC27247CA32C> 97 DI101 DI104 D<1307EB1FC0A2497EA36D5AA20107C7FC90C8FCA7387F FFC080B5FC7EA2EA0007B3A8007FB512FCB612FEA36C14FC1F3479B32C>I107 D<387FFFE0B57EA37EEA0003B3B3A5007FB61280B712C0A36C158022337BB22C>I<3A7F 83F007E09039CFFC1FF83AFFDFFE3FFCD87FFF13FF91B57E3A07FE1FFC3E01FCEBF83F49 6C487E01F013E001E013C0A301C01380B33B7FFC3FF87FF0027F13FFD8FFFE6D13F8D87F FC4913F0023F137F2D2481A32C>I<397FF01FE039FFF87FFC9038F9FFFE01FB7F6CB6FC 00019038F03F80ECC01F02807FEC000F5B5BA25BB3267FFFE0B5FCB500F11480A36C01E0 140029247FA32C>II<397FF01FE039FFF8FFF801FB13FE90B6FC6C158000019038 F07FC09138801FE091380007F049EB03F85BED01FC491300A216FE167EA816FE6D14FCA2 ED01F86D13036DEB07F0150F9138801FE09138E07FC091B51280160001FB5B01F813F8EC 3FC091C8FCAD387FFFE0B57EA36C5B27367FA32C>I114 D<90387FF8700003B512F8120F5A5A387FC00F 387E00034813015AA36CEB00F0007F140013F0383FFFC06C13FE6CEBFF80000314E0C66C 13F8010113FCEB0007EC00FE0078147F00FC143F151F7EA26C143F6D133E6D13FE9038F0 07FC90B5FC15F815E000F8148039701FFC0020247AA32C>I<131E133FA9007FB6FCB712 80A36C1500D8003FC8FCB1ED03C0ED07E0A5EC800F011FEB1FC0ECE07F6DB51280160001 035B6D13F89038003FE0232E7EAD2C>I<3A7FF003FF80486C487FA3007F7F0001EB000F B3A3151FA2153F6D137F3900FE03FF90B7FC6D15807F6D13CF902603FE07130029247FA3 2C>I<3A7FFF01FFFCB514FE148314016C15FC3A03E0000F80A26D131F00011500A26D5B 0000143EA26D137E017C137CA2017E13FC013E5BA2EB3F01011F5BA21483010F5BA214C7 01075BA214EF01035BA214FF6D90C7FCA26D5A147C27247EA32C>I<003FB612E04815F0 A4007EC7EA1FE0ED3FC0ED7F80EDFF004A5A003C495AC7485A4A5A4A5A4A5A4A5A4AC7FC EB01FC495AEB0FF0495A495A495A49C8FC4848EB01E04848EB03F0485A485A485A485A48 5AB7FCA46C15E024247DA32C>122 D<01F81370D803FE13F8380FFF0148138748EBCFF0 397F9FFFE0D8FF0F13C0D8FC07138039F803FE00387000F81D0A79B22C>126 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fb msam8 8 1 /Fb 1 23 df<12E0A27EA27E7E12EE12E7EAE380EAE1C0EAE0E01378131C1300B3B3AA0E 3B73AD1D>22 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fc cmr6 6 4 /Fc 4 51 df<1438B2B712FEA3C70038C7FCB227277C9F2F>43 D<13FF000313C0380781 E0380F00F0001E137848133CA248131EA400F8131FAD0078131EA2007C133E003C133CA2 6C13786C13F0380781E03803FFC0C6130018227DA01E>48 D<13E01201120712FF12F912 01B3A7487EB512C0A212217AA01E>II E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fd cmsy6 6 4 /Fd 4 50 df0 D<136013701360A20040132000E0137038F861 F0387E67E0381FFF803807FE00EA00F0EA07FE381FFF80387E67E038F861F038E0607000 40132000001300A21370136014157B9620>3 D48 D<01FEEC0FE02603FFC0EB3FF8000F01F0EBFE3E3B1F0FF801F0073C3C01FC07C003803B 3000FE0F00010070D93F1EEB00C00060EB1F9C00E0D90FF81460485C14076E7E6E7E8102 0315E00060D9073F14C091390F1F80016C90261E0FE01380003890397C07F0073C1C01F0 03FE1F003B0F8FE001FFFE3B03FF80007FF8C648C7EA0FE033177C953D>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fe cmti8 8 4 /Fe 4 116 df97 D99 D<90383C01F09038FF07FC3901E79E1E9038C7 BC0F000301F81380903887F00702E013C038078FC0130F1480A2D8061F130F12001400A2 49131F1680133EA2017EEB3F00A2017C133E157E01FC137C5DEBFE015D486C485AEC0F80 D9F3FEC7FCEBF0F8000390C8FCA25BA21207A25BA2120FA2EAFFFCA2222B7F9D24>112 D115 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Ff cmti12 12 47 /Ff 47 128 df12 D14 D<167016E0ED01C0ED0380ED0700150E153C5D15F85D4A5A4A5A4A5A140F4AC7FC 141E143E5C147814F8495A5C1303495AA2495AA249C8FCA25B133E137E137CA25BA21201 5BA212035BA212075BA2120FA25BA2121FA290C9FCA25AA2123EA3127EA2127CA65AAB12 78A6127C123CA47EA2120E120FA27E6C7EA26C7EA26C7E1360246472CA28>40 D<1560A2157081A281151E150E150FA2811680A3ED03C0A516E0A21501A71503A91507A2 16C0A4150FA21680A2151FA21600A25DA2153EA2157EA2157C15FCA25D1401A25D14035D A214075D140F5DA24AC7FCA2143EA25C147814F8495AA2495A5C1307495A91C8FC131E13 3E5B13785B485A485A485A48C9FC121E5A5A12E05A23647FCA28>I<13F0EA03FC1207A2 EA0FFEA4EA07FCEA03CCEA000C131C1318A2133813301370136013E0EA01C013801203EA 0700120E5A5A5A5A5A0F1D7A891E>44 D<007FB5FCB6FCA214FEA21805789723>I<120F EA3FC0127FA212FFA31380EA7F00123C0A0A76891E>I 48 D<16C01501A215031507ED0F80151F153F157F913801FF005C140F147F903807FCFE EB0FF0EB0700EB00015DA314035DA314075DA3140F5DA3141F5DA3143F5DA3147F92C7FC A35C5CA313015CA313035CA313075CA2130FA2131F133FB612FCA25D224276C132>II I<14F0EB01FC1303EB07FE130FA214FCEB07F814F0EB01E090C7FCB3A513F0EA03F8487E A2120FA46C5AEA03D8EA001813381330A21370136013E05B12015B120348C7FC1206120E 5A5A5A5A5A173E7AAA1E>59 D65 D<91B712FCF0FF8019E00201903980001FF06E90 C7EA07F84A6F7E727E4B81841A800203167F5DA314075D19FFA2020F17004B5C61180302 1F5E4B4A5A180F4E5A023F4B5A4BEC7F804EC7FCEF03FC027FEC0FF84BEBFFC092B6C8FC 18E0913AFF800007F892C7EA01FC717E187F49834A6F7EA30103835CA313075CA3010F5F 4A157FA24E5A131F4A4A90C7FC601703013F4B5A4A4A5A4D5A017F4B5A4D5A4A4948C8FC 01FFEC0FFEB812F817C04CC9FC41447AC345>I<91B91280A30201902680000713006E90 C8FC4A163FA24B81A30203160E5DA314074B151E191CA2140F5D17075F021F020E90C7FC 5DA2171E023F141C4B133CA2177C027F5CED800392B5FCA291B65AED00071601A2496E5A 5CA2160101035D5CA2160301075D4A90CAFCA3130F5CA3131F5CA3133F5CA2137FA313FF B612E0A341447AC340>70 D<91B6D8803FB512E0A302010180C7387FE0006E90C86C5A4A 167FA24B5EA219FF14034B93C7FCA26014074B5DA21803140F4B5DA21807141F4B5DA218 0F143F4B5DA2181F147F92B75AA3DAFF80C7123F92C85BA2187F5B4A5EA218FF13034A93 C8FCA25F13074A5DA21703130F4A5DA21707131F4A5DA2170F133F4A5DA2017F151FA24A 5D496C4A7EB6D8803FB512E0A34B447AC348>72 D<027FB512E091B6FCA20200EBE000ED 7F8015FFA293C7FCA35C5DA314035DA314075DA3140F5DA3141F5DA3143F5DA3147F5DA3 14FF92C8FCA35B5CA313035CA313075CA3130F5CA3131F5CA2133FA25CEBFFE0B612E0A2 5D2B447BC326>I<91B712F018FEF0FF800201903980007FE06E90C7EA1FF04AED07F818 034B15FCF001FE1403A24B15FFA21407A25DA2140FF003FE5DA2021F16FC18074B15F818 0F023F16F0F01FE04B15C0F03F80027FED7F0018FE4BEB03FCEF0FF002FFEC7FC092B6C7 FC17F892CAFC5BA25CA21303A25CA21307A25CA2130FA25CA2131FA25CA2133FA25CA213 7FA25C497EB67EA340447AC342>80 D83 D<48B912F85AA2913B0007FC001FF0D807F84A130701E0010F14034916014848 5C90C71500A2001E021F15E05E121C123C0038143F4C1301007818C0127000F0147F485D A3C800FF91C7FC93C9FCA35C5DA314035DA314075DA3140F5DA3141F5DA3143F5DA3147F 5DA314FF92CAFCA35B5CA21303A21307497E007FB612C0A25E3D446FC346>I97 DIIIII<15FCEC03FF91390F8383809139 3E01CFC091387C00EF4A13FF4948137F010315804948133F495A131F4A1400133F91C75A 5B167E13FE16FE1201495CA215011203495CA21503A2495CA21507A25EA2150F151F5E00 01143F157F6C6C13FF913801DF8090387C039F90383E0F3FEB0FFCD903F090C7FC90C7FC 5DA2157EA215FEA25DA2001C495A127F48495A14074A5A485C023FC8FC00F8137E387C01 F8381FFFE0000390C9FC2A407BAB2D>I<14FE137FA3EB01FC13001301A25CA21303A25C A21307A25CA2130FA25CA2131FA25C157F90393F83FFC091388F81F091381E00F802387F 4948137C5C4A137EA2495A91C7FCA25B484814FE5E5BA2000314015E5BA2000714035E5B 1507000F5DA249130F5E001F1678031F1370491480A2003F023F13F0EE00E090C7FC1601 48023E13C01603007E1680EE070000FEEC1E0FED1F1E48EC0FF80038EC03E02D467AC432 >I<143C147E14FE1301A3EB00FC14701400AE137C48B4FC3803C780380703C0000F13E0 120E121C13071238A21278EA700F14C0131F00F0138012E0EA003F1400A25B137EA213FE 5B12015BA212035B141E0007131C13E0A2000F133CEBC038A21478EB807014F014E0EB81 C0EA0783EBC7803803FE00EA00F8174378C11E>I<16F0ED03F8A21507A316F0ED01C092 C7FCAEEC01F0EC07FCEC1E1EEC380F0270138014E0130114C0EB03800107131F1400A213 0E153F131E011C140090C7FC5DA2157EA215FEA25DA21401A25DA21403A25DA21407A25D A2140FA25DA2141FA25DA2143FA292C7FCA25C147EA214FE001C5B127F48485A495AA248 485A495AD8F81FC8FCEA707EEA3FF8EA0FC0255683C11E>I<14FE137FA3EB01FC130013 01A25CA21303A25CA21307A25CA2130FA25CA2131FA25C167E013F49B4FC92380783C091 38000E07ED3C1F491370ED603F017E13E0EC01C09026FE03801380913907000E00D9FC0E 90C7FC5C00015B5C495AEBF9C03803FB8001FFC9FCA214F03807F3FCEBF07F9038E01FC0 6E7E000F130781EBC003A2001F150FA20180140EA2003F151E161C010013E0A2485DA200 7E1578167000FE01015B15F1489038007F800038021FC7FC2A467AC42D>IIIIII<91381F800C91387FE01C903901F0703C903907C0387890390F801CF890381F 001D013E130F017E14F05B48481307A2484814E012075B000F140F16C0485AA2003F141F 491480A3007F143F90C71300A35D00FE147EA315FE5DA2007E1301A24A5A1407003E130F A26C495A143B380F80F33807C3E73901FF87E038007E071300140F5DA3141F5DA3143F92 C7FCA25CA25C017F13FEA25D263F76AB2D>III<1470EB01F8A313035CA313075CA3130F5CA3131F5CA2007F B512E0B6FC15C0D8003FC7FCA25B137EA313FE5BA312015BA312035BA312075BA3120F5B A2EC0780001F140013805C140E003F131EEB001C143C14385C6C13F0495A6C485AEB8780 D807FEC7FCEA01F81B3F78BD20>I<137C48B414072603C780EB1F80380703C0000F7F00 0E153F121C0107150012385E1278D8700F147E5C011F14FE00F05B00E05DEA003FEC0001 A2495C137E150313FE495CA215071201495CA2030F13380003167849ECC070A3031F13F0 EE80E0153F00011581037F13C06DEBEF8300000101148090397C03C787903A3E0F07C700 90391FFE01FE903903F000782D2D78AB34>I<017C143848B414FC3A03C78001FE380703 C0000F13E0120E001C14000107147E1238163E1278D8700F141E5C131F00F049131C12E0 EA003F91C7123C16385B137E167801FE14705BA216F0000115E05B150116C0A24848EB03 80A2ED0700A2150E12015D6D5B000014786D5B90387C01E090383F0780D90FFFC7FCEB03 F8272D78AB2D>I<017CEE038048B4020EEB0FC02603C780013FEB1FE0380703C0000E7F 5E001C037E130F01071607123804FE130300785DEA700F4A1501011F130100F001804914 C012E0EA003FDA000314034C14805B137E0307140701FE1700495CA2030F5C0001170E49 5CA260A24848495A60A2601201033F5C7F4B6C485A000002F713036D9039E7E007809026 7E01C349C7FC903A1F0781F81E903A0FFF007FF8D901FCEB0FE03B2D78AB41>I<02F813 3FD907FEEBFFE0903A0F0F83C0F0903A1C07C780F890393803CF03017013EE01E0EBFC07 120101C013F8000316F00180EC01C000074AC7FC13001407485C120EC7FC140F5DA3141F 5DA3143F92C8FCA34AEB03C01780147EA202FEEB0700121E003F5D267F81FC130E6E5BD8 FF83143CD903BE5B26FE079E5B3A7C0F1F01E03A3C1E0F83C0271FF803FFC7FC3907E000 FC2D2D7CAB2D>I<137C48B414072603C780EB1F80380703C0000F7F000E153F001C1600 130712385E0078157EEA700F5C011F14FE00F0495B12E0EA003FEC00015E5B137E150301 FE5C5BA2150700015D5BA2150F00035D5BA2151F5EA2153F12014BC7FC6D5B00005BEB7C 0390383E0F7EEB1FFEEB03F090C712FE5DA214015D121F397F8003F0A24A5A4848485A5D 48131F00F049C8FC0070137E007813F8383801F0381E07C06CB4C9FCEA01FC294078AB2F >I<027C130749B4130F49EB800E010F141E49EBC03CEDE03890393F03F07890397C00FD F00178EB3FE00170EB03C001F0148049130790C7EA0F00151E5D5D5D4A5A4A5A4A5A4AC7 FC141E5C5C5C495A495A495A49C8FC011E14F04914E05B491301485A4848EB03C0D807B0 130701FEEB0F80390FCF801F3A1F07E07F00393E03FFFED83C015B486C5B00705C00F0EB 7FC048011FC7FC282D7BAB28>I<000FEB0780393F801FC0397FC03FE000FF137FA40180 13C0397F003F80003CEB1E001B0A66C232>127 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fg cmr9 9 10 /Fg 10 58 df48 D<13075B5B137FEA07FFB5FC13BFEAF83F1200B3B3A2497E007FB51280A319327AB126> IIII<000C14C0380FC00F90B5128015005C5C14F014C0D80C18C7FC90C8FCA9 EB0FC0EB7FF8EBF07C380FC03F9038001F80EC0FC0120E000CEB07E0A2C713F01403A215 F8A41218127E12FEA315F0140712F8006014E01270EC0FC06C131F003C14806CEB7F0038 0F80FE3807FFF8000113E038003F801D347CB126>I<14FE903807FF80011F13E090383F 00F0017C13703901F801F8EBF003EA03E01207EA0FC0EC01F04848C7FCA248C8FCA35A12 7EEB07F0EB1FFC38FE381F9038700F809038E007C039FFC003E0018013F0EC01F8130015 FC1400A24814FEA5127EA4127F6C14FCA26C1301018013F8000F14F0EBC0030007EB07E0 3903E00FC03901F81F806CB51200EB3FFCEB0FE01F347DB126>I<1230123C003FB6FCA3 4814FEA215FC0070C7123800601430157015E04814C01401EC0380C7EA07001406140E5C 141814385CA25CA2495A1303A3495AA2130FA3131F91C7FCA25BA55BA9131C20347CB126 >III E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fh cmti10 10 56 /Fh 56 128 df<04FFEB03F003039038E00FFC923A0FC0F01F1E923A3F00783E0F923A7E 01F87C3FDB7C03EBFC7F03FC14F8DA01F813F905F1137EDC01E1133C913B03F00003F000 A314074B130760A3140F4B130F60A3010FB812C0A3903C001F80001F8000A3023F143F92 C790C7FCA44A5C027E147EA402FE14FE4A5CA413014A13015FA313034A13035FA313074A 495AA44948495AA44948495AA3001CD9038090C8FC007E90380FC03F013E143E00FE011F 5B133C017C5C3AF8780F01E0D878F0EB07C0273FE003FFC9FC390F8000FC404C82BA33> 11 DI< 130FEB1F80133F137FEBFF00485A5BEA03F0485A485A485A003EC7FC5A5A12E05A111064 B92A>19 D<150C151C153815F0EC01E0EC03C0EC0780EC0F00141E5C147C5C5C495A1303 495A5C130F49C7FCA2133EA25BA25BA2485AA212035B12075BA2120F5BA2121FA290C8FC A25AA2123EA2127EA2127CA412FC5AAD1278A57EA3121C121EA2120E7EA26C7E6C7EA212 001E5274BD22>40 D<140C140E80EC0380A2EC01C015E0A2140015F0A21578A4157C153C AB157CA715FCA215F8A21401A215F0A21403A215E0A21407A215C0140F1580A2141F1500 A2143EA25CA25CA2495AA2495A5C1307495A91C7FC5B133E133C5B5B485A12035B48C8FC 120E5A12785A12C01E527FBD22>I44 D<387FFFF8A2B5FCA214F0150579941E>I<120EEA3F80127F12FFA31300127E123C0909 778819>I<15181538157815F0140114031407EC0FE0141F147FEB03FF90383FEFC0148F EB1C1F13001580A2143FA21500A25CA2147EA214FEA25CA21301A25CA21303A25CA21307 A25CA2130FA25CA2131FA25CA2133FA291C7FC497EB61280A31D3877B72A>49 D56 DI<133C 137E13FF5AA313FE13FCEA00701300B2120EEA3F80127F12FFA31300127E123C102477A3 19>I65 D67 D<0103B612FEEFFFC018F0903B00 07F8000FF84BEB03FCEF00FE020F157FF03F804B141F19C0021F150F19E05D1807143F19 F05DA2147FA292C8FCA25C180F5CA2130119E04A151FA2130319C04A153FA20107178018 7F4A1600A2010F16FEA24A4A5A60011F15034D5A4A5D4D5A013F4B5A173F4A4AC7FC17FC 017FEC03F84C5A91C7EA1FC04949B45A007F90B548C8FCB712F016803C397CB83F>I<01 07B8FCA3903A000FF000034BEB007F183E141F181E5DA2143FA25D181C147FA292380003 80A24A130718004A91C7FC5E13015E4A133E167E49B512FEA25EECF8000107147C163C4A 1338A2010F147818E04A13701701011F16C016004A14031880013F150718004A5CA2017F 151E173E91C8123C177C4915FC4C5A4914070001ED7FF0B8FCA25F38397BB838>I<0107 B712FEA3903A000FF000074B1300187C021F153CA25DA2143FA25D1838147FA292C8FCEE 03804A130718004A91C7FCA201015CA24A131E163E010314FE91B5FC5EA2903807F80016 7C4A1378A2130FA24A1370A2011F14F0A24A90C8FCA2133FA25CA2137FA291CAFCA25BA2 5B487EB6FCA337397BB836>I<0103B5D8F80FB512E0A390260007F8C7381FE0004B5DA2 020F153F615DA2021F157F96C7FC5DA2023F5D605DA2027F14016092C7FCA24A1403605C A249B7FC60A202FCC712070103150F605CA20107151F605CA2010F153F605CA2011F157F 95C8FC5CA2013F5D5F5CA2017F14015F91C7FC491403007FD9FE01B512F8B55BA243397C B83E>72 D<0103B512F8A390390007F8005DA2140FA25DA2141FA25DA2143FA25DA2147F A292C7FCA25CA25CA21301A25CA21303A25CA21307A25CA2130FA25CA2131FA25CA2133F A25CA2137FA291C8FC497EB6FCA25C25397CB820>I<0207B512F0A391390007FC006F5A A215075EA3150F5EA3151F5EA3153F5EA3157F93C7FCA35D5DA314015DA314035DA31407 A25DA2140FA2003F5C5A141F485CA24A5A12FC00E049C8FC14FE00705B495A6C485A381E 0FC06CB4C9FCEA01F82C3B78B82C>I<0103B500F890387FFFE0A21AC090260007F8C738 0FFC004B15E061020F4BC7FC183E4B5C18F0021F4A5A4D5A4BEB0F804DC8FC023F143C5F 4B5B4C5A027FEB07C04CC9FCED001E5E4A5BED01FCECFE0315070101497E151FECFC7C4B 7E903903FDE07FDAFFC07F1580ED003F49488014F84A131F83130F160F4A801607011F81 A24A130383133F16014A80A2017F6E7EA291C8FC494A7F007F01FE011F13FCB55CA24339 7CB840>I<0107B512FCA25E9026000FF8C7FC5D5D141FA25DA2143FA25DA2147FA292C8 FCA25CA25CA21301A25CA21303A25CA21307A25CA2130F170C4A141CA2011F153C17384A 1478A2013F157017F04A14E01601017F140317C091C71207160F49EC1F80163F4914FF00 0102071300B8FCA25E2E397BB834>I<902607FFF8923807FFF0614F13E0D9000FEFF000 4F5AA2021F167FF1EFC0141DDA1CFCEC01CF023C16DF9538039F800238ED071FA20278ED 0E3F97C7FC0270151CA202F04B5AF0707E14E0037E14E0010117FE4D485A02C0EC0380A2 0103ED0701610280140EA20107ED1C0305385B14006F137049160705E05B010EEC01C0A2 011E913803800F61011CEC0700A2013C020E131F4C5C1338ED1FB80178163F04F091C8FC 01705CA201F04A5B187E00015DD807F816FEB500C09039007FFFFC151E150E4C397AB84A >I<902603FFF891B512E0A281D90007923807F8006F6E5A61020F5E81DA0E7F5DA2021E 6D1307033F92C7FC141C82DA3C1F5C70130EEC380FA202786D131E0307141C147082DAF0 03143C70133814E0150101016E1378030014705C8201036E13F0604A1480163F010715C1 041F5B91C7FC17E149EC0FE360010E15F31607011E15FF95C8FC011C80A2013C805F1338 160013785F01F8157CEA03FC267FFFE0143CB51538A243397CB83E>II<0107B612F817FF1880 903B000FF0003FE04BEB0FF0EF03F8141FEF01FC5DA2023F15FEA25DA2147FEF03FC92C7 FCA24A15F817074A15F0EF0FE01301EF1FC04AEC3F80EFFE0001034A5AEE0FF091B612C0 4CC7FCD907F8C9FCA25CA2130FA25CA2131FA25CA2133FA25CA2137FA291CAFCA25BA25B 1201B512FCA337397BB838>I<0103B612F017FEEFFF80903B0007F8003FC04BEB0FF017 07020FEC03F8EF01FC5DA2021F15FEA25DA2143FEF03FC5DA2027FEC07F818F092C7120F 18E04AEC1FC0EF3F004A14FEEE01F80101EC0FE091B6128004FCC7FC9138FC003F0103EC 0F80834A6D7E8301071403A25C83010F14075F5CA2011F140FA25CA2133F161F4AECE007 A2017F160F180E91C7FC49020F131C007F01FE153CB5913807F078040313F0CAEAFFE0EF 3F80383B7CB83D>82 D<92383FC00E913901FFF01C020713FC91391FC07E3C91393F001F 7C027CEB0FF84A130749481303495A4948EB01F0A2495AA2011F15E091C7FCA34915C0A3 6E90C7FCA2806D7E14FCECFF806D13F015FE6D6D7E6D14E0010080023F7F14079138007F FC150F15031501A21500A2167C120EA3001E15FC5EA3003E4A5AA24B5AA2007F4A5A4B5A 6D49C7FC6D133ED8F9F013FC39F8FC03F839F07FFFE0D8E01F138026C003FCC8FC2F3D7A BA2F>I<0007B812E0A25AD9F800EB001F01C049EB07C0485AD900011403121E001C5C00 3C17801403123800785C00701607140700F01700485CA2140FC792C7FC5DA2141FA25DA2 143FA25DA2147FA292C9FCA25CA25CA21301A25CA21303A25CA21307A25CA2130FA25CEB 3FF0007FB512F8B6FCA2333971B83B>I86 D<14F8EB07FE90381F871C90383E03FE137CEBF801120148486C5A485A120FEBC001001F 5CA2EA3F801403007F5C1300A21407485C5AA2140F5D48ECC1C0A2141F15831680143F15 87007C017F1300ECFF076C485B9038038F8E391F0F079E3907FE03FC3901F000F0222677 A42A>97 D<133FEA1FFFA3C67E137EA313FE5BA312015BA312035BA31207EBE0F8EBE7FE 9038EF0F80390FFC07C013F89038F003E013E0D81FC013F0A21380A2123F1300A214075A 127EA2140F12FE4814E0A2141F15C05AEC3F80A215005C147E5C387801F8007C5B383C03 E0383E07C0381E1F80D80FFEC7FCEA01F01C3B77B926>I<147F903803FFC090380FC1E0 90381F0070017E13784913383901F801F83803F003120713E0120FD81FC013F091C7FC48 5AA2127F90C8FCA35A5AA45AA3153015381578007C14F0007EEB01E0003EEB03C0EC0F80 6CEB3E00380F81F83803FFE0C690C7FC1D2677A426>II<147F903803FFC090380F C1E090383F00F0017E13785B485A485A485A120F4913F8001F14F0383F8001EC07E0EC1F 80397F81FF00EBFFF891C7FC90C8FC5A5AA55AA21530007C14381578007E14F0003EEB01 E0EC03C06CEB0F806CEB3E00380781F83803FFE0C690C7FC1D2677A426>IIIII<150E153F157FA3157E151C1500ABEC1F80EC7FC0ECF1F0EB01 C090380380F813071401130F130E131EEB1C03133C013813F0A2EB0007A215E0A2140FA2 15C0A2141FA21580A2143FA21500A25CA2147EA214FEA25CA21301A25CA213035C121C38 7E07E0A238FE0FC05C49C7FCEAF83EEA787CEA3FF0EA0FC0204883B619>IIIII<147F903803FFC090380FC1F090 381F00F8017E137C5B4848137E4848133E0007143F5B120F485AA2485A157F127F90C7FC A215FF5A4814FEA2140115FC5AEC03F8A2EC07F015E0140F007C14C0007EEB1F80003EEB 3F00147E6C13F8380F83F03803FFC0C648C7FC202677A42A>I<9039078007C090391FE0 3FF090393CF0787C903938F8E03E9038787FC00170497EECFF00D9F0FE148013E05CEA01 E113C15CA2D80003143FA25CA20107147FA24A1400A2010F5C5E5C4B5A131F5EEC80035E 013F495A6E485A5E6E48C7FC017F133EEC70FC90387E3FF0EC0F8001FEC9FCA25BA21201 A25BA21203A25B1207B512C0A3293580A42A>II<3903C003F0390FF01FFC391E783C0F381C7C703A3C3EE03F8038383FC0EB7F8000 78150000701300151CD8F07E90C7FCEAE0FE5BA2120012015BA312035BA312075BA3120F 5BA3121F5BA3123F90C9FC120E212679A423>I<14FE903807FF8090380F83C090383E00 E04913F00178137001F813F00001130313F0A215E00003EB01C06DC7FC7FEBFFC06C13F8 14FE6C7F6D13807F010F13C01300143F141F140F123E127E00FE1480A348EB1F0012E06C 133E00705B6C5B381E03E06CB45AD801FEC7FC1C267AA422>II<13F8D803FEEB01C0D8078FEB03E0390E0F800712 1E121C0038140F131F007815C01270013F131F00F0130000E015805BD8007E133FA201FE 14005B5D120149137EA215FE120349EBFC0EA20201131E161C15F813E0163CD9F0031338 14070001ECF07091381EF8F03A00F83C78E090393FF03FC090390FC00F00272679A42D> I<01F0130ED803FC133FD8071EEB7F80EA0E1F121C123C0038143F49131F0070140FA25B D8F07E140000E08013FEC6485B150E12015B151E0003141C5BA2153C000714385B5DA35D A24A5A140300035C6D48C7FC0001130E3800F83CEB7FF8EB0FC0212679A426>I<01F015 07D803FC903903801F80D8071E903907C03FC0D80E1F130F121C123C0038021F131F49EC 800F00701607A249133FD8F07E168000E0ED000313FEC64849130718000001147E5B03FE 5B0003160E495BA2171E00070101141C01E05B173C1738A217781770020314F05F000301 0713016D486C485A000190391E7C07802800FC3C3E0FC7FC90393FF81FFE90390FE003F0 322679A437>I<903907E007C090391FF81FF89039787C383C9038F03E703A01E01EE0FE 3803C01F018013C0D8070014FC481480000E1570023F1300001E91C7FC121CA2C75AA214 7EA214FEA25CA21301A24A1370A2010314F016E0001C5B007E1401010714C000FEEC0380 010F1307010EEB0F0039781CF81E9038387C3C393FF03FF03907C00FC027267CA427>I< 13F0D803FCEB01C0D8071EEB03E0D80E1F1307121C123C0038140F4914C01270A249131F D8F07E148012E013FEC648133F160012015B5D0003147E5BA215FE00075C5BA214015DA3 14035D14070003130FEBF01F3901F87FE038007FF7EB1FC7EB000F5DA2141F003F5C4813 3F92C7FC147E147C007E13FC387001F8EB03E06C485A383C1F80D80FFEC8FCEA03F02336 79A428>I<001E1338007F13FEEAFF811383A3EB03FC00FE13F8383800F017096AB72A> 127 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fi cmr8 8 18 /Fi 18 127 df<1406140FA34A7EA34A7EA3EC6FE01467A2ECC7F014C3A290380183F814 8101037F1400A2497F0106137EA249137F81A24980151FA24980150FA249801507A24980 1503000181491301A2000381A2487ED81FE0497ED8FFF890383FFFF0A22C2F7EAE31>3 D<913901C001C0A30203130303805BA302071307030090C7FCA34A5B020E130EA3021E13 1E021C131CA3023C133CB912C0A3C726700070C7FC02F013F04A5BA40101130102C05BA4 0103130302805BB912C0A327000F000FC8FC010E130EA3011E131E011C131CA3013C133C 01381338A30178137801701370A301F013F0495BA3323B7CAD3B>35 D<13031307130E131C1338137013F0EA01E013C01203EA0780A2EA0F00A2121EA35AA45A A512F8A25AAB7EA21278A57EA47EA37EA2EA0780A2EA03C0120113E0EA00F01370133813 1C130E1307130310437AB11B>40 D<12C07E12707E7E7E120FEA0780120313C0EA01E0A2 EA00F0A21378A3133CA4131EA5131FA2130FAB131FA2131EA5133CA41378A313F0A2EA01 E0A2EA03C013801207EA0F00120E5A5A5A5A5A10437CB11B>I43 D48 D<130C133C137CEA03FC12FFEAFC7C1200B3B113FE387FFFFEA2172C7AAB23>III<123C127E12FFA4127E123C1200AD123C127E12FE12 FFA3127F123F1203A312071206A2120E120C121C1218123812701260082A7A9C14>59 D61 D99 D108 D111 D<3807C0FE39FFC7FF809038CF03E0390FDC01 F03907F800FC49137E49133E49133FED1F80A3ED0FC0A8151F1680A2ED3F00A26D137E6D 137C5D9038FC01F09038CE07E09038C7FF80D9C1FCC7FC01C0C8FCA9487EEAFFFEA2222B 7E9D27>I<3801FE183807FFB8381E01F8EA3C00481378481338A21418A27E7EB41300EA 7FF06CB4FC6C13C06C13F0000113F838001FFC130138C0007E143EA26C131EA27EA26C13 3CA26C137838FF01F038E3FFC000C0130017207E9E1C>115 D117 D<38078008380FE01C381FF838383FFFF038707FE038E01FC03840 078016077AAC23>126 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fj msbm10 12 6 /Fj 6 91 df<007FB91280BA12C0A27E2800F803E00113C3913A07C0001FE30178ED07F3 4BEB01FBEF00FF187F183F181F180FA29338018007EE03C01803A4F00180040790C7FCA3 160FA2161F163F167FED81FFED8FFBEDFFF316C316E316F3ED87FF1580163F161F160FA2 1607A31603A21918193CA27048137C93C8FC19FC19F81801A218031807180FF03FF0187F EF01FC6FEB07F801F8ED1FF1913A03E001FFC1007FB912E0BAFCA26C18C03E447FC330> 69 D<007FB54AB512C0B66C4914E0816C6E6D14C02707F003F09039000FF8002601F801 ED03F000006D7E017C6D6E5A017E137E017F133E8102807FECC00F6E6C7E017B80903979 F003F0ECF801903978FC00F8027C7F6E137E023F133E6E6C7E020F1480913907C00FC0ED E007913903F003E0020114F0913900F801F8EDFC00037E137C033E137E6F133EEE801FDB 0FC013810307EB0FC1923803E0079338F003E1DB01F813F1923900FC01F9EE7C0070137D 043F137F93381F803F040F131F933807C00F17E0933803F00704011303933800F80117FC 177E173E171F1881EF0FC11707EF03E118F1EF01F91700187D01FC167F183FD803FF161F 007F01F8150FB57E18076C491503CB1201725A43467DC339>78 D<007FB612FEB812F017 FE6C707E2801F00FE03F7F92398007DFF000000200EBE3F8933803E0FC0401137E183E71 7EA20400EB0F80A21807A6180FA2190004015B60EFE07E04035BEFE1F8933807C7F04CB4 5A043F138092B6C7FC17FC17E004FCC8FC92CAFCB3A9000180A2007FB6FCB77EA26C92C9 FC39447EC33B>80 D<007FB712C0B812FCEFFF806C17E02800F807F00F13F8DBC00113FE 017890398000FCFF94387C3F8094383E0FC0727E94381E03F0EF1F011800717FA21978A5 19F8A24D5B1801EF1E034E5A94383E0FC094387E3F80DDFDFFC7FC933807FFFE92B612F8 18E095C8FC17F0ED87C1EEC0F8923883E0FC177C923881F03EA2923880F81F84EE7C0F71 7E163E93383F03E0041F7FEE0F81EF80F8EE07C0187C933803E07E183E706C7E85706C6C 7E180794387C03E0057E7F94383E01F8716C7E197C01F86D6D6C7EF13F80007FB66C6CB5 12E0B700C015F0836C4B6C14E044447EC33D>82 D<007FB912E0BA12F0A33CF07FE3C03C 7FE026F1FE03EC07F8D8F3F8ED01FCD8F7E0ED007ED8FFC0163F0180161F0100160F4817 07A2481703481701A3481700A400601860C71700B3B3A40207133E020F133F0107B612FE 4981A26D5D3C447DC33F>84 D<0003B812FE4883A301879039000F803ED98FF0011F137E D9BFC0EC007C01FFC7003E5B13FC48484A485A49ECFC034902F85B4B48485A5B49494848 5A0307131F04C090C7FC90C7380F803EA24B485A00064A13FCC8003E5B4B485AA24B485A 0201130703F05B4A48485AA24A4848C8FC5E91380F803E021F5B1500023E5B1501027C5B 9138FC03E014F84948485AA24948485A0107011F156002C090C812F090380F803EA24948 4814014913FC013E5B494848EC03E0A249484814070001130701F049140F48484848141F A2484848C8EA3FC0000F49157FD9803E15FF484848EC01FBEF07F3003E49EC0FE7D87E01 ED7F87007C49903903FF0780BAFCA36C18003C447DC345>90 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fk cmmi6 6 15 /Fk 15 123 df11 D<13F8D803FE1318487E48EB803048EBC060EA3C03 397000E0C00060136048EB71801431C7FCEC3300141B141EA2141CA31418A31438A21430 1470A45CA35CA21D217E9520>13 D<000F13FC381F83FF3931C707803861EC0301F813C0 EAC1F0A213E03903C00780A43907800F00A4380F001EA4001E5BA2120CC7FC5CA45CA45C 1A217D9520>17 D<0003B512FC120F5A4814F8397818180000E01338EAC03000001330A2 13701360EBE070A21478EA01C0A21203EB807C0007133C143E380F003C000613181E167D 9424>25 D34 D<127812FCA212FEA2127E1206A3120CA2121C121812301260124007107A8513>59 D<140C141C143C1438A21478147014F014E0130114C0A21303148013071400A25B130E13 1E131CA2133C13381378137013F05BA212015B12035BA2120790C7FC5A120EA2121E121C 123C123812781270A212F05AA216317CA420>61 D<90B57E92C7FCEB07C0A2495AA449C8 FCA4133EA45BA45BED0180A2ED0300485A1506A2150E48485B153C15F800071303B6FC5D 21227CA12A>76 D78 D100 D<1418143C147CA214381400A7EB0780 EB1FE01338EB60F013C0A2EA0180A2380001E0A4EB03C0A4EB0780A4EB0F00A4131EA212 38EA783CEAF8381378EA70F0EA7FC0001FC7FC162D81A119>106 D<13F8EA0FF0A21200A2485AA4485AA43807801E147FEB81C3EB8387380F060F495A1318 EB700E4848C7FCA213FCEA1E7EEA3C0F80EB0781158039780F0300A21402EB070600F013 8CEB03F8386000F019247CA221>II<000F13 FC381FC3FF3931C707803861EC0301F813C0EAC1F0A213E03903C00780A3EC0F00EA0780 A2EC1E041506D80F00130C143C15181538001EEB1C70EC1FE0000CEB07801F177D9526> 110 D122 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fl msbm8 8 4 /Fl 4 91 df78 D82 D84 D<001FB612FCA23A183E00701801F0EB6038D81BC0EBE030001FC7EAC070003E010113E0 003C90380380C01501003801071380EC0603003090380E0700EC1C06EC180EC7EA380CEC 301CEC7038ECE030ECC07001015B4A5AEB03819038070180EB0603D90E07C7FCEB0C06EB 1C0EEB380CEB301CD970381303EBE030EBC070000101601307EB80E0260381C013062607 0180130ED80603141E000E90C7FCD80C07143ED81C0E1476D8380C14E6D8301CEB01CED8 7018EB078CD86038EB3E0CB712FCA2282E7EAD38>90 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fm cmsy8 8 15 /Fm 15 111 df0 D<123C127E12FFA4127E123C08087A9414>I< 130C131EA50060EB01800078130739FC0C0FC0007FEB3F80393F8C7F003807CCF83801FF E038007F80011EC7FCEB7F803801FFE03807CCF8383F8C7F397F0C3F8000FCEB0FC03978 1E078000601301000090C7FCA5130C1A1D7C9E23>3 D20 D<12E012F812FEEA3F80EA0F E0EA03F8EA00FEEB3F80EB0FE0EB03F8EB00FC143FEC0FC0EC07F0EC01FCEC007FED1FC0 ED07F0ED01FCED007FEE1FC01607161FEE7F00ED01FCED07F0ED1FC0037FC7FCEC01FCEC 07F0EC0FC0023FC8FC14FCEB03F8EB0FE0EB3F8001FEC9FCEA03F8EA0FE0EA3F80007ECA FC12F812E0CBFCAD007FB71280B812C0A22A3B7AAB37>I<170EA3170F83841703841701 84717E1878187C84180FF007C0BA12F819FC19F8CBEA07C0F00F00183E601878604D5A60 170360170795C7FC5F170EA33E237CA147>33 D<137813FE1201A3120313FCA3EA07F8A3 13F0A2EA0FE0A313C0121F1380A3EA3F00A3123E127E127CA35AA35A0F227EA413>48 DI<91B512C01307131FD97F80C7FC01FCC8FCEA01F0EA03 C0485A48C9FC120E121E5A123812781270A212F05AA3B712C0A300E0C9FCA37E1270A212 781238123C7E120E120F6C7E6C7EEA01F0EA00FCEB7F80011FB512C013071300222B7AA5 2F>I<4A7E1403B3B3A6007FB712FEB8FC7E2F2E7CAD38>63 D<141F14FFEB03F0EB0FC0 EB1F8014005B133EB3A2137E137C13FC485A485AEA7FC048C7FCEA7FC0EA03F06C7E6C7E 137C137E133EB3A2133F7F1480EB0FC0EB03F0EB00FF141F18437BB123>102 D<12FCB47EEA0FE0EA01F0EA00FC137C137E133EB3A37F1480130FEB07E0EB01FEEB007F EB01FEEB07E0EB0F80131F1400133EB3A3137E137C13FCEA01F0EA0FE0EAFF8000FCC7FC 18437BB123>I<12E0B3B3B3AD034378B114>106 D<0060136000E01370B3B3B3AB006013 60144379B123>I<12E0A27E1270A212781238A2123C121CA2121E120EA2120F7E7F1203 A27F1201A27F1200A27F137013781338A2133C131CA2131E130EA2130F7FA28013038013 01A2801300A2801470A214781438143C141CA2141E140EA2140F80A215801403A215C014 0114001A437CB123>110 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fn cmex10 12 42 /Fn 42 114 df0 D<12E07E12787E7E7E7F6C7E6C7E7F12016C7E7F137C137E7FA26D7EA26D7EA26D7EA36D 7EA2801301A2801300A280A2147EA2147FA4801580A7EC1FC0B3A5EC3F80A715005CA414 7EA214FEA25CA213015CA213035CA2495AA3495AA2495AA249C7FCA2137E137C13FC5B48 5A12035B485A485A90C8FC121E5A5A5A5A1A777C832E>II I8 D<12F012FEEAFFC0EA3FF0EA07FCEA01FE6C6C7EEB3FC06D7E130F801307801303B3B080 1301A26D7E806E7E6E7E6E7EEC07F8EC01FC9138007F80ED1FE01503151FED7F80913801 FC00EC07F8EC1FE04A5A4A5A4AC7FC5C495AA213035CB3B013075C130F5C131F495AEBFF 804848C8FCEA07FCEA3FF0EAFFC048C9FC12F0237775833A>I<12F0B3B3B3AA04407281 21>12 D<00F0EB03C0B3B3B3AA1A40728137>I<16F01501ED03E0ED07C0ED0F80ED1F00 5D157E5D5D14014A5A4A5A4A5AA24A5A143F92C7FC147EA25C13015C13035C13075C130F 5C131FA2495AA349C8FCA213FEA312015BA212035BA21207A25BA2120FA25BA2121FA45B A2123FA55B127FA990C9FC5AB3AA7E7FA9123F7FA5121FA27FA4120FA27FA21207A27FA2 1203A27F1201A27F1200A3137FA26D7EA36D7EA2130F801307801303801301801300147E A28081141F6E7EA26E7E6E7E6E7E140081157E8181ED0F80ED07C0ED03E0ED01F0150024 B26E833B>16 D<12F07E127C7E7E6C7E7F6C7E6C7E12017F6C7E137E7FA26D7E80130F6D 7EA26D7E80130180130080147E147F8081A26E7EA36E7EA26E7EA3811403A2811401A281 A21400A281A281A21680A4153FA216C0A5151F16E0A9150F16F0B3AA16E0151FA916C015 3FA51680A2157FA41600A25DA25DA21401A25DA214035DA214075DA34A5AA24A5AA34A5A A292C7FC5C147E14FE5C13015C13035C495AA2495A131F5C49C8FCA2137E5B485A5B1203 485A485A5B48C9FC123E5A5A5A24B27C833B>I<171E173E177C17F8EE01F0EE03E0EE07 C0160FEE1F80EE3F00167E167C16FC4B5A4B5A15075E4B5A4B5A153F93C7FC5D15FE5D14 015D14034A5AA24A5AA24A5AA24A5AA24AC8FCA214FEA213015C13035C1307A25C130F5C 131FA25C133FA3495AA349C9FCA35A5BA312035BA31207A25BA2120FA35BA3121FA35BA3 123FA55BA2127FAB485AB3B06C7EAB123FA27FA5121FA37FA3120FA37FA31207A27FA212 03A37F1201A37F7EA36D7EA36D7EA3131F80A2130F80130780A21303801301801300A214 7FA26E7EA26E7EA26E7EA26E7EA26E7E140181140081157F8182151F6F7E6F7E8215036F 7E6F7E167C167E82EE1F80EE0FC01607EE03E0EE01F0EE00F8177C173E171E2FEE6B8349 >I<12F07E127C7E7E6C7E6C7E7F6C7E6C7E6C7E137C137E7F6D7E80130F6D7E6D7E8013 01806D7E147E147F80816E7EA26E7EA26E7EA26E7EA26E7EA26E7EA2818182153F82A215 1F82150F82A2150782A36F7EA36F7EA38281A31780167FA317C0A2163FA217E0A3161FA3 17F0A3160FA317F8A51607A217FCABEE03FEB3B0EE07FCAB17F8A2160FA517F0A3161FA3 17E0A3163FA317C0A2167FA21780A316FF1700A35D5EA34B5AA34B5AA35E150FA25E151F 5E153FA25E157F93C7FC5D5DA24A5AA24A5AA24A5AA24A5AA24A5AA24A5A92C8FC5C147E 14FE495A5C13035C495A495A131F5C49C9FC137E137C13FC485A485A485A5B485A48CAFC 123E5A5A5A2FEE7C8349>I[51 298 104 131 79 32 D[<12F87E127E7E7F121F6C 7E6C7E7F6C7E12016C7E7F137F7F806D7E6D7EA26D7E8013036D7EA26D7E808081143F81 141F816E7EA26E7EA26E7EA26E7EA36E7EA26F7EA282153FA282151F82150FA2821507A2 82150382A3150182A28183A3707EA4707EA483161FA483160FA383A31607A383A31603A3 83A582A21880A882A218C0AD177F18E0B3B3A618C017FFAD1880A25EA81800A25EA55FA3 1607A35FA3160FA35FA3161F5FA4163F5FA44C5AA44C5AA394C7FC5DA25E1503A35E1507 5EA2150F5EA2151F5E153F5EA2157F5EA24BC8FCA24A5AA34A5AA24A5AA24A5AA24A5A5D 143F5D147F92C9FC5C5C495AA2495A13075C495AA2495A495A91CAFC5B13FE5B485A1203 485A5B485A485A123F90CBFC127E5A5A>51 298 125 131 79 I[29 298 101 131 58 I[29 298 127 131 58 I[51 298 114 131 80 40 D[<12F812FE6C7E13E07FEA3FF8EA1FFEEA07FF6C7F6C7F6C7FEB 3FF06D7E806D7E6D7E7F6D7F817F81147F81143F81141FA281140FA3811407B3B3B3B3AD 8180A46E7FA36E7FA36F7EA26F7E151F82150F826F7E6F7E816F7F707E707E707E707E70 7E707E933801FF809338007FC0EF3FE0170FA2173FEF7FC0933801FF80933803FE004C5A 4C5A4C5A4C5A4C5A4C5A4B90C7FC5D4B5A4B5A5E151F5E153F4B5AA24B5AA34A5BA34A90 C8FCA45C5DB3B3B3B3AD140F5DA3141F5DA2143F5D147F5D14FF5D5B5D4990C9FC5B495A 495A5C495AEBFFE0485B485B4890CAFCEA1FFEEA3FF8B45A5B138048CBFC12F8>51 298 114 131 80 I<187C18FCEF01F8A2EF03F0EF07E0EF0FC0171F1880EF3F005F177E 17FE4C5A5F16034C5AA24C5A4C5AA24C5A167F94C7FC5E5E15015E15034B5AA24B5AA24B 5AA24B5AA2157F5E15FF93C8FCA24A5AA214035D14075DA2140F5D141FA25D143FA24A5A A34A5AA34990C9FCA35B5CA213075CA3130F5CA2131FA25CA2133FA35C137FA4495AA548 5BA55A91CAFCA55A5BA5120FA35BA4121FA55BA4123FA75BA4127FAF5BA212FFB3A836B3 638257>48 D<12F87E127EA27E6C7E6C7E7F12076C7E7F12017F6C7E137E137F6D7EA26D 7E6D7EA26D7E801303801301801300806E7EA26E7EA26E7EA26E7EA2811407811403A26E 7EA2818082157FA282153F82A2151F82A26F7EA36F7EA36F7EA38281A28381A383167FA2 83A2163FA283A3161F83A4707EA5707EA58382A5188082A518C0A382A418E0A5177FA418 F0A7173FA418F8AF171FA218FCB3A836B37D8257>III<12FEB3B3B3 B3B3B3B3B3B3A9B7FCA720B2608342>I<157FB3B3B3B3B3B3B3B3B3A9B7FCA720B27F83 42>I<12FEB3B3B3A8073E608042>I<12FEB3B3B3A8073E668042>II<12F812FE6C7E7F 13F06C7EEA1FFC6C7E6C7E6C13C06C7F6C7F137F6D7E6D7E6D7E807F6D7F817F817F8114 7F81143F81A2141F81A36E7EA56E1380B3B3B0215A6F7E59>II<913807FF80B3B3B04A1300A54A 5AA35D143FA25D147F5D14FF5D5B5D5B5D4990C7FC5B5C495A495A495A13FF485B485B48 90C8FC485A485AEA7FF8485A13C05B48C9FC12F8215A6F8059>I<913807FF80B3B3B04A 1300A55D141FA35D143F5DA2147F5D14FF5DA2495B5D5B4990C7FC5C130F5C495A495A49 5AA2495A485B4890C8FCEA07FC485A485AEA7FE0EAFF8090C9FC12FCB4FC7FEA7FE0EA1F F06C7E6C7E6CB4FC6C7F6C7F6D7EA26D7E6D7E6D7E801307806D7F7F816D7FA281147F81 143FA281141F81A3140F81A56E1380B3B3B021B56F8059>III64 DII<17FF040313C093380F81F09338 1E0078043E137C93387C01FC9338F803FEA2150116F01503EF01FC9338E0007003071400 A3150FA45E151FA7153FA74B5AA715FFA85C93C8FCA95C5DA85DA74A5AA75DA75D140FA4 5DA3001C5C007F131FEAFF8092C9FC5C143EA26C485A007C5B003C5B381F03E03807FF80 D801FECAFC376F7B7F2F>82 D88 D<1B3FF3FFC0973803E0F0973807C03897380F801C081F137E97383F01FEF303FF1A7E1A FE1AFC1901A2963903F801FEF300781C004F5AA2190FA262191FA34F5AA44F5AA319FF97 C8FCA360A261A21803A3611807A461180FA44E5AA4183FA261A2187FA361A218FFA44D5B A55F96C9FCA35FA360A2170FA460171FA460173FA54D5AA54D5AA45E60A55E60A44C90CA FCA54C5AA55F161FA45F163FA45FA2167FA35FA316FF5FA54B5BA494CBFCA25DA35EA215 07A25EA44B5AA45E151FA45E153FA35EA2157FA25EA315FF93CCFCA34A5AA44A5AA35D14 075DA2140F5D121E397F801FC0EAFFC05D143F92CDFC5C147E6C485AEA7E00383801F86C 485A380F07C03803FF80D800FCCEFC58DD7B7F37>90 D110 D<12F012FE6C7E13E0EA3FF8EA0FFCEA 03FFC67F6D7E6D7E6D7E6D7E6D7E6D7EA26D7E7FA281147FB3B3AF81143FA281141F8114 0F8114076E7E6E7E6E7E6F7E6F7EED1FF0ED07F8ED01FE923800FF80163FA216FF923801 FE00ED07F8ED1FF0ED3FC04B5A4BC7FC4A5A4A5A4A5A140F5D141F5D143F5DA2147F5DB3 B3AF14FF92C8FCA25B495AA2495A495A495A495A495A495A000390C9FCEA0FFCEA3FF8EA FFE0138048CAFC12F029B2748342>I<1DC0F401E0A21C03A21DC01C07A21D801C0FA21D 0064A21C1E1C3EA21C3C1C7CA21C781CF8A2641B01A264A21B03A2641B07A2641B0FA299 C7FC63A21B1E1B3EA21B3C1B7CA21B781BF8A2631A01A263A21A03A2631A07A2631A0FA2 98C8FC62A21A1E1A3EA21A3C1A7CA21A781AF8A2621901A262A21903A2621907A262190F A297C9FC61A2191E0104173E130E011E173C197C133E017F17784917F85A486D5E481701 12064860486C7E003817031270486C6C5E0040170712006D6C5E180FA296CAFC6D6C5DA2 181E6D6C153EA2183C187C6D7E187818F86D7E601701A26D6D5CA217036E7E601707A26E 6C5C170FA26E6C91CBFC5FA26E6C131E173EA2173C6E6C137CA217786E6C13F8A25F1601 EC01FF5FA26E1383A25F1687ED7FC75F16CFED3FEF94CCFC16FFA26F5AA36F5AA36F5AA3 5E1503A25E15015E5BB3758364>113 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fo cmsy10 12 28 /Fo 28 115 df<007FB912E0BA12F0A26C18E03C04789A4D>0 D<121FEA3F80EA7FC0EA FFE0A5EA7FC0EA3F80EA1F000B0B789E1C>I<0060160600F8160F6C161F007E163F6C16 7E6C6C15FC6C6CEC01F86C6CEC03F06C6CEC07E06C6CEC0FC06C6CEC1F80017EEC3F006D 147E6D6C5B6D6C485A6D6C485A6D6C485A6D6C485A6D6C485ADA7E3FC7FCEC3F7E6E5A6E 5A6E5AA24A7E4A7EEC3F7EEC7E3F4A6C7E49486C7E49486C7E49486C7E49486C7E49486C 7E49C7127E017E8049EC1F804848EC0FC04848EC07E04848EC03F04848EC01F84848EC00 FC48C9127E007E163F48161F48160F00601606303072B04D>I<49B4FC010F13E0013F13 F8497F48B6FC4815804815C04815E04815F0A24815F8A24815FCA3B712FEA96C15FCA36C 15F8A26C15F0A26C15E06C15C06C15806C15006C6C13FC6D5B010F13E0010190C7FC2727 7BAB32>15 D<19E0F003F0180FF03FE0F0FF80943803FE00EF0FF8EF3FE0EFFF80DC03FE C7FCEE0FF8EE3FE0EEFF80DB03FEC8FCED1FF8ED7FE0913801FF80DA07FEC9FCEC1FF0EC 7FC04948CAFCEB07FCEB1FF0EB7FC04848CBFCEA07FCEA1FF0EA7FC048CCFCA2EA7FC0EA 1FF0EA07FCEA01FF38007FC0EB1FF0EB07FCEB01FF9038007FC0EC1FF0EC07FC913801FF 809138007FE0ED1FF8ED07FE923800FF80EE3FE0EE0FF8EE03FE933800FF80EF3FE0EF0F F8EF03FE943800FF80F03FE0F00FF01803F000E01900B0007FB912E0BA12F0A26C18E03C 4E78BE4D>20 D<127012FCB4FCEA7FC0EA1FF0EA07FCEA01FF38007FC0EB1FF0EB07FCEB 01FF9038007FC0EC1FF0EC07FC913801FF809138007FE0ED1FF8ED07FE923800FF80EE3F E0EE0FF8EE03FE933800FF80EF3FE0EF0FF8EF03FE943800FF80F03FE0F00FF0A2F03FE0 F0FF80943803FE00EF0FF8EF3FE0EFFF80DC03FEC7FCEE0FF8EE3FE0EEFF80DB03FEC8FC ED1FF8ED7FE0913801FF80DA07FEC9FCEC1FF0EC7FC04948CAFCEB07FCEB1FF0EB7FC048 48CBFCEA07FCEA1FF0EA7FC048CCFC12FC1270CDFCB0007FB912E0BA12F0A26C18E03C4E 78BE4D>I<037FB612E00207B712F0143F91B812E0010301C0C9FCD907FCCAFCEB0FE0EB 3F8049CBFC13FC485A485A485A5B485A121F90CCFC123EA2123C127CA2127812F8A25AA8 7EA21278127CA2123C123EA27E7F120F6C7E7F6C7E6C7E6C7E137E6D7EEB1FE0EB07FC6D B47E010090B712E0023F16F01407020016E03C3A78B54D>26 D<1AF0A3861A78A21A7C1A 3CA21A3E1A1E1A1F747EA2747E747E87747E747E1B7E87757EF30FE0F303F8007FBC12FE BE1280A26CF3FE00CEEA03F8F30FE0F31F8051C7FC1B7E63505A505A63505A505AA250C8 FC1A1E1A3E1A3CA21A7C1A78A21AF862A359347BB264>33 D<49B4EF3FC0010F01E09238 03FFF8013F01FC030F13FE4901FF92383FE01F48B66C91397E0007C02603F80301E0D901 F8EB01E02807E0007FF049486D7E01806D6CD907C0147048C76C6C494880001EDA07FE49 C87E001C6E6C013E150C486E6D48150E71481506486E01E0160793387FF1F0006092263F F3E08193381FFBC000E004FF1780486F4915017090C9FC82707F8482717E844D7E6C4B6D 1503006004EF1700933803E7FE0070922607C7FF5DDC0F837F003004816D140E00384BC6 FC0018033E6D6C5C001C4B6D6C143C6C4BD91FFC5C6C4A486D6C5C6DD907E06D6C13036C 6C49486D9038E00FE0D801F0013FC890B55A27007C03FE6F91C7FC90263FFFF8031F5B01 0F01E0030313F8D901FECAEA7FC0592D7BAB64>49 D<92B6FC02071580143F91B7120001 030180C8FCD907FCC9FCEB1FE0EB3F80017ECAFC5B485A485A485A5B485A121F90CBFC12 3EA2123C127CA2127812F8A25AA2B9FC1880A2180000F0CBFCA27EA21278127CA2123C12 3EA27E7F120F6C7E7F6C7E6C7E6C7E137E6D7EEB1FE0EB07FC6DB47E010090B6FC023F15 80140702001500313A78B542>I<1706170F171FA2173EA2177CA217F8A2EE01F0A2EE03 E0A2EE07C0A2EE0F80A2EE1F00A2163EA25EA25EA24B5AA24B5AA24B5AA24B5AA24BC7FC A2153EA25DA25DA24A5AA24A5AA24A5AA24A5AA24AC8FCA2143EA25CA25CA2495AA2495A A2495AA2495AA249C9FCA2133EA25BA25BA2485AA2485AA2485AA2485AA248CAFCA2123E A25AA25AA25A1260305C72C600>54 D<126012F0B012FC12FEA212FC12F0B0126007267B AB00>I<0060171800F0173C6C177CA200781778007C17F8A2003C17F0003E1601A26CEE 03E0A26C17C06D1507A2000717806D150FA26C6CED1F00A20001161E6D153EA20000163C 90B712FCA26D5DA2013CC85A013E1401A2011E5D011F1403A26D5D6E1307A26D6C495AA2 010392C7FC6E5BA20101141E6E133EA26D6C5BA202781378027C13F8A2023C5BEC3E01A2 6E485AA2020F5B1587A202075B15CFA26EB4C8FCA26E5AA36E5AA315781530364780C437 >I<007FB712E0B812F0A27ECAFCB3AA001FB7FC127FA3CAFCB3AB007FB7FCB8FCA26C16 E02C457BC437>I<4B7E4B7EA21507A25EECFF8F010313EF90260F80FFC7FC90383E003F 497F49804848804848497E5B0007EC3DF049133C000FEC7CF8A248C7EA787C15F848157E 15F0A2140148157F007E4A7E1403A215C0A200FE01071480A21580140FA21500A25CA214 1E143EA2143CA2147CA21478A214F8A25C1301A2007E491400A21303A2007F495B130700 3F157E5CA2130F001F157C018FC712FCD80F9F5CA201DE130100075DD803FE495AA26C48 495A00004A5A017C49C7FC017E133E90387F80F89038FBFFE001F8138049C9FC1201A25B A26C5A29557CCC32>59 D78 D86 D<0060170C00F0171EB3B3A66C173EA20078173C007C177C007E17FC 003E17F86CEE01F06D15036C6CED07E06C6CED0FC0D803F8ED3F80D801FEEDFF0026007F C0EB07FCD93FFCEB7FF8010FB612E001031580D9007F01FCC7FC020713C0373D7BBA42> 91 D<913807FFC0027F13FC0103B67E010F15E0903A3FFC007FF8D97FC0EB07FCD801FE C8B4FCD803F8ED3F80D807E0ED0FC04848ED07E04848ED03F090C91201003EEE00F8007E 17FC007C177C0078173C00F8173EA248171EB3B3A60060170C373D7BBA42>I102 D<12FEEAFFE0EA07F8EA00FEEB7F806D7E6D7E130F6D7EA26D7EB3AD6D7EA26D7E806E7E 6E7EEC0FE0EC03FC913800FFE0A2913803FC00EC0FE0EC3FC04A5A4AC7FC5C495AA2495A B3AD495AA2495A131F495A495A01FEC8FCEA07F8EAFFE048C9FC236479CA32>I<140C14 1E143EA2143C147CA214F8A214F01301A2EB03E0A214C01307A2EB0F80A214005BA2133E A2133C137CA2137813F8A2485AA25B1203A2485AA25B120FA248C7FCA2121E123EA25AA2 127812F8A41278127CA27EA2121E121FA26C7EA212077FA26C7EA212017FA26C7EA21378 137CA2133C133EA27FA27F1480A2EB07C0A2130314E0A2EB01F0A2130014F8A2147CA214 3C143EA2141E140C176476CA27>I<126012F07EA21278127CA27EA2121E121FA26C7EA2 12077FA26C7EA212017FA26C7EA21378137CA2133C133EA27FA27F1480A2EB07C0A21303 14E0A2EB01F0A2130014F8A2147CA2143C143EA4143C147CA214F8A214F01301A2EB03E0 A214C01307A2EB0F80A214005BA2133EA2133C137CA2137813F8A2485AA25B1203A2485A A25B120FA248C7FCA2121E123EA25AA2127812F8A25A126017647BCA27>I<126012F0B3 B3B3B3B3A81260046474CA1C>I<0070130700F01480B3B3B3B3B3A800701400196474CA 32>I<126012F07EA21278127CA2123C123EA2121E121FA26C7EA212077FA212037FA212 017FA26C7EA21378137CA2133C133EA2131E131FA26D7EA2130780A2130380A2130180A2 6D7EA21478147CA2143C143EA280A28081A2140781A2140381A26E7EA2140081A2157815 7CA2153C153EA281A2811680A2150716C0A2150316E0A2ED01F0A2150016F8A21678167C A2163C163EA2161E160C27647BCA32>110 D<1B0C1B1E1B3EA21B7CA21BF8A2F201F0A2 F203E0A2F207C0A2F20F80A2F21F00A21A3EA262A262A24F5AA2621903A24F5AA24F5AA2 4FC7FCA2193EA261A261A24E5AA24E5AA24E5AA24E5AA2010C4CC8FC133C017C163EEA01 FE00035F487E001E5F00387FD8707F4B5A00E07FD8003F4B5A80011F4B5AA26E4A5A130F 6E4AC9FC13076E143E13036E5C13016E5C7F6F5B027F1301A26F485A143F6F485A141F6F 485A140F6F48CAFC1407EDFC3E14035E15FE02015B15FF6E5BA26F5AA26F5AA26F5AA26F CBFC150E4F647A8353>112 D114 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fp cmmi8 8 42 /Fp 42 123 df12 D<131FD9FFC013304801F01370 00076D13604815E0D9807C13C0391E003C0148011E13800038EB0E03480107130000605C EC030612E0C7138EEC018C159C159815B815B0A215F05DA35DA25DA21403A44AC7FCA414 0EA45CA31418242C7F9D24>I15 D<3907C007E0390FE03FF8391CF8783E393879E01E39307B801F3870 7F00126013FEEAE0FC12C05B0081143F120149133EA20003147EA249137CA2000714FCA2 4913F8A2000F1301A2018013F0A2001F1303A2010013E0120EC71207A215C0A2140FA215 80A2141FA21500A2140E202C7E9D23>17 D<147C49B4FC903803C78090380783C090381F 03E0EB1E01133E017C13F013F8A2EA01F0120313E01207A2EA0FC01403A2EA1F80A21407 003F14E0130090B5FCA2397F000FC0127EA2141F1580127C00FC14005CA2147EA248137C 14FC00785B495AA2387C03E0383C07C0495A001C90C7FCEA1E3EEA0FF8EA03E01C307DAE 21>I<13E0486C133C15FF00031303EC0F7F9038E01C7EEC381C000749C7FC5CEBC3C001 C7C8FCEA0FDE13F8EBFF8014F8381F83FEEB803F496C7E140F48154016C0123EA2007E14 811680007C1403ED830000FC1487EC078E48EB03FC0070EB00F0221F7D9D29>20 D<13FC13FFEB1FC0130F6D7EA36D7EA2130180A26D7EA3147EA280A36E7EA2140F81A24A 7E143F147FECF3F0EB01E3EB03C190380781F8130F49C67E133E5B49137E485A48487F12 07485A4848EB1F8048C7FC127E48EC0FC048EC07E000701403232F7DAD29>I23 D<14C0A5ECFFE04913F8130790381F9FE0017FC7FC13FE5B485A 12035B1207A25BA312037FA23801FBFE38007FFFA2EBF7FED803C0C7FC485A48C8FC121E A25A127C1278A212F85A7EA37EB4FCEA7FC0EA3FF8EA1FFE380FFFC0000313F038007FFC EB1FFEEB03FF1300141F80A3EB701EEB3C1CEB1FF8EB03E01D3C7EAD1F>I<90B612F812 035A4815F03A1E0380C000003C130000701301130700E05CEAC00638000E03A3131CA213 3C140713381378A201F07FA21201A2D803E07FA20007130313C0A26C486C5A251E7E9C29 >II<90B6128012035A481500261E00E0C7FC5A00705B130112E012C0EA0003A2 5CA21307A349C8FCA35BA2131E133EA45BA21338211E7E9C1F>28 D<160ED80380143FA20007168090C8FC000E151F001E150F001C16000018811238003013 0C141E007015061260143E023C130E00E0150C5A0238131C6C15184A1338147802F85BD8 F00114F0496C485A397C0FBE073A7FFF9FFFC0021F5B263FFC0F90C7FC391FF807FC3907 E001F0291F7F9D2C>33 DI<123C127EB4FCA2 1380A2127F123D1201A312031300A25A1206120E5A5A5A126009157A8714>59 DI<15C0140114031580A21407 1500A25C140EA2141E141CA2143C143814781470A214F05CA213015CA213035C130791C7 FCA25B130EA2131E131CA2133C1338A21378137013F05BA212015BA212035BA2120790C8 FC5A120EA2121E121CA2123C1238A212781270A212F05AA21A437CB123>I<12E012F812 FEEA3F80EA0FE0EA03F8EA00FEEB3F80EB0FE0EB03F8EB00FC143FEC0FC0EC07F0EC01FC EC007FED1FC0ED07F0ED01FCED007FEE1FC01607161FEE7F00ED01FCED07F0ED1FC0037F C7FCEC01FCEC07F0EC0FC0023FC8FC14FCEB03F8EB0FE0EB3F8001FEC9FCEA03F8EA0FE0 EA3F8000FECAFC12F812E02A2B7AA537>I<013FB6FC17C0903A00FE0007F0EE01F84AEB 00FC177E1301177F5CA21303177E4A14FEA20107EC01FC17F84AEB03F0EE07E0010FEC1F C0EE7F009138C003FC91B55A4914FE9139C0003F804AEB0FC017E0013F140717F091C7FC 16035BA2017E1407A201FE15E0160F4915C0161F0001ED3F80EE7F004914FEED03F80003 EC0FF0B712C003FCC7FC302D7CAC35>66 D<92387FC003913903FFF80791391FC03E0F91 397E00071FD901F8EB03BF4948EB01FED90FC013004948147E49C8FC017E157C49153C48 5A120348481538485AA2485A173048481500A2127F90CAFCA35A5AA5EE018016031700A2 007E5D1606160E6C5D5E6C6C5C000F5D6C6C495A6C6CEB0780D801F8011EC7FCD8007E13 F890381FFFE0010390C8FC302F7CAD32>I<013FB71280A2D900FEC7127F170F4A1407A2 0101150318005CA21303A25C16300107147094C7FC4A136016E0130F15019138C007C091 B5FC5BECC0074A6C5AA2133FA20200EB000CA249151C92C71218017E1538173001FE1570 5F5B4C5A000115034C5A49140F161F00034AB4C7FCB8FC5E312D7DAC34>69 D<90383FFFFEA2010090C8FC5C5CA21301A25CA21303A25CA21307A25CA2130FA25CA213 1FA25CA2133FA291C7EA0180A24914031700017E5C160601FE140EA2495C163C12015E49 EB01F84B5A0003141FB7FC5E292D7DAC30>76 DII97 D99 D<151FEC03FFA2EC003FA215 3EA2157EA2157CA215FCA215F8A21401EB07E190381FF9F0EB7C1DEBF80FEA01F03903E0 07E0EA07C0120FEA1F8015C0EA3F00140F5A007E1480A2141F12FE481400A2EC3F021506 143E5AEC7E0E007CEBFE0C14FC0101131C393E07BE18391F0E1E38390FFC0FF03903F003 C0202F7DAD24>II< 157C4AB4FC913807C380EC0F87150FEC1F1FA391383E0E0092C7FCA3147E147CA414FC90 383FFFF8A2D900F8C7FCA313015CA413035CA413075CA5130F5CA4131F91C8FCA4133EA3 EA383C12FC5BA25B12F0EAE1E0EA7FC0001FC9FC213D7CAE22>I<131FEA03FFA2EA003F A2133EA2137EA2137CA213FCA25BA21201143F9038F1FFC09038F3C1F03803FF0001FC7F 5BA2485A5BA25B000F13015D1380A2001F13035D1300140748ECC04016C0003E130F1580 007E148191381F0180007C1403ED070000FCEB0F06151E48EB07F80070EB01E0222F7DAD 29>104 D<1307EB0F80EB1FC0A2EB0F80EB070090C7FCA9EA01E0EA07F8EA0E3CEA1C3E 123812301270EA607EEAE07C12C013FC485A120012015B12035BA21207EBC04014C0120F 13801381381F01801303EB0700EA0F06131EEA07F8EA01F0122E7EAC18>I<15E0EC01F0 1403A3EC01C091C7FCA9147CEB03FE9038078F80EB0E07131C013813C01330EB700F0160 138013E013C0EB801F13001500A25CA2143EA2147EA2147CA214FCA25CA21301A25CA213 03A25CA2130700385BEAFC0F5C49C7FCEAF83EEAF0F8EA7FF0EA1F801C3B81AC1D>I<13 1FEA03FFA2EA003FA2133EA2137EA2137CA213FCA25BA2120115F89038F003FCEC0F0E00 03EB1C1EEC387EEBE07014E03807E1C09038E3803849C7FC13CEEA0FDC13F8A2EBFF8038 1F9FE0EB83F0EB01F81300481404150C123EA2007E141C1518007CEBF038ECF83000FC14 70EC78E048EB3FC00070EB0F801F2F7DAD25>I<137CEA0FFCA21200A213F8A21201A213 F0A21203A213E0A21207A213C0A2120FA21380A2121FA21300A25AA2123EA2127EA2127C A2EAFC08131812F8A21338133012F01370EAF860EA78E0EA3FC0EA0F000E2F7DAD15>I< 3907C007E0391FE03FF83918F8783E393879E01E39307B801F38707F00126013FEEAE0FC 12C05B00815C0001143E5BA20003147E157C5B15FC0007ECF8081618EBC00115F0000F15 38913803E0300180147016E0001F010113C015E390C7EAFF00000E143E251F7E9D2B> 110 DI<90387C01F89038 FE07FE3901CF8E0F3A03879C0780D907B813C0000713F000069038E003E0EB0FC0000E13 80120CA2D8081F130712001400A249130F16C0133EA2017EEB1F80A2017C14005D01FC13 3E5D15FC6D485A3901FF03E09038FB87C0D9F1FFC7FCEBF0FC000390C8FCA25BA21207A2 5BA2120FA2EAFFFCA2232B829D24>I<903807E03090381FF87090387C1CF0EBF80D3801 F00F3903E007E0EA07C0000F1303381F800715C0EA3F00A248130F007E1480A300FE131F 481400A35C143E5A147E007C13FE5C1301EA3E07EA1F0E380FFCF8EA03F0C7FC13015CA3 13035CA21307A2EBFFFEA21C2B7D9D20>I<3807C01F390FF07FC0391CF8E0E0383879C1 38307B8738707F07EA607E13FC00E0EB03804848C7FCA2128112015BA21203A25BA21207 A25BA2120FA25BA2121FA290C8FC120E1B1F7E9D20>I<130E131FA25BA2133EA2137EA2 137CA213FCA2B512F8A23801F800A25BA21203A25BA21207A25BA2120FA25BA2001F1310 143013001470146014E0381E01C0EB0380381F0700EA0F0EEA07FCEA01F0152B7EA919> 116 D<013F137C9038FFC1FF3A01C1E383803A0380F703C0390700F60F000E13FE4813FC 12180038EC0700003049C7FCA2EA200100005BA313035CA301075B5D14C000385CD87C0F 130600FC140E011F130C011B131C39F03BE038D8707113F0393FE0FFC0260F803FC7FC22 1F7E9D28>120 D<011E1330EB3F809038FFC07048EBE0E0ECF1C03803C0FF9038803F80 903800070048130EC75A5C5C5C495A495A49C7FC131E13385B491340484813C0485A3807 0001000EEB0380380FE007391FF81F0038387FFF486C5A38601FFC38E00FF038C003C01C 1F7D9D21>122 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fq cmmi12 12 61 /Fq 61 121 df11 DI I<1578913807FFE0021F13FC91383C7FFEEC7007EC6003ECE0004A13381600A280A380A2 80147CA2147E143E143F816E7EA26E7E81140781EC3FFC14FF903803E1FEEB07C190381F 00FF133E49EB7F805B0001143F485A484814C049131F120F485AA248C7FC150F5A127EA3 00FEEC1F805AA316005A5DA2153E157E157CA26C5C127C4A5A6C495AA26C495A6C6C485A 6C6C48C7FC3803E07C3800FFF0EB1FC027487CC62B>II<01F8EB03FCD803FEEB1FFFD8071F9038 7C0FC03B0E0F80E007E0001C9038C3C003271807C70013F002CE1301003801DC14F80030 13D8EB0FF800705B00605BA200E0491303D8C01F15F05C12001607133F91C713E0A2160F 5B017E15C0A2161F13FE491580A2163F1201491500A25E120349147EA216FE1207495CA2 1501120F495CEA0380C81203A25EA21507A25EA2150FA25EA2151FA25EA2153FA293C7FC 150E2D417DAB30>17 D<157E913801FF80913807C3E091381F01F0EC3E004A13F814FC49 48137C495A5C0107147E495A131F5C133F49C7127FA213FEA212015B12034914FF1207A2 5B000F15FE1501A2485AA21503003F15FC5B90B6FCA24815F89038800007A2150F00FF15 F090C7FCA2ED1FE0A25AED3FC0A21680157F16005A15FEA24A5AA25D14035D4A5A007C49 5AA24A5A007E49C7FC003E133E5C001E5B6C485A380783C06CB4C8FCEA00FC28477CC52D >I<130E011FEC03E049EC1FF8167F16E749EB03C792380707F0017E130E92381C03C001 FE0178C7FC15E049485A4A5A000149C8FC141EEBF8385C3803F9E0EBFF8014F8ECFFC039 07F07FF0EC03FC49C6B4FCED3F80000F6E7EA249130FA2001F160717065BA2003F160E17 0C90C71380171C4816181738007E1630923807C07000FE16E0923803E1C048913800FF80 0038ED3E00302D7BAB38>20 DI23 D<1560A7ED7FFF92B512C0913807F80191381FDFFF91397F87FE004AC8FCEB03FC495A13 0F5C495A133F5C137F5C13FFA291C9FCA57F80A2133F6D7E90390FE3FF806DB512E09039 01FC006049B512E0D90F8F1380011EC9FC5B13F8485A5B485A485A48CAFCA2121E123E12 3C127C1278A312F8A47EA27E127F7FEA3FE013F86CB4FC6C13C0000313F86C13FE39007F FFC0010F13F0010313FC9038007FFF021F7F02037F1400151F150F1507A401025C903803 800FD901C090C7FC903800F83EEC3FF8EC07E02A597EC42B>I<010FB712E0013F16F05B 48B812E04817C02807E0060030C7FCEB800EEA0F00001E010C13705A0038011C13605A00 60011813E000E013381240C7FC5C4B5AA214F014E01301150314C01303A3EB078082130F A2EB1F00A34980133E137EA24980A2000114015BA26C48EB00E0342C7EAA37>II<0203B612E0021F15F091B7FC 4916E0010716C090270FF80FF8C7FC90381FC00349486C7E017EC7FC49147E485A484814 3E0007153F5B485AA2485AA2123F90C8FC5E48157E127EA216FE00FE5D5A15015EA24B5A 007C5D15074B5A5E6C4AC8FC153E6C5C5D390F8003F03907C007C02601F03FC9FC38007F FCEB1FE0342C7DAA37>I<010FB612FC013F15FE5B48B712FC4816F82707E001C0C7FC01 805B380F0003121E121C5A4849C8FC126012E000405BC7FC140E141EA45CA3147CA21478 14F8A4495AA31303A25C1307A3130FA25C6D5A2F2C7EAA2A>I<137E48B46C150626078F E0150E260607F0151C260E03F81538000C6D1570D81C0116E000006D15C0010015016EEC 03806EEC0700170E6E6C5B5F5F6E6C136017E04C5A6E6C485A4CC7FC0207130E6F5A5E16 30913803F8705EEDF9C06EB45A93C8FC5D6E5A81A2157E15FF5C5C9138073F80140E141C 9138181FC014381470ECE00FD901C07FEB038049486C7E130E130C011C6D7E5B5B496D7E 485A48488048C8FC000681000E6F137048EE806048033F13E04892381FC0C048ED0FE348 923803FF00CA12FC37407DAB3D>31 D<1730A317701760A317E05FA316015FA3160394C8 FCA35E1606A3160E160C013E1607D9FF80ED1F802603C3C0011CEB3FC0260703E0131826 0601F0157F000E173F001C1538D818030230131F0038170F0030170700701570D8600702 6013035CA2D8E00F02E0148000C049491301EA001F4A150303011500013F5C1400604901 031406017E91C7FC180E180C01FE49141C4901061418183860030E1460030C14E04D5A4D 5A031C49C7FC0318130E017E5D5F6D01385B90261F80305BD90FC0EB03C0D907F0010FC8 FC903901FE707C9039003FFFF002031380DA0060C9FC15E05DA314015DA3140392CAFCA3 5C1406A3140E140C3A597DC43F>I<0110160E0138163F0178EE7F80137001F016FF4848 167F5B0003173F49161F120790CA120FA2000E1707A248180015060018140FA20038021E 14061230A2180E00704A140C1260181CA203381418183800E05C6015F86C01015D170114 030078D907BC495ADA0FBE1307007CD91F3E495A007ED97E3F013FC7FC3B7F83FE1FE0FF 263FFFFCEBFFFE4A6C5B6C01F05C6CD9C0075B6CD9000113C0D801FC6D6CC8FC392D7FAB 3D>II<177F01309138 03FFC00170020F13E0494A13F048484A13F84848EC7F0190C838F8007C484A48133C0006 4A48131C000E4B131E000C4A48130E001C92C7FC0018140E150C0038021C140600301418 5D180E00704A140C1260154003C0141C00E017184A5A4817386C17304AC8127018E01260 007049EC01C0EF03800078010614070038EE0F00003C010E141E6C167CD81F805D6C6C48 EB03F0D807F0EC0FE0D803FEEC3FC02801FFFC03FFC7FC6C6CB55A6D14F8010F14E00101 14809026007FF8C8FC02F8C9FCA25CA21301A3495AA31307A25C130FA4131F5C6DCAFC37 417BAB40>39 D<121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A0A78891B>58 D<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A312011380120313005A 1206120E5A5A5A12600B1D78891B>II<1618163C16 7CA2167816F8A216F01501A216E01503A216C01507A21680150FA2ED1F00A2151E153EA2 153C157CA2157815F8A25D1401A24A5AA25D1407A25D140FA292C7FC5CA2141E143EA214 3C147CA25CA25C1301A25C1303A25C1307A25C130FA291C8FC5BA2133EA2133C137CA213 7813F8A25B1201A25B1203A2485AA25B120FA290C9FC5AA2121E123EA2123C127CA21278 12F8A25A126026647BCA31>I<127012FCB4FCEA7FC0EA1FF0EA07FCEA01FF38007FC0EB 1FF0EB07FE903801FF809038007FE0EC1FF8EC03FE913800FF80ED3FE0ED0FF8ED03FF03 0013C0EE3FF0EE0FFCEE01FF9338007FC0EF1FF0EF07FCEF01FF9438007FC0F01FE0A2F0 7FC0943801FF00EF07FCEF1FF0EF7FC04C48C7FCEE0FFCEE3FF0EEFFC0030390C8FCED0F F8ED3FE0EDFF80DA03FEC9FCEC1FF8EC7FE0903801FF80D907FECAFCEB1FF0EB7FC04848 CBFCEA07FCEA1FF0EA7FC048CCFC12FC12703B3878B44C>I64 D<1830187018F0A217011703A24D 7EA2170F171FA21737A2176717E717C793380187FCA2EE0307EE07031606160CA2161816 38163004607FA216C0030113011680ED0300A21506150E150C5D845D03707F15605DA24A 5A4AB7FCA25C0206C87F5C021C157F14185CA25C14E05C495A8549C9FC49163F1306130E 5B133C137C01FE4C7ED807FFED01FF007F01F0027FEBFFC0B5FC5C42477DC649>I<91B8 7E19F019FC02009039C00003FF6F480100138003FFED3FC01AE093C8121FF10FF0A24A17 F84B1507A314035D190FA2020717F04B151F1AE0193F020F17C04BED7F80F1FF004E5A02 1F4B5A4B4A5AF01FF0F03FC0023F4AB4C7FC4BEB1FFC92B612F018FEDA7FC0C7EA7F804B EC1FC0F00FF0727E02FF6F7E92C8FC727EA249835CA313035CA301075F4A1503A24E5A13 0F4A4B5A4E5AA2011F4C5A4A4B5A4D485A013F4B48C7FCEF0FFC4AEC3FF801FF913801FF E0B9128005FCC8FC17C045447CC34A>I<4CB46C1318043F01F013384BB512FC0307D900 7E1378DB1FF090380F80F0DB7F80EB03C1DA01FEC7EA01C34A48EC00E7DA0FF0ED7FE04A 48153F4A5A02FFC9121F494817C04948160F495A130F4A178049481607495A137F494817 0091CAFC5A485A1906485AA2485A96C7FC121F5BA2123F5BA3127F5BA4485AA419C0A218 0161127F180396C7FC6018066C6C160E601818001F17386D5E000F5F6D4B5A6C6C4B5A00 034CC8FC6C6C150E6C6C153C017F5DD93FC0EB01E0D91FF0EB0FC0D907FE017FC9FC0101 B512FCD9003F13E0020790CAFC45487CC546>I<91B912FCA3020001C0C7123F6F48EC03 F803FF1501190093C91278A21A385C5DA3020317305DA314074B1460A218E0020F4B1300 5DA21701021F5D4B13031707170F023F027FC8FC92B6FCA391397FC0007E4B131EA2170E 02FF140C92C7FCA2171C49031813035C611906010392C7FC4A160E190C191C010717184A 163819301970130F4A5E180161011F16034A15074E5A013F163F4EC7FC4AEC03FF01FFED 3FFEB9FCA26046447CC348>69 D<4CB46C1318043F01F013384BB512FC0307D9007E1378 DB1FF090380F80F0DB7F80EB03C1DA01FEC7EA01C34A48EC00E7DA0FF0ED7FE04A48153F 4A5A02FFC9121F494817C04948160F495A130F4A178049481607495A137F4948170091CA FC5A485A1906485AA2485A96C7FC121F5BA2123F5BA3127F5BA4485A4CB612805EA293C7 EBE000725AA3007F60A218FF96C7FCA26C7E5F606C7EA2000F16036D5E6C6C1507000316 0F6C6C151F6C6CED3DF8D97F8014786D6CEB01E0D91FF0903807C078D907FE90387F0070 0101B500FC1330D9003F01F090C8FC020790CAFC45487CC54D>71 D<91B6D8E003B61280A3020001E0C70003EB8000DB7F806E48C7FC03FF1503A293C85BA2 19075C4B5EA2190F14034B5EA2191F14074B5EA2193F140F4B5EA2197F141F4B5EA219FF 143F92B8C8FCA3DA7FC0C712014B5DA2180314FF92C85BA218075B4A5EA2180F13034A5E A2181F13074A5EA2183F130F4A5EA2187F131F4A5EA2013F16FFA24A93C9FCD9FFE00203 7FB6D8E003B67EA351447CC351>I<027FB512F8A217F09139007FF000ED3FC0157FA25E A315FF93C7FCA35C5DA314035DA314075DA3140F5DA3141F5DA3143F5DA3147F5DA314FF 92C8FCA35B5CA313035CA313075CA3130F5CA2131FA25CEB7FF0007FB512F0B6FCA22D44 7DC32B>I<91B612F8A3020001E0C8FC6F5A4B5AA293C9FCA35C5DA314035DA314075DA3 140F5DA3141F5DA3143F5DA3147F5DA314FF92CAFCA35B4A16C0A21801010317804A1503 1900A201075E4A1506180E181E010F161C4A153C18381878011F16F84A4A5A1703013F15 0F4D5A4A14FF01FF02075BB9FCA2603A447CC342>76 D<91B500C0933803FFFE63630200 F1FE00DB6FE0EE1BF803EF171F1B3703CFEF67F0A21BCF0201EF018F038F60DB87F0ED03 0F1B1F020317060307040C5BA2F2183F020717300206616F6C15601B7F020E17C0020CDC 018090C7FCA24F485A021C16060218606F6C5C1A0102381618023004305BA2F160030270 16C00260606F6CEB01801A0702E0ED03004A03065CA24E130F01015E4A60047F5B1A1F01 035E91C74A5CA24D48133F494BC7FC010661EE3F861A7F010E158C010C039892C8FCA205 B05C011C15E001186001386E5A190101785D01FC92C75BD803FFEF07FEB500F8011E0107 B512FE161C160C5F447BC35E>I<91B500C0020FB5128082A2DA007F9239007FE00070ED 1F8074C7FCDBEFF8150E15CF03C7160C70151C1401DB83FE1518A2DB81FF153814030300 1630831A704A6D7E02061760163F7114E0140E020C6D6C5CA2706C1301141C021801075D 83190302386D7E023094C8FC1601715B147002606DEB8006A294387FC00E14E04A023F13 0C18E0191C0101ED1FF04A1618170FF0F838130391C83807FC30A2943803FE705B010603 01136018FF19E0010E81010C5F187FA2131C0118705A1338181F137801FC70C9FCEA03FF B512F884180651447CC34E>II<007FB56C91381FFFF8B65DA2000101E0 C8000313006C0180ED01FCF000F0614E5AA2017F4C5A96C7FC1806A2606E5DA2013F5E18 70186060A24D5A6E4AC8FCA2011F1506170E170C5FA26E5C5FA2010F5D16015F4CC9FCA2 6E13065EA201075C5EA25E16E06E5B4B5A13034BCAFC1506A25D151CECFE185D13015D5D A26E5AA292CBFC5C13005C5CA25CA25C45467BC339>86 DI<023FB500E0011FB5FC A39126007FFEC7000313E0DB3FF8913801FE006F486E5A1AF06F6C4A5A626F6C4A5A0706 C7FC190E6F6C5C616F6C5C6171485A6F5D4EC8FC93387FC00660706C5A6060706C5A17F1 93380FFB8005FFC9FC5F705AA2707EA3707E5E04067F5E93381C7FC0163816704C6C7EED 01C04B486C7E160015064B6D7E5D4B6D7E5D5D4A486D7E14034AC76C7E140E5C4A6E7F14 3002E06F7E495A0103707E495A131F496C4B7E2603FFE04A487E007F01FC021FEBFFF0B5 FCA250447EC351>I<020FB812C05C1A809326800001130003F8C7FCDA3FE04A5A03804A 5A92C8485A027E4B5A027C4B5A02784B5A4A4B5AA24A4A90C7FC4A4A5A01014B5A4D5A4A 4A5A01034B5A91C8485A4D5AA290C84890C8FC4C5A4C5A4C5A4C5A4C5A4C5A4C5AA24B90 C9FC4B5A4B5A4B5A4B5A4B5A4B5AA24B5A4A90CAFC4A5A4A4814064A5A4A5A4A48140E4A 48140CA24A48141C4990C8121849481538495A49485D495A494815F049485D1701494814 034890C8485A4848150F4848151F48484B5A484815FF48481403043F90C8FC48B8FCB9FC 5F42447BC343>90 D97 D99 DIII<14FE137FA3EB01FC13001301A25CA21303A25CA21307A25CA2 130FA25CA2131FA25CED3FC090393F81FFF0913887C0FC91380E007E023C133ED97F7013 3F4A7F4A14805C13FF91C7FC5BA24848143F17005BA200035D167E5BA2000715FE5E5B15 01000F5DA24913035E001F1607030713064914E0150F003FEDC00E170C90C7141CEE8018 4816381730007E167017E000FE91380781C0EEC38048913801FF000038EC007C30467BC4 38>104 D<141E143F5C5CA3147E143891C7FCAE133EEBFF803801C3C0380781E0380601 F0120E121CEA180312381230A2EA700700605BA2EAE00F00C05BEA001F5CA2133F91C7FC A25B137E13FE5BA212015BEC03800003140013F01207495A1406140E140CEBC01C141814 385C00035BEBE1C0C6B45A013EC7FC19437DC121>I<163C16FEA21501A316FCED007016 00AE15FCEC03FF91380F0780021C13C091383803E0147014E014C01301EC800713031400 5B0106130F130E010C14C090C7FC151FA21680A2153FA21600A25DA2157EA215FEA25DA2 1401A25DA21403A25DA21407A25DA2140FA25DA2141F5DA2143F001C91C7FC127F48137E 5CA248485AEB03E038F807C038781F80D83FFEC8FCEA07F0275681C128>I<14FE137FA3 EB01FC13001301A25CA21303A25CA21307A25CA2130FA25CA2131FA25C163F013FECFFC0 923803C0E09138000703ED1E0F491338ED701F017E13E0EC01C001FE018013C00203EB07 004948C8FC140E00015B5C495A5C3803FBC001FFC9FC8014F83807F1FE9038F03F809038 E00FE06E7E000F130381EBC001A2001FED01C017801380A2003F15031700010013F05E48 1506160E007E150C161C00FE01005BED787048EC3FE00038EC0F802B467BC433>II<01F8D903FCEC7F80D803FED91FFF903803FFE0D8 071F903B7C0FC00F81F83E0E0F80E007E01C00FC001C9026C3C0030178137C271807C700 D9F0E0137E02CE902601F1C0133E003801DCDAFB80133F003001D892C7FCD90FF814FF00 70495C0060495CA200E04949485CD8C01F187E4A5C1200040715FE013F6091C75BA2040F 14014960017E5D1903041F5D13FE494B130762043F160E0001060F130C4992C713C0191F 4CED801C00031A1849027E1638F2003004FE167000071A60494A16E0F201C0030192380F 0380000FF18700494AEC03FED80380D90070EC00F84F2D7DAB55>I<01F8EB03FCD803FE EB1FFFD8071F90387C0FC03B0E0F80E007E03A0C07C3C003001CD9C7007F001801CE1301 003801DC80003013D8EB0FF800705B00605BA200E0491303D8C01F5D5C12001607013F5D 91C7FCA2160F495D137E161F5F13FE49143F94C7FC187000014B136049147E16FE4C13E0 000317C049150104F81380170300071700495D170EEE781C000FED7C3849EC1FF0D80380 EC07C0342D7DAB3A>III< 91380FC00391383FF0079138F83C0F903903E00E1E90390FC0063E90381F800790393F00 037E4914FC01FE1301485AA2484814F812075B000F140316F0485AA2003F14074914E0A3 007F140F4914C0A3151F90C713805AA2153F6C1500A2127E5D007F14FE6C1301A214036C 6C485A000F131E3807C0383803E0F13901FFC1F838003F01130014035DA314075DA3140F 5DA2141FA2143F011FB51280A21600283F7DAB2B>I<01F8EB0FC0D803FEEB7FF0D8070F EBF038000E903883C07C3A0C07C701FC001C13CE0018EBDC03003813D8003013F8D90FF0 13F800709038E000E0006015005C12E0EAC01F5C1200A2133F91C8FCA35B137EA313FE5B A312015BA312035BA312075BA3120F5BEA0380262D7DAB2C>I<141C147EA314FE5CA313 015CA313035CA313075CA2007FB512FCB6FC15F839000FC000A2131F5CA3133F91C7FCA3 5B137EA313FE5BA312015BA312035BA21570000714605B15E015C0000F130101C0138014 03EC070000071306140E5C6C6C5A000113F03800FFC0013FC7FC1E3F7EBD23>116 D<133ED9FF8014E02603C3C0EB03F0380703E0380601F0000E1507121CD818035D123800 30150FA2D870075D00605B161FEAE00F00C0495CEA001F4A133FA2013F92C7FC91C7FC5E 5B017E147EA216FE13FE495CA20301EB01801703484802F81300A25F0303130616F00000 1407030F130E6D010D130C017C011D131C033913186D9038F0F838903A1F03C07870903A 07FF803FE0903A01FC000F80312D7DAB38>I<013E140ED9FF80EB3F802603C3C0137F38 0703E0380601F0120E121CD81803143F0038151F0030150FA2D87007140700605BA2D8E0 0F150000C0497FEA001F4A5B1606133F91C7FC160E49140C137EA2161C01FE14185B1638 163016704848146016E05E150100005D15036D49C7FC1506017C130E017E5B6D13789038 0F81E06DB45AD900FEC8FC292D7DAB2F>I<02FCEB07E0903A03FF801FFC903A0F07C078 1E903A1C03E0E01F903A3801F1C07FD9700013804901FB13FF4848EBFF00495B000316FE 90C71438484A130012061401000E5C120CC7FC14035DA314075DA3140F5DA3021F143817 305D1770023F1460121E003F16E0267F807FEB01C0026F148000FF01EF1303D901CFEB07 0000FE903887C00E267C03835B3A3C0F01E0783A1FFC00FFE0D803F0EB3F80302D7EAB37 >120 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fr cmcsc10 12 28 /Fr 28 121 df<121FEA3F80EA7FC0EAFFE0A5EA7FC0EA3F80EA1F000B0B768A20>46 D<1438147814F81303130F13FFB5FC13F713071200B3B3B0497E497EB712C0A3224276C1 37>49 D51 D<1638167CA316FEA34B7EA24B7FA34B7F167FA2030E7F163FA24B6C7EA2033C 7FED380FA203787FED7007A203E07F1603A24A486C7EA20203814B7EA202078192C7127F A2020E81173FA24A6E7EA2023C810238140FA2027FB67EA302E0C7EA07FE17030101824A 80A20103834A80A249C97F187FA2010E707EA2011E83181F133E85137E48B483000701C0 ED7FFFB500FC021FB512FEA347477CC651>65 D70 D 73 D80 D82 D<003FBAFCA3903BF8000FFE000701C06D48130090C7163F007EF0 1F80007C180FA200781807A300701803A548F001C0A5C893C7FCB3B3A44B7E92383FFF80 49B712F0A342437BC24E>84 D87 D<157015F8A34A7EA24A7EA34A7E81A29138 0E3F80A2021E7FEC1C1FA24A6C7EA34A6C7EA202F07FECE003A249486C7EA349486C7EA2 01078091C77EA249B67EA24981011CC7121FA2013C810138140FA2496E7EA201F0814914 03120183486C140100074B7ED81FF84A7EB5027F13F8A335357CB43D>97 D<4AB4EB0180021FEBF00391B5EAFC0701039038007E0FD907F8EB0F9FD91FE0EB03DF49 48EB01FF01FFC8FC4848157F4848153FA24848151F4848150F121F491507123F5BA2007F 1603A3484892C7FCAB6C7EEF0380A2123FA27F001F16076D1600000F5E6C6C150E6C6C15 1E171C6C6C153C6C6C5DD93FC05C6D6CEB03E0D907F8495A902703FF807FC7FC0100EBFF FC021F13F00201138031357BB33B>99 DIIIIII108 DIIII< B612F8EDFF8016E03A03FE000FF86C48EB03FEED00FF707E707E83161FA283A55FA24C5A 5F4CC7FC16FEED03FCED1FF090B6128003FCC8FC9038FC003FED0FC06F7E6F7E6F7E8215 0082A382A383A4EFC01CA2167FEFE03C486C023F1338B500F890381FF07893380FF8F093 3803FFE0CAEA7F8036347BB23C>114 D<90390FF0018090387FFE0348B512873907F00F EF390FC001FF48C7FC003E143F151F5A150F5A1507A36C1403A27E6C91C7FC6C7E7FEA3F F8EBFF806C13FC6CEBFFC06C14F06C80C614FE011F7F01031480D9001F13C01401913800 3FE0151F150FED07F0150312E01501A37EA216E06C1403A26CEC07C06CEC0F806C6CEB1F 0001E0133ED8FBFE13FC00F0B55AD8E01F13E0D8C00390C7FC24357BB32E>I<007FB812 C0A3903A8007FC003F277E0003F8130F007C16070078160300701601A200F017E0A24816 00A6C71600B3AA4A7E4A7E010FB512FEA333327CB13B>II<267FFFF890383FFFF0A3000101E0010F13006C49EB07F8017F5D013F15C06D 6C5C6D6C49C7FC160E6D6C131E6D6C5B6D6C133816786D6C5B91387F81E0023F5B15C391 381FE7806EB4C8FC5D14076E5A6E7EA26E7E4A7FA24A7F9138079FE091380F0FF0140E91 381E07F84A6C7E4A6C7E14709138F000FF49486D7E4948133F4A8001076E7E49C76C7E13 1E013E6E7E017E6E7E01FE81000182D80FFF4A1380B500C0011F13FEA337337DB23D> 120 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fs cmr12 12 83 /Fs 83 128 df0 D<1618163CA2167EA216FFA24B7FA24B6C7EA29238063FE0A24B6C7EA24B6C7EA2923838 07FC153092387003FE15609238E001FF15C002016D7F5D02036E7E92C7FC4A6E7E140602 0E6E7E140C021C6E7E141802386E7E143002706E7E146002E06E7E5C01016F7F5C010370 7E91C9FC183F010683181F4983180F49831807498318034983A249707EA24848701380A2 48CBEA7FC0A20006F03FE0A248F01FF0A2001FBA12F8A24819FCA24819FEA2BCFC48477C C651>I<1507A34B7EA34B7EA34B7EA34B7E156FA2EDEFF815C7A202017F158715830203 7F1503150102077F140681020E80140C167FA24A80163FA24A80161FA24A80160FA24A80 1607A24948801603A249C77F1601A201068182A24982177FA24982173FA24982171FA201 7082136001E0150F6D821201486C82D80FFEED3FFEB500C00107B512F8A33D477DC644> 3 D5 DI<027FB67EA39126001FFEC9FC6F5A6F5AA8B46CEFFF8001E01603D81F F0933807FC006C6C4C5A0007606D161F000360A26D163F000160AC6C6C5F187FA4D97F80 4BC7FCA2013F5E02C01401131F02E04A5A010F5ED907F01407D903F85DD901FC4A5AD900 FE4A5A027F027FC8FCDA1FC713FE0207B512F8020114C09126001FFCC9FCED07F8A84B7E 4B7E027FB67EA341447BC34C>9 DI<9239FFC001FC020F9038F80FFF913B3F803E3F03C0913BFC0007 7E07E0D903F890390FFC0FF0494890383FF81F4948EB7FF0495A494814E049C7FCF00FE0 4991393FC0038049021F90C7FCAFB912F0A3C648C7D81FC0C7FCB3B2486CEC3FF0007FD9 FC0FB512E0A33C467EC539>I<4AB4FC020F13E091387F80F8903901FC001C49487FD907 E0130F4948137F011FECFF80495A49C7FCA25B49EC7F00163E93C7FCACEE3F80B8FCA3C6 48C7FC167F163FB3B0486CEC7FC0007FD9FC1FB5FCA330467EC536>I<913801FFC0020F EBFB8091387F803F903801FC00494813FFEB07E0EB1FC0A2495A49C7FC167F49143F5BAF B8FCA3C648C7123FB3B2486CEC7FC0007FD9FC1FB5FCA330467EC536>II<001EEB03C0397F800FF000FF131F01C013F8A201E013FCA3007F13 0F391E6003CC0000EB000CA401E0131C491318A3000114384913300003147090C7126048 14E0000614C0000E130148EB038048EB070048130E0060130C1E1D7DC431>34 D<043014C00478497EA204F81303A24C5CA203011407A24C5CA20303140FA24C91C7FCA2 03075CA24C131EA2030F143EA293C7123CA24B147CA2031E1478A2033E14F8A2033C5CA2 037C1301007FBA12F8BB12FCA26C19F8C72801F00007C0C7FC4B5CA30203140FA24B91C8 FCA402075CA24B131EA3020F143E007FBA12F8BB12FCA26C19F8C7003EC700F8C8FC023C 5CA2027C1301A202785CA202F81303A24A5CA201011407A24A5CA20103140FA24A91C9FC A201075CA24A131EA2010F143EA291C7123CA249147CA2011E1478A2010C143046587BC4 51>I<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A312011380120313 005A1206120E5A5A5A12600B1D78C41B>39 D<140C141C1438147014E0EB01C01303EB07 80EB0F00A2131E5BA25B13F85B12015B1203A2485AA3485AA348C7FCA35AA2123EA2127E A4127CA312FCB3A2127CA3127EA4123EA2123FA27EA36C7EA36C7EA36C7EA212017F1200 7F13787FA27F7FA2EB0780EB03C01301EB00E014701438141C140C166476CA26>I<12C0 7E12707E7E7E120F6C7E6C7EA26C7E6C7EA21378137C133C133E131E131FA2EB0F80A3EB 07C0A3EB03E0A314F0A21301A214F8A41300A314FCB3A214F8A31301A414F0A21303A214 E0A3EB07C0A3EB0F80A3EB1F00A2131E133E133C137C13785BA2485A485AA2485A48C7FC 120E5A5A5A5A5A16647BCA26>I<16C04B7EB3AB007FBAFCBB1280A26C1900C8D801E0C9 FCB3AB6F5A41407BB84C>43 D<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E0 13C0A312011380120313005A1206120E5A5A5A12600B1D78891B>II<121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A0A78891B>I<14FF010713E090381F81 F890383E007C01FC133F4848EB1F8049130F4848EB07C04848EB03E0A2000F15F0491301 001F15F8A2003F15FCA390C8FC4815FEA54815FFB3A46C15FEA56D1301003F15FCA3001F 15F8A26C6CEB03F0A36C6CEB07E0000315C06D130F6C6CEB1F806C6CEB3F00013E137C90 381F81F8903807FFE0010090C7FC28447CC131>48 D<143014F013011303131F13FFB5FC 13E713071200B3B3B0497E497E007FB6FCA3204278C131>II<49B4FC010F13E0013F13FC9038FE01FE3A01F0007F80D803C0EB 3FC048C7EA1FE0120EED0FF0EA0FE0486C14F8A215077F5BA26C48130FEA03C0C813F0A3 ED1FE0A2ED3FC01680ED7F0015FE4A5AEC03F0EC1FC0D90FFFC7FC15F090380001FCEC00 7FED3F80ED1FC0ED0FE016F0ED07F816FC150316FEA2150116FFA3121EEA7F80487EA416 FE491303A2007EC713FC00701407003015F80038140F6C15F06CEC1FE06C6CEB3FC0D803 E0EB7F803A01FE01FE0039007FFFF8010F13E0010190C7FC28447CC131>II< 000615C0D807C0130701FCEB7F8090B612005D5D5D15E0158026063FFCC7FC90C9FCAE14 FF010713C090381F01F090383800FC01F0137ED807C07F49EB1F8016C090C7120F000615 E0C8EA07F0A316F81503A216FCA5123E127F487EA416F890C712075A006015F0A2007014 0F003015E00038EC1FC07E001EEC3F806CEC7F006C6C13FE6C6C485A3901F807F039007F FFE0011F90C7FCEB07F826447BC131>II<121CA2EA 1F8090B712C0A3481680A217005E0038C8120C0030151C00705D0060153016705E5E4814 014B5A4BC7FCC81206150E5D151815385D156015E04A5AA24A5A140792C8FC5CA25C141E 143EA2147E147CA214FCA21301A3495AA41307A6130FAA6D5AEB01C02A457BC231>I<14 FF010713E0011F13F890387F00FE01FC133FD801F0EB1F804848EB0FC049EB07E00007EC 03F048481301A290C713F8481400A47FA26D130116F07F6C6CEB03E013FC6C6CEB07C090 39FF800F806C9038C01F006CEBF03EECF87839007FFEF090383FFFC07F01077F6D13F849 7F90381E7FFFD97C1F1380496C13C02601E00313E048486C13F000079038007FF84848EB 3FFC48C7120F003EEC07FE150148140016FF167F48153FA2161FA56C151E007C153EA200 7E153C003E157C6C15F86DEB01F06C6CEB03E06C6CEB07C0D803F8EB1F80C6B4EBFF0090 383FFFFC010F13F00101138028447CC131>I<14FF010713E0011F13F890387F80FC9038 FC007E48487F4848EB1F804848EB0FC0000FEC07E0485AED03F0485A16F8007F140190C7 13FCA25AA216FE1500A516FFA46C5CA36C7E5D121F7F000F5C6C6C130E150C6C6C131C6C 6C5BD8007C5B90383F01E090390FFF80FE903801FE0090C8FC150116FCA4ED03F8A216F0 D80F801307486C14E0486C130F16C0ED1F80A249EB3F0049137E001EC75A001C495A000F 495A3907E01FE06CB51280C649C7FCEB1FF028447CC131>I<121EEA7F80A2EAFFC0A4EA 7F80A2EA1E00C7FCB3A5121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A2B78AA1B>I<121E EA7F80A2EAFFC0A4EA7F80A2EA1E00C7FCB3A5121E127FEAFF80A213C0A4127F121E1200 A512011380A3120313005A1206120E120C121C5A5A12600A3E78AA1B>I<007FBAFCBB12 80A26C1900CEFCB0007FBAFCBB1280A26C190041187BA44C>61 D<16C04B7EA34B7EA34B 7EA34B7EA3ED19FEA3ED30FFA203707FED607FA203E07FEDC03FA2020180ED801FA2DA03 007F160FA20206801607A24A6D7EA34A6D7EA34A6D7EA20270810260147FA202E08191B7 FCA249820280C7121FA249C87F170FA20106821707A2496F7EA3496F7EA3496F7EA20178 8313F8486C83D80FFF03037FB500E0027FEBFFC0A342477DC649>65 DIIIII72 DI76 DIIII82 D<49B41303010FEBE007013F13 F89039FE00FE0FD801F8131FD807E0EB079F49EB03DF48486DB4FC48C8FC4881003E8112 7E82127C00FC81A282A37E82A27EA26C6C91C7FC7F7FEA3FF813FE381FFFE06C13FE6CEB FFE06C14FC6C14FF6C15C0013F14F0010F80010180D9001F7F14019138001FFF03031380 816F13C0167F163F161F17E000C0150FA31607A37EA36C16C0160F7E17806C151F6C1600 6C5D6D147ED8FBC05CD8F9F0495AD8F07C495A90393FC00FE0D8E00FB51280010149C7FC 39C0003FF02B487BC536>I<003FB912F8A3903BF0001FF8001F01806D481303003EC715 0048187C0078183CA20070181CA30060180CA5481806A5C81600B3B3A54B7EED7FFE49B7 7EA33F447DC346>II87 D91 D<01C01318000114384848137048C712E0000EEB01C0000C148000 1C13030018140000385B003013060070130E0060130CA300E0131C481318A400CFEB19E0 39FFC01FF801E013FCA3007F130FA2003F130701C013F8390F0001E01E1D71C431>II<130C131E133F497EEBF3C03801 E1E03803C0F03807807848487E001E7F487F0070EB038048EB01C00040EB00801A0E75C3 31>I97 DII<167FED3FFFA315018182B3EC7F80903803FFF090380FC07C 90383F000E017E1307496D5AD803F87F48487F5B000F81485AA2485AA2127FA290C8FC5A AB7E7FA2123FA26C7EA2000F5D7F6C6C5B00035C6C6C9038077F806C6C010E13C0013F01 1C13FE90380FC0F8903803FFE09026007F0013002F467DC436>III III<143C14FFA2491380A46D1300A2143C91C7FCADEC7F80EB 3FFFA31300147F143FB3B3AA123E127F39FF807F00A2147EA25C6C485A383C01F06C485A 3807FF80D801FEC7FC195785C21E>IIII<3901FC01FE00FF903807FFC091381E07F091383801F800070170 7F0003EBE0002601FDC07F5C01FF147F91C7FCA25BA35BB3A8486CECFF80B5D8F83F13FE A32F2C7DAB36>II<3901FC03FC00FF9038 0FFF8091383C07E091387001F83A07FDE000FE00030180137FD801FFEC3F8091C7EA1FC0 4915E049140F17F0160717F8160317FCA3EE01FEABEE03FCA3EE07F8A217F0160F6D15E0 EE1FC06D143F17806EEB7E00D9FDC05B9039FCF003F891383C0FE091381FFF80DA03FCC7 FC91C9FCAE487EB512F8A32F3F7DAB36>I<91387F8003903903FFE00790380FE0789039 3F801C0F90387E000E496D5AD803F8EB039F0007EC01BF4914FF48487F121F5B003F81A2 485AA348C8FCAB6C7EA3123F7F121F6D5C120F6D5B12076C6C5B6C6C497E6C6C130E013F 131C90380FC0F8903803FFE09038007F0091C7FCAEEEFF80033F13FEA32F3F7DAB33>I< 3903F803F000FFEB1FFCEC3C3EEC707F0007EBE0FF3803F9C000015B13FBEC007E153C01 FF13005BA45BB3A748B4FCB512FEA3202C7DAB26>I<90383FE0183901FFFC383907E01F 78390F0003F8001E1301481300007C1478127800F81438A21518A27EA27E6C6C13006C7E 13FC383FFFE06C13FC6C13FF6C14C06C14E0C614F0011F13F81300EC0FFC140300C0EB01 FE1400157E7E153EA27EA36C143C6C147C15786C14F86CEB01F039F38003E039F1F00F80 39E07FFE0038C00FF01F2E7DAC26>I<1306A5130EA4131EA3133E137EA213FE12011207 001FB512F0B6FCA2C648C7FCB3A4150CAA017E131C017F1318A26D133890381F8030ECC0 70903807E0E0903801FFC09038007F001E3E7EBC26>IIIIII<003FB612E0A29038C0003F90C713C0003CEC7F800038EC FF00A20030495A0070495AA24A5A0060495AA24A5A4A5AA2C7485A4AC7FC5B5C495A1307 5C495A131F4A1360495A495AA249C712C0485AA2485A485A1501485A48481303A24848EB 07804848131F00FF14FF90B6FCA2232B7DAA2B>I<01F81302D803FE13073907FF800E48 EBE01C391F1FF8F8393807FFF0D8700113E039E0007FC00040EB1F00200978C131>126 D<001EEB0780007FEB0FE039FF801FF0EBC03FA4EB801F397F000FE0001EEB07801C0A76 C231>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Ft cmmi10 10 1 /Ft 1 22 df<133F14C0EB07F06D7E801301A26D7EA3147FA36E7EA36E7EA36E7EA36E7E A36E7EA36E7EA26E7EA214014A7E5C4A7E91381E3F80143C14784A6C7E1301EB03E04948 6C7EEB0F80EB1F00496D7E137E5B48486D7E485A485A000F6E7E485A485A48C87E12FE16 7F4816800070151F293B7CB930>21 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fu cmcsc10 10 43 /Fu 43 119 df<133C137EA213FE1201EA03FC13F0EA07E0EA0FC0EA1F80EA1E005A5A5A 12C00F0F6DB92E>19 D<121C127FEAFF80A213C0A3127F121C1200A412011380A2120313 005A1206120E5A5A5A12600A1977881B>44 DI<121C127FEAFF 80A5EA7F00121C090977881B>I48 D51 D<151C153CA2157C15FCA214011403A21407140F141D141914311471146114C11301EB03 8114011307130E130C131813381330136013E0EA01C01380EA03005A12065A121C5A1230 12705AB712FEA3C73801FC00AB4A7E49B512FCA327397DB82E>I<00061406D80780131E 9038F801FC90B5FC5D5D15C05D4AC7FC38067FF090C9FCABEB03FC90381FFF8090387C07 E09038E001F03907C000F8497F90C7127E0006147FC8EA3F80A216C0151FA216E0A4123E 127F487EA490C713C048143F126016800070147F6C150015FE6C5C000F495A39078007F0 3903F01FE06CB512806C6C48C7FCEB0FF0233A7BB72E>I<12301238123E003FB612F8A3 16F05A16E016C00070C7EA018000601403ED0700150E00E0140C48141C5D5DC8126015E0 4A5A4A5A92C7FC5C140EA25C143C14381478147014F0A213015C1303A21307A3130F5CA2 131FA5133FA96D5A6DC8FC253B7AB82E>55 D57 D<150EA3151FA24B7EA34B7EA3EDDFE0A202017F158FA29138030FF81507A202067F1503 020E7FEC0C01A2021C7FEC1800A24A80167FA24A6D7EA202E0804A131FA2494880160FA2 49B67EA249810106C71203A249811601A2498182A2496F7EA20170820160153F13E06D82 1203D80FFCED7FF8B56C010FB512E0A33B3C7CBB44>65 DIII70 DI73 D<011FB512F0A39039000FFE00EC03FCB3B3A3123FEA7F80EAFFC0A44A5A1380 D87F005B0070130F6C495A6C5C6C49C7FC3807C0FE3801FFF838003FC0243B7CB82F>I< B5933801FFFE6E5DA2000119002600DFC0ED06FEA2D9CFE0150CA3D9C7F01518A2D9C3F8 1530A3D9C1FC1560A2D9C0FE15C0A3027FEC0180A26E6CEB0300A36E6C1306A26E6C5BA2 6E6C5BA36E6C5BA26E6C5BA36E6C5BA292387F0180A3DB3F83C7FCA2ED1FC6A3ED0FECA2 ED07F8A3486C6D5A487ED80FFC6D48497EB500C092B512FEA26F5A47397BB852>77 DI80 D82 DI85 DI<1407A24A7EA34A7EA3 EC37E0A2EC77F01463A2ECC1F8A201017F1480A2903803007EA301067FA2010E80010C13 1FA2496D7EA2013FB57EA29038300007496D7EA3496D7EA200018149130012036D801207 D81FE0903801FF80D8FFF8010F13F8A22D2C7DAB33>97 DI<91383FC006903901FFF80E9039 0FE03E1E90381F0007017EEB03BE01F8EB01FE484813004848147E0007153E485A001F15 1E5B003F150E90C8FC5A1606A212FE1600AA007F1506A37E6D140E001F150C7F000F151C 6C6C1418000315386C6C14706C6C14E0017EEB01C0011FEB078090390FE03E00903801FF F89038003FC0272D7BAB31>III104 DI108 DIII III<017F13603901FFE0E0 380780F9380E001F48130748130312780070130100F01300A315607EA26C14007E127F13 C0EA3FFEEBFFE06C13F8000713FE6C7FC61480010F13C01300EC0FE01407EC03F01401A2 12C01400A37E15E06C1301A26CEB03C06CEB0780B4EB0F0038F3E01E38E0FFF838C01FE0 1C2D7BAB26>I<007FB712C0A23A7E003FC00F007890381F8003007015011600126000E0 16E0A2481660A5C71500B3A8EC7FE0011FB57EA22B2B7DAA31>III E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fv cmr10 10 79 /Fv 79 128 df12 D15 D<127812FCA27E7EEA7F80121FEA0FC0EA07E0EA03F012001378133C131E13 060F0F77B92A>18 D<133C137EA213FE1201EA03FC13F0EA07E0EA0FC0EA1F80EA1E005A 5A5A12C00F0F6FB92A>I<001C131C007F137F39FF80FF80A26D13C0A3007F137F001C13 1C00001300A40001130101801380A20003130301001300485B00061306000E130E485B48 5B485B006013601A197DB92A>34 D<121C127FEAFF80A213C0A3127F121C1200A4120113 80A2120313005A1206120E5A5A5A12600A1979B917>39 D<146014E0EB01C0EB0380EB07 00130E131E5B5BA25B485AA2485AA212075B120F90C7FCA25A121EA2123EA35AA65AB212 7CA67EA3121EA2121F7EA27F12077F1203A26C7EA26C7E1378A27F7F130E7FEB0380EB01 C0EB00E01460135278BD20>I<12C07E12707E7E7E120F6C7E6C7EA26C7E6C7EA21378A2 137C133C133E131EA2131F7FA21480A3EB07C0A6EB03E0B2EB07C0A6EB0F80A31400A25B 131EA2133E133C137C1378A25BA2485A485AA2485A48C7FC120E5A5A5A5A5A13527CBD20 >I<121C127FEAFF80A213C0A3127F121C1200A412011380A2120313005A1206120E5A5A 5A12600A19798817>44 DI<121C127FEAFF80A5EA7F00121C09 09798817>I<150C151E153EA2153C157CA2157815F8A215F01401A215E01403A215C014 07A21580140FA215005CA2141E143EA2143C147CA2147814F8A25C1301A25C1303A2495A A25C130FA291C7FC5BA2131E133EA2133C137CA2137813F8A25B1201A25B1203A25B1207 A25B120FA290C8FC5AA2121E123EA2123C127CA2127812F8A25A12601F537BBD2A>II< EB01C013031307131F13FFB5FCA2131F1200B3B3A8497E007FB512F0A31C3879B72A>I< EB0FF0EB7FFE48B57E3903E03FE0390F000FF0000E6D7E486D7E486D7E123000706D7E12 6012FCB4EC7F807FA56CC7FC121CC8FCEDFF00A34A5A5D14035D4A5A5D140F4A5A4A5A92 C7FC147C5C495A495A495A495A91C8FC011EEB01805B5B49130348481400485A485A000E C75A000FB6FC5A5A485CB6FCA321387CB72A>II<1538A2157815F8A2 140114031407A2140F141F141B14331473146314C313011483EB030313071306130C131C 131813301370136013C01201EA038013005A120E120C5A123812305A12E0B712F8A3C738 03F800AB4A7E0103B512F8A325397EB82A>I<0006140CD80780133C9038F003F890B5FC 5D5D158092C7FC14FC38067FE090C9FCABEB07F8EB3FFE9038780F803907E007E0903880 03F0496C7E12066E7EC87EA28181A21680A4123E127F487EA490C71300485C12E000605C 12700030495A00385C6C1303001E495A6C6C485A3907E03F800001B5C7FC38007FFCEB1F E0213A7CB72A>II<12301238123E003FB612E0A316 C05A168016000070C712060060140E5D151800E01438485C5D5DC712014A5A92C7FC5C14 0E140C141C5CA25CA214F0495AA21303A25C1307A2130FA3495AA3133FA5137FA96DC8FC 131E233B7BB82A>III<121C127F EAFF80A5EA7F00121CC7FCB2121C127FEAFF80A5EA7F00121C092479A317>I<121C127F EAFF80A5EA7F00121CC7FCB2121C127F5A1380A4127F121D1201A412031300A25A1206A2 120E5A121812385A1260093479A317>I<1538A3157CA315FEA34A7EA34A6C7EA202077F EC063FA2020E7FEC0C1FA2021C7FEC180FA202387FEC3007A202707FEC6003A202C07F15 01A2D901807F81A249C77F167FA20106810107B6FCA24981010CC7121FA2496E7EA3496E 7EA3496E7EA213E0707E1201486C81D80FFC02071380B56C90B512FEA3373C7DBB3E>65 DI<913A01FF800180020FEBE003027F13F8903A01FF807E07903A03 FC000F0FD90FF0EB039F4948EB01DFD93F80EB00FF49C8127F01FE153F12014848151F48 48150FA248481507A2485A1703123F5B007F1601A35B00FF93C7FCAD127F6DED0180A312 3F7F001F160318006C7E5F6C7E17066C6C150E6C6C5D00001618017F15386D6C5CD91FE0 5C6D6CEB03C0D903FCEB0F80902701FF803FC7FC9039007FFFFC020F13F002011380313D 7BBA3C>III< B812F8A30001903880001F6C90C71201EE00FC177C173C171CA2170CA4170E1706A2ED01 80A21700A41503A21507151F91B5FCA3EC001F15071503A21501A692C8FCAD4813C0B612 C0A32F397DB836>III I<013FB512E0A39039001FFC00EC07F8B3B3A3123FEA7F80EAFFC0A44A5A1380D87F005B 0070131F6C5C6C495A6C49C7FC380781FC3801FFF038007F80233B7DB82B>III< B5933807FFF86E5DA20001F0FC002600DFC0ED1BF8A2D9CFE01533A3D9C7F01563A3D9C3 F815C3A2D9C1FCEC0183A3D9C0FEEC0303A2027F1406A36E6C130CA36E6C1318A26E6C13 30A36E6C1360A26E6C13C0A3913901FC0180A3913900FE0300A2ED7F06A3ED3F8CA2ED1F D8A3ED0FF0A3486C6D5A487ED80FFC6D48497EB500C00203B512F8A2ED018045397DB84C >I III82 D I<003FB812E0A3D9C003EB001F273E0001FE130348EE01F00078160000701770A3006017 30A400E01738481718A4C71600B3B0913807FF80011FB612E0A335397DB83C>IIII89 D<003FB7FCA39039FC0001 FE01C0130349495A003EC7FC003C4A5A5E0038141F00784A5A12704B5A5E006014FF4A90 C7FCA24A5A5DC712074A5AA24A5A5D143F4A5AA24A5A92C8FC5B495AA2495A5C130F4948 EB0180A2495A5C137F495A16034890C7FC5B1203485AEE0700485A495C001F5D48485C5E 4848495A49130FB8FCA329397BB833>II<3901800180000313033907000700000E130E485B001813180038133800301330 0070137000601360A200E013E0485BA400CE13CE39FF80FF806D13C0A3007F137FA2393F 803F80390E000E001A1974B92A>I I97 DIIII<147E903803FF8090380FC1E0EB1F8790 383F0FF0137EA213FCA23901F803C091C7FCADB512FCA3D801F8C7FCB3AB487E387FFFF8 A31C3B7FBA19>IIII< EB01C0EB07F0EB0FF8A5EB07F0EB01C090C7FCAAEB01F813FFA313071301B3B3A2123C12 7E00FF13F01303A214E038FE07C0127C383C0F00EA0FFEEA03F8154984B719>III<2703F00FF0EB1FE000FFD93FFCEB7FF8913AF03F01E0 7E903BF1C01F83803F3D0FF3800FC7001F802603F70013CE01FE14DC49D907F8EB0FC0A2 495CA3495CB3A3486C496CEB1FE0B500C1B50083B5FCA340257EA445>I<3903F00FF000 FFEB3FFCECF03F9039F1C01F803A0FF3800FC03803F70013FE496D7EA25BA35BB3A3486C 497EB500C1B51280A329257EA42E>II<3903F01FE000FFEB7FF89038 F1E07E9039F3801F803A0FF7000FC0D803FEEB07E049EB03F04914F849130116FC150016 FEA3167FAA16FEA3ED01FCA26DEB03F816F06D13076DEB0FE001F614C09039F7803F0090 38F1E07E9038F0FFF8EC1FC091C8FCAB487EB512C0A328357EA42E>II<3807E01F00 FFEB7FC09038E1E3E09038E387F0380FE707EA03E613EE9038EC03E09038FC0080491300 A45BB3A2487EB512F0A31C257EA421>II<1318A51338A31378A313F8120112031207001FB5FCB6FC A2D801F8C7FCB215C0A93800FC011580EB7C03017E13006D5AEB0FFEEB01F81A347FB220 >IIIIII<003FB512FCA2EB8003D83E0013F8003CEB07F00038EB0FE012300070EB1FC0 EC3F800060137F150014FE495AA2C6485A495AA2495A495A495AA290387F000613FEA248 5A485A0007140E5B4848130C4848131CA24848133C48C7127C48EB03FC90B5FCA21F247E A325>II<001C131C007F137F39FF80FF80A5397F007F00001C13 1C190978B72A>127 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fw cmbx12 12 47 /Fw 47 128 df46 D48 DII< ECFFF0010713FF011F14C0017F14F049C66C7ED803F8EB3FFED807E06D7E81D80FF86D13 8013FE001F16C07FA66C5A6C4815806C485BC814005D5E4B5A4B5A4B5A4A5B020F138090 2607FFFEC7FC15F815FF16C090C713F0ED3FFCED0FFEEEFF80816F13C017E0A26F13F0A2 17F8A3EA0FC0EA3FF0487EA2487EA217F0A25D17E06C5A494913C05BD83F80491380D81F F0491300D80FFEEBFFFE6CB612F800015D6C6C14C0011F49C7FC010113E02D427BC038> I<0007150301E0143F01FFEB07FF91B6FC5E5E5E5E5E16804BC7FC5D15E092C8FC01C0C9 FCAAEC3FF001C1B5FC01C714C001DF14F09039FFE03FFC9138000FFE01FC6D7E01F06D13 804915C0497F6C4815E0C8FC6F13F0A317F8A4EA0F80EA3FE0487E12FF7FA317F05B5D6C 4815E05B007EC74813C0123E003F4A1380D81FC0491300D80FF0495AD807FEEBFFFC6CB6 12F0C65D013F1480010F01FCC7FC010113C02D427BC038>53 D58 D65 D67 DIII72 DI75 DIII<923807FFC092B512FE0207ECFFC0021F15F091267FFE0013 FC902601FFF0EB1FFF01070180010313C04990C76C7FD91FFC6E6C7E49486F7E49486F7E 01FF8348496F7E48496F1380A248496F13C0A24890C96C13E0A24819F04982003F19F8A3 007F19FC49177FA400FF19FEAD007F19FC6D17FFA3003F19F8A26D5E6C19F0A26E5D6C19 E0A26C6D4B13C06C19806E5D6C6D4B13006C6D4B5A6D6C4B5A6D6C4B5A6D6C4A5B6D01C0 01075B6D01F0011F5B010101FE90B5C7FC6D90B65A023F15F8020715C002004AC8FC0307 13C047467AC454>II82 DI<003FBA12E0A59026FE000FEB8003D87FE09338003FF049171F90C7 1607A2007E1803007C1801A300781800A400F819F8481978A5C81700B3B3A20107B8FCA5 45437CC24E>II87 D<001FB812FEA59126F8000113FC028015 F801FCC75A494A13F04916E0495C494A13C0484816805E90C84813005F003E15FF4B5B5F 003C5C4B5B5F5D4B5BC85C4B90C7FC5D5E4B5A5C5E4A5B5C5E4A5B5C5E4A90C8FC5C5D4A 48140F5B5D495B5B4949141F5D49161E495B92C8FC49163E495A5C48177E485B4A15FE48 1601484914034A140748160F4849143F91C8EAFFFC48150FB9FCA538447AC344>90 D<903801FFE0011F13FE017F6D7E48B612E03A03FE007FF84848EB1FFC6D6D7E486C6D7E A26F7FA36F7F6C5A6C5AEA00F090C7FCA40203B5FC91B6FC1307013F13F19038FFFC0100 0313E0000F1380381FFE00485A5B127F5B12FF5BA35DA26D5B6C6C5B4B13F0D83FFE013E EBFFC03A1FFF80FC7F0007EBFFF86CECE01FC66CEB8007D90FFCC9FC322F7DAD36>97 D99 DIIIII<137C48B4FC4813804813C0A24813E0A56C13C0A26C 13806C1300EA007C90C7FCAAEB7FC0EA7FFFA512037EB3AFB6FCA518467CC520>I108 D<90277F8007FEEC0FFCB59026 3FFFC090387FFF8092B5D8F001B512E002816E4880913D87F01FFC0FE03FF8913D8FC00F FE1F801FFC0003D99F009026FF3E007F6C019E6D013C130F02BC5D02F86D496D7EA24A5D 4A5DA34A5DB3A7B60081B60003B512FEA5572D7CAC5E>I<90397F8007FEB590383FFF80 92B512E0028114F8913987F03FFC91388F801F000390399F000FFE6C139E14BC02F86D7E 5CA25CA35CB3A7B60083B512FEA5372D7CAC3E>II<90397FC00FF8B590B57E02C314E002CF14F89139DFC03FFC9139 FF001FFE000301FCEB07FF6C496D13804A15C04A6D13E05C7013F0A2EF7FF8A4EF3FFCAC EF7FF8A318F017FFA24C13E06E15C06E5B6E4913806E4913006E495A9139DFC07FFC02CF B512F002C314C002C091C7FCED1FF092C9FCADB67EA536407DAC3E>II<90387F807FB53881FFE0028313F0 028F13F8ED8FFC91389F1FFE000313BE6C13BC14F8A214F0ED0FFC9138E007F8ED01E092 C7FCA35CB3A5B612E0A5272D7DAC2E>I<90391FFC038090B51287000314FF120F381FF0 03383FC00049133F48C7121F127E00FE140FA215077EA27F01E090C7FC13FE387FFFF014 FF6C14C015F06C14FC6C800003806C15806C7E010F14C0EB003F020313E0140000F0143F A26C141F150FA27EA26C15C06C141FA26DEB3F8001E0EB7F009038F803FE90B55A00FC5C D8F03F13E026E007FEC7FC232F7CAD2C>III120 DI127 D E %EndDVIPSBitmapFont end %%EndProlog %%BeginSetup %%Feature: *Resolution 600dpi TeXDict begin %%PaperSize: A4 %%EndSetup %%Page: 1 1 1 0 bop -5 506 a Fw(WEAK)47 b(DISORDER)h(LOCALIZA)-9 b(TION)48 b(AND)f(LIFSHITZ)j(T)-9 b(AILS:)48 b(CONTINUOUS)1556 623 y(HAMIL)-9 b(TONIANS)1621 872 y Fv(FR)1743 851 y(\023)1736 872 y(ED)1863 851 y(\023)1856 872 y(ERIC)36 b(KLOPP)181 1113 y Fu(Abstra)n(ct.)41 b Fv(This)e(pap)r(er)f(is)h(dev)n(oted)f(to)h (the)g(study)g(of)g(band)g(edge)f(lo)r(calization)g(for)g(con)n(tin)n (uous)g(random)181 1212 y(Sc)n(hr\177)-42 b(odinger)24 b(op)r(erators)g(with)i(w)n(eak)f(random)g(p)r(erturbations.)35 b(W)-7 b(e)27 b(pro)n(v)n(e)d(that,)i(in)g(the)h(w)n(eak)d(disorder)h (regime,)181 1312 y Ft(\025)34 b Fv(small,)i(the)e(sp)r(ectrum)g(in)g (in)n(terv)-5 b(als)34 b(of)f(size)h Ft(\025)h Fv(at)e(a)h (non-degenerate)e(simple)i(band)g(edge)g(is)g(exp)r(onen)n(tially)181 1412 y(and)29 b(dynamically)f(lo)r(calized.)42 b(Upp)r(er)29 b(b)r(ounds)g(on)g(the)h(lo)r(calization)e(length)h(in)h(these)f (energy)f(regions)g(are)g(also)181 1511 y(obtained.)42 b(Our)29 b(results)f(rely)h(on)g(the)h(analysis)e(of)i(Lifshitz)f (tails)h(when)f(the)h(disorder)e(is)h(small;)h(the)g(single)f(site)181 1611 y(p)r(oten)n(tial)e(need)h(not)g(b)r(e)g(of)f(\014xed)h(sign.)181 1829 y Fu(R)247 1822 y(\023)247 1829 y(esum)444 1822 y(\023)444 1829 y(e.)34 b Fv(Ce)19 b(tra)n(v)-5 b(ail)18 b(est)i(consacr)n(\023)-39 b(e)16 b(\022)-42 b(a)19 b(l')n(\023)-39 b(etude)18 b(des)f(\023)-39 b(etats)18 b(lo)r(calis)n(\023)-39 b(es)17 b(en)i(b)r(ords)g(de)g(sp)r(ectre)g(p)r(our)g(des)g(op)n(\023) -39 b(erateurs)16 b(de)181 1928 y(Sc)n(hr\177)-42 b(odinger)19 b(al)n(\023)-39 b(eatoires)18 b(\022)-42 b(a)21 b(faible)g(d)n(\023)-39 b(esordre,)20 b Ft(\025)h Fv(p)r(etit.)36 b(Nous)21 b(prouv)n(ons)e (que,)k(dans)d(un)i(v)n(oisinage)d(de)i(taille)g Ft(\025)h Fv(d'un)181 2028 y(b)r(ord)i(simple)h(et)g(non-d)n(\023)-39 b(eg)n(\023)g(en)n(\023)g(er)n(\023)g(e)20 b(du)25 b(sp)r(ectre,)g(les) d(\023)-39 b(etats)24 b(son)n(t)g(lo)r(calis)n(\023)-39 b(es)23 b(exp)r(onen)n(tiellemen)n(t)i(et)g(dynamiquemen)n(t.)181 2128 y(Nous)35 b(obtenons)g(aussi)g(une)h(ma)5 b(joration)34 b(de)i(la)g(longueur)e(de)i(lo)r(calisation.)60 b(Notre)35 b(analyse)g(rep)r(ose)g(sur)g(une)178 2227 y(\023)-39 b(etude)33 b(des)g(asymptotiques)f(de)g(Lifshitz)i(quand)e(le)h(d)n (\023)-39 b(esordre)30 b(est)j(p)r(etit;)j(le)d(p)r(oten)n(tiel)g(de)g (simple)g(site)g(n'a)g(pas)181 2327 y(n)n(\023)-39 b(ecessairemen)n(t) 25 b(un)j(signe)f(constan)n(t.)1604 2763 y Fs(0.)55 b Fr(Intr)n(oduction)-118 2937 y Fs(Consider)33 b(the)g(follo)m(wing)d (con)m(tin)m(uous)j(Anderson)h(mo)s(del)1166 3124 y Fq(H)1247 3139 y Fp(!)r(;\025)1385 3124 y Fs(=)28 b Fo(\000)p Fs(\001)23 b(+)f Fq(\025V)1882 3139 y Fp(!)1960 3124 y Fs(=)27 b Fo(\000)p Fs(\001)c(+)f Fq(\025)2428 3029 y Fn(X)2416 3249 y Fp(\015)t Fm(2)p Fl(Z)2553 3230 y Fk(d)2600 3124 y Fq(!)2661 3139 y Fp(\015)2705 3124 y Fq(V)2762 3139 y Fp(\015)2806 3124 y Fq(;)-118 3403 y Fs(where)-18 3547 y(1.)41 b Fq(V)156 3562 y Fp(\015)200 3547 y Fs(\()p Fo(\001)p Fs(\))48 b(=)g Fq(V)21 b Fs(\()p Fo(\001)30 b(\000)h Fq(\015)5 b Fs(\))44 b(where)i Fq(V)69 b Fs(:)93 b Fj(R)1502 3511 y Fp(d)1596 3547 y Fo(!)48 b Fj(R)55 b Fs(is)44 b(a)g(b)s(ounded,)49 b(measurable)44 b(and)g(compactly)g (supp)s(orted)99 3663 y(function.)-18 3779 y(2.)d(the)33 b(a)m(v)m(erage)g(of)g Fq(V)54 b Fs(do)s(es)33 b(not)f(v)-5 b(anish)32 b(i.e.)p 1548 3917 79 4 v 1548 3997 a Fq(V)49 b Fs(:=)1785 3861 y Fn(Z)1840 4087 y Fl(R)1888 4068 y Fk(d)1945 3997 y Fq(V)21 b Fs(\()p Fq(x)p Fs(\))p Fq(dx)29 b Fo(6)p Fs(=)e(0)p Fq(:)-2586 b Fs(\(0.1\))-18 4224 y(3.)41 b(the)33 b(random)f(v)-5 b(ariables)31 b(\()p Fq(!)1128 4239 y Fp(\015)1172 4224 y Fs(\))1210 4243 y Fp(\015)t Fm(2)p Fl(Z)1348 4224 y Fk(d)j Fs(are)f(i.i.d.,)e(b)s (ounded,)j(non-trivial)29 b(and)k(ha)m(v)m(e)h(a)e(b)s(ounded)h(densit) m(y)-8 b(.)-18 4340 y(4.)41 b Fq(\025)32 b Fs(is)g(a)h(p)s(ositiv)m(e)f (coupling)f(constan)m(t.)-118 4484 y(It)36 b(is)f(w)m(ell)g(kno)m(wn)i (that)f(the)g(sp)s(ectrum)g(of)g Fq(H)1616 4499 y Fp(!)r(;\025)1762 4484 y Fs(is)g(almost)e(surely)i(non)g(random)f(\([27]\).)53 b(Denote)36 b(it)e(b)m(y)j(\006)3979 4499 y Fp(\025)4058 4484 y Fs(=)-118 4600 y Fq(\033)t Fs(\()p Fq(H)60 4615 y Fp(!)r(;\025)171 4600 y Fs(\).)43 b(Let)33 b Fq(E)526 4615 y Fm(\000)585 4600 y Fs(\()p Fq(\025)p Fs(\))28 b(=)f(inf)c(\006)1054 4615 y Fp(\025)1100 4600 y Fs(.)43 b(Consider)33 b(the)g(p)s(erio)s(dic)e(Sc)m(hr\177)-49 b(odinger)33 b(op)s(erator)p 1556 4715 89 4 v 1556 4795 a Fq(H)1645 4810 y Fp(\025)1718 4795 y Fs(=)27 b Fo(\000)p Fs(\001)c(+)f Fq(\025)2186 4700 y Fn(X)2174 4920 y Fp(\015)t Fm(2)p Fl(Z)2311 4901 y Fk(d)2358 4795 y Fq(V)2415 4810 y Fp(\015)-118 5093 y Fs(and)46 b(let)p 240 5013 79 4 v 46 w Fq(E)6 b Fs(\()p Fq(\025)p Fs(\))47 b(b)s(e)f(the)h(in\014m)m (um)e(of)h(the)h(sp)s(ectrum)g(of)f(the)h(p)s(erio)s(dic)e(Sc)m(hr\177) -49 b(odinger)46 b(op)s(erator)p 3618 5013 89 4 v 46 w Fq(H)3707 5108 y Fp(\025)3752 5093 y Fs(.)85 b(De\014ne)p -118 5155 65 4 v -118 5209 a Fq(!)31 b Fs(=)c Fj(E)13 b Fs(\()p Fq(!)237 5224 y Fi(0)282 5209 y Fs(\).)43 b(Assumption)30 b(\(0.1\))g(ensures)i(that,)f(for)f(some)g Fq(C)35 b(>)27 b Fs(0)k(and)f Fq(\025)h Fs(su\016cien)m(tly)g(small)d(\(see)k(section) e(5.1\),)p -118 5298 499 4 v -18 5392 a Fv(1991)d Fh(Mathematics)32 b(Subje)l(ct)d(Classi\014c)l(ation.)43 b Fv(82B44,)26 b(47B80,)g(60H25.)-18 5491 y Fh(Key)k(wor)l(ds)g(and)g(phr)l(ases.)43 b Fv(Random)28 b(op)r(erators,)d(lo)r(calization,)i(w)n(eak)f (disorder,)h(Lifshitz)h(tails.)-18 5591 y(The)f(author)g(gratefully)g (ac)n(knoledges)e(supp)r(ort)j(of)f(the)h(FNS)g(2000)e(\\Programme)f (Jeunes)i(Cherc)n(heurs".)1989 5690 y Fg(1)p eop %%Page: 2 2 2 1 bop -118 241 a Fs(one)33 b(has)p 1509 329 79 4 v 1509 409 a Fq(E)6 b Fs(\()p Fq(\025)p 1682 354 65 4 v(!)s Fs(\))22 b Fo(\000)h Fq(E)1978 424 y Fm(\000)2037 409 y Fs(\()p Fq(\025)p Fs(\))k Fo(\025)i Fq(\025=C)r(:)-2626 b Fs(\(0.2\))-118 596 y(Note)33 b(that)p 329 516 79 4 v 32 w Fq(E)6 b Fs(\()p Fq(\025)p 502 542 65 4 v(!)s Fs(\))33 b(is)f(the)h(in\014m)m(um)e(of)h(the)h(sp)s(ectrum)g(of)f Fj(E)12 b Fs(\()p Fq(H)2280 611 y Fp(!)r(;\025)2397 596 y Fs(\))28 b(=)p 2566 516 89 4 v 27 w Fq(H)2655 611 y Fp(\025)p 2696 574 47 3 v(!)2747 596 y Fs(.)-118 713 y(W)-8 b(e)33 b(pro)m(v)m(e)-118 893 y Fw(Theorem)k(0.1.)49 b Ff(Fix)27 b Fq(\021)k Fo(2)d Fs(\(0)p Fq(;)17 b(d=)p Fs(\(4)p Fq(d)5 b Fs(+)g(4\)\))p Ff(.)40 b(Ther)-5 b(e)26 b(exists)h Fq(\025)2157 908 y Fp(\021)2227 893 y Fq(>)g Fs(0)g Ff(such)g(that,)i(for)e Fq(\025)g Fo(2)i Fs(\(0)p Fq(;)17 b(\025)3358 908 y Fp(\021)3399 893 y Fs(\))p Ff(,)28 b(with)f(pr)-5 b(ob)g(ability)-118 1010 y(1,)34 b(one)h(has)-18 1152 y Fs(1.)41 b Ff(exp)-5 b(onential)33 b(lo)-5 b(c)g(alization)34 b(in)h Fq(I)1278 1167 y Fp(\021)r(;\025)1408 1152 y Fs(:=)28 b([)p Fq(E)1638 1167 y Fm(\000)1697 1152 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)p 1874 1072 79 4 v 17 w(E)6 b Fs(\()p Fq(\025)p 2047 1097 65 4 v(!)s Fs(\))22 b Fo(\000)g Fq(\025)2327 1116 y Fi(1+)p Fp(\021)2459 1152 y Fs(])35 b Ff(i.e.)175 1268 y Fo(\017)41 b Fq(\033)t Fs(\()p Fq(H)444 1283 y Fp(!)r(;\025)555 1268 y Fs(\))22 b Fo(\\)h Fq(I)747 1283 y Fp(\021)r(;\025)877 1268 y Fs(=)28 b Fq(\033)1036 1283 y Fe(pp)1113 1268 y Fs(\()p Fq(H)1232 1283 y Fp(!)r(;\025)1343 1268 y Fs(\))22 b Fo(\\)h Fq(I)1535 1283 y Fp(\021)r(;\025)1637 1268 y Ff(;)175 1384 y Fo(\017)41 b Fq(\033)321 1399 y Fe(ac)395 1384 y Fs(\()p Fq(H)514 1399 y Fp(!)r(;\025)625 1384 y Fs(\))22 b Fo(\\)g Fq(I)816 1399 y Fp(\021)r(;\025)947 1384 y Fs(=)27 b Fq(\033)1105 1399 y Fe(sc)1172 1384 y Fs(\()p Fq(H)1291 1399 y Fp(!)r(;\025)1402 1384 y Fs(\))22 b Fo(\\)h Fq(I)1594 1399 y Fp(\021)r(;\025)1724 1384 y Fs(=)28 b Fo(;)p Ff(;)175 1501 y Fo(\017)41 b Ff(ther)-5 b(e)41 b(exists)f Fq(a)e(>)g Fs(0)i Ff(such)g(that,)i(an)e (eigenfunction)g Fq( )k Ff(c)-5 b(orr)g(esp)g(onding)39 b(to)h(an)g(eigenvalue)g Fq(E)k Fo(2)38 b Fq(I)4031 1516 y Fp(\021)r(;\025)266 1617 y Ff(satis\014es)1197 1839 y Fs(lim)17 b(inf)1195 1905 y Fm(j)p Fp(x)p Fm(j!)p Fi(+)p Fm(1)1486 1839 y Fo(\000)1573 1771 y Fs(log)g Fo(j)p Fq( )t Fs(\()p Fq(x)p Fs(\))p Fo(j)p 1573 1816 397 4 v 1716 1907 a(j)p Fq(x)p Fo(j)2008 1839 y(\025)28 b Fq(a)2164 1712 y Fn(q)p 2264 1712 531 4 v 127 x Fo(j)p Fq(E)f Fo(\000)p 2491 1759 79 4 v 23 w Fq(E)6 b Fs(\()p Fq(\025)p 2664 1784 65 4 v(!)s Fs(\))p Fo(j)p Fq(:)-2939 b Fs(\(0.3\))-18 2067 y(2.)41 b Ff(str)-5 b(ong)29 b(Hilb)-5 b(ert-Schmidt)30 b(dynamic)-5 b(al)28 b(lo)-5 b(c)g(alization)29 b(in)g Fq(I)2191 2082 y Fp(\021)r(;\025)2324 2067 y Ff(i.e.)42 b(if)30 b Fs(\005)2664 2082 y Fp(\021)2706 2067 y Fs(\()p Fq(H)2825 2082 y Fp(!)r(;\025)2936 2067 y Fs(\))g Ff(denotes)f(the)g (sp)-5 b(e)g(ctr)g(al)30 b(pr)-5 b(oje)g(c-)99 2185 y(tor)33 b(of)f Fq(H)448 2200 y Fp(!)r(;\025)591 2185 y Ff(on)g(the)h(interval)f Fq(I)1286 2200 y Fp(\021)r(;\025)1421 2185 y Ff(and)g Fq(X)40 b Ff(denotes)32 b(the)h(p)-5 b(osition)31 b(op)-5 b(er)g(ator,)33 b(then,)g(for)f Fq(B)h Fo(\032)28 b Fj(R)3689 2149 y Fp(d)3768 2185 y Ff(b)-5 b(ounde)g(d,)99 2302 y(one)34 b(has)751 2536 y Fo(8)p Fq(q)e Fo(\025)c Fs(0)p Fq(;)116 b Fj(E)1255 2366 y Fn( )1400 2536 y Fs(sup)1340 2622 y Fm(k)p Fp(f)7 b Fm(k)1451 2630 y Fd(1)1516 2622 y Fm(\024)p Fi(1)1623 2452 y Fn(\015)1623 2511 y(\015)1679 2536 y Fo(j)p Fq(X)h Fo(j)1824 2495 y Fp(q)r(=)p Fi(2)1931 2536 y Fq(f)j Fs(\()p Fq(H)2109 2551 y Fp(!)r(;\025)2220 2536 y Fs(\)\005)2331 2551 y Fp(\021)2373 2536 y Fs(\()p Fq(H)2492 2551 y Fp(!)r(;\025)2603 2536 y Fs(\))p Fw(1)2697 2551 y Fp(B)2758 2452 y Fn(\015)2758 2511 y(\015)2813 2472 y Fi(2)2813 2575 y(2)2852 2366 y Fn(!)2959 2536 y Fq(<)27 b Fs(+)p Fo(1)p Fq(:)-3383 b Fs(\(0.4\))-118 2790 y Ff(Her)-5 b(e,)37 b Fq(\033)202 2805 y Fe(pp)q Fp(;)p Fe(ac)p Fp(;)p Fe(sc)486 2790 y Ff(denote)e(r)-5 b(esp)g(e)g(ctively)36 b(the)g(pur)-5 b(e)37 b(p)-5 b(oint,)36 b(absolutely)g(c)-5 b(ontinuous)36 b(and)g(singular)g(c)-5 b(ontinuous)36 b(p)-5 b(art)-118 2907 y(of)27 b(the)g(sp)-5 b(e)g(ctrum.)42 b(The)26 b(function)h Fw(1)1213 2922 y Fp(B)1301 2907 y Ff(is)g(the)g(char)-5 b(acteristic)27 b(function)f(of)h Fq(B)5 b Ff(;)30 b Fo(k)5 b(\001)g(k)2909 2922 y Fi(2)2975 2907 y Ff(denotes)26 b(the)h(Hilb)-5 b(ert-Schmidt)-118 3023 y(norm.)44 b(In)e Fs(\(0.4\))o Ff(,)35 b(the)g(supr)-5 b(emum)34 b(is)h(taken)f(over)h(b)-5 b(ounde)g(d,)34 b(Bor)-5 b(el)34 b(me)-5 b(asur)g(able)34 b(functions)g(on)h Fj(R)5 b Ff(.)-118 3204 y Fs(Theorem)31 b(0.1)f(is)f(a)h(consequence)k(of)c(the)h(b)s(eha)m(vior)f(of)g(the)g (in)m(tegrated)h(densit)m(y)g(of)f(states)h(near)g(the)f(in\014m)m(um)f (of)-118 3320 y(the)h(sp)s(ectrum.)42 b(More)30 b(precisely)-8 b(,)30 b(let)f(\003)1379 3335 y Fp(L)1460 3320 y Fs(b)s(e)h(the)f(cub)s (e)h(of)f(cen)m(ter)i(0)e(and)g(side)h(length)e Fq(L)i Fs(in)f Fj(R)3400 3284 y Fp(d)3446 3320 y Fs(,)h(and)f(let)g Fq(H)3908 3335 y Fp(!)r(;\025)p Fm(j)p Fi(\003)4084 3346 y Fk(L)-118 3436 y Fs(b)s(e)36 b(the)h(Hamiltonian)32 b Fq(H)835 3451 y Fp(!)r(;\025)982 3436 y Fs(restricted)37 b(to)e(the)i(cub)s(e)g(\003)2016 3451 y Fp(L)2104 3436 y Fs(with)e(Diric)m(hlet)f(b)s(oundary)j(conditions.)53 b(De\014ne)36 b(the)-118 3552 y(in)m(tegrated)c(densit)m(y)i(of)e (states)h(of)f Fq(H)1262 3567 y Fp(!)r(;\025)1406 3552 y Fs(b)m(y)984 3786 y Fo(N)1066 3801 y Fp(\025)1111 3786 y Fs(\()p Fq(E)6 b Fs(\))28 b(=)111 b(lim)1396 3849 y Fi(#\003)p Fm(!)p Fi(+)p Fm(1)1727 3715 y Fs(#)p Fo(f)p Fs(eigen)m(v)-5 b(alues)32 b(of)g Fq(H)2554 3731 y Fp(!)r(;\025)p Fm(j)p Fi(\003)2762 3715 y Fo(\024)c Fq(E)6 b Fo(g)p 1727 3763 1268 4 v 2299 3855 a(j)p Fs(\003)p Fo(j)3005 3786 y Fq(:)-3150 b Fs(\(0.5\))-118 4015 y(The)33 b(limit)c(in)j (\(0.5\))g(exists)i Fq(!)t Fs(-a.e.;)d(it)h(is)g(non-random)f(and)i (non-decreasing)g(\([3,)f(27]\).)43 b(W)-8 b(e)33 b(pro)m(v)m(e)-118 4195 y Fw(Theorem)k(0.2.)49 b Ff(Fix)26 b Fq(\021)31 b Fo(2)d Fs(\(0)p Fq(;)17 b(d=)p Fs(\(4)p Fq(d)t Fs(+)t(4\)\))p Ff(.)40 b(Then,)27 b(ther)-5 b(e)27 b(exists)f Fq(")h(>)h Fs(0)e Ff(and)g Fq(\025)2826 4210 y Fp(\021)2896 4195 y Fq(>)h Fs(0)g Ff(such)f(that,)j(for)d Fq(\025)i Fo(2)g Fs(\(0)p Fq(;)17 b(\025)4025 4210 y Fp(\021)4066 4195 y Fs(\))p Ff(,)-118 4312 y(one)34 b(has)1420 4480 y Fo(N)1502 4495 y Fp(\025)1547 4480 y Fs(\()p 1585 4400 79 4 v Fq(E)6 b Fs(\()p Fq(\025)p 1758 4425 65 4 v(!)s Fs(\))22 b Fo(\000)h Fq(\025)2039 4439 y Fi(1+)p Fp(\021)2171 4480 y Fs(\))28 b Fo(\024)g Fq(e)2387 4439 y Fm(\000)p Fp(\025)2483 4415 y Fd(\000)p Fk(")2569 4480 y Fq(:)-2714 b Fs(\(0.6\))-118 4661 y(So,)38 b(the)g(densit)m(y)h(of)e(states)h(in)e(the)i(in)m(terv) -5 b(al)36 b Fq(I)1654 4676 y Fp(\021)r(;\025)1794 4661 y Fs(is)h(small.)56 b(This)38 b(in)m(terv)-5 b(al)36 b(is)h(in)f(the)i(\015uctuational)e(region)g(of)-118 4777 y(the)f(sp)s(ectrum)g(\(see)g([26]\).)49 b(That)34 b(in)g(\015uctuation)g(regions,)h(the)f(sp)s(ectrum)h(is)f(scarce)i (and)e(th)m(us)i(the)e(states)i(are)-118 4893 y(lo)s(calized)27 b(is)i(a)h(basic)f(mec)m(hanism)g(for)g(lo)s(calization)d(and)j(has)h (b)s(een)h(kno)m(wn)f(for)g(a)f(long)f(time)g(\(see)j(e.g.)f([25,)f (26]\).)-118 5010 y(It)h(also)f(is)g(the)h(only)g(mec)m(hanism)f(that)g (has)h(b)s(een)h(understo)s(o)s(d)f(mathematically)d(in)i(dimensions)f (larger)h(than)h(1;)-118 5126 y(this)i(mec)m(hanism)g(is)g(also)g (basic)g(in)g(the)h(study)h(of)e(large)f(disorder)i(lo)s(calization.)94 5242 y(The)g(asymptotics)e(\(0.6\))h(is)f(directly)g(related)g(to)g (the)h(celebrated)h(\\Lifshitz)d(tail")f(b)s(eha)m(vior)i(\(see)i(e.g.) f([18])-118 5358 y(for)h(a)h(recen)m(t)i(review\).)48 b(The)35 b(main)d(di\013erence)j(with)f(Lifshitz)f(tails)f(is)i(that)f (Lifshitz)g(tails)g(are)h(asymptotics)g(in)-118 5475 y(the)f(limit)28 b(when)34 b(one)e(approac)m(hes)i(the)e(band)h(edge,)g (and)f(\(0.6\))g(holds)g(on)g(an)g(in)m(terv)-5 b(al.)43 b(This)32 b(is)g(a)g(consequence)-118 5591 y(of)g(the)h(w)m(eak)h (disorder)e(limit.)1989 5690 y Fg(2)p eop %%Page: 3 3 3 2 bop 94 241 a Fs(T)-8 b(ec)m(hnically)42 b(sp)s(eaking)f(the)h (passage)h(from)d(Theorem)i(0.2)f(to)h(Theorem)g(0.1)f(mak)m(es)h(use)h (of)e(m)m(ultiscale)-118 357 y(analysis)24 b(and)h(W)-8 b(egner)25 b(estimates)g(\(see)g([30,)g(8,)f(11]\).)41 b(These)26 b(are)f(w)m(ell)f(kno)m(wn)i(to)s(ols)e(in)g(the)h(pro)s(of) f(of)g(lo)s(calization)-118 473 y(for)32 b(random)g(Sc)m(hr\177)-49 b(odinger)32 b(op)s(erators.)44 b(In)33 b(section)f(3,)h(w)m(e)g (explain)f(ho)m(w)h(w)m(e)h(use)f(these)h(to)s(ols.)94 589 y(As)i(the)e(main)f(result)i(of)f(this)g(pap)s(er,)h(w)m(e)g(sho)m (w)h(that)e(the)h(b)s(eha)m(vior)f(\(0.6\),)h(found)f(at)g(the)h(b)s (ottom)e(of)h(the)-118 706 y(sp)s(ectrum)g(also)g(happ)s(ens)h(at)f (simple)f(non-degenerate)i(sp)s(ectral)f(edges.)49 b(Hence,)36 b(at)e(suc)m(h)i(sp)s(ectral)e(edges,)i(one)-118 822 y(also)c(has)g(lo)s(calization.)40 b(This)33 b(is)f(the)h(con)m(ten)m (t)h(of)e(Theorems)h(1.1)f(and)h(1.3.)94 938 y(T)-8 b(o)40 b(complete)g(this)f(section,)j(let)e(us)g(note)g(that)g(results)h (similar)36 b(to)k(Theorems)h(0.1)e(and)h(0.2)g(ha)m(v)m(e)h(b)s(een) -118 1054 y(obtained)32 b(for)g(discrete)h(random)f(op)s(erators)g(in)g ([22].)1640 1420 y(1.)55 b Fr(The)38 b(resul)-7 b(ts)-118 1594 y Fs(Let)44 b Fq(W)58 b Fs(b)s(e)45 b(a)e(b)s(ounded)i Fj(Z)934 1558 y Fp(d)972 1594 y Fs(-p)s(erio)s(dic)d(p)s(oten)m(tial)h (and)h(consider)h(the)f(p)s(erio)s(dic)f(Sc)m(hr\177)-49 b(odinger)44 b(op)s(erator)g Fq(H)55 b Fs(=)-118 1710 y Fo(\000)p Fs(\001)23 b(+)f Fq(W)46 b Fs(acting)32 b(on)g Fq(L)793 1674 y Fi(2)833 1710 y Fs(\()p Fj(R)937 1674 y Fp(d)983 1710 y Fs(\).)44 b(It)32 b(is)g(self-adjoin)m(t)f(on)i Fq(H)2022 1674 y Fi(2)2061 1710 y Fs(\()p Fj(R)2165 1674 y Fp(d)2211 1710 y Fs(\);)g(let)e(\006)2519 1725 y Fi(0)2592 1710 y Fs(b)s(e)i(its)f(sp)s(ectrum.)-118 1827 y(Consider)h(the)g(con)m (tin)m(uous)g(Anderson)h(mo)s(del)d(i.e.)43 b(the)33 b(random)f(Sc)m(hr\177)-49 b(odinger)32 b(op)s(erator)g(de\014ned)i(b)m (y)1236 2058 y Fq(H)1317 2073 y Fp(!)r(;\025)1456 2058 y Fs(=)27 b Fq(H)j Fs(+)22 b Fq(\025V)1882 2073 y Fp(!)1960 2058 y Fs(=)27 b Fq(H)j Fs(+)22 b Fq(\025)2357 1964 y Fn(X)2346 2183 y Fp(\015)t Fm(2)p Fl(Z)2483 2164 y Fk(d)2530 2058 y Fq(!)2591 2073 y Fp(\015)2635 2058 y Fq(V)2692 2073 y Fp(\015)2736 2058 y Fq(;)-2881 b Fs(\(1.1\))-118 2396 y(where)48 b Fq(V)235 2411 y Fp(\015)279 2396 y Fs(\()p Fo(\001)p Fs(\))k(=)g Fq(V)22 b Fs(\()p Fo(\001)31 b(\000)i Fq(\015)5 b Fs(\),)50 b Fq(V)74 b Fs(:)99 b Fj(R)1343 2360 y Fp(d)1442 2396 y Fo(!)52 b Fj(R)57 b Fs(is)47 b(a)g(p)s(oten)m(tial)e(and)i(\()p Fq(!)2650 2411 y Fp(\015)2694 2396 y Fs(\))2732 2415 y Fp(\015)t Fm(2)p Fl(Z)2870 2396 y Fk(d)i Fs(are)e(indep)s(enden)m(t)h(iden)m (tically)-118 2512 y(distributed)32 b(random)g(v)-5 b(ariables.)42 b(W)-8 b(e)33 b(assume)g(that.)-1 2678 y Fw(H0.1:)42 b Fq(V)49 b Fs(:)60 b Fj(R)562 2642 y Fp(d)636 2678 y Fo(!)28 b Fj(R)43 b Fs(is)32 b(b)s(ounded)i(and)e(deca)m(ying)h(faster) g(than)g Fo(j)p Fq(x)p Fo(j)2563 2642 y Fm(\000)p Fp(d)p Fm(\000)p Fi(1)p Fm(\000)p Fp(\017)2864 2678 y Fs(for)f(some)g Fq(\017)c(>)g Fs(0;)-1 2794 y Fw(H0.2:)42 b Fs(The)33 b(random)f(v)-5 b(ariables)31 b(\()p Fq(!)1364 2809 y Fp(\015)1408 2794 y Fs(\))1446 2814 y Fp(\015)t Fm(2)p Fl(Z)1584 2795 y Fk(d)1651 2794 y Fs(are)h(i.i.d.,)g(b)s(ounded)h(and)g (non-trivial.)-118 2960 y(Notice)f(that)g(w)m(e)i(do)f(not)f(assume)h (that)f Fq(V)54 b Fs(k)m(eeps)35 b(a)d(\014xed)i(sign.)94 3076 y(Assumption)j(\(H0\))f(ensures)i(that)e(the)h(p)s(oten)m(tial)e Fq(V)2079 3091 y Fp(!)2166 3076 y Fs(sta)m(ys)i(uniformly)e(b)s (ounded.)55 b(Hence,)39 b Fq(H)3713 3091 y Fp(!)r(;\025)3861 3076 y Fs(is)d(self-)-118 3195 y(adjoin)m(t)42 b(on)h Fq(H)458 3159 y Fi(2)497 3195 y Fs(\()p Fj(R)601 3159 y Fp(d)648 3195 y Fs(\).)75 b(By)44 b(assumption)f(\(H0.2\),)j Fq(H)1907 3210 y Fp(!)r(;\025)2061 3195 y Fs(is)d(ergo)s(dic;)48 b(hence,)f(its)c(sp)s(ectrum)h(is)f(almost)e(surely)-118 3311 y(indep)s(enden)m(t)34 b(of)e Fq(!)t Fs(.)43 b(W)-8 b(e)33 b(denote)g(it)e(b)m(y)j(\006)1466 3326 y Fp(\025)1512 3311 y Fs(.)94 3427 y(Consider)42 b(\()p Fq(E)620 3442 y Fi(+)680 3427 y Fs(\(0\))p Fq(;)17 b(E)921 3442 y Fm(\000)979 3427 y Fs(\(0\)\))41 b(a)h(gap)f(in)g(the)h(sp)s(ectrum)g(of)f Fq(H)49 b Fs(\(if)40 b Fq(E)2660 3442 y Fm(\000)2719 3427 y Fs(\(0\))i(is)f(the)h(in\014m)m(um)e(of)h(\006)3751 3442 y Fi(0)3791 3427 y Fs(,)i(w)m(e)g(set)-118 3544 y Fq(E)-46 3559 y Fi(+)13 3544 y Fs(\(0\))31 b(=)g Fo(\0001)p Fs(\).)49 b(F)-8 b(or)34 b Fq(\025)g Fs(su\016cien)m(tly)i(small,)c (let)i Fq(E)1825 3559 y Fm(\000)1885 3544 y Fs(\()p Fq(\025)p Fs(\))g(\(resp.)50 b Fq(E)2412 3559 y Fi(+)2471 3544 y Fs(\()p Fq(\025)p Fs(\)\))35 b(b)s(e)f(the)h(in\014m)m(um)e(\(resp.) 51 b(suprem)m(um\))-118 3660 y(of)31 b(\006)62 3675 y Fp(\025)139 3660 y Fs(in)f([)p Fq(E)350 3675 y Fi(0)390 3660 y Fq(;)17 b Fs(+)p Fo(1)p Fs(\))30 b(\(resp.)44 b(\()p Fo(\0001)p Fq(;)17 b(E)1291 3675 y Fi(0)1330 3660 y Fs(]\))32 b(where)g Fq(E)1779 3675 y Fi(0)1846 3660 y Fs(=)c(\()p Fq(E)2060 3675 y Fm(\000)2119 3660 y Fs(\(0\))19 b(+)g Fq(E)2430 3675 y Fi(+)2490 3660 y Fs(\(0\)\))p Fq(=)p Fs(2)30 b(,see)i(Fig.)e(1.)43 b(So,)31 b(for)g Fq(\025)g Fs(su\016cien)m(tly)-118 3776 y(small,)f(one)j(has)166 3992 y Fq(E)238 4007 y Fi(+)297 3992 y Fs(\()p Fq(\025)p Fs(\))28 b Fq(<)f(E)633 4007 y Fm(\000)692 3992 y Fs(\()p Fq(\025)p Fs(\))33 b(and)f(\006)1117 4007 y Fp(\025)1185 3992 y Fo(\\)23 b Fs([)p Fq(E)1373 4007 y Fi(+)1432 3992 y Fs(\(0\))f Fo(\000)h Fq(\016)n(;)17 b(E)1836 4007 y Fm(\000)1895 3992 y Fs(\(0\))22 b(+)g Fq(\016)t Fs(])27 b Fo(\032)i Fs([)p Fq(E)2446 4007 y Fi(+)2505 3992 y Fs(\(0\))22 b Fo(\000)g Fq(\016)n(;)17 b(E)2908 4007 y Fi(+)2968 3992 y Fs(\()p Fq(\025)p Fs(\)])22 b Fo([)g Fs([)p Fq(E)3337 4007 y Fm(\000)3397 3992 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)17 b(E)3646 4007 y Fm(\000)3705 3992 y Fs(\(0\))k(+)h Fq(\016)t Fs(])p Fq(:)-118 4213 y Fs(W)-8 b(e)30 b(study)i(the)f(sp)s (ectrum)f(of)g Fq(H)1093 4228 y Fp(!)r(;\025)1234 4213 y Fs(near)g Fq(E)1520 4228 y Fm(\000)1580 4213 y Fs(\()p Fq(\025)p Fs(\))g(for)f Fq(\025)h Fs(su\016cien)m(tly)h(small.)41 b(An)30 b(analogous)f(study)i(can)g(b)s(e)f(done)-118 4329 y(near)j Fq(E)171 4344 y Fi(+)230 4329 y Fs(\()p Fq(\025)p Fs(\).)1063 5066 y @beginspecial @setspecial tx@Dict begin STP newpath 2.0 SLW 0. setgray /ArrowA { moveto } def /ArrowB { BeginArrow 1. 1. scale 0.15 2.0 5. Bracket EndArrow } def [ 56.90549 56.90549 0.0 56.90549 /Lineto /lineto load def false Line gsave 2.0 SLW 0. setgray 0 setlinecap stroke grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 1.0 SLW 0. setgray /ArrowA { moveto } def /ArrowB { } def [ 170.71646 56.90549 56.90549 56.90549 /Lineto /lineto load def false Line gsave 1.0 SLW 0. setgray 1.0 1.0 0 0 add DashLine grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 2.0 SLW 0. setgray /ArrowA { BeginArrow 1. 1. scale 0.15 2.0 5. Bracket EndArrow moveto } def /ArrowB { } def [ 227.62195 56.90549 170.71646 56.90549 /Lineto /lineto load def false Line gsave 2.0 SLW 0. setgray 0 setlinecap stroke grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 2.0 SLW 0. setgray /ArrowA { moveto } def /ArrowB { BeginArrow 1. 1. scale 0.15 2.0 5. Bracket EndArrow } def [ 85.35823 28.45274 0.0 28.45274 /Lineto /lineto load def false Line gsave 2.0 SLW 0. setgray 0 setlinecap stroke grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 1.0 SLW 0. setgray /ArrowA { moveto } def /ArrowB { } def [ 128.03734 28.45274 85.35823 28.45274 /Lineto /lineto load def false Line gsave 1.0 SLW 0. setgray 1.0 1.0 0 0 add DashLine grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 2.0 SLW 0. setgray /ArrowA { BeginArrow 1. 1. scale 0.15 2.0 5. Bracket EndArrow moveto } def /ArrowB { } def [ 227.62195 28.45274 128.03734 28.45274 /Lineto /lineto load def false Line gsave 2.0 SLW 0. setgray 0 setlinecap stroke grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0. setgray /ArrowA { moveto } def /ArrowB { } def [ 56.3363 19.91682 56.3363 65.44139 /Lineto /lineto load def false Line gsave 0.8 SLW 0. setgray 1.0 1.0 0 0 add DashLine grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0. setgray /ArrowA { moveto } def /ArrowB { } def [ 171.28563 19.91682 171.28563 65.44139 /Lineto /lineto load def false Line gsave 0.8 SLW 0. setgray 1.0 1.0 0 0 add DashLine grestore end @endspecial 2835 4475 a tx@Dict begin { 0.0 13.23608 8.2 1.79999 0. Uput UUput } PutCoor PutBegin end 2835 4475 a 2780 4502 a Fs(\006)2850 4517 y Fi(0)2835 4475 y tx@Dict begin PutEnd end 2835 4475 a 1299 4948 a tx@Dict begin { 0.0 13.94443 8.2 1.79999 0. Uput UUput } PutCoor PutBegin end 1299 4948 a 1241 4974 a Fs(\006)1311 4989 y Fp(\025)1299 4948 y tx@Dict begin PutEnd end 1299 4948 a 1535 4475 a tx@Dict begin { 0.0 30.82277 9.0 3.0 0. Uput UUput } PutCoor PutBegin end 1535 4475 a 1407 4500 a Fq(E)1479 4515 y Fi(+)1539 4500 y Fs(\(0\))1535 4475 y tx@Dict begin PutEnd end 1535 4475 a 2480 4475 a tx@Dict begin { 0.0 30.82277 9.0 3.0 0. Uput UUput } PutCoor PutBegin end 2480 4475 a 2352 4500 a Fq(E)2424 4515 y Fm(\000)2484 4500 y Fs(\(0\))2480 4475 y tx@Dict begin PutEnd end 2480 4475 a 1748 4948 a tx@Dict begin { 0.0 31.80193 9.0 3.0 0. Uput UUput } PutCoor PutBegin end 1748 4948 a 1616 4973 a Fq(E)1688 4988 y Fi(+)1747 4973 y Fs(\()p Fq(\025)p Fs(\))1748 4948 y tx@Dict begin PutEnd end 1748 4948 a 2126 4948 a tx@Dict begin { 0.0 31.80193 9.0 3.0 0. Uput UUput } PutCoor PutBegin end 2126 4948 a 1994 4973 a Fq(E)2066 4988 y Fm(\000)2125 4973 y Fs(\()p Fq(\025)p Fs(\))2126 4948 y tx@Dict begin PutEnd end 2126 4948 a 1122 5164 a Fr(Figure)k(1.)49 b Fs(The)33 b(band)g(edges)h(for)e(\006)h(and)g(\006)2854 5179 y Fp(p)94 5475 y Fs(T)-8 b(o)45 b(describ)s(e)h(our)f(main)e (assumption,)k(w)m(e)f(need)g(to)f(recall)e(some)i(facts)g(from)e(the)j (Flo)s(quet)e(theory)h(of)-118 5591 y(p)s(erio)s(dic)31 b(Sc)m(hr\177)-49 b(odinger)33 b(op)s(erators.)1989 5690 y Fg(3)p eop %%Page: 4 4 4 3 bop -118 241 a Fs(1.1.)56 b Fw(Flo)s(quet)47 b(theory)g(of)g(p)s (erio)s(dic)f(Sc)m(hr\177)-56 b(odinger)46 b(op)s(erators.)k Fs(The)42 b(Flo)s(quet)e(sp)s(ectrum)h(of)f Fq(H)49 b Fs(is)40 b(the)-118 357 y(sp)s(ectrum)32 b(of)f(the)h(di\013eren)m (tial)e(op)s(erator)h Fq(H)39 b Fs(acting)31 b(on)g Fq(L)2075 321 y Fp(d)2075 383 y Fi(lo)r(c)2168 357 y Fs(\()p Fj(R)2272 321 y Fp(d)2318 357 y Fs(\))h(with)f(quasi-p)s(erio)s(dic)f(b)s (oundary)i(conditions.)-118 473 y(F)-8 b(or)32 b Fq(\022)e Fo(2)f Fj(T)290 437 y Fm(\003)360 473 y Fs(=)f Fj(R)530 437 y Fp(d)576 473 y Fq(=)p Fj(Z)694 437 y Fp(d)732 473 y Fs(,)k(consider)h(the)g(follo)m(wing)d(eigen)m(v)-5 b(alue)32 b(problem)g(on)g Fq(L)2798 437 y Fp(d)2798 499 y Fi(lo)r(c)2891 473 y Fs(\()p Fj(R)2995 437 y Fp(d)3041 473 y Fs(\))1011 553 y Fn(\()1189 656 y Fq(H)8 b(')27 b Fs(=)h Fq(E)6 b(')1189 796 y(')p Fs(\()p Fq(x)22 b Fs(+)g Fq(\015)5 b Fs(\))28 b(=)g Fq(e)1737 760 y Fp(i)p Fi(2)p Fp(\031)r(\015)t(\022)1918 796 y Fq(')p Fs(\()p Fq(x)p Fs(\))p Fq(;)50 b Fo(8)p Fq(x)28 b Fo(2)g Fj(R)2488 760 y Fp(d)2535 796 y Fq(;)49 b Fo(8)p Fq(\015)33 b Fo(2)28 b Fj(Z)2913 760 y Fp(d)2951 796 y Fq(:)-118 723 y Fs(\(1.2\))-118 971 y(As)39 b Fq(H)47 b Fs(is)39 b(elliptic,)e(one)j(kno)m(ws)g(that)f (the)h(eigen)m(v)-5 b(alues)39 b(of)45 b(\(1.2\))39 b(are)g(discrete;)k (when)d(rep)s(eated)g(according)e(to)-118 1088 y(m)m(ultiplicit)m(y)-8 b(,)35 b(w)m(e)k(denote)g(them)f(b)m(y)g Fq(E)1366 1103 y Fi(0)1406 1088 y Fs(\()p Fq(\022)s Fs(\))f Fo(\024)g Fq(E)1753 1103 y Fi(1)1793 1088 y Fs(\()p Fq(\022)s Fs(\))f Fo(\024)h(\001)17 b(\001)g(\001)35 b(\024)j Fq(E)2407 1103 y Fp(n)2454 1088 y Fs(\()p Fq(\022)s Fs(\))e Fo(\024)i Fq(:)17 b(:)g(:)f Fs(.)59 b(They)39 b(are)f(called)f(the)h Ff(Flo)-5 b(quet)-118 1204 y(eigenvalues)30 b Fs(of)h Fq(H)8 b Fs(.)42 b(These)34 b(functions)d(are)g(Lipsc)m(hitz)h(con)m (tin)m(uous)g(in)e(the)i(v)-5 b(ariable)30 b Fq(\022)s Fs(;)i(when)g(of)f(m)m(ultiplicit)m(y)d(1,)-118 1320 y(the)35 b(Flo)s(quet)f(eigen)m(v)-5 b(alues)35 b(are)g(ev)m(en)i (analytic)d(in)g Fq(\022)s Fs(.)50 b(Moreo)m(v)m(er,)38 b(W)-8 b(eyl's)35 b(la)m(w)g(tells)f(us)h(that)g Fq(E)3502 1335 y Fp(n)3549 1320 y Fs(\()p Fq(\022)s Fs(\))d Fo(!)f Fs(+)p Fo(1)k Fs(as)-118 1436 y Fq(n)e Fo(!)g Fs(+)p Fo(1)j Fs(\(uniformly)d(in)i Fq(\022)s Fs(\).)54 b(In)36 b(regard)g(of)42 b(\(1.2\),)37 b(the)f(Flo)s(quet)f(eigen)m(v)-5 b(alues)36 b(are)g Fj(Z)3184 1400 y Fp(d)3222 1436 y Fs(-p)s(erio)s(dic)d(functions)j(of)-118 1553 y Fq(\022)s Fs(.)56 b(The)38 b(sp)s(ectrum)f(of)f Fq(H)44 b Fs(is)36 b(giv)m(en)h(b)m(y)h(\006)1459 1568 y Fi(0)1534 1553 y Fs(=)c Fo([)1710 1568 y Fp(n)p Fm(\025)p Fi(0)1848 1553 y Fq(E)1920 1568 y Fp(n)1967 1553 y Fs(\()p Fj(T)2068 1516 y Fm(\003)2111 1553 y Fs(\).)56 b(So)36 b(the)h(sp)s(ectrum)g(of)g Fq(H)44 b Fs(is)36 b(the)h(union)f(of)h(closed)-118 1669 y(in)m(terv)-5 b(als)29 b(called)g Ff(the)j(b)-5 b(ands)29 b Fs(of)h(the)g(sp)s(ectrum;)h(the)g(connected)g(comp)s(onen)m(ts)g(of) e Fj(R)f Fo(n)16 b Fs(\006)3178 1684 y Fi(0)3248 1669 y Fs(are)30 b(called)f Ff(the)j(gaps)d Fs(of)-118 1785 y(the)k(sp)s(ectrum)g(of)f Fq(H)8 b Fs(.)-118 1901 y(One)31 b(sa)m(ys)g(that)g(an)f(energy)h Fq(E)j Fo(2)28 b Fs(\006)1212 1916 y Fi(0)1282 1901 y Fs(is)i Ff(simple)g Fs(if)f(there)i(exists)g (exactly)g(one)g(index)f Fq(n)e Fo(\025)g Fs(1)j(suc)m(h)g(that,)g(for) f(some)-118 2017 y Fq(\022)39 b Fo(2)d Fj(T)131 1981 y Fm(\003)174 2017 y Fs(,)i(one)g(has)f Fq(E)673 2032 y Fp(n)720 2017 y Fs(\()p Fq(\022)s Fs(\))f(=)g Fq(E)6 b Fs(.)57 b(It)37 b(is)g(pro)m(v)m(ed)i(in)d([19])h(that,)i (generically)-8 b(,)37 b(the)g(band)h(edges)g(are)f(simple.)56 b(One)-118 2134 y(sa)m(ys)29 b(that)e Fq(E)6 b Fs(,)29 b(a)e(simple)f(band)i(edge,)h(is)e Ff(non-de)-5 b(gener)g(ate)26 b Fs(if)g(the)i(Flo)s(quet)f(eigen)m(v)-5 b(alue)27 b Fq(E)3177 2149 y Fp(n)3224 2134 y Fs(\()p Fo(\001)p Fs(\))g(reac)m (hing)g(this)h(band)-118 2250 y(edge)33 b(has)g(only)f(non-degenerate)i (quadratic)e(extrema)h(at)f(that)h(edge,)g(i.e.)44 b(if)31 b Fq(\022)36 b Fs(is)c(suc)m(h)i(that)f Fq(E)3504 2265 y Fp(n)3551 2250 y Fs(\()p Fq(\022)s Fs(\))28 b(=)f Fq(E)6 b Fs(,)33 b(then)-118 2366 y Fq(\022)j Fs(is)c(a)g(non-degenerate)h (quadratic)g(extrem)m(um)f(of)g Fq(E)1899 2381 y Fp(n)1947 2366 y Fs(.)-118 2482 y(One)d(can)h(de\014ne)g Fo(N)620 2497 y Fi(0)660 2482 y Fs(\()p Fq(E)6 b Fs(\),)29 b(the)h(in)m (tegrated)f(densit)m(y)h(of)f(states)h(of)f Fq(H)37 b Fs(in)28 b(the)i(same)f(w)m(a)m(y)h(as)g(for)e Fq(H)3489 2497 y Fp(!)3569 2482 y Fs(i.e.)42 b(b)m(y)30 b(means)-118 2599 y(of)39 b(\(0.5\))o(.)44 b(One)33 b(pro)m(v)m(es)h(that)1411 2808 y Fo(N)1493 2823 y Fi(0)1532 2808 y Fs(\()p Fq(E)6 b Fs(\))28 b(=)1817 2714 y Fn(X)1828 2924 y Fp(j)t Fm(\025)p Fi(1)1978 2673 y Fn(Z)2033 2898 y Fl(T)2083 2879 y Fd(\003)2134 2808 y Fw(1)2190 2824 y Fp(E)2242 2834 y Fk(j)2275 2824 y Fi(\()p Fp(\022)r Fi(\))p Fm(\024)p Fp(E)2479 2808 y Fq(d\022)s(:)-118 3065 y Fs(The)34 b(set)g(of)e(p)s(oin)m(ts)h(of)g (increase)g(of)g Fo(N)1316 3080 y Fi(0)1388 3065 y Fs(coincides)g(with) f(the)i(sp)s(ectrum.)45 b(The)34 b(non-degeneracy)h(of)d(band)i(edges) -118 3182 y(can)g(also)f(b)s(e)h(c)m(haracterized)h(in)e(terms)g(of)h (the)g(densit)m(y)h(of)e(states.)48 b(Namely)-8 b(,)33 b Fq(E)2876 3197 y Fi(0)2916 3182 y Fs(,)h(a)g(simple)e(band)i(edge)h (of)e Fq(H)41 b Fs(is)-118 3298 y(non-degenerate)33 b(if)f(and)g(only)g (if)g Fo(jN)1252 3313 y Fi(0)1291 3298 y Fs(\()p Fq(E)6 b Fs(\))22 b Fo(\000)g(N)1648 3313 y Fi(0)1688 3298 y Fs(\()p Fq(E)1798 3313 y Fi(0)1837 3298 y Fs(\))p Fo(j)27 b(\024)i Fq(C)7 b Fo(j)p Fq(E)27 b Fo(\000)c Fq(E)2412 3313 y Fi(0)2452 3298 y Fo(j)2480 3262 y Fp(d=)p Fi(2)2623 3298 y Fs(as)33 b Fq(E)g Fo(!)28 b Fq(E)3048 3313 y Fi(0)3087 3298 y Fs(,)33 b Fq(E)h Fo(2)28 b Fs(\006)3417 3313 y Fi(0)3489 3298 y Fs(\(see)34 b([20]\).)-118 3414 y(Details)d(on)h(the)h (material)d(presen)m(ted)35 b(here)e(ma)m(y)f(b)s(e)h(found)g(in)f([28) o(,)h(24,)f(29].)-118 3589 y(1.2.)56 b Fw(The)32 b(main)g(assumptions.) 49 b Fs(Let)29 b(us)f(no)m(w)h(state)g(our)f(main)f(assumptions.)42 b(On)28 b(the)h(underlying)e(p)s(erio)s(dic)-118 3705 y(Sc)m(hr\177)-49 b(odinger)33 b(op)s(erator,)f(w)m(e)h(assume)-1 3842 y Fw(H1:)42 b Fq(E)288 3857 y Fm(\000)347 3842 y Fs(\(0\))32 b(is)g(a)g(simple)f(non-degenerate)j(band)f(edge.)-118 3978 y(This)j(condition)e(is)h(kno)m(wn)i(to)e(hold)g(at)g(the)h(b)s (ottom)e(of)h(the)i(sp)s(ectrum)e(of)h Fq(H)43 b Fs(in)35 b(an)m(y)h(dimension,)f(see)i([1)o(,)f(28].)-118 4095 y(It)44 b(also)g(holds)g(at)g(an)m(y)h(band)g(edge)g(in)e(dimension)g (1,)48 b(see)d([31,)f(7].)79 b(As)45 b(assumption)f(\(H1\))g(is)g (stable)g(under)-118 4211 y(small)31 b(p)s(erturbations,)j(it)e(holds)i (for)f(su\016cien)m(tly)h(small)d(p)s(erturbations)i(of)h(p)s(erio)s (dic)d(op)s(erators)j(with)f(separate)-118 4327 y(v)-5 b(ariables.)42 b(F)-8 b(or)32 b(a)g(more)g(general)g(discussion)h(on)f (the)h(v)-5 b(alidit)m(y)31 b(of)h(assumption)g(\(H1\),)g(w)m(e)i (refer)f(to)f([4].)-118 4443 y(De\014ne)h(the)g(p)s(erio)s(dic)e(op)s (erator)p 1340 4537 89 4 v 1340 4617 a Fq(H)1429 4632 y Fp(\025)1502 4617 y Fs(=)c Fq(H)j Fs(+)22 b Fq(\025)1899 4522 y Fn(X)1888 4742 y Fp(\015)t Fm(2)p Fl(Z)2025 4723 y Fk(d)2072 4617 y Fq(V)2129 4632 y Fp(\015)2201 4617 y Fs(=)27 b Fq(H)j Fs(+)22 b Fq(\025)p 2570 4537 79 4 v(V)f(:)-2793 b Fs(\(1.3\))-118 4902 y(Let)p 56 4822 V 32 w Fq(E)6 b Fs(\()p Fq(\025)p Fs(\))32 b(b)s(e)g(the)g(sp)s(ectral) g(band)g(edge)h(of)p 1539 4822 89 4 v 31 w Fq(H)1628 4917 y Fp(\025)1705 4902 y Fs(closest)g(to)e Fq(E)6 b Fs(\(0\).)43 b(F)-8 b(or)31 b Fq(\025)h Fs(su\016cien)m(tly)h(small,)d (it)h(is)g(w)m(ell)g(de\014ned)-118 5018 y(\(see)j(section)e(5.1\).)43 b(W)-8 b(e)33 b(assume)g(that)-1 5155 y Fw(H2:)42 b Fs(there)33 b(exists)g Fq(C)i(>)27 b Fs(0)33 b(suc)m(h)h(that,)e(for)g Fq(\025)h Fs(su\016cien)m(tly)g(small)1177 5312 y Fo(j)p 1205 5232 79 4 v Fq(E)6 b Fs(\()p Fq(\025)p Fs(\))22 b Fo(\000)p 1537 5232 V 22 w Fq(E)6 b Fs(\(0\))p Fo(j)27 b Fs(=)h Fo(j)p 1927 5232 V Fq(E)6 b Fs(\()p Fq(\025)p Fs(\))22 b Fo(\000)g Fq(E)6 b Fs(\(0\))p Fo(j)27 b(\025)h Fq(C)7 b Fo(j)p Fq(\025)p Fo(j)p Fq(:)-2957 b Fs(\(1.4\))-118 5475 y(It)42 b(is)g(pro)m(v)m(ed)h(in)f(section)g(5.1)g(that,)i(for)e (a)g(giv)m(en)g(bac)m(kground)i(p)s(erio)s(dic)c(op)s(erator)i Fq(H)8 b Fs(,)44 b(assumption)d(\(H2\))h(is)-118 5591 y(satis\014ed)33 b(for)f(a)g(generic)h(single-site)e(p)s(erturbation)g Fq(V)22 b Fs(.)43 b(Moreo)m(v)m(er,)35 b(\(1.4\))d(implies)e(\(0.2\))o (.)1989 5690 y Fg(4)p eop %%Page: 5 5 5 4 bop -118 241 a Fs(1.3.)56 b Fw(The)37 b(results.)49 b Fs(W)-8 b(e)33 b(pro)m(v)m(e)-118 447 y Fw(Theorem)k(1.1.)49 b Ff(Assume)33 b(\(H0\),)h(\(H1\))f(and)g(\(H2\).)44 b(Fix)33 b Fq(\021)e Fo(2)d Fs(\(0)p Fq(;)17 b(d=)p Fs(\(4)p Fq(d)g Fs(+)i(4\)\))p Ff(.)44 b(Then,)32 b(ther)-5 b(e)34 b(exists)e Fq(")c(>)f Fs(0)33 b Ff(and)-118 563 y Fq(\025)-61 578 y Fp(\021)8 563 y Fq(>)28 b Fs(0)35 b Ff(such)f(that,)h(for)g Fq(\025)28 b Fo(2)g Fs(\(0)p Fq(;)17 b(\025)1169 578 y Fp(\021)1210 563 y Fs(\))p Ff(,)35 b(one)f(has)1126 793 y Fo(N)1208 808 y Fp(\025)1253 793 y Fs(\()p 1291 713 79 4 v Fq(E)6 b Fs(\()p Fq(\025)p 1464 738 65 4 v(!)s Fs(\))22 b Fo(\000)h Fq(\025)1745 752 y Fi(1+)p Fp(\021)1877 793 y Fs(\))f Fo(\000)g(N)2118 808 y Fp(\025)2163 793 y Fs(\()p Fq(E)2273 808 y Fm(\000)2333 793 y Fs(\()p Fq(\025)p Fs(\)\))27 b Fo(\024)h Fq(e)2681 752 y Fm(\000)p Fp(\025)2777 728 y Fd(\000)p Fk(")2863 793 y Fq(:)-118 1000 y Fs(This)33 b(result)f(has)h(strong)g(consequences)j(on)c(the)h (sp)s(ectral)g(b)s(eha)m(vior)f(of)g Fq(H)2698 1015 y Fp(!)2748 1000 y Fs(.)44 b(Indeed,)34 b(let)e(us)h(assume)g(that)-1 1164 y Fw(H3:)42 b Fs(the)22 b(common)f(probabilit)m(y)f(distribution)g (of)i(the)h(random)e(v)-5 b(ariables)21 b(\()p Fq(!)2861 1179 y Fp(\015)2905 1164 y Fs(\))2943 1183 y Fp(\015)t Fm(2)p Fl(Z)3080 1164 y Fk(d)k Fs(is)d(absolutely)f(con)m(tin)m(uous)99 1280 y(with)32 b(resp)s(ect)i(to)e(Leb)s(esgue)i(measure)f(and)g(its)f (densit)m(y)h(is)f(lo)s(cally)e(absolutely)i(con)m(tin)m(uous.)-118 1445 y(Under)h(this)f(additional)e(assumption,)i(in)g([11],)g(it)g(is)g (pro)m(v)m(ed)i(that)-118 1651 y Fw(Theorem)j(1.2.)49 b Ff(Assume)c(\(H0\),)j(\(H1\),)f(\(H2\))f(and)e(\(H3\).)76 b(Fix)44 b Fs(0)j Fq(<)f(\034)59 b(<)46 b Fs(1)p Ff(.)76 b(Then,)47 b(ther)-5 b(e)45 b(exists)g Fq(c)h(>)h Fs(0)-118 1768 y Ff(and)g Fq(\025)141 1783 y Fi(0)231 1768 y Fq(>)j Fs(0)d Ff(such)g(that,)k(for)c Fs(0)j Fq(<)h(\025)f(<)h(\025)1617 1783 y Fi(0)1656 1768 y Ff(,)g(the)c(inte)-5 b(gr)g(ate)g(d)47 b(density)g(of)g(states)g(of)g Fq(H)3335 1783 y Fp(!)r(;\025)3446 1768 y Ff(,)k Fo(N)3609 1783 y Fp(\025)3654 1768 y Ff(,)f(is)d(H\177) -50 b(older)-118 1892 y(c)-5 b(ontinuous)43 b(of)g(or)-5 b(der)43 b Fq(\034)55 b Ff(in)43 b(the)g(interval)g Fs([)p Fq(E)1629 1907 y Fm(\000)1689 1892 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)p 1866 1812 79 4 v 17 w(E)5 b Fs(\()p Fq(\025)p 2038 1837 65 4 v(!)s Fs(\))29 b(+)f Fq(c\025)p Fs(])43 b Ff(i.e.)70 b(ther)-5 b(e)43 b(exists)g Fq(C)3243 1907 y Fp(\025)3332 1892 y Fq(>)g Fs(0)g Ff(such)g(that,)j(for)-118 2013 y Fs(\()p Fq(E)6 b(;)17 b(E)120 1977 y Fm(0)143 2013 y Fs(\))28 b Fo(2)g Fs([)p Fq(E)402 2028 y Fm(\000)461 2013 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)p 638 1933 79 4 v 17 w(E)5 b Fs(\()p Fq(\025)p 810 1958 65 4 v(!)t Fs(\))22 b(+)g Fq(c\025)p Fs(])1159 1977 y Fi(2)1198 2013 y Ff(,)35 b(one)f(has)1289 2226 y Fo(jN)1399 2241 y Fp(\025)1444 2226 y Fs(\()p Fq(E)6 b Fs(\))22 b Fo(\000)h(N)1802 2241 y Fp(\025)1847 2226 y Fs(\()p Fq(E)1963 2185 y Fm(0)1986 2226 y Fs(\))p Fo(j)k(\024)i Fq(C)2255 2241 y Fp(\025)2300 2226 y Fo(j)p Fq(E)f Fo(\000)22 b Fq(E)2605 2185 y Fm(0)2628 2226 y Fo(j)2656 2185 y Fp(\034)2699 2226 y Fq(:)94 2438 y Fs(Theorem)38 b(1.2)f(is)g(a)g(consequence)j(of)d(the)h(W)-8 b(egner's)38 b(estimate)f(pro)m(v)m(ed)h(in)f([11];)i(a)e(w)m(eak)m(er) i(form)e(of)f(suc)m(h)-118 2555 y(an)c(estimate)g(is)g(pro)m(v)m(ed)i (in)e(Prop)s(osition)f(3.1.)94 2671 y(Using)42 b(Theorems)h(1.1)e(and)h (1.2)f(\(or)h(b)s(etter)g(said,)i(the)e(W)-8 b(egner)43 b(estimate,)g(Prop)s(osition)d(3.1\))i(together)-118 2787 y(with)32 b(the)h(m)m(ulti-scale)d(analysis)i(tec)m(hnique)i (\(see)g(e.g.)e([30,)h(8)o(]\),)g(w)m(e)h(pro)m(v)m(e)-118 2993 y Fw(Theorem)j(1.3.)49 b Ff(Assume)39 b(\(H0\),)h(\(H1\),)f (\(H2\))g(and)g(\(H3\).)56 b(Fix)39 b Fq(\021)g Fo(2)c Fs(\(0)p Fq(;)17 b(d=)p Fs(\(4)p Fq(d)24 b Fs(+)h(4\)\))p Ff(.)56 b(Ther)-5 b(e)38 b(exists)h Fq(\025)3897 3008 y Fp(\021)3974 2993 y Fq(>)c Fs(0)-118 3110 y Ff(such)g(that,)g(for)f Fq(\025)28 b Fo(2)g Fs(\(0)p Fq(;)17 b(\025)855 3125 y Fp(\021)896 3110 y Fs(\))p Ff(,)35 b(with)g(pr)-5 b(ob)g(ability)34 b(1,)h(one)f(has)-18 3282 y Fs(1.)41 b Ff(exp)-5 b(onential)43 b(lo)-5 b(c)g(alization)43 b(in)h Fq(I)1306 3297 y Fp(\021)r(;\025)1453 3282 y Fs(:=)h([)p Fq(E)1700 3297 y Fm(\000)1759 3282 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)p 1936 3202 79 4 v 17 w(E)6 b Fs(\()p Fq(\025)p 2109 3227 65 4 v(!)s Fs(\))29 b Fo(\000)g Fq(\025)2403 3246 y Fi(1+)p Fp(\021)2535 3282 y Fs(])45 b Ff(\(se)-5 b(e)43 b(the)h(description)g(given)f(in)h (The)-5 b(o-)99 3399 y(r)g(em)34 b(0.1\);)h(mor)-5 b(e)g(over,)33 b(the)i(eigenfunctions)f(asso)-5 b(ciate)g(d)34 b(to)h(eigenvalues)e (in)i(this)g(interval)f(satisfy)44 b Fs(\(0.3\))o Ff(.)-18 3515 y Fs(2.)d Ff(str)-5 b(ong)29 b(Hilb)-5 b(ert-Schmidt)30 b(dynamic)-5 b(al)28 b(lo)-5 b(c)g(alization)29 b(in)g Fq(I)2191 3530 y Fp(\021)r(;\025)2324 3515 y Ff(\(se)-5 b(e)29 b(the)h(description)f(given)g(in)g(The)-5 b(or)g(em)29 b(0.1\).)94 3721 y Fs(T)-8 b(o)45 b(our)g(kno)m(wledge,)k(these)e(are)d (the)i(\014rst)f(results)h(on)f(lo)s(calization)40 b(for)45 b(sign-inde\014nite)e(p)s(oten)m(tials)h(at)-118 3837 y(in)m(ternal)f(band)h(edges.)78 b(Lo)s(calization)41 b(for)i(suc)m(h)j(p)s(oten)m(tials)c(had)i(b)s(een)h(established)f(at)f (the)i(b)s(ottom)d(of)h(the)-118 3954 y(sp)s(ectrum)49 b(assuming)e(some)i(Lifshitz)e(b)s(eha)m(vior)h(or)g(quic)m(kly)h(deca) m(ying)g(tails)e(for)h(the)g(distributions)f(of)h(the)-118 4070 y(random)42 b(v)-5 b(ariables)42 b(\()p Fq(!)764 4085 y Fp(\015)808 4070 y Fs(\))846 4089 y Fp(\015)t Fm(2)p Fl(Z)984 4070 y Fk(d)j Fs(\(see)f(e.g.)f([17,)g(2]\).)75 b(T)-8 b(o)43 b(our)g(kno)m(wledge,)k(for)42 b(single)g(site)h(p)s (oten)m(tials)f(that)h(do)-118 4186 y(not)h(ha)m(v)m(e)j(a)d (de\014nite)h(sign,)i(Lifshitz)d(tails)f(ha)m(v)m(e)j(not)f(b)s(een)g (pro)m(v)m(ed)h(to)f(hold,)i(ev)m(en)f(at)f(the)g(b)s(ottom)e(of)h(the) -118 4302 y(sp)s(ectrum.)74 b(In)43 b(the)h(presen)m(t)g(pap)s(er,)i(w) m(e)d(pro)m(v)m(e)h(a)f(kind)g(of)f(Lifshitz)f(b)s(eha)m(vior)i(at)f (in)m(ternal)g(non-degenerate)-118 4419 y(band)33 b(edges)g(without)f (assuming)g(that)g(the)h(single)e(site)h(p)s(oten)m(tial)f(has)h(a)h (de\014nite)f(sign.)43 b(This)33 b(assumption)e(has)-118 4535 y(alw)m(a)m(ys)j(pla)m(y)m(ed)g(a)g(crucial)e(role)h(in)g(the)h (analysis)f(of)g(Lifshitz)g(tails.)45 b(In)34 b(the)g(presen)m(t)h(w)m (ork,)g(it)e(is)g(replaced)h(with)-118 4651 y(assumption)27 b(\(H2\))g(and)g(the)h(assumption)f(that)g Fq(\025)p Fs(,)h(the)g(disorder,)g(is)f(small.)39 b(Note)28 b(also)e(that,)j(due) f(to)f(the)g(unique)-118 4767 y(con)m(tin)m(uation)32 b(principle,)f(assumption)h(\(H2\))g(is)g(satis\014ed)h(for)f(p)s(oten) m(tials)f(ha)m(ving)i(a)f(de\014nite)h(sign.)94 4883 y(Theorems)e(0.2)e(and)h(0.1)g(follo)m(w)e(immediately)f(from)h (Theorems)j(1.1)e(and)h(1.3.)42 b(Indeed,)32 b(for)d Fq(H)36 b Fs(=)27 b Fo(\000)p Fs(\001)k(and)-118 5000 y Fq(E)-46 5015 y Fm(\000)13 5000 y Fs(\(0\))41 b(=)g(0,)i(it)c(is)i(w) m(ell)e(kno)m(wn)j(that)f(assumption)f(\(H1\))g(is)g(ful\014lled)f(at)h (the)h(b)s(ottom)e(of)h(the)i(sp)s(ectrum,)h(see)-118 5121 y(e.g.[28,)33 b(1].)47 b(In)34 b(this)f(case,)i(one)f(pro)m(v)m (es)p 1394 5041 79 4 v 35 w Fq(E)6 b Fs(\()p Fq(\025)p 1567 5066 65 4 v(!)s Fs(\))29 b(=)h Fq(\025)p 1861 5041 79 4 v(V)44 b Fs(+)23 b Fq(o)p Fs(\()p Fq(\025)p Fs(\))33 b(\(see)h(section)g(5.1\);)g(hence,)h(assumption)e(\(H2\))g(is)-118 5242 y(ful\014lled)d(if)i(and)h(only)f(if)p 814 5162 V 31 w Fq(V)49 b Fo(6)p Fs(=)28 b(0.)94 5358 y(Analogues)35 b(of)f(Theorems)i(1.1)e(and)h(1.3)g(in)f(the)h(case)h(of)e(discrete)i (random)e(Sc)m(hr\177)-49 b(odinger)35 b(op)s(erators)f(ha)m(v)m(e)-118 5475 y(b)s(een)c(pro)m(v)m(ed)i(in)d([22)o(].)43 b(Finally)-8 b(,)28 b(let)h(us)h(sa)m(y)h(that)e(the)i(metho)s(ds)e(used)i(in)e(the) h(presen)m(t)i(pap)s(er)e(should)f(also)g(apply)-118 5591 y(to)j(other)g(random)f(mo)s(dels,)g(e.g.)43 b(to)32 b(Sc)m(hr\177)-49 b(odinger)32 b(op)s(erators)g(with)g(w)m(eak)h (random)e(magnetic)g(p)s(oten)m(tials)g(\([9]\).)1989 5690 y Fg(5)p eop %%Page: 6 6 6 5 bop -118 241 a Fs(1.4.)56 b Fw(The)49 b(outline)e(of)h(the)h(pap)s (er.)h Fs(Section)42 b(2)g(is)g(dev)m(oted)i(to)e(the)g(pro)s(of)g(of)f (Theorem)i(1.1.)72 b(This)43 b(pro)s(of)-118 357 y(is)j(made)h(in)f (four)g(steps.)88 b(In)47 b(section)g(2.1,)j(w)m(e)e(in)m(tro)s(duce)f (the)g(p)s(erio)s(dic)f(appro)m(ximations)f(that)h(enable)h(us)-118 473 y(to)35 b(estimate)f Fo(N)479 488 y Fp(\025)524 473 y Fs(.)52 b(Section)35 b(2.2)g(is)g(dev)m(oted)i(to)d(the)i (recollection)e(of)h(some)g(facts)g(from)f(the)i(Flo)s(quet)e(theory)i (of)-118 589 y(p)s(erio)s(dic)23 b(op)s(erators.)40 b(In)25 b(section)f(2.3,)i(w)m(e)f(sho)m(w)h(that)e(estimating)e Fo(N)2446 604 y Fp(\025)2516 589 y Fs(comes)i(up)h(to)f(estimating)e (the)j(probabilit)m(y)-118 706 y(that,)50 b(restricted)d(to)f(a)g (su\016cien)m(tly)h(but)g(not)f(to)s(o)g(large)f(cub)s(e,)51 b(the)c(op)s(erator)f Fq(H)3078 721 y Fp(!)r(;\025)3235 706 y Fs(has)h(an)g(eigen)m(v)-5 b(alue)46 b(in)-118 822 y Fq(I)-75 837 y Fp(\021)r(;\025)28 822 y Fs(.)j(This)35 b(probabilit)m(y)e(is)h(then)i(estimated)e(in)g(section)g(2.4)h(b)m(y)g (sho)m(wing)g(that)g(it)e(reduces)k(to)d(large)g(deviation)-118 938 y(estimates)45 b(for)g(sums)h(of)f(indep)s(enden)m(t)i(random)d(v) -5 b(ariables.)82 b(In)45 b(section)h(3,)j(w)m(e)d(pro)m(v)m(e)h (Theorem)f(1.3)f(using)-118 1054 y(Theorem)33 b(1.1)f(and)g(Prop)s (osition)f(3.1)h(that)g(is)g(pro)m(v)m(ed)h(in)f(section)g(4.)44 b(A)m(t)32 b(last,)g(in)g(the)g(app)s(endix,)h(section)g(5,)f(w)m(e) -118 1171 y(gathered)h(some)f(useful)h(results.)1270 1393 y(2.)54 b Fr(The)38 b(pr)n(oof)g(of)g(Theorem)g(1.1)94 1568 y Fs(The)k(sc)m(heme)f(of)f(this)g(pro)s(of)g(follo)m(ws)f(the)i (one)g(of)e(the)i(pro)s(of)f(of)g(Theorem)g(1.1)g(in)g([22].)67 b(W)-8 b(e)40 b(\014rst)h(state)-118 1684 y(an)31 b(appro)m(ximation)f (theorem)h(giving)f(precise)i(\014nite)g(v)m(olume)f(appro)m(ximations) e(to)j Fo(N)3124 1699 y Fp(\025)3169 1684 y Fs(;)g(suc)m(h)h(a)e (statemen)m(t)h(w)m(as)-118 1800 y(deriv)m(ed)h(in)f([20,)g(23].)43 b(Then,)34 b(w)m(e)g(study)g(the)f(\014nite)f(v)m(olume)g(appro)m (ximations.)-118 1992 y(2.1.)56 b Fw(P)m(erio)s(dic)47 b(appro)m(ximations.)i Fs(Let)43 b Fq(n)k Fo(2)g Fj(N)d Fo(n)30 b(f)p Fs(0)p Fo(g)42 b Fs(and)i(de\014ne)h(the)f(follo)m(wing)d (p)s(erio)s(dic)h(Sc)m(hr\177)-49 b(odinger)-118 2108 y(op)s(erator)744 2290 y Fq(H)833 2249 y Fp(n)825 2315 y(!)r(;\025)964 2290 y Fs(=)27 b Fq(H)j Fs(+)22 b Fq(\025)1418 2195 y Fn(X)1350 2419 y Fp(\015)t Fm(2)p Fl(Z)1487 2396 y Fk(d)1487 2440 y Fc(2)p Fk(n)p Fc(+1)1647 2290 y Fq(!)1708 2305 y Fp(\015)1894 2195 y Fn(X)1769 2415 y Fp(\014)s Fm(2)p Fi(\(2)p Fp(n)p Fi(+1\))p Fl(Z)2133 2396 y Fk(d)2180 2290 y Fq(V)f Fs(\()p Fq(x)i Fo(\000)f Fq(\015)27 b Fo(\000)c Fq(\014)6 b Fs(\))27 b(=)h Fq(H)h Fs(+)22 b Fq(\025V)3225 2249 y Fp(n)3203 2315 y(!)-118 2290 y Fs(\(2.1\))-118 2597 y(where)34 b Fj(Z)233 2561 y Fp(d)233 2622 y Fi(2)p Fp(n)p Fi(+1)430 2597 y Fs(:=)28 b Fj(Z)630 2561 y Fp(d)668 2597 y Fq(=)p Fs(\(2)p Fq(n)22 b Fs(+)g(1\))p Fj(Z)1138 2561 y Fp(d)1175 2597 y Fs(.)-118 2719 y(F)-8 b(or)30 b Fq(!)k Fs(\014xed)e(and)f Fq(n)d Fo(2)g Fj(N)818 2683 y Fm(\003)864 2719 y Fs(,)j Fq(H)1011 2683 y Fp(n)1003 2745 y(!)r(;\025)1145 2719 y Fs(is)f(a)h(\(2)p Fq(n)19 b Fs(+)f(1\))p Fj(Z)1735 2683 y Fp(d)1773 2719 y Fs(-p)s(erio)s(dic)29 b(self-adjoin)m(t)g(Sc)m(hr\177)-49 b(odinger)31 b(op)s(erator.)42 b(Let)31 b Fq(N)3901 2683 y Fp(n)3891 2745 y(!)r(;\025)4034 2719 y Fs(b)s(e)-118 2835 y(its)h(in)m(tegrated)g(densit)m(y)i(of)e (states;)h(it)f(satis\014es)1149 3048 y Fo(N)1246 3007 y Fp(n)1231 3073 y(!)r(;\025)1342 3048 y Fs(\()p Fq(E)6 b Fs(\))27 b(=)1627 2953 y Fn(X)1632 3166 y Fp(k)r Fm(2)p Fl(N)1787 2913 y Fn(Z)1843 3138 y Fm(f)p Fp(\022)r Fm(2)p Fl(T)2010 3115 y Fd(\003)2010 3159 y Fc(2)p Fk(n)p Fc(+1)2154 3138 y Fi(;)32 b Fp(E)2258 3150 y Fk(k)2296 3138 y Fi(\()p Fp(n;!)r(;\025)p Fi(;)p Fp(\022)r Fi(\))p Fm(\024)p Fp(E)t Fm(g)2741 3048 y Fq(d\022)s(:)-2985 b Fs(\(2.2\))-118 3312 y(where)40 b(\()p Fq(E)280 3327 y Fp(k)323 3312 y Fs(\()p Fq(n;)17 b(!)t(;)g(\025)p Fs(;)g Fq(\022)s Fs(\)\))797 3327 y Fp(k)r Fm(\025)p Fi(0)967 3312 y Fs(are)39 b(the)h(Flo)s(quet)e(eigen)m(v)-5 b(alues)39 b(of)f Fq(H)2396 3276 y Fp(n)2388 3338 y(!)r(;\025)2538 3312 y Fs(and)h(the)h(torus)f Fj(T)3228 3276 y Fm(\003)3228 3337 y Fp(n)3317 3312 y Fs(is)g(de\014ned)h(b)m(y)g Fj(T)3969 3276 y Fm(\003)3969 3337 y Fp(n)4058 3312 y Fs(=)-118 3442 y Fj(R)-52 3406 y Fp(d)-6 3442 y Fq(=)57 3402 y Fi(1)p 53 3419 43 4 v 53 3476 a Fp(n)106 3442 y Fj(Z)175 3406 y Fp(d)213 3442 y Fs(.)-118 3559 y(W)-8 b(e)33 b(recall)e(Theorem)i(1.2)f(from)f([21])i (namely)-118 3738 y Fw(Theorem)k(2.1)h Fs(\([21)o(]\))p Fw(.)49 b Ff(Pick)40 b Fq(\013)f(>)e Fs(0)j Ff(and)g Fq(I)46 b Fo(\032)38 b Fj(R)5 b Ff(,)48 b(a)40 b(c)-5 b(omp)g(act)40 b(interval.)60 b(Ther)-5 b(e)40 b(exists)g Fq(\027)3408 3753 y Fi(0)3486 3738 y Fq(>)d Fs(0)j Ff(and)g Fq(\032)e(>)g Fs(0)-118 3855 y Ff(such)d(that,)g(for)f Fq(\025)28 b Fo(2)g Fs([0)p Fq(;)17 b Fs(1])p Ff(,)34 b Fq(E)g Fo(2)28 b Fq(I)8 b Ff(,)35 b Fq(\027)f Fo(2)28 b Fs(\(0)p Fq(;)17 b(\027)1598 3870 y Fi(0)1637 3855 y Fs(\))35 b Ff(and)f Fq(n)28 b Fo(\025)g Fq(\027)2144 3819 y Fm(\000)p Fp(\032)2240 3855 y Ff(,)35 b(one)f(has)-118 4063 y Fs(\(2.3\))82 b Fj(E)13 b Fs(\()p Fo(N)361 4022 y Fp(n)346 4087 y(!)r(;\025)463 4063 y Fs(\()p Fq(E)28 b Fs(+)22 b Fq(\027)6 b(=)p Fs(2\)\))22 b Fo(\000)h Fj(E)12 b Fs(\()p Fo(N)1244 4022 y Fp(n)1229 4087 y(!)r(;\025)1346 4063 y Fs(\()p Fq(E)28 b Fo(\000)23 b Fq(\027)6 b(=)p Fs(2\)\))22 b Fo(\000)g Fq(e)1978 4022 y Fm(\000)p Fp(\027)2072 3998 y Fd(\000)p Fk(\013)1385 4214 y Fo(\024)29 b(N)1573 4229 y Fp(\025)1618 4214 y Fs(\()p Fq(E)f Fs(+)22 b Fq(\027)6 b Fs(\))22 b Fo(\000)h(N)2150 4229 y Fp(\025)2195 4214 y Fs(\()p Fq(E)28 b Fo(\000)23 b Fq(\027)6 b Fs(\))28 b Fo(\024)2120 4387 y Fj(E)12 b Fs(\()p Fo(N)2315 4346 y Fp(n)2300 4411 y(!)r(;\025)2417 4387 y Fs(\()p Fq(E)28 b Fs(+)22 b(2)p Fq(\027)6 b Fs(\)\))22 b Fo(\000)h Fj(E)12 b Fs(\()p Fo(N)3149 4346 y Fp(n)3134 4411 y(!)r(;\025)3251 4387 y Fs(\()p Fq(E)28 b Fo(\000)23 b Fs(2)p Fq(\027)6 b Fs(\)\))22 b(+)g Fq(e)3833 4346 y Fm(\000)p Fp(\027)3927 4322 y Fd(\000)p Fk(\013)4024 4387 y Fq(:)-118 4572 y Fs(In)40 b([21],)i(w)m(e)f(did)f(not)g(consider)g(the)h(case)g(when)g (the)g(random)e(op)s(erator)g(dep)s(ends)j(on)e(a)g(parameter)f Fq(\025)p Fs(.)66 b(One)-118 4688 y(easily)32 b(c)m(hec)m(ks)j(that)d (the)h(pro)s(of)f(of)g(Theorem)h(1.2)f(of)g([21])h(holds)f(uniformly)e (in)i(the)h(parameter)f Fq(\025)p Fs(.)-118 4880 y(2.2.)56 b Fw(More)43 b(on)h(Flo)s(quet)f(Theory.)49 b Fs(It)37 b(is)h(con)m(v)m(enien)m(t)h(to)e(in)m(tro)s(duce)h(some)f(notations.) 58 b(Fix)37 b Fq(\022)i Fo(2)e Fj(R)3834 4844 y Fp(d)3880 4880 y Fs(.)59 b(The)-118 4996 y(set)42 b(of)f(functions)h Fq(')g Fs(that)f(are)h(lo)s(cally)d(square)j(in)m(tegrable)f(\(resp.)72 b(lo)s(cally)39 b(in)i Fq(H)3026 4960 y Fi(2)3064 4996 y Fs(\))h(on)g Fj(R)3355 4960 y Fp(d)3443 4996 y Fs(and)f(that)h (satisfy)-118 5112 y Fq(')p Fs(\()p Fq(x)28 b Fs(+)h Fq(\015)5 b Fs(\))42 b(=)h Fq(e)472 5076 y Fp(i\015)t(\022)576 5112 y Fq(')p Fs(\()p Fq(x)p Fs(\),)h Fo(8)p Fq(\015)k Fo(2)c Fj(Z)1175 5076 y Fp(d)1254 5112 y Fs(is)d(denoted)i(b)m(y)f Fq(L)1949 5076 y Fi(2)1949 5138 y Fp(\022)2030 5112 y Fs(\(resp.)72 b Fq(H)2429 5076 y Fi(2)2421 5138 y Fp(\022)2468 5112 y Fs(\);)46 b(b)s(oth)41 b(spaces)i(are)f(endo)m(w)m(ed)h(with)e (their)-118 5229 y(natural)31 b(scalar)h(pro)s(duct)h(\(see)h([28)o (]\).)44 b(The)33 b(op)s(erator)f Fq(H)40 b Fs(acting)32 b(on)g(the)h Fq(H)2721 5193 y Fi(2)2713 5255 y Fp(\022)2793 5229 y Fs(is)f(denoted)i(b)m(y)f Fq(H)8 b Fs(\()p Fq(\022)s Fs(\).)-118 5345 y(Pic)m(k)30 b Fq(n)e Fo(\025)g Fs(1.)43 b(The)31 b(op)s(erator)e Fq(H)37 b Fs(is)30 b Fj(Z)1278 5309 y Fp(d)1316 5345 y Fs(-p)s(erio)s(dic;)f(hence,)j(it)c(is)i(also)f (\(2)p Fq(n)17 b Fs(+)f(1\))p Fj(Z)2837 5309 y Fp(d)2875 5345 y Fs(-p)s(erio)s(dic.)40 b(T)-8 b(o)30 b(stress)i(this)e(p)s(oin)m (t)-118 5461 y(of)38 b(view,)j(w)m(e)f(sometimes)e(call)g(it)g Fq(H)1267 5425 y Fp(n)1313 5461 y Fs(.)63 b(Let)39 b Fq(L)1650 5425 y Fi(2)1650 5487 y Fp(n;\022)1791 5461 y Fs(\(resp.)63 b Fq(H)2181 5425 y Fi(2)2173 5487 y Fp(n;\022)2274 5461 y Fs(\))39 b(b)s(e)g(the)h(set)f(of)g(functions)g Fq(')g Fs(that)f(are)h(lo)s(cally)-118 5591 y(square)28 b(in)m(tegrable)f(\(resp.)42 b(lo)s(cally)25 b(in)i Fq(H)1413 5555 y Fi(2)1452 5591 y Fs(\))g(on)g Fj(R)1713 5555 y Fp(d)1787 5591 y Fs(and)h(that)f(satisfy)g Fq(')p Fs(\()p Fq(x)12 b Fs(+)g Fq(\015)5 b Fs(\))27 b(=)h Fq(e)3004 5555 y Fp(i)p Fi(2)p Fp(\031)r(\015)t(\022)3185 5591 y Fq(')p Fs(\()p Fq(x)p Fs(\),)h Fo(8)p Fq(\015)k Fo(2)28 b Fs(\(2)p Fq(n)12 b Fs(+)g(1\))p Fj(Z)4070 5555 y Fp(d)4107 5591 y Fs(;)1989 5690 y Fg(6)p eop %%Page: 7 7 7 6 bop -118 241 a Fs(b)s(oth)28 b(spaces)i(are)e(endo)m(w)m(ed)i(with) e(their)g(natural)f(scalar)g(pro)s(duct.)43 b(The)29 b(op)s(erator)e Fq(H)36 b Fs(acting)27 b(on)i(the)f(space)i Fq(H)4041 205 y Fi(2)4033 267 y Fp(n;\022)-118 363 y Fs(is)i(denoted)i(b)m(y)f Fq(H)573 326 y Fp(n)619 363 y Fs(\()p Fq(\022)s Fs(\).)44 b(Notice)32 b(that,)h(in)e(this)i(case,)g (w)m(e)h(can)f(restrict)f(ourselv)m(es)i(to)e Fq(\022)f Fo(2)d Fj(T)3320 326 y Fm(\003)3320 387 y Fi(2)p Fp(n)p Fi(+1)3496 363 y Fs(.)94 479 y(The)j(Flo)s(quet)e(eigen)m(v)-5 b(alues)30 b(and)f(eigen)m(v)m(ectors)j(of)d Fq(H)2079 443 y Fp(n)2125 479 y Fs(\()p Fq(\022)s Fs(\))h(are)g(easily)f (computed)h(in)f(terms)g(of)h(the)g(Flo)s(quet)-118 595 y(eigen)m(v)-5 b(alues)48 b(and)h(eigen)m(v)m(ectors)h(of)e Fq(H)8 b Fs(\()p Fq(\022)s Fs(\).)91 b(Indeed,)54 b(let)48 b(\()p Fq(E)2258 610 y Fp(k)2301 595 y Fs(\()p Fq(\022)s Fs(\))p Fq(;)17 b(')2533 610 y Fp(k)2575 595 y Fs(\()p Fo(\001)p Fq(;)g(\022)s Fs(\)\))2809 610 y Fp(k)r Fm(\025)p Fi(0)2990 595 y Fs(b)s(e)49 b(the)g(Flo)s(quet)e(eigen)m(v)-5 b(alue)-118 711 y(and)38 b(eigen)m(v)m(ectors)j(for)c Fq(H)8 b Fs(\()p Fq(\022)s Fs(\))38 b(i.e.)61 b(the)39 b(solutions)f(to)g(the)h(eigen)m(v)-5 b(alue)38 b(problem)f(\(1.2\))o (.)61 b(One)39 b(c)m(hec)m(ks)j(that,)d(for)-118 828 y Fq(\015)33 b Fo(2)28 b Fj(Z)129 791 y Fp(d)129 852 y Fi(2)p Fp(n)p Fi(+1)299 828 y Fs(,)317 1165 y Fq(H)8 b(')470 1180 y Fp(k)r(;\015)572 1165 y Fs(\()p Fq(\022)s Fs(\))28 b(=)f Fq(E)899 1180 y Fp(k)r(;\015)1002 1165 y Fs(\()p Fq(\022)s Fs(\))p Fq(')1190 1180 y Fp(k)r(;\015)1292 1165 y Fs(\()p Fq(\022)s Fs(\))33 b(where)1747 961 y Fn(8)1747 1050 y(<)1747 1230 y(:)1836 1056 y Fq(E)1908 1071 y Fp(k)r(;\015)2011 1056 y Fs(\()p Fq(\022)s Fs(\))27 b(=)h Fq(E)2338 1071 y Fp(k)2381 1056 y Fs(\()p Fq(\022)d Fs(+)d Fq(\015)5 b(=)p Fs(\(2)p Fq(n)22 b Fs(+)g(1\)\))p Fq(;)1836 1229 y(')1900 1244 y Fp(k)r(;\015)2002 1229 y Fs(\()p Fq(\022)s Fs(\))28 b(=)2475 1162 y(1)p 2268 1206 463 4 v 2268 1297 a(\(2)p Fq(n)22 b Fs(+)g(1\))2620 1269 y Fp(d=)p Fi(2)2740 1229 y Fq(')2804 1244 y Fp(k)2847 1229 y Fs(\()p Fq(\022)j Fs(+)d Fq(\015)5 b(=)p Fs(\(2)p Fq(n)22 b Fs(+)g(1\)\))p Fq(:)-118 1503 y Fs(F)-8 b(or)32 b Fq(\015)g Fs(=)c(\()p Fq(\015)333 1518 y Fi(1)372 1503 y Fq(;)17 b(:)g(:)g(:)f(;)h(\015)642 1518 y Fp(d)681 1503 y Fs(\))28 b Fo(2)g Fj(Z)910 1467 y Fp(d)981 1503 y Fs(and)k Fq(l)1201 1467 y Fm(0)1252 1503 y Fo(\025)d Fs(0,)j(de\014ne)356 1710 y Fq(C)426 1725 y Fp(\015)t(;l)508 1706 y Fd(0)561 1710 y Fs(=)c Fo(f)p Fq(x)g Fs(=)f(\()p Fq(x)994 1725 y Fi(1)1034 1710 y Fq(;)17 b(:)g(:)g(:)f(;)h(x)1308 1725 y Fp(d)1349 1710 y Fs(\);)49 b Fo(8)p Fs(1)28 b Fo(\024)g Fq(i)g Fo(\024)g Fq(d;)49 b Fo(\000)p Fq(l)2101 1669 y Fm(0)2147 1710 y Fo(\000)23 b Fs(1)p Fq(=)p Fs(2)k Fo(\024)h Fq(x)2581 1725 y Fp(i)2631 1710 y Fo(\000)23 b Fs(\(2)p Fq(l)2849 1669 y Fm(0)2894 1710 y Fs(+)g(1\))p Fq(\015)3131 1725 y Fp(i)3186 1710 y Fq(<)k(l)3320 1669 y Fm(0)3366 1710 y Fs(+)22 b(1)p Fq(=)p Fs(2)p Fo(g)-3779 b Fs(\(2.4\))-118 1927 y(The)33 b(v)m(ectors)i(\()p Fq(')516 1942 y Fp(k)r(;\015)618 1927 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\)\))852 1942 y Fp(k)r(;\015)986 1927 y Fs(form)32 b(an)g(orthonormal)e(family)g(in)i Fq(L)2388 1891 y Fi(2)2428 1927 y Fs(\()p Fq(C)2536 1942 y Fi(0)p Fp(;n)2638 1927 y Fs(\))g(as)190 2053 y Fn(Z)246 2279 y Fp(C)296 2288 y Fc(0)p Fk(;n)409 2189 y Fq(')473 2204 y Fp(k)r(;\015)575 2189 y Fs(\()p Fq(x;)17 b(\022)s Fs(\))p 798 2102 435 4 v Fq(')862 2204 y Fp(k)901 2185 y Fd(0)923 2204 y Fp(;\015)983 2185 y Fd(0)1009 2189 y Fs(\()p Fq(x;)g(\022)s Fs(\))q Fq(dx)27 b Fs(=)1653 2094 y Fn(X)1470 2314 y Fp(\014)s Fm(2)p Fl(Z)1610 2295 y Fk(d)1640 2314 y Fp(=)p Fi(\(2)p Fp(n)p Fi(+1\))p Fl(Z)1949 2295 y Fk(d)1996 2053 y Fn(Z)2051 2279 y Fp(\014)s Fi(+)p Fp(C)2199 2288 y Fc(0)p Fk(;)p Fc(0)2304 2189 y Fq(')2368 2204 y Fp(k)r(;\015)2471 2189 y Fs(\()p Fq(x;)17 b(\022)s Fs(\))p 2694 2102 412 4 v Fq(')2758 2204 y Fp(k)2797 2185 y Fd(0)2819 2204 y Fp(;\015)2883 2189 y Fs(\()p Fq(x;)g(\022)s Fs(\))p Fq(dk)201 2582 y Fs(=)487 2515 y(1)p 315 2559 393 4 v 315 2651 a(\(2)p Fq(n)22 b Fs(+)g(1\))667 2622 y Fp(d)734 2382 y Fn(0)734 2561 y(@)891 2488 y(X)821 2711 y Fp(\014)s Fm(2)p Fl(Z)961 2688 y Fk(d)961 2732 y Fc(2)p Fk(n)p Fc(+1)1122 2582 y Fq(e)1167 2541 y Fi(2)p Fp(\031)r(\014)s Fi(\()p Fp(\015)t Fm(\000)p Fp(\015)1450 2518 y Fd(0)1474 2541 y Fi(\))p Fp(=)p Fi(\(2)p Fp(n)p Fi(+1\))1764 2382 y Fn(1)1764 2561 y(A)1867 2447 y(Z)1923 2672 y Fp(C)1973 2681 y Fc(0)p Fk(;)p Fc(0)2078 2582 y Fq(')2142 2597 y Fp(k)2184 2582 y Fs(\()p Fq(x;)17 b(\022)26 b Fs(+)c Fq(\015)5 b(=)p Fs(\(2)p Fq(n)22 b Fs(+)g(1\)\))p 2985 2495 953 4 v Fq(')3049 2597 y Fp(k)3088 2578 y Fd(0)3113 2582 y Fs(\()p Fq(x;)17 b(\022)26 b Fs(+)c Fq(\015)3475 2553 y Fm(0)3498 2582 y Fq(=)p Fs(\(2)p Fq(n)g Fs(+)g(1\)\))o Fq(dx)201 2856 y Fs(=)28 b Fq(\016)348 2871 y Fp(k)r(k)426 2852 y Fd(0)452 2856 y Fq(\016)495 2871 y Fp(\015)t(\015)575 2852 y Fd(0)602 2856 y Fq(:)-118 2499 y Fs(\(2.5\))-118 3076 y(The)33 b(family)d(\()p Fq(')482 3091 y Fp(k)r(;\015)585 3076 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\)\))819 3091 y Fp(k)r(;\015)953 3076 y Fs(is)32 b(complete)g(as)h(the)g(family)d(\() p Fq(')2151 3091 y Fp(k)2194 3076 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\)\))2428 3091 y Fp(k)r Fm(\025)p Fi(0)2592 3076 y Fs(is.)43 b(Indeed,)34 b(for)e Fq(u)c Fo(2)g Fq(L)3465 3040 y Fi(2)3505 3076 y Fs(\()p Fj(R)3608 3040 y Fp(d)3655 3076 y Fs(\),)k(one)h(has)-118 3454 y Fq(u)27 b Fs(=)69 3360 y Fn(X)76 3572 y Fp(k)r Fm(\025)p Fi(0)229 3319 y Fn(Z)284 3544 y Fl(T)334 3525 y Fd(\003)392 3454 y Fs(^)-56 b Fq(u)441 3469 y Fp(n)488 3454 y Fs(\()p Fq(\022)s Fs(\))p Fq(')676 3469 y Fp(n)723 3454 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\))p Fq(d\022)30 b Fs(=)1148 3360 y Fn(X)1156 3572 y Fp(k)r Fm(\025)p Fi(0)1378 3360 y Fn(X)1309 3583 y Fp(\015)t Fm(2)p Fl(Z)1446 3560 y Fk(d)1446 3604 y Fc(2)p Fk(n)p Fc(+1)1607 3319 y Fn(Z)1662 3544 y Fl(T)1712 3521 y Fd(\003)1712 3565 y Fc(2)p Fk(n)p Fc(+1)1883 3454 y Fs(^)-55 b Fq(u)1933 3469 y Fp(\015)t(;n)2040 3454 y Fs(\()p Fq(\022)s Fs(\))p Fq(')2228 3469 y Fp(\015)t(;n)2335 3454 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\))p Fq(d\022)34 b Fs(where)40 b(^)-55 b Fq(u)2999 3469 y Fp(\015)t(;n)3106 3454 y Fs(\()p Fq(\022)s Fs(\))27 b(=)34 b(^)-55 b Fq(u)3417 3469 y Fp(n)3463 3454 y Fs(\()p Fq(\022)25 b Fs(+)e Fq(\015)5 b(=)p Fs(\(2)p Fq(n)21 b Fs(+)h(1\)\))p Fq(:)-118 3802 y Fs(So,)34 b(the)h(pairs)e(\()p Fq(E)566 3817 y Fp(k)r(;\015)669 3802 y Fs(\()p Fq(\022)s Fs(\))p Fq(;)17 b(')901 3817 y Fp(k)r(;\015)1003 3802 y Fs(\()p Fo(\001)p Fq(;)g(\022)s Fs(\)\))1237 3825 y Fp(k)r Fm(\025)p Fi(0)p Fp(;\015)t Fm(2)p Fl(Z)1522 3803 y Fk(d)1522 3847 y Fc(2)p Fk(n)p Fc(+1)1704 3802 y Fs(form)33 b(a)g(family)f(of)h(\(2)p Fq(n)23 b Fs(+)g(1\))p Fj(Z)2853 3766 y Fp(d)2891 3802 y Fs(-p)s(erio)s(dic)32 b(Flo)s(quet)h(eigen)m(v)-5 b(alues)-118 3931 y(and)33 b(eigen)m(v)m(ectors)h(of)e Fq(H)8 b Fs(.)94 4047 y(W)-8 b(e)40 b(also)d(mak)m(e)i(use)h(of)e(sp)s(ectral)g(pro)5 b(jectors.)63 b(W)-8 b(e)39 b(de\014ne)h(\005)2445 4062 y Fp()1032 1514 y(<)1032 1693 y(>)1032 1723 y(:)1121 1629 y Fq(!)t Fs(;)1308 1463 y Fo(9)p Fq(\022)j Fo(2)d Fj(R)1599 1422 y Fp(d)1645 1463 y Fq(;)1278 1632 y Fo(9)p Fq(E)34 b Fo(2)28 b Fs([)p Fq(E)1632 1647 y Fm(\000)1691 1632 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)p 1868 1552 79 4 v 17 w(E)6 b Fs(\()p Fq(\025)p 2041 1577 65 4 v(!)s Fs(\))22 b Fo(\000)h Fq(\025)2322 1591 y Fi(1+)p Fp(\021)2449 1567 y Fd(0)2476 1632 y Fs(])p Fq(;)1292 1792 y Fo(9)p Fq(')28 b Fo(2)g Fq(H)1622 1751 y Fi(2)1614 1817 y Fp(n;\022)1715 1792 y Fq(;)49 b Fo(k)p Fq(')p Fo(k)28 b Fs(=)f(1)p Fq(;)2579 1629 y Fs(s.t.)44 b Fq(H)2842 1587 y Fp(n)2834 1653 y(!)r(;\025)2945 1629 y Fs(\()p Fq(\022)s Fs(\))p Fq(')28 b Fs(=)g Fq(E)6 b(')3407 1394 y Fn(9)3407 1484 y(>)3407 1514 y(=)3407 1693 y(>)3407 1723 y(;)3512 1629 y Fq(:)-118 1962 y Fs(Flo)s(quet)32 b(theory)h(giv)m(es)g(us)g(another)g(c)m(haracterization)e(of)h(\012\() p Fq(n;)17 b(\025;)g(\021)2458 1925 y Fm(0)2481 1962 y Fs(\),)33 b(namely)-8 b(,)777 2157 y(\012\()p Fq(n;)17 b(\025;)g(\021)1140 2116 y Fm(0)1163 2157 y Fs(\))28 b(=)1332 2046 y Fn(n)1399 2157 y Fq(!)t Fs(;)48 b Fq(\033)t Fs(\()p Fq(H)1725 2116 y Fp(n)1717 2181 y(!)r(;\025)1828 2157 y Fs(\))22 b Fo(\\)h Fs([)p Fq(E)2076 2172 y Fm(\000)2135 2157 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)p 2312 2077 79 4 v 17 w(E)6 b Fs(\()p Fq(\025)p 2485 2102 65 4 v(!)s Fs(\))22 b Fo(\000)h Fq(\025)2766 2116 y Fi(1+)p Fp(\021)2893 2092 y Fd(0)2920 2157 y Fs(])28 b Fo(6)p Fs(=)f Fo(;)3128 2046 y Fn(o)3211 2157 y Fq(:)-3356 b Fs(\(2.7\))-118 2352 y(By)34 b(\(2.6\))e(and)h(Theorem)g(2.1,)f(Theorem)h(1.1)f(is)g (an)h(immediate)d(consequence)35 b(of)-118 2530 y Fw(Prop)s(osition)g (2.1.)50 b Ff(Fix)38 b Fq(\021)j Fo(2)36 b Fs(\(0)p Fq(;)17 b(d=)p Fs(\(4)p Fq(d)24 b Fs(+)i(4\)\))39 b Ff(and)g Fq(\032)e(>)f(d)p Ff(.)58 b(Then,)40 b(ther)-5 b(e)40 b(exists)f Fq(\025)3136 2545 y Fp(\021)r(;\032)3270 2530 y Fq(>)d Fs(0)j Ff(and)g Fq(")d(>)h Fs(0)i Ff(such)-118 2646 y(that,)c(for)g Fq(\025)27 b Fo(2)h Fs(\(0)p Fq(;)17 b(\025)633 2661 y Fp(\021)r(;\032)730 2646 y Fs(\))p Ff(,)35 b(one)f(has)1557 2826 y Fj(P)p Fs([\012\()p Fq(n;)17 b(\025;)g(\021)t Fs(\)])29 b Fo(\024)f Fq(e)2250 2785 y Fm(\000)p Fp(\025)2346 2762 y Fd(\000)p Fk(")2432 2826 y Fq(:)-2577 b Fs(\(2.8\))-118 2990 y Ff(wher)-5 b(e)701 3154 y Fs(2)p Fq(n)23 b Fs(+)f(1)27 b(=)h([)p Fq(\025)1193 3113 y Fm(\000)p Fi(1)p Fp(=)p Fi(2+2)p Fp(\021)1480 3089 y Fd(0)1508 3154 y Fs(])1535 3169 y Fp(o)1595 3154 y Fo(\001)22 b Fs([)p Fq(\025)1729 3113 y Fm(\000)p Fp(\021)1821 3089 y Fd(0)1848 3154 y Fs(])1875 3169 y Fp(o)1936 3154 y Fo(\001)g Fs([)p Fq(\025)2070 3113 y Fm(\000)p Fp(\032)2165 3154 y Fs(])2192 3169 y Fp(o)2265 3154 y Ff(and)34 b Fq(\021)e(<)27 b(\021)2689 3113 y Fm(0)2740 3154 y Fq(<)g(d=)p Fs(\(4)p Fq(d)21 b Fs(+)h(4\))p Fq(:)-118 3323 y Ff(Her)-5 b(e,)35 b Fs([)p Fo(\001)p Fs(])227 3338 y Fp(o)300 3323 y Ff(denotes)f(the)h(lar)-5 b(gest)35 b(o)-5 b(dd)34 b(inte)-5 b(ger)34 b(smal)5 b(ler)34 b(than)h Fo(\001)p Ff(.)-118 3501 y Fs(2.4.)56 b Fw(The)45 b(pro)s(of)h(of)g(Prop)s (osition)d(2.1.)50 b Fs(W)-8 b(e)40 b(\014rst)g(reform)m(ulate)e(the)i (de\014nition)e(of)h(\012\()p Fq(n;)17 b(\025;)g(\021)t Fs(\).)64 b(It)40 b(is)f(con-)-118 3617 y(v)m(enien)m(t)h(to)f(w)m(ork) g(at)g(extremal)f(p)s(oin)m(ts)h(of)f(the)i(sp)s(ectrum)f(e.g.)63 b(at)38 b(the)i(b)s(ottom)d(of)i(the)g(sp)s(ectrum.)63 b(W)-8 b(e)39 b(\014rst)-118 3734 y(transform)32 b(our)i(problem)e(so)i (as)g(to)f(b)s(e)h(in)e(that)i(case.)47 b(Therefore,)35 b(w)m(e)f(pro)5 b(ject)35 b(out)e(the)h(part)f(of)g(the)h(sp)s(ectrum) -118 3850 y(b)s(elo)m(w)e Fq(E)230 3865 y Fi(0)298 3850 y Fs(=)27 b(\()p Fq(E)511 3865 y Fm(\000)570 3850 y Fs(\(0\))22 b(+)g Fq(E)887 3865 y Fi(+)946 3850 y Fs(\(0\)\))p Fq(=)p Fs(2.)94 3966 y(W)-8 b(e)33 b(decomp)s(ose)g Fq(L)819 3930 y Fi(2)887 3966 y Fs(=)27 b Fq(L)1056 3930 y Fi(2)1096 3966 y Fs(\()p Fj(R)1200 3930 y Fp(d)1247 3966 y Fs(\))32 b(in)m(to)g Fq(L)1581 3930 y Fi(2)1648 3966 y Fs(=)c(\005)1825 3981 y Fm(\024)p Fp(E)1932 3990 y Fc(0)1970 3966 y Fq(L)2036 3930 y Fi(2)2098 3966 y Fs(+)22 b(\005)2269 3981 y Fp(>E)2376 3990 y Fc(0)2415 3966 y Fq(L)2481 3930 y Fi(2)2553 3966 y Fs(and)33 b(write)705 4193 y Fq(H)794 4152 y Fp(n)786 4218 y(!)r(;\025)919 4193 y Fo(\000)23 b Fq(E)34 b Fs(=)1228 4053 y Fn(\022)1301 4129 y Fs(\005)1374 4144 y Fm(\024)p Fp(E)1481 4153 y Fc(0)1520 4129 y Fs(\()p Fq(H)1647 4093 y Fp(n)1639 4155 y(!)r(;\025)1772 4129 y Fo(\000)23 b Fq(E)6 b Fs(\)\005)2061 4144 y Fm(\024)p Fp(E)2168 4153 y Fc(0)2432 4129 y Fq(\025)p Fs(\005)2562 4144 y Fm(\024)p Fp(E)2669 4153 y Fc(0)2707 4129 y Fq(V)2786 4093 y Fp(n)2764 4154 y(!)2833 4129 y Fs(\005)2906 4144 y Fp(>E)3013 4153 y Fc(0)1444 4249 y Fq(\025)p Fs(\005)1574 4264 y Fp(>E)1681 4273 y Fc(0)1719 4249 y Fq(V)1798 4213 y Fp(n)1776 4274 y(!)1845 4249 y Fs(\005)1918 4264 y Fm(\024)p Fp(E)2025 4273 y Fc(0)2289 4249 y Fs(\005)2362 4264 y Fp(>E)2469 4273 y Fc(0)2508 4249 y Fs(\()p Fq(H)2635 4213 y Fp(n)2627 4275 y(!)r(;\025)2760 4249 y Fo(\000)22 b Fq(E)6 b Fs(\)\005)3048 4264 y Fp(>E)3155 4273 y Fc(0)3194 4053 y Fn(\023)3284 4193 y Fq(:)-3429 b Fs(\(2.9\))-118 4419 y(F)-8 b(or)43 b Fq(E)53 b Fo(2)47 b Fq(I)349 4434 y Fp(\021)r(;\025)452 4419 y Fs(,)f(the)f(op)s(erator)e(\005)1182 4434 y Fm(\024)p Fp(E)1289 4443 y Fc(0)1327 4419 y Fs(\()p Fq(H)1454 4383 y Fp(n)1446 4445 y(!)r(;\025)1587 4419 y Fo(\000)30 b Fq(E)6 b Fs(\)\005)1883 4434 y Fm(\024)p Fp(E)1990 4443 y Fc(0)2072 4419 y Fs(is)44 b(in)m(v)m(ertible)f(and)h(its)f(in)m(v)m (erse)i(b)s(ounded)g(b)m(y)f(a)g(con-)-118 4535 y(stan)m(t)c(indep)s (enden)m(t)h(of)e Fq(\025)g Fs(and)h Fq(!)t Fs(.)64 b(This)39 b(follo)m(ws)g(from)f(the)i(fact)f(that)h Fq(V)2707 4550 y Fp(!)2797 4535 y Fs(is)f(uniformly)e(b)s(ounded)j(and)g(that)-118 4651 y(\005)-45 4666 y Fm(\024)p Fp(E)62 4675 y Fc(0)100 4651 y Fq(H)189 4615 y Fp(n)236 4651 y Fs(\005)309 4666 y Fm(\024)p Fp(E)416 4675 y Fc(0)482 4651 y Fo(\024)28 b Fq(E)659 4666 y Fi(+)718 4651 y Fs(\(0\)\005)916 4666 y Fm(\024)p Fp(E)1023 4675 y Fc(0)1062 4651 y Fs(.)-118 4767 y(Hence,)34 b Fq(E)g Fo(2)28 b Fq(I)442 4782 y Fp(\021)r(;\025)577 4767 y Fs(is)k(in)g(the)h(sp)s(ectrum)g(of)f Fq(H)1583 4731 y Fp(n)1575 4793 y(!)r(;\025)1718 4767 y Fs(if)g(and)h(only)f(if)f (it)h(is)g(in)f(the)i(sp)s(ectrum)g(of)451 4963 y(\005)524 4978 y Fp(>E)631 4987 y Fc(0)669 4963 y Fq(H)758 4922 y Fp(n)750 4988 y(!)r(;\025)861 4963 y Fs(\005)934 4978 y Fp(>E)1041 4987 y Fc(0)1102 4963 y Fo(\000)22 b Fq(\025)1258 4922 y Fi(2)1298 4963 y Fs(\005)1371 4978 y Fp(>E)1478 4987 y Fc(0)1516 4963 y Fq(V)1595 4922 y Fp(n)1573 4988 y(!)1642 4963 y Fs(\005)1715 4978 y Fm(\024)p Fp(E)1822 4987 y Fc(0)1877 4882 y Fn(\002)1918 4963 y Fs(\005)1991 4978 y Fm(\024)p Fp(E)2098 4987 y Fc(0)2137 4963 y Fs(\()p Fq(H)2264 4922 y Fp(n)2256 4988 y(!)r(;\025)2389 4963 y Fo(\000)h Fq(E)6 b Fs(\)\005)2678 4978 y Fm(\024)p Fp(E)2785 4987 y Fc(0)2823 4882 y Fn(\003)2865 4905 y Fm(\000)p Fi(1)2975 4963 y Fs(\005)3048 4978 y Fm(\024)p Fp(E)3155 4987 y Fc(0)3194 4963 y Fq(V)3272 4922 y Fp(n)3251 4988 y(!)3319 4963 y Fs(\005)3392 4978 y Fp(>E)3499 4987 y Fc(0)3538 4963 y Fq(:)-3683 b Fs(\(2.10\))-118 5137 y(As)39 b(the)g(second)g(term)f(in)g(\(2.10\))f(is)h(b)s(ounded)h(b)m (y)h Fq(C)7 b(\025)1956 5101 y Fi(2)1995 5137 y Fs(,)40 b(w)m(e)f(see)h(that)e Fq(E)44 b Fo(2)38 b Fq(I)2855 5152 y Fp(\021)r(;\025)2996 5137 y Fs(is)g(in)f(the)i(sp)s(ectrum)g(of) f Fq(H)4031 5101 y Fp(n)4023 5163 y(!)r(;\025)-118 5272 y Fs(implies)27 b(that)i(the)h(op)s(erator)e(\005)1045 5287 y Fp(>E)1152 5296 y Fc(0)1191 5272 y Fq(H)1280 5236 y Fp(n)1272 5298 y(!)r(;\025)1383 5272 y Fs(\005)1456 5287 y Fp(>E)1563 5296 y Fc(0)1630 5272 y Fs(has)i(sp)s(ectrum)g(b)s (elo)m(w)f(the)h(energy)p 2970 5192 79 4 v 30 w Fq(E)6 b Fs(\()p Fq(\025)p 3143 5217 65 4 v(!)s Fs(\))15 b Fo(\000)g Fq(\025)3409 5236 y Fi(1+)p Fp(\021)3558 5272 y Fs(+)g Fq(C)7 b(\025)3783 5236 y Fi(2)3823 5272 y Fs(.)42 b(Th)m(us,)-118 5388 y(w)m(e)34 b(ha)m(v)m(e)f(pro)m(v)m(ed)360 5552 y(\012\()p Fq(n;)17 b(\025;)g(\021)t Fs(\))28 b Fo(\032)894 5471 y Fn(\010)952 5552 y Fq(!)t Fs(;)48 b Fo(9)p Fq(')28 b Fo(2)g Fs(\005)1406 5567 y Fp(>E)1513 5576 y Fc(0)1552 5552 y Fq(H)1641 5511 y Fi(2)1680 5552 y Fq(;)49 b Fo(k)p Fq(')p Fo(k)27 b Fs(=)h(1)p Fq(;)49 b Fs(s.t.)44 b Fo(h)p Fq(H)2478 5511 y Fp(n)2470 5576 y(!)r(;\025)2580 5552 y Fq(';)17 b(')p Fo(i)27 b(\024)p 2924 5472 79 4 v 29 w Fq(E)6 b Fs(\()p Fq(\025)p 3097 5497 65 4 v(!)s Fs(\))22 b Fo(\000)g Fq(\025)3377 5511 y Fi(1+)p Fp(\021)3532 5552 y Fs(+)g Fq(C)7 b(\025)3764 5511 y Fi(2)3803 5471 y Fn(\011)3878 5552 y Fq(:)-4023 b Fs(\(2.11\))1989 5690 y Fg(8)p eop %%Page: 9 9 9 8 bop -118 241 a Fs(Let)32 b(us)i(estimate)d(the)i(probabilit)m(y)d (of)i(this)g(last)g(ev)m(en)m(t.)45 b(As)33 b Fq(V)2242 205 y Fp(n)2220 265 y(!)2321 241 y Fs(is)f(uniformly)e(b)s(ounded,)k(p) s(erturbation)d(theory)-118 357 y(tells)g(us)j(that,)e(for)g(some)g Fq(C)j(>)28 b Fs(0)k(and)h Fq(\025)f Fs(su\016cien)m(tly)h(small,)1071 537 y Fo(j)p Fq(E)1171 552 y Fm(\000)1230 537 y Fs(\()p Fq(\025)p Fs(\))21 b Fo(\000)i Fq(E)1556 552 y Fm(\000)1615 537 y Fs(\(0\))p Fo(j)f Fs(+)g Fo(j)p 1916 457 79 4 v Fq(E)6 b Fs(\()p Fq(\025)p 2089 483 65 4 v(!)s Fs(\))22 b Fo(\000)g Fq(E)2384 552 y Fm(\000)2444 537 y Fs(\(0\))p Fo(j)27 b(\024)h Fq(C)7 b Fo(j)p Fq(\025)p Fo(j)p Fq(:)-118 724 y Fs(Hence,)34 b(for)e Fq(')g Fs(as)h(in)f(\(2.11\))o(,)h(one)g (has)943 904 y Fo(h)p Fq(H)c Fo(\000)23 b Fq(E)1264 919 y Fm(\000)1323 904 y Fs(\(0\))p Fq(';)17 b(')p Fo(i)27 b(\024)h(j)p Fq(E)g Fo(\000)22 b Fq(E)2090 919 y Fm(\000)2150 904 y Fs(\(0\))p Fo(j)f Fs(+)h Fq(\025)p Fo(k)p Fq(V)2607 863 y Fp(n)2586 929 y(!)2654 904 y Fo(k)2704 919 y Fm(1)2807 904 y Fo(\024)28 b Fq(C)7 b(\025:)-3191 b Fs(\(2.12\))-118 1090 y(Rewrite)32 b(the)h(condition)e(in)h(\(2.11\))g(as)549 1278 y Fo(h)p Fs(\()p 626 1198 89 4 v Fq(H)714 1216 y Fp(n)714 1303 y(\025)p 755 1265 47 3 v(!)828 1278 y Fo(\000)p 928 1198 79 4 v 23 w Fq(E)6 b Fs(\()p Fq(\025)p 1101 1223 65 4 v(!)s Fs(\)\))p Fq(';)17 b(')p Fo(i)27 b(\024)h Fs(\()p Fo(\000)p Fq(\025)1756 1237 y Fi(1+)p Fp(\021)1910 1278 y Fs(+)22 b Fq(C)7 b(\025)2142 1237 y Fi(2)2182 1278 y Fs(\))p Fo(k)p Fq(')p Fo(k)2384 1237 y Fi(2)2445 1278 y Fs(+)22 b Fq(\025)p Fo(h)p Fs(\()p Fj(E)12 b Fs(\()p Fq(V)2859 1237 y Fp(n)2832 1303 y(!)2906 1278 y Fs(\))22 b Fo(\000)h Fq(V)3144 1237 y Fp(n)3123 1303 y(!)3191 1278 y Fs(\))p Fq(';)17 b(')p Fo(i)p Fq(:)-3585 b Fs(\(2.13\))-118 1480 y(Note)37 b(that)g Fj(E)12 b Fs(\()p Fq(V)493 1495 y Fp(!)549 1480 y Fs(\))35 b(=)g Fj(E)12 b Fs(\()p Fq(V)916 1444 y Fp(n)888 1504 y(!)963 1480 y Fs(\))35 b(=)p 1147 1425 V 35 w Fq(!)p 1211 1400 79 4 v 3 w(V)21 b Fs(.)57 b(By)37 b(the)g(de\014nition)f(of)p 2256 1400 V 37 w Fq(E)6 b Fs(\()p Fq(\025)p 2429 1425 65 4 v(!)s Fs(\),)38 b(for)e Fq(\025)h Fs(su\016cien)m(tly)g(small,)p 3623 1400 89 4 v 36 w Fq(H)3712 1418 y Fp(n)3712 1504 y(\025)p 3753 1467 47 3 v(!)3803 1480 y Fs(,)h(hence,)-118 1603 y(\005)-45 1618 y Fp(>E)62 1627 y Fc(0)p 100 1523 89 4 v 100 1603 a Fq(H)189 1541 y Fp(n)189 1628 y(\025)p 230 1590 47 3 v(!)280 1603 y Fs(\005)353 1618 y Fp(>E)460 1627 y Fc(0)532 1603 y Fs(has)c(no)g(sp)s(ectrum)g(in)e(the)i(in)m (terv)-5 b(al)33 b([)p Fq(E)2007 1618 y Fi(0)2046 1603 y Fq(;)p 2090 1523 79 4 v 17 w(E)6 b Fs(\()p Fq(\025)p 2263 1548 65 4 v(!)s Fs(\)\);)34 b(hence,)i(equation)d(\(2.13\))g (implies)e(that,)i(for)-118 1719 y(some)f Fq(')c Fo(2)g Fs(\005)385 1734 y Fp(>E)492 1743 y Fc(0)530 1719 y Fq(H)619 1683 y Fi(2)658 1719 y Fs(,)1308 1900 y Fo(h)p Fs(\()p Fj(E)12 b Fs(\()p Fq(V)1568 1859 y Fp(n)1540 1925 y(!)1615 1900 y Fs(\))22 b Fo(\000)g Fq(V)1853 1859 y Fp(n)1831 1925 y(!)1900 1900 y Fs(\))p Fq(';)17 b(')p Fo(i)27 b(\025)h Fq(\025)2338 1859 y Fp(\021)2380 1900 y Fq(=)p Fs(2)p Fo(k)p Fq(')p Fo(k)2642 1859 y Fi(2)2680 1900 y Fq(:)-2825 b Fs(\(2.14\))-118 2090 y(Indeed,)34 b(if)d(this)i(is)f(not)g(the)h (case,)h(then)f(\(2.13\))f(implies)e(that,)i(for)g(some)h Fq(')27 b Fo(2)h Fs(\005)2904 2105 y Fp(>E)3011 2114 y Fc(0)3050 2090 y Fq(H)3139 2054 y Fi(2)3178 2090 y Fs(,)1009 2278 y Fo(h)p Fs(\()p 1086 2198 89 4 v Fq(H)1174 2216 y Fp(n)1174 2303 y(\025)p 1215 2265 47 3 v(!)1288 2278 y Fo(\000)p 1387 2198 79 4 v 22 w Fq(E)6 b Fs(\()p Fq(\025)p 1560 2223 65 4 v(!)t Fs(\)\))p Fq(';)17 b(')p Fo(i)26 b(\024)j Fs(\()p Fo(\000)p Fq(\025)2216 2237 y Fi(1+)p Fp(\021)2348 2278 y Fq(=)p Fs(2)22 b(+)g Fq(C)7 b(\025)2700 2237 y Fi(2)2739 2278 y Fs(\))p Fo(k)p Fq(')p Fo(k)2941 2237 y Fi(2)2980 2278 y Fq(:)-118 2480 y Fs(whic)m(h)32 b(means)g(that,)f(for)g Fq(\025)h Fs(su\016cien)m(tly)g(small,)e(\005) 1774 2495 y Fp(>E)1881 2504 y Fc(0)p 1919 2400 89 4 v 1919 2480 a Fq(H)2008 2418 y Fp(n)2008 2505 y(\025)p 2049 2467 47 3 v(!)2099 2480 y Fs(\005)2172 2495 y Fp(>E)2279 2504 y Fc(0)2349 2480 y Fs(has)i(sp)s(ectrum)g(in)f(the)h(in)m(terv)-5 b(al)31 b([)p Fq(E)3678 2495 y Fi(0)3717 2480 y Fq(;)p 3761 2400 79 4 v 17 w(E)6 b Fs(\()p Fq(\025)p 3934 2425 65 4 v(!)s Fs(\))20 b Fo(\000)-118 2596 y Fq(\025)-61 2560 y Fi(1+)p Fp(\021)71 2596 y Fq(=)p Fs(4\).)43 b(So,)32 b(taking)i(\(2.11\))d(in)m(to)h(accoun)m(t,)i(w)m(e)f(pro)m(v)m(ed)h (that)1529 2777 y(\012\()p Fq(n;)17 b(\025;)g(\021)t Fs(\))27 b Fo(\032)i Fs(\012)2133 2735 y Fm(0)2156 2777 y Fs(\()p Fq(n;)17 b(\025;)g(\021)t Fs(\))-118 2957 y(where)389 3138 y(\012)459 3096 y Fm(0)483 3138 y Fs(\()p Fq(n;)g(\025;)g(\021)t Fs(\))26 b(=)944 3057 y Fn(\010)1002 3138 y Fq(!)t Fs(;)49 b Fo(9)p Fq(')28 b Fo(2)g Fs(\005)1457 3153 y Fp(>E)1564 3162 y Fc(0)1602 3138 y Fq(H)1691 3096 y Fi(2)1730 3138 y Fq(;)49 b Fo(k)p Fq(')p Fo(k)27 b Fs(=)h(1)p Fq(;)49 b Fs(s.t.)44 b(equations)33 b(\(2.12\))f(and)g(\(2.14\))g(hold)3774 3057 y Fn(\011)3849 3138 y Fq(:)-118 3328 y Fs(Let)g(us)g(no)m(w)h (estimate)e(the)h(probabilit)m(y)e(of)h(\012)1618 3292 y Fm(0)1642 3328 y Fs(\()p Fq(n;)17 b(\025;)g(\021)t Fs(\).)42 b(W)-8 b(rite)32 b Fq(')27 b Fo(2)h Fs(\005)2571 3343 y Fp(>E)2678 3352 y Fc(0)2717 3328 y Fq(H)2806 3292 y Fi(2)2876 3328 y Fs(using)k(the)g(Flo)s(quet)f(decomp)s(osi-)-118 3444 y(tion)g(in)m(tro)s(duced)i(in)f(section)h(2.2)1419 3652 y Fq(')27 b Fs(=)1622 3558 y Fn(X)1614 3768 y Fp(p)p Fm(\025)p Fp(p)1741 3777 y Fc(0)1791 3517 y Fn(Z)1846 3742 y Fl(T)1896 3723 y Fd(\003)1947 3652 y Fq(\037)2008 3667 y Fp(p)2048 3652 y Fs(\()p Fq(\022)s Fs(\))p Fq(')2236 3667 y Fp(p)2276 3652 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\))p Fq(d\022)s(:)-2716 b Fs(\(2.15\))-118 3938 y(The)33 b(index)g Fq(p)394 3953 y Fi(0)466 3938 y Fs(is)f(the)h(largest)f (index)h Fq(p)f Fs(so)h(that,)g(for)f(all)e Fq(\022)h Fo(2)d Fj(T)2267 3902 y Fm(\003)2310 3938 y Fs(,)33 b(one)f(has)h Fq(E)2794 3953 y Fp(p)p Fm(\000)p Fi(1)2924 3938 y Fs(\()p Fq(\022)s Fs(\))28 b Fo(\024)g Fq(E)3253 3953 y Fi(0)3293 3938 y Fs(.)-118 4054 y(By)34 b(assumption)e(\(H.2\),)i Fq(E)910 4069 y Fm(\000)969 4054 y Fs(\(0\))f(is)f(a)h(simple)f (degenerate)i(Flo)s(quet)f(eigen)m(v)-5 b(alue)33 b(of)f Fq(H)41 b Fs(i.e.,)33 b(hence,)i(there)f(exists)-118 4171 y Fq(C)h(>)27 b Fs(0)32 b(suc)m(h)i(that)8 4319 y Fo(\017)41 b Fs(for)32 b Fq(p)c Fo(6)p Fs(=)f Fq(p)477 4334 y Fi(0)517 4319 y Fs(,)32 b Fo(8)p Fq(\022)f Fo(2)d Fj(T)864 4283 y Fm(\003)907 4319 y Fs(,)1560 4499 y Fo(j)p Fq(E)1660 4514 y Fp(p)1722 4499 y Fo(\000)22 b Fq(E)1893 4514 y Fm(\000)1952 4499 y Fs(\(0\))p Fo(j)27 b(\025)i Fs(1)p Fq(=C)7 b Fs(;)-2558 b(\(2.16\))8 4693 y Fo(\017)41 b Fs(there)33 b(exists)h Fq(Z)g Fs(=)28 b Fo(f)p Fq(\022)918 4708 y Fp(j)954 4693 y Fs(;)50 b(1)27 b Fo(\024)h Fq(j)34 b Fo(\024)28 b Fq(n)1449 4708 y Fp(z)1489 4693 y Fo(g)k Fs(suc)m(h)i(that)f Fq(E)2075 4708 y Fp(p)2111 4717 y Fc(0)2149 4693 y Fs(\()p Fq(\022)2232 4708 y Fp(j)2269 4693 y Fs(\))28 b(=)f Fq(E)2510 4708 y Fm(\000)2570 4693 y Fs(\(0\))32 b(and)g(for)h Fq(\022)d Fo(2)e Fj(R)3301 4657 y Fp(d)3348 4693 y Fs(,)k(one)h(has)1233 4877 y Fo(j)p Fq(E)1333 4892 y Fp(p)1369 4901 y Fc(0)1429 4877 y Fo(\000)23 b Fq(E)1601 4892 y Fm(\000)1660 4877 y Fs(\(0\))p Fo(j)k(\025)h Fs(1)p Fq(=C)92 b Fs(inf)2136 4938 y Fi(1)p Fm(\024)p Fp(j)t Fm(\024)p Fp(n)2357 4946 y Fk(z)2409 4877 y Fo(j)p Fq(\022)25 b Fo(\000)e Fq(\022)2652 4892 y Fp(j)2689 4877 y Fo(j)2717 4836 y Fi(2)2756 4877 y Fq(:)-2901 b Fs(\(2.17\))-118 5103 y(W)-8 b(e)33 b(refer)g(to)f (section)h(5.1)f(for)g(more)g(details)f(on)i(these)h(prop)s(erties.) -118 5219 y(Equation)e(\(2.12\))g(implies)e(that)1119 5357 y Fn(X)1111 5568 y Fp(p)p Fm(\025)p Fp(p)1238 5577 y Fc(0)1288 5317 y Fn(Z)1344 5542 y Fl(T)1394 5523 y Fd(\003)1445 5452 y Fo(j)p Fq(E)1545 5467 y Fp(p)1584 5452 y Fs(\()p Fq(\022)s Fs(\))22 b Fo(\000)h Fq(E)1902 5467 y Fm(\000)1961 5452 y Fs(\(0\))p Fo(j)2114 5411 y Fi(2)2153 5452 y Fo(j)p Fq(\037)2242 5467 y Fp(p)2281 5452 y Fs(\()p Fq(\022)s Fs(\))p Fo(j)2433 5411 y Fi(2)2473 5452 y Fq(d\022)30 b Fo(\024)e Fq(C)7 b(\025)2838 5411 y Fi(2)2878 5452 y Fq(:)-3023 b Fs(\(2.18\))1989 5690 y Fg(9)p eop %%Page: 10 10 10 9 bop -118 245 a Fs(Fix)43 b(2)p Fq(l)31 b Fs(+)f(1)46 b(=)g([)p Fq(\025)584 209 y Fm(\000)p Fi(1)p Fp(=)p Fi(2+2)p Fp(\021)871 185 y Fd(0)899 245 y Fs(])926 260 y Fp(o)994 245 y Fo(\001)29 b Fs([)p Fq(\025)1135 209 y Fm(\000)p Fp(\021)1227 185 y Fd(0)1255 245 y Fs(])1282 260 y Fp(o)1364 245 y Fs(and)43 b(2)p Fq(k)33 b Fs(+)c(1)46 b(=)g([)p Fq(\025)2103 209 y Fm(\000)p Fp(\032)2199 245 y Fs(])2226 260 y Fp(o)2307 245 y Fs(where)f Fq(\021)50 b(<)c(\021)2872 209 y Fm(0)2942 245 y Fq(<)g(d=)p Fs(\(4)p Fq(d)28 b Fs(+)i(4\))43 b(is)g(\014xed)i(as)f(in)-118 361 y(Prop)s(osition)29 b(2.1.)42 b(Note)31 b(that)g(2)p Fq(n)18 b Fs(+)h(1)27 b(=)h(\(2)p Fq(l)20 b Fs(+)e(1\)\(2)p Fq(k)j Fs(+)e(1\).)42 b(Equations)31 b(\(2.18\))o(,)g(\(2.16\))f(and)h(\(2.17\))f(imply)f (that)623 476 y Fn(X)615 686 y Fp(p>p)742 695 y Fc(0)792 435 y Fn(Z)847 661 y Fl(T)897 642 y Fd(\003)948 571 y Fo(j)p Fq(\037)1037 586 y Fp(p)1077 571 y Fs(\()p Fq(\022)s Fs(\))p Fo(j)1229 530 y Fi(2)1268 571 y Fq(d\022)c Fs(+)1543 476 y Fn(X)1487 687 y Fi(1)p Fm(\024)p Fp(j)t Fm(\024)p Fp(n)1708 695 y Fk(z)1760 435 y Fn(Z)1815 661 y Fm(j)p Fp(\022)r Fm(\000)p Fp(\022)1958 671 y Fk(j)1990 661 y Fm(j)p Fp(>)p Fi(1)p Fp(=l)2178 571 y Fo(j)p Fq(\037)2267 586 y Fp(p)2303 595 y Fc(0)2341 571 y Fs(\()p Fq(\022)s Fs(\))p Fo(j)2493 530 y Fi(2)2532 571 y Fq(d\022)30 b Fo(\024)e Fq(C)7 b(\025)2897 530 y Fi(2)2937 571 y Fq(l)2968 530 y Fi(2)3035 571 y Fo(\024)28 b Fq(C)7 b(\025)3274 530 y Fi(2)p Fp(\021)3346 507 y Fd(0)3374 571 y Fq(:)-118 827 y Fs(Hence,)34 b(w)m(e)g(write)395 1032 y Fq(')28 b Fs(=)646 937 y Fn(X)590 1147 y Fi(1)p Fm(\024)p Fp(j)t Fm(\024)p Fp(n)811 1155 y Fk(z)863 1032 y Fq(')927 1047 y Fp(j)985 1032 y Fs(+)22 b Fq(')1147 1047 y Fp(e)1217 1032 y Fs(where)34 b Fq(')1563 1047 y Fp(j)1627 1032 y Fs(=)1730 896 y Fn(Z)1786 1121 y Fm(j)p Fp(\022)r Fm(\000)p Fp(\022)1929 1131 y Fk(j)1960 1121 y Fm(j\024)p Fi(1)p Fp(=l)2148 1032 y Fq(\037)2209 1047 y Fp(p)2245 1056 y Fc(0)2283 1032 y Fs(\()p Fq(\022)s Fs(\))p Fq(')2471 1047 y Fp(p)2507 1056 y Fc(0)2546 1032 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\))p Fq(d\022)34 b Fs(and)f Fo(k)p Fq(')3176 1047 y Fp(e)3213 1032 y Fo(k)27 b(\024)h Fq(C)7 b(\025)3529 990 y Fp(\021)3566 967 y Fd(0)3594 1032 y Fq(:)-3739 b Fs(\(2.19\))-118 1289 y(W)-8 b(e)33 b(note)g(that)1182 1351 y Fn(X)1126 1562 y Fi(1)p Fm(\024)p Fp(j)t Fm(\024)p Fp(n)1347 1570 y Fk(z)1399 1446 y Fo(k)p Fq(')1513 1461 y Fp(j)1549 1446 y Fo(k)1599 1405 y Fi(2)1666 1446 y Fs(=)27 b Fo(k)p Fq(')p Fo(k)1933 1405 y Fi(2)1994 1446 y Fo(\000)c Fq(C)7 b(\025)2228 1405 y Fi(2)p Fp(\021)2300 1381 y Fd(0)2355 1446 y Fs(=)28 b(1)22 b Fo(\000)g Fq(C)7 b(\025)2763 1405 y Fi(2)p Fp(\021)2835 1381 y Fd(0)2863 1446 y Fq(:)-3008 b Fs(\(2.20\))-118 1709 y(Pluging)32 b(\(2.19\))g(in)m(to)g(\(2.14\))o(,)h(for)f Fq(\025)g Fs(su\016cien)m(tly)i(small,)c(w)m(e)k(get)1290 1793 y Fn(X)1199 2006 y Fi(1)p Fm(\024)p Fp(j;j)1371 1987 y Fd(0)1392 2006 y Fm(\024)p Fp(n)1490 2014 y Fk(z)1525 1888 y Fo(h)p Fs(\()p Fj(E)12 b Fs(\()p Fq(V)1785 1846 y Fp(n)1757 1912 y(!)1832 1888 y Fs(\))22 b Fo(\000)h Fq(V)2070 1846 y Fp(n)2049 1912 y(!)2117 1888 y Fs(\))p Fq(')2219 1903 y Fp(j)2255 1888 y Fq(;)17 b(')2363 1903 y Fp(j)2396 1884 y Fd(0)2422 1888 y Fo(i)27 b(\025)h Fq(\025)2650 1846 y Fp(\021)2692 1888 y Fq(=)p Fs(4)p Fq(:)-118 2153 y Fs(By)34 b(\(2.20\),)e(this)g(implies)f(that,)h(for)g (some)g(1)c Fo(\024)g Fq(j;)17 b(j)1810 2116 y Fm(0)1861 2153 y Fo(\024)28 b Fq(n)2024 2168 y Fp(z)2064 2153 y Fs(,)33 b(one)g(has)1255 2311 y Fo(h)p Fs(\()p Fj(E)12 b Fs(\()p Fq(V)1515 2270 y Fp(n)1487 2335 y(!)1562 2311 y Fs(\))22 b Fo(\000)h Fq(V)1800 2270 y Fp(n)1779 2335 y(!)1847 2311 y Fs(\))p Fq(')1949 2326 y Fp(j)1985 2311 y Fq(;)17 b(')2093 2326 y Fp(j)2126 2307 y Fd(0)2152 2311 y Fo(i)27 b(\025)i Fq(\025)2381 2270 y Fp(\021)2422 2311 y Fq(=)p Fs(\(2)p Fq(n)2616 2326 y Fp(z)2656 2311 y Fs(\))2694 2270 y Fi(2)2733 2311 y Fq(:)-2878 b Fs(\(2.21\))-118 2474 y(Let)33 b(us)g(study)h(the)f(functions)f(\()p Fq(')1141 2489 y Fp(j)1178 2474 y Fs(\))1216 2489 y Fi(1)p Fm(\024)p Fp(j)t Fm(\024)p Fp(n)1437 2497 y Fk(z)1508 2474 y Fs(in)g(more)g (detail.)42 b(W)-8 b(e)33 b(pro)m(v)m(e)-118 2651 y Fw(Lemma)k(2.1.)49 b Ff(Fix)34 b Fs(1)28 b Fo(\024)g Fq(j)34 b Fo(\024)28 b Fq(n)1094 2666 y Fp(z)1134 2651 y Ff(.)44 b(F)-7 b(or)34 b Fs(1)28 b Fo(\024)g Fq(l)1603 2614 y Fm(0)1654 2651 y Fo(\024)g Fq(l)r Ff(,)35 b(ther)-5 b(e)35 b(exists)50 b Fs(~)-64 b Fq(')2429 2666 y Fp(j)2493 2651 y Fo(2)28 b Fq(L)2653 2614 y Fi(2)2693 2651 y Fs(\()p Fj(R)2797 2614 y Fp(d)2843 2651 y Fs(\))35 b Ff(such)g(that)-18 2787 y Fs(1.)57 b(~)-65 b Fq(')163 2802 y Fp(j)234 2787 y Ff(is)35 b(c)-5 b(onstant)34 b(on)h(e)-5 b(ach)34 b(cub)-5 b(e)478 2945 y Fq(C)548 2960 y Fp(\015)t(;l)630 2941 y Fd(0)684 2945 y Fs(=)27 b Fo(f)p Fq(x)h Fs(=)g(\()p Fq(x)1117 2960 y Fi(1)1157 2945 y Fq(;)17 b(:)g(:)g(:)e(;)i(x)1430 2960 y Fp(d)1471 2945 y Fs(\);)51 b Fo(8)p Fs(1)28 b Fo(\024)g Fq(i)g Fo(\024)h Fq(d;)51 b Fo(\000)p Fq(l)2228 2903 y Fm(0)2274 2945 y Fo(\000)23 b Fs(1)p Fq(=)p Fs(2)k Fo(\024)h Fq(x)2708 2960 y Fp(i)2758 2945 y Fo(\000)23 b Fs(\(2)p Fq(l)2976 2903 y Fm(0)3021 2945 y Fs(+)g(1\))p Fq(\015)3258 2960 y Fp(i)3313 2945 y Fq(<)k(l)3447 2903 y Fm(0)3493 2945 y Fs(+)22 b(1)p Fq(=)p Fs(2)p Fo(g)99 3115 y Ff(wher)-5 b(e)34 b Fq(\015)f Fs(=)27 b(\()p Fq(\015)650 3130 y Fi(1)689 3115 y Fq(;)17 b(:)g(:)g(:)f(;)h(\015)959 3130 y Fp(d)999 3115 y Fs(\))28 b Fo(2)g Fj(Z)1228 3079 y Fp(d)1265 3115 y Ff(;)-18 3231 y Fs(2.)41 b Ff(ther)-5 b(e)35 b(exists)f Fq(C)h(>)27 b Fs(0)35 b Ff(\(dep)-5 b(ending)33 b(only)i(on)f Fq(')1808 3246 y Fp(p)1844 3255 y Fc(0)1883 3231 y Ff(\))1258 3389 y Fo(k)p Fq(')1372 3404 y Fp(j)1408 3389 y Fs(\()p Fo(\001)p Fs(\))22 b Fo(\000)38 b Fs(~)-64 b Fq(')1698 3404 y Fp(j)1734 3389 y Fs(\()p Fo(\001)p Fs(\))22 b Fo(\001)g Fq( )1973 3404 y Fp(p)2009 3413 y Fc(0)2047 3389 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)2202 3404 y Fp(j)2239 3389 y Fs(\))p Fo(k)2327 3405 y Fp(L)2375 3387 y Fc(2)2441 3389 y Fo(\024)28 b Fq(C)7 b(l)2654 3348 y Fm(0)2677 3389 y Fq(=l)-2873 b Fs(\(2.22\))-118 3559 y Ff(wher)-5 b(e)34 b Fq( )220 3574 y Fp(p)256 3583 y Fc(0)295 3559 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\))34 b Ff(is)h(the)g(p)-5 b(erio)g(dic)33 b(c)-5 b(omp)g(onent)34 b(of)h Fq(')1821 3574 y Fp(p)1857 3583 y Fc(0)1895 3559 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\))34 b Ff(i.e.)45 b Fq(')2369 3574 y Fp(p)2405 3583 y Fc(0)2443 3559 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\))27 b(=)g Fq(e)2814 3523 y Fp(ix\022)2917 3559 y Fq( )2980 3574 y Fp(p)3016 3583 y Fc(0)3055 3559 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\))p Ff(.)-118 3734 y Fs(W)-8 b(e)40 b(p)s(ostp)s(one)g(the)g(pro)s(of)e(of)h(Lemma)f(2.1)h(to)h (complete)e(the)i(pro)s(of)f(of)g(Prop)s(osition)f(2.1.)64 b(W)-8 b(e)40 b(set)g(2)p Fq(l)3817 3698 y Fm(0)3867 3734 y Fs(+)27 b(1)39 b(=)-118 3850 y([)p Fq(\025)-34 3814 y Fm(\000)p Fi(1)p Fp(=)p Fi(2+2)p Fp(\021)253 3791 y Fd(0)281 3850 y Fs(])308 3865 y Fp(o)384 3850 y Fs(and)f(2)p Fq(k)682 3814 y Fm(0)731 3850 y Fs(+)26 b(1)37 b(=)f([)p Fq(\025)1115 3814 y Fm(\000)p Fp(\032)1210 3850 y Fs(])1237 3865 y Fp(o)1302 3850 y Fo(\001)25 b Fs([)p Fq(\025)1439 3814 y Fm(\000)p Fp(\021)1531 3791 y Fd(0)1558 3850 y Fs(])1585 3865 y Fp(o)1661 3850 y Fs(where)40 b Fq(\021)g(<)d(\021)2202 3814 y Fm(0)2262 3850 y Fq(<)f(d=)p Fs(\(4)p Fq(d)25 b Fs(+)g(4\))38 b(is)g(\014xed)h(as)f(in)f(Prop)s(osition)f(2.1.)-118 3966 y(Note)d(that)f(2)p Fq(n)22 b Fs(+)g(1)28 b(=)f(\(2)p Fq(l)854 3930 y Fm(0)899 3966 y Fs(+)c(1\)\(2)p Fq(k)1226 3930 y Fm(0)1270 3966 y Fs(+)f(1\).)44 b(Using)32 b(p)s(oin)m(t)g (\(1\))g(of)g(Lemma)f(2.1,)h(w)m(e)i(de\014ne)504 4145 y(\011)580 4160 y Fp(j)616 4145 y Fs(\()p Fq(x)p Fs(\))28 b(=)g Fq( )942 4160 y Fp(p)978 4169 y Fc(0)1016 4145 y Fs(\()p Fq(x;)17 b(\022)1198 4160 y Fp(j)1235 4145 y Fs(\))f(~)-65 b Fq(')1337 4160 y Fp(j)1374 4145 y Fs(\()p Fq(x)p Fs(\))28 b(=)f Fq( )1699 4160 y Fp(p)1735 4169 y Fc(0)1774 4145 y Fs(\()p Fq(x;)17 b(\022)1956 4160 y Fp(j)1993 4145 y Fs(\))2061 4051 y Fn(X)2048 4270 y Fp(\014)s Fm(2)p Fl(Z)2188 4251 y Fk(d)2218 4145 y Fs(\(2)p Fq(l)2336 4104 y Fm(0)2381 4145 y Fs(+)22 b(1\))2566 4104 y Fm(\000)p Fp(d=)p Fi(2)2732 4145 y Fq(a)2783 4160 y Fp(j)2820 4145 y Fs(\()p Fq(\014)6 b Fs(\))p Fw(1)3013 4161 y Fi(\(2)p Fp(l)3097 4142 y Fd(0)3119 4161 y Fi(+1\))p Fp(\014)s Fi(+)p Fp(C)3384 4180 y Fc(0)p Fk(;l)3453 4166 y Fd(0)3485 4145 y Fq(:)-118 4425 y Fs(As)33 b Fq( )89 4440 y Fp(p)125 4449 y Fc(0)164 4425 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)319 4440 y Fp(j)355 4425 y Fs(\))f(~)-65 b Fq(')457 4440 y Fp(j)493 4425 y Fs(\()p Fo(\001)p Fs(\))28 b Fo(2)g Fq(L)785 4388 y Fi(2)824 4425 y Fs(\()p Fj(R)928 4388 y Fp(d)975 4425 y Fs(\),)k(using)h(the)g(p)s(erio)s(dicit)m(y)d (of)i Fq( )2157 4440 y Fp(p)2193 4449 y Fc(0)2232 4425 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)2387 4440 y Fp(j)2423 4425 y Fs(\),)33 b(w)m(e)h(compute)501 4637 y Fo(k)p Fq( )614 4652 y Fp(p)650 4661 y Fc(0)688 4637 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)843 4652 y Fp(j)880 4637 y Fs(\))f(~)-65 b Fq(')982 4652 y Fp(j)1018 4637 y Fo(k)1068 4596 y Fi(2)1068 4666 y Fp(L)1116 4647 y Fc(2)1151 4666 y Fi(\()p Fl(R)1226 4647 y Fk(d)1262 4666 y Fi(\))1321 4637 y Fs(=)1438 4543 y Fn(X)1425 4762 y Fp(\014)s Fm(2)p Fl(Z)1565 4743 y Fk(d)1595 4637 y Fs(\(2)p Fq(l)1713 4596 y Fm(0)1759 4637 y Fs(+)22 b(1\))1944 4596 y Fm(\000)p Fp(d)2039 4637 y Fo(j)p Fq(a)2118 4652 y Fp(j)2154 4637 y Fs(\()p Fq(\014)6 b Fs(\))p Fo(j)2319 4596 y Fi(2)2374 4502 y Fn(Z)2430 4727 y Fi(\(2)p Fp(l)2514 4708 y Fd(0)2537 4727 y Fi(+1\))p Fp(\014)s Fi(+)p Fp(C)2802 4746 y Fc(0)p Fk(;l)2871 4732 y Fd(0)2919 4637 y Fo(j)p Fq( )3010 4652 y Fp(p)3046 4661 y Fc(0)3085 4637 y Fs(\()p Fq(x;)17 b(\022)3267 4652 y Fp(j)3304 4637 y Fs(\))p Fo(j)3370 4596 y Fi(2)3409 4637 y Fq(dx)1321 4958 y Fs(=)1438 4864 y Fn(X)1425 5083 y Fp(\014)s Fm(2)p Fl(Z)1565 5064 y Fk(d)1612 4958 y Fo(j)p Fq(a)1691 4973 y Fp(j)1727 4958 y Fs(\()p Fq(\014)6 b Fs(\))p Fo(j)1892 4917 y Fi(2)1948 4823 y Fn(Z)2003 5048 y Fp(C)2053 5057 y Fc(0)p Fk(;)p Fc(0)2158 4958 y Fo(j)p Fq( )2249 4973 y Fp(p)2285 4982 y Fc(0)2323 4958 y Fs(\()p Fq(x;)17 b(\022)2505 4973 y Fp(j)2542 4958 y Fs(\))p Fo(j)2608 4917 y Fi(2)2647 4958 y Fq(dx:)-118 5236 y Fs(Hence,)34 b(as)319 5155 y Fn(R)366 5270 y Fp(C)416 5279 y Fc(0)p Fk(;)p Fc(0)521 5236 y Fo(j)p Fq(')613 5251 y Fp(p)649 5260 y Fc(0)687 5236 y Fs(\()p Fq(x;)17 b(\022)869 5251 y Fp(j)906 5236 y Fs(\))p Fo(j)972 5199 y Fi(2)1011 5236 y Fq(dx)27 b Fs(=)1248 5155 y Fn(R)1295 5270 y Fp(C)1345 5279 y Fc(0)p Fk(;)p Fc(0)1450 5236 y Fo(j)p Fq( )1541 5251 y Fp(p)1577 5260 y Fc(0)1615 5236 y Fs(\()p Fq(x;)17 b(\022)1797 5251 y Fp(j)1834 5236 y Fs(\))p Fo(j)1900 5199 y Fi(2)1939 5236 y Fq(dx)33 b Fs(is)f(p)s(ositiv)m(e,)g(b)m(y)j(\(2.22\))o(,)e(w)m (e)h(get)1283 5348 y Fn(X)1270 5568 y Fp(\014)s Fm(2)p Fl(Z)1410 5549 y Fk(d)1457 5443 y Fo(j)p Fq(a)1536 5458 y Fp(j)1573 5443 y Fs(\()p Fq(\014)6 b Fs(\))p Fo(j)1738 5402 y Fi(2)1804 5443 y Fo(\024)28 b Fq(C)7 b Fo(k)p Fq(')2100 5458 y Fp(j)2136 5443 y Fo(k)2186 5402 y Fi(2)2186 5471 y Fp(L)2234 5452 y Fc(2)2269 5471 y Fi(\()p Fl(R)2344 5452 y Fk(d)2380 5471 y Fi(\))2439 5443 y Fq(<)28 b Fs(+)p Fo(1)p Fq(:)-2864 b Fs(\(2.23\))1969 5690 y Fg(10)p eop %%Page: 11 11 11 10 bop -118 241 a Fs(By)34 b(\(2.22\))e(and)h(the)g(de\014nitions)f (of)g Fq(l)j Fs(and)d Fq(l)1543 205 y Fm(0)1567 241 y Fs(,)h(the)g(lo)m(w)m(er)f(b)s(ound)h(\(2.21\))f(implies)e(that)1083 448 y Fo(h)p Fs(\()p Fj(E)13 b Fs(\()p Fq(V)1343 407 y Fp(n)1316 472 y(!)1390 448 y Fs(\))22 b Fo(\000)h Fq(V)1628 407 y Fp(n)1607 472 y(!)1675 448 y Fs(\)\011)1789 463 y Fp(j)1826 448 y Fq(;)17 b Fs(\011)1946 463 y Fp(j)1979 444 y Fd(0)2004 448 y Fo(i)27 b(\025)i Fq(\025)2233 407 y Fp(\021)2274 448 y Fq(=)p Fs(\(2)p Fq(n)2468 463 y Fp(z)2508 448 y Fs(\))2546 407 y Fi(2)2607 448 y Fo(\000)23 b Fq(C)7 b(\025)2841 407 y Fp(\021)2878 383 y Fd(0)2905 448 y Fq(:)-3050 b Fs(\(2.24\))-118 651 y(Let)33 b(us)g(compute)f Fo(h)p Fs(\()p Fj(E)13 b Fs(\()p Fq(V)837 615 y Fp(n)810 676 y(!)884 651 y Fs(\))22 b Fo(\000)h Fq(V)1122 615 y Fp(n)1101 676 y(!)1169 651 y Fs(\)\011)1283 666 y Fp(j)1320 651 y Fq(;)17 b Fs(\011)1440 666 y Fp(j)1473 647 y Fd(0)1498 651 y Fo(i)p Fs(.)43 b(One)33 b(has)211 874 y Fo(h)p Fs(\()p Fj(E)12 b Fs(\()p Fq(V)471 833 y Fp(n)443 898 y(!)518 874 y Fs(\))22 b Fo(\000)h Fq(V)756 833 y Fp(n)735 898 y(!)803 874 y Fs(\)\011)917 889 y Fp(j)953 874 y Fq(;)17 b Fs(\011)1073 889 y Fp(j)1106 870 y Fd(0)1132 874 y Fo(i)27 b Fs(=)1315 779 y Fn(X)1302 999 y Fp(\014)s Fm(2)p Fl(Z)1442 980 y Fk(d)1558 779 y Fn(X)1489 1003 y Fp(\015)t Fm(2)p Fl(Z)1627 980 y Fk(d)1627 1024 y Fc(2)p Fk(n)p Fc(+1)1771 874 y Fs(\()p 1809 819 65 4 v Fq(!)e Fo(\000)e Fq(!)2056 889 y Fp(\015)2100 874 y Fs(\)\(2)p Fq(l)2256 833 y Fm(0)2301 874 y Fs(+)f(1\))2486 833 y Fm(\000)p Fp(d)2581 874 y Fq(a)2632 889 y Fp(j)2669 874 y Fs(\()p Fq(\014)6 b Fs(\))p 2806 787 247 4 v Fq(a)2857 889 y Fp(j)2890 870 y Fd(0)2915 874 y Fs(\()p Fq(\014)g Fs(\))1754 1078 y Fn(Z)1809 1304 y Fi(\(2)p Fp(l)1893 1285 y Fd(0)1916 1304 y Fi(+1\))p Fp(\014)s Fi(+)p Fp(C)2181 1323 y Fc(0)p Fk(;l)2250 1309 y Fd(0)2298 1214 y Fq(V)2377 1173 y Fp(n)2424 1214 y Fs(\()p Fq(x)22 b Fo(\000)h Fq(\015)5 b Fs(\))p Fq( )2796 1229 y Fp(p)2832 1238 y Fc(0)2871 1214 y Fs(\()p Fq(x;)17 b(\022)3053 1229 y Fp(j)3090 1214 y Fs(\))p 3128 1127 418 4 v Fq( )3191 1229 y Fp(p)3227 1238 y Fc(0)3265 1214 y Fs(\()p Fq(x;)g(\022)3447 1229 y Fp(j)3480 1210 y Fd(0)3507 1214 y Fs(\))p Fq(dx)584 1474 y Fs(=)721 1380 y Fn(X)687 1599 y Fp(\014)730 1580 y Fd(00)771 1599 y Fm(2)p Fl(Z)868 1580 y Fk(d)1005 1380 y Fn(X)915 1603 y Fp(\014)958 1584 y Fd(0)980 1603 y Fm(2)p Fl(Z)1077 1580 y Fk(d)1077 1634 y Fc(2)p Fk(k)1141 1620 y Fd(0)1158 1634 y Fc(+1)1325 1380 y Fn(X)1256 1603 y Fp(\015)t Fm(2)p Fl(Z)1394 1580 y Fk(d)1394 1624 y Fc(2)p Fk(n)p Fc(+1)1538 1474 y Fs(\()p 1576 1420 65 4 v Fq(!)25 b Fo(\000)e Fq(!)1823 1489 y Fp(\015)1867 1474 y Fs(\)\(2)p Fq(l)2023 1433 y Fm(0)2068 1474 y Fs(+)f(1\))2253 1433 y Fm(\000)p Fp(d)2348 1474 y Fq(a)2399 1489 y Fp(j)2436 1474 y Fs(\()p Fq(\014)2535 1433 y Fm(0)2580 1474 y Fs(+)g(\(2)p Fq(k)2819 1433 y Fm(0)2864 1474 y Fs(+)g(1\))p Fq(\014)3110 1433 y Fm(0)o(0)3152 1474 y Fs(\))p 3190 1388 864 4 v Fq(a)3241 1489 y Fp(j)3274 1470 y Fd(0)3300 1474 y Fs(\()p Fq(\014)3399 1446 y Fm(0)3444 1474 y Fs(+)g(\(2)p Fq(k)3683 1446 y Fm(0)3728 1474 y Fs(+)g(1\))p Fq(\014)3974 1446 y Fm(0)o(0)4016 1474 y Fs(\))1754 1689 y Fn(Z)1809 1914 y Fp(C)1859 1933 y Fc(0)p Fk(;l)1928 1919 y Fd(0)1976 1824 y Fq(V)2054 1783 y Fp(n)2101 1824 y Fs(\()p Fq(x)h Fo(\000)f Fq(\015)28 b Fs(+)22 b(\(2)p Fq(l)2611 1783 y Fm(0)2656 1824 y Fs(+)g(1\))p Fq(\014)2902 1783 y Fm(0)2925 1824 y Fs(\))p Fq( )3026 1839 y Fp(p)3062 1848 y Fc(0)3100 1824 y Fs(\()p Fq(x;)17 b(\022)3282 1839 y Fp(j)3319 1824 y Fs(\))p 3357 1737 418 4 v Fq( )3420 1839 y Fp(p)3456 1848 y Fc(0)3495 1824 y Fs(\()p Fq(x;)g(\022)3677 1839 y Fp(j)3710 1820 y Fd(0)3736 1824 y Fs(\))p Fq(dx:)-118 2115 y Fs(as)33 b Fq(V)80 2079 y Fp(n)160 2115 y Fs(is)f(\(2)p Fq(n)22 b Fs(+)g(1\))p Fj(Z)679 2079 y Fp(d)716 2115 y Fs(-p)s(erio)s(dic)31 b(and)i(\(2)p Fq(l)1431 2079 y Fm(0)1476 2115 y Fs(+)22 b(1\)\(2)p Fq(k)1802 2079 y Fm(0)1847 2115 y Fs(+)g(1\))27 b(=)h(\(2)p Fq(n)22 b Fs(+)g(1\).)-118 2231 y(Then,)34 b(setting)829 2445 y Fq(c)871 2460 y Fp(j)t(j)937 2441 y Fd(0)962 2445 y Fs(\()p Fq(\014)1061 2404 y Fm(0)1084 2445 y Fs(\))28 b(=)1287 2350 y Fn(X)1253 2570 y Fp(\014)1296 2551 y Fd(0)q(0)1337 2570 y Fm(2)p Fl(Z)1434 2551 y Fk(d)1481 2445 y Fq(a)1532 2460 y Fp(j)1569 2445 y Fs(\()p Fq(\014)1668 2404 y Fm(0)1713 2445 y Fs(+)22 b(\(2)p Fq(k)1952 2404 y Fm(0)1997 2445 y Fs(+)g(1\))p Fq(\014)2243 2404 y Fm(0)o(0)2285 2445 y Fs(\))p 2323 2358 864 4 v Fq(a)2374 2460 y Fp(j)2407 2441 y Fd(0)2433 2445 y Fs(\()p Fq(\014)2532 2416 y Fm(0)2577 2445 y Fs(+)g(\(2)p Fq(k)2816 2416 y Fm(0)2861 2445 y Fs(+)g(1\))p Fq(\014)3107 2416 y Fm(0)o(0)3149 2445 y Fs(\))-118 2752 y(w)m(e)34 b(obtain)238 3076 y Fo(h)p Fs(\()p Fj(E)12 b Fs(\()p Fq(V)497 3035 y Fp(n)470 3101 y(!)544 3076 y Fs(\))22 b Fo(\000)h Fq(V)783 3035 y Fp(n)761 3101 y(!)830 3076 y Fs(\)\011)944 3091 y Fp(j)980 3076 y Fq(;)17 b Fs(\011)1100 3091 y Fp(j)1133 3072 y Fd(0)1158 3076 y Fo(i)28 b Fs(=)f(\(2)p Fq(l)1446 3035 y Fm(0)1492 3076 y Fs(+)22 b(1\))1677 3035 y Fm(\000)p Fp(d)1857 2981 y Fn(X)1788 3205 y Fp(\015)t Fm(2)p Fl(Z)1926 3182 y Fk(d)1926 3226 y Fc(2)p Fk(n)p Fc(+1)2070 3076 y Fs(\()p 2108 3021 65 4 v Fq(!)j Fo(\000)e Fq(!)2355 3091 y Fp(\015)2399 3076 y Fs(\))2454 2846 y Fn(0)2454 3021 y(B)2454 3085 y(@)2631 2981 y(X)2541 3205 y Fp(\014)2584 3186 y Fd(0)2606 3205 y Fm(2)p Fl(Z)2704 3182 y Fk(d)2704 3236 y Fc(2)p Fk(k)2768 3222 y Fd(0)2784 3236 y Fc(+1)2882 3076 y Fq(c)2924 3091 y Fp(j)t(j)2990 3072 y Fd(0)3015 3076 y Fs(\()p Fq(\014)3114 3035 y Fm(0)3137 3076 y Fs(\))1696 3336 y Fn(Z)1751 3562 y Fp(C)1801 3581 y Fc(0)p Fk(;l)1870 3567 y Fd(0)1918 3472 y Fq(V)1997 3431 y Fp(n)2044 3472 y Fs(\()p Fq(x)f Fo(\000)h Fq(\015)k Fs(+)22 b(\(2)p Fq(l)2553 3431 y Fm(0)2599 3472 y Fs(+)g(1\))p Fq(\014)2845 3431 y Fm(0)2867 3472 y Fs(\))p Fq( )2968 3487 y Fp(p)3004 3496 y Fc(0)3043 3472 y Fs(\()p Fq(x;)17 b(\022)3225 3487 y Fp(j)3262 3472 y Fs(\))p 3300 3385 418 4 v Fq( )3363 3487 y Fp(p)3399 3496 y Fc(0)3437 3472 y Fs(\()p Fq(x;)g(\022)3619 3487 y Fp(j)3652 3468 y Fd(0)3679 3472 y Fs(\))p Fq(dx)3823 3302 y Fn(!)1225 3868 y Fs(=)27 b(\(2)p Fq(l)1446 3827 y Fm(0)1492 3868 y Fs(+)22 b(1\))1677 3827 y Fm(\000)p Fp(d)1859 3773 y Fn(X)1788 3997 y Fp(\015)t Fm(2)p Fl(Z)1926 3974 y Fk(d)1926 4028 y Fc(2)p Fk(l)1976 4014 y Fd(0)1993 4028 y Fc(+1)2091 3638 y Fn(0)2091 3813 y(B)2091 3877 y(@)2267 3773 y(X)2178 3997 y Fp(\015)2218 3978 y Fd(0)2240 3997 y Fm(2)p Fl(Z)2338 3974 y Fk(d)2338 4028 y Fc(2)p Fk(k)2402 4014 y Fd(0)2418 4028 y Fc(+1)2500 3868 y Fs(\()p 2538 3813 65 4 v Fq(!)j Fo(\000)e Fq(!)2785 3884 y Fp(\015)t Fi(+\(2)p Fp(l)2964 3865 y Fd(0)2987 3884 y Fi(+1\))p Fp(\015)3144 3865 y Fd(0)3171 3868 y Fs(\))3226 3638 y Fn(2)3226 3813 y(6)3226 3877 y(4)3382 3773 y(X)3292 3997 y Fp(\014)3335 3978 y Fd(0)3357 3997 y Fm(2)p Fl(Z)3455 3974 y Fk(d)3455 4028 y Fc(2)p Fk(k)3519 4014 y Fd(0)3535 4028 y Fc(+1)3633 3868 y Fq(c)3675 3883 y Fp(j)t(j)3741 3864 y Fd(0)3766 3868 y Fs(\()p Fq(\014)3865 3827 y Fm(0)3888 3868 y Fs(\))1470 4128 y Fn(Z)1525 4354 y Fp(C)1575 4373 y Fc(0)p Fk(;l)1644 4359 y Fd(0)1692 4264 y Fq(V)1771 4223 y Fp(n)1818 4264 y Fs(\()p Fq(x)f Fo(\000)h Fq(\015)k Fs(+)22 b(\(2)p Fq(l)2327 4223 y Fm(0)2372 4264 y Fs(+)g(1\)\()p Fq(\014)2656 4223 y Fm(0)2701 4264 y Fo(\000)h Fq(\015)2857 4223 y Fm(0)2880 4264 y Fs(\)\))p Fq( )3019 4279 y Fp(p)3055 4288 y Fc(0)3094 4264 y Fs(\()p Fq(x;)17 b(\022)3276 4279 y Fp(j)3313 4264 y Fs(\))p 3351 4177 418 4 v Fq( )3414 4279 y Fp(p)3450 4288 y Fc(0)3488 4264 y Fs(\()p Fq(x;)g(\022)3670 4279 y Fp(j)3703 4260 y Fd(0)3730 4264 y Fs(\))p Fq(dx)3874 4094 y Fn(#!)1225 4531 y Fs(=)27 b(\(2)p Fq(l)1446 4489 y Fm(0)1492 4531 y Fs(+)22 b(1\))1677 4489 y Fm(\000)p Fp(d)1859 4436 y Fn(X)1788 4659 y Fp(\015)t Fm(2)p Fl(Z)1926 4637 y Fk(d)1926 4690 y Fc(2)p Fk(l)1976 4676 y Fd(0)1993 4690 y Fc(+1)2091 4531 y Fq(X)2172 4546 y Fp(j)t(j)2238 4527 y Fd(0)2263 4531 y Fs(\()p Fq(\015)5 b Fs(\))-118 3800 y(\(2.25\))-118 4866 y(where)1043 5064 y Fq(X)1124 5079 y Fp(j)t(j)1190 5060 y Fd(0)1215 5064 y Fs(\()p Fq(\015)g Fs(\))28 b(=)1567 4970 y Fn(X)1478 5193 y Fp(\015)1518 5174 y Fd(0)1541 5193 y Fm(2)p Fl(Z)1638 5170 y Fk(d)1638 5224 y Fc(2)p Fk(k)1702 5210 y Fd(0)1719 5224 y Fc(+1)1800 5064 y Fs(\()p 1838 5009 65 4 v Fq(!)e Fo(\000)c Fq(!)2085 5080 y Fp(\015)t Fi(+\(2)p Fp(l)2264 5061 y Fd(0)2287 5080 y Fi(+1\))p Fp(\015)2444 5061 y Fd(0)2472 5064 y Fs(\))p Fq(A)2583 5079 y Fp(j)t(j)2649 5060 y Fd(0)2674 5064 y Fs(\()p Fq(\015)5 b(;)17 b(\015)2868 5023 y Fm(0)2891 5064 y Fs(\))p Fq(;)192 5414 y(A)265 5429 y Fp(j)t(j)331 5410 y Fd(0)356 5414 y Fs(\()p Fq(\015)5 b(;)17 b(\015)550 5373 y Fm(0)573 5414 y Fs(\))28 b(=)833 5319 y Fn(X)742 5543 y Fp(\014)785 5524 y Fd(0)808 5543 y Fm(2)p Fl(Z)905 5520 y Fk(d)905 5574 y Fc(2)p Fk(k)969 5560 y Fd(0)986 5574 y Fc(+1)1083 5414 y Fq(c)1125 5429 y Fp(j)t(j)1191 5410 y Fd(0)1217 5414 y Fs(\()p Fq(\014)1316 5373 y Fm(0)1339 5414 y Fs(\))1394 5278 y Fn(Z)1448 5504 y Fp(C)1498 5523 y Fc(0)p Fk(;l)1567 5509 y Fd(0)1615 5414 y Fq(V)1694 5373 y Fp(n)1741 5414 y Fs(\()p Fq(x)22 b Fo(\000)h Fq(\015)k Fs(+)22 b(\(2)p Fq(l)2250 5373 y Fm(0)2296 5414 y Fs(+)g(1\)\()p Fq(\014)2580 5373 y Fm(0)2624 5414 y Fo(\000)h Fq(\015)2780 5373 y Fm(0)2803 5414 y Fs(\)\))p Fq( )2942 5429 y Fp(p)2978 5438 y Fc(0)3017 5414 y Fs(\()p Fq(x;)17 b(\022)3199 5429 y Fp(j)3236 5414 y Fs(\))p 3274 5327 418 4 v Fq( )3337 5429 y Fp(p)3373 5438 y Fc(0)3411 5414 y Fs(\()p Fq(x;)g(\022)3593 5429 y Fp(j)3626 5410 y Fd(0)3653 5414 y Fs(\))p Fq(dx:)1969 5690 y Fg(11)p eop %%Page: 12 12 12 11 bop -118 241 a Fs(The)31 b(random)d(v)-5 b(ariables)29 b(\()p Fq(X)955 256 y Fp(j)t(j)1021 237 y Fd(0)1046 241 y Fs(\()p Fq(\015)5 b Fs(\)\))1216 264 y Fp(\015)t Fm(2)p Fl(Z)1353 241 y Fk(d)1353 295 y Fc(2)p Fk(l)1403 281 y Fd(0)1420 295 y Fc(+1)1535 241 y Fs(are)30 b(indep)s(enden)m(t)h(and) e(cen)m(tered)j(\(i.e.)42 b Fj(E)12 b Fs(\()p Fq(X)3200 256 y Fp(j)t(j)3266 237 y Fd(0)3297 241 y Fs(\()p Fq(\015)5 b Fs(\)\))28 b(=)f(0\).)43 b(They)31 b(are)-118 379 y(b)s(ounded;)i (indeed,)g(one)g(computes)35 671 y Fo(j)p Fq(X)144 686 y Fp(j)t(j)210 667 y Fd(0)235 671 y Fs(\()p Fq(\015)5 b Fs(\))p Fo(j)27 b(\024)h Fq(C)710 577 y Fn(X)621 800 y Fp(\015)661 781 y Fd(0)683 800 y Fm(2)p Fl(Z)781 777 y Fk(d)781 831 y Fc(2)p Fk(k)845 817 y Fd(0)861 831 y Fc(+1)959 671 y Fo(j)p Fq(A)1060 686 y Fp(j)t(j)1126 667 y Fd(0)1151 671 y Fs(\()p Fq(\015)5 b(;)17 b(\015)1345 630 y Fm(0)1368 671 y Fs(\))p Fo(j)422 990 y(\024)28 b Fq(C)711 896 y Fn(X)621 1119 y Fp(\014)664 1100 y Fd(0)686 1119 y Fm(2)p Fl(Z)783 1096 y Fk(d)783 1150 y Fc(2)p Fk(k)847 1136 y Fd(0)864 1150 y Fc(+1)1051 896 y Fn(X)962 1119 y Fp(\015)1002 1100 y Fd(0)1025 1119 y Fm(2)p Fl(Z)1122 1096 y Fk(d)1122 1150 y Fc(2)p Fk(k)1186 1136 y Fd(0)1203 1150 y Fc(+1)1300 990 y Fo(j)p Fq(c)1370 1005 y Fp(j)t(j)1436 986 y Fd(0)1461 990 y Fs(\()p Fq(\014)1560 949 y Fm(0)1583 990 y Fs(\))p Fo(j)1120 1204 y Fn(Z)1175 1430 y Fp(C)1225 1449 y Fc(0)p Fk(;l)1294 1435 y Fd(0)1342 1340 y Fo(j)p Fq(V)1448 1299 y Fp(n)1495 1340 y Fs(\()p Fq(x)23 b Fo(\000)f Fq(\015)27 b Fs(+)22 b(\(2)p Fq(l)2004 1299 y Fm(0)2050 1340 y Fs(+)g(1\)\()p Fq(\014)2334 1299 y Fm(0)2378 1340 y Fo(\000)h Fq(\015)2534 1299 y Fm(0)2557 1340 y Fs(\)\))p Fo(jj)p Fq( )2752 1355 y Fp(p)2788 1364 y Fc(0)2826 1340 y Fs(\()p Fq(x;)17 b(\022)3008 1355 y Fp(j)3045 1340 y Fs(\))p Fo(jj)p Fq( )3202 1355 y Fp(p)3238 1364 y Fc(0)3276 1340 y Fs(\()p Fq(x;)g(\022)3458 1355 y Fp(j)3491 1336 y Fd(0)3518 1340 y Fs(\))p Fo(j)p Fq(dx)422 1632 y Fo(\024)28 b Fq(C)711 1537 y Fn(X)621 1761 y Fp(\014)664 1742 y Fd(0)686 1761 y Fm(2)p Fl(Z)783 1738 y Fk(d)783 1792 y Fc(2)p Fk(k)847 1778 y Fd(0)864 1792 y Fc(+1)962 1632 y Fo(j)p Fq(c)1032 1647 y Fp(j)t(j)1098 1628 y Fd(0)1123 1632 y Fs(\()p Fq(\014)1222 1591 y Fm(0)1245 1632 y Fs(\))p Fo(j)1416 1537 y Fn(X)1328 1761 y Fp(\015)1368 1742 y Fd(0)1390 1761 y Fm(2)p Fl(Z)1487 1738 y Fk(d)1487 1792 y Fc(2)p Fk(k)1551 1778 y Fd(0)1568 1792 y Fc(+1)1665 1496 y Fn(Z)1721 1722 y Fp(C)1771 1741 y Fc(0)p Fk(;l)1840 1727 y Fd(0)1888 1632 y Fo(j)p Fq(V)1994 1591 y Fp(n)2041 1632 y Fs(\()p Fq(x)22 b Fo(\000)h Fq(\015)k Fs(+)22 b(\(2)p Fq(l)2550 1591 y Fm(0)2596 1632 y Fs(+)g(1\))p Fq(\015)2837 1591 y Fm(0)2860 1632 y Fs(\))p Fo(jj)p Fq( )3017 1647 y Fp(p)3053 1656 y Fc(0)3091 1632 y Fs(\()p Fq(x;)17 b(\022)3273 1647 y Fp(j)3310 1632 y Fs(\))p Fo(jj)p Fq( )3467 1647 y Fp(p)3503 1656 y Fc(0)3541 1632 y Fs(\()p Fq(x;)g(\022)3723 1647 y Fp(j)3756 1628 y Fd(0)3782 1632 y Fs(\))p Fo(j)p Fq(dx:)-118 1943 y Fs(Using)38 b(the)i(fact)f(that)f Fq(V)832 1906 y Fp(n)918 1943 y Fs(is)g(\(2)p Fq(n)27 b Fs(+)f(1\))p Fj(Z)1452 1906 y Fp(d)1490 1943 y Fs(-p)s(erio)s(dic,)38 b(the)i(relation)d(\(2)p Fq(n)26 b Fs(+)g(1\))39 b(=)f(\(2)p Fq(l)3101 1906 y Fm(0)3151 1943 y Fs(+)26 b(1\)\(2)p Fq(k)3481 1906 y Fm(0)3530 1943 y Fs(+)h(1\))38 b(and)h(esti-)-118 2059 y(mate)32 b(\(2.23\))o(,)h(w)m(e)g(obtain)375 2271 y Fo(j)p Fq(X)484 2286 y Fp(j)t(j)550 2267 y Fd(0)575 2271 y Fs(\()p Fq(\015)5 b Fs(\))p Fo(j)27 b(\024)h Fq(C)974 2177 y Fn(X)961 2396 y Fp(\014)s Fm(2)p Fl(Z)1101 2377 y Fk(d)1148 2271 y Fo(j)p Fq(a)1227 2286 y Fp(j)1263 2271 y Fs(\()p Fq(\014)6 b Fs(\))p Fo(j)21 b(\001)h(j)p Fq(a)1578 2286 y Fp(j)1611 2267 y Fd(0)1637 2271 y Fs(\()p Fq(\014)6 b Fs(\))p Fo(j)1898 2177 y Fn(X)1819 2400 y Fp(\015)1859 2381 y Fd(0)1880 2400 y Fm(2)p Fl(Z)1978 2377 y Fk(d)1978 2421 y Fc(2)p Fk(n)p Fc(+1)2138 2136 y Fn(Z)2194 2361 y Fp(C)2244 2370 y Fc(0)p Fk(;)p Fc(0)2349 2271 y Fo(j)p Fq(V)2455 2230 y Fp(n)2502 2271 y Fs(\()p Fq(x)22 b Fo(\000)h Fq(\015)2773 2230 y Fm(0)2796 2271 y Fs(\))p Fo(jj)p Fq( )2953 2286 y Fp(p)2989 2295 y Fc(0)3027 2271 y Fs(\()p Fq(x;)17 b(\022)3209 2286 y Fp(j)3246 2271 y Fs(\))p Fo(jj)p Fq( )3403 2286 y Fp(p)3439 2295 y Fc(0)3477 2271 y Fs(\()p Fq(x;)g(\022)3659 2286 y Fp(j)3692 2267 y Fd(0)3719 2271 y Fs(\))p Fo(j)p Fq(dx)762 2611 y Fo(\024)28 b Fq(C)7 b Fo(k)p Fq(')1058 2626 y Fp(j)1094 2611 y Fo(kk)p Fq(')1258 2626 y Fp(j)1291 2607 y Fd(0)1317 2611 y Fo(k)1406 2516 y Fn(X)1384 2736 y Fp(\015)1424 2717 y Fd(0)1446 2736 y Fm(2)p Fl(Z)1543 2717 y Fk(d)1590 2476 y Fn(Z)1645 2701 y Fp(C)1695 2710 y Fc(0)p Fk(;)p Fc(0)1800 2611 y Fo(j)p Fq(V)21 b Fs(\()p Fq(x)i Fo(\000)f Fq(\015)2177 2570 y Fm(0)2201 2611 y Fs(\))p Fo(jj)p Fq( )2358 2626 y Fp(p)2394 2635 y Fc(0)2432 2611 y Fs(\()p Fq(x;)17 b(\022)2614 2626 y Fp(j)2651 2611 y Fs(\))p Fo(jj)p Fq( )2808 2626 y Fp(p)2844 2635 y Fc(0)2882 2611 y Fs(\()p Fq(x;)g(\022)3064 2626 y Fp(j)3097 2607 y Fd(0)3123 2611 y Fs(\))p Fo(j)p Fq(dx)762 2871 y Fo(\024)28 b Fq(C)7 b Fo(k)p Fq(')1058 2886 y Fp(j)1094 2871 y Fo(kk)p Fq(')1258 2886 y Fp(j)1291 2867 y Fd(0)1317 2871 y Fo(k)27 b Fq(<)h Fs(+)p Fo(1)-118 3037 y Fs(By)34 b(\(2.24\))e(and)g(\(2.25\))o(,)h(to)f (estimate)f(the)i(probabilit)m(y)d(of)i(\012\()p Fq(n;)17 b(\025;)g(\021)t Fs(\),)32 b(it)f(su\016ces)k(to)d(estimate)f(the)i (probabilit)m(y)-118 3153 y(that)759 3313 y Fq(\025)816 3271 y Fp(\021)857 3313 y Fq(=)p Fs(\(4)p Fq(n)1051 3328 y Fp(z)1091 3313 y Fs(\))1129 3271 y Fi(2)1196 3313 y Fo(\024)28 b Fq(\025)1358 3271 y Fp(\021)1400 3313 y Fq(=)p Fs(\(2)p Fq(n)1594 3328 y Fp(z)1634 3313 y Fs(\))1672 3271 y Fi(2)1733 3313 y Fo(\000)23 b Fq(C)7 b(\025)1967 3271 y Fp(\021)2004 3248 y Fd(0)2059 3313 y Fo(\024)28 b Fs(\(2)p Fq(l)2282 3271 y Fm(0)2327 3313 y Fs(+)22 b(1\))2512 3271 y Fm(\000)p Fp(d)2695 3218 y Fn(X)2624 3441 y Fp(\015)t Fm(2)p Fl(Z)2761 3419 y Fk(d)2761 3473 y Fc(2)p Fk(l)2811 3459 y Fd(0)2828 3473 y Fc(+1)2926 3313 y Fq(X)3007 3328 y Fp(j)t(j)3073 3309 y Fd(0)3098 3313 y Fs(\()p Fq(\015)5 b Fs(\))p Fq(:)-118 3610 y Fs(This)36 b(is)g(a)g(large)g(deviation)f(estimate;)i(it)f(is)f(b)s(ounded)j(ab)s (o)m(v)m(e)f(in)e(the)i(usual)f(w)m(a)m(y)i(using)e(exp)s(onen)m(tial)f (Mark)m(o)m(v)-118 3727 y(inequalities)c(\(see)i(e.g.)g([6,)g(5)o(]\))g (and)g(yields)476 4038 y Fj(P)552 3807 y Fn(2)552 3983 y(6)552 4047 y(4)620 4038 y Fq(\025)677 3996 y Fp(\021)719 4038 y Fq(=)p Fs(\(4)p Fq(n)913 4053 y Fp(z)953 4038 y Fs(\))991 3996 y Fi(2)1058 4038 y Fo(\024)28 b Fs(\(2)p Fq(l)1281 3996 y Fm(0)1326 4038 y Fs(+)22 b(1\))1511 3996 y Fm(\000)p Fp(d)1694 3943 y Fn(X)1623 4166 y Fp(\015)t Fm(2)p Fl(Z)1760 4144 y Fk(d)1760 4197 y Fc(2)p Fk(l)1810 4183 y Fd(0)1827 4197 y Fc(+1)1925 4038 y Fq(X)2006 4053 y Fp(j)t(j)2072 4034 y Fd(0)2097 4038 y Fs(\()p Fq(\015)5 b Fs(\))2229 3807 y Fn(3)2229 3983 y(7)2229 4047 y(5)2323 4038 y Fo(\024)28 b Fq(e)2473 3996 y Fm(\000)p Fp(c)p Fi(\()p Fp(l)2608 3973 y Fd(0)2631 3996 y Fi(\))2658 3973 y Fk(d)2694 3996 y Fp(\025)2735 3973 y Fc(2)p Fk(\021)2836 4038 y Fo(\024)g Fq(e)2986 3996 y Fm(\000)p Fp(c\025)3113 3973 y Fd(\000)p Fk(d=)p Fc(2+2)p Fk(d\021)3398 3952 y Fd(0)3420 3973 y Fc(+2)p Fk(\021)-118 4348 y Fs(recalling)h(the)i (de\014nition)f(of)h Fq(l)1010 4312 y Fm(0)1033 4348 y Fs(.)43 b(As)32 b Fq(\021)f(<)d(\021)1481 4312 y Fm(0)1531 4348 y Fq(<)g(d=)p Fs(\(4)p Fq(d)18 b Fs(+)h(4\),)31 b(one)g(has)g Fo(\000)p Fq(d=)p Fs(2)19 b(+)g(2)p Fq(d\021)2972 4312 y Fm(0)3013 4348 y Fs(+)g(2)p Fq(\021)31 b(<)d Fs(0.)43 b(Hence,)32 b(for)f(some)-118 4465 y Fq(")c(>)h Fs(0)k(and)h Fq(\025)f Fs(su\016cien)m(tly)h(small,)e(one)i(has)905 4770 y Fj(P)981 4540 y Fn(2)981 4715 y(6)981 4779 y(4)1049 4770 y Fq(\025)1106 4729 y Fp(\021)1148 4770 y Fq(=)p Fs(\(4)p Fq(n)1342 4785 y Fp(z)1381 4770 y Fs(\))1419 4729 y Fi(2)1486 4770 y Fo(\024)28 b Fs(\(2)p Fq(l)1709 4729 y Fm(0)1755 4770 y Fs(+)22 b(1\))1940 4729 y Fm(\000)p Fp(d)2122 4675 y Fn(X)2051 4899 y Fp(\015)t Fm(2)p Fl(Z)2189 4876 y Fk(d)2189 4930 y Fc(2)p Fk(l)2239 4916 y Fd(0)2256 4930 y Fc(+1)2354 4770 y Fq(X)2435 4785 y Fp(j)t(j)2501 4766 y Fd(0)2526 4770 y Fs(\()p Fq(\015)5 b Fs(\))2658 4540 y Fn(3)2658 4715 y(7)2658 4779 y(5)2752 4770 y Fo(\024)28 b Fq(e)2902 4729 y Fm(\000)p Fp(\025)2998 4705 y Fd(\000)p Fk(")3084 4770 y Fq(:)-118 5081 y Fs(On)d(the)g(other)g(hand,)i(the)e (probabilit)m(y)e(of)h(\012\()p Fq(n;)17 b(\025;)g(\021)t Fs(\))25 b(is)f(b)s(ounded)i(b)m(y)f(the)h(sum)e(o)m(v)m(er)i Fq(j)31 b Fs(and)25 b Fq(j)3356 5045 y Fm(0)3404 5081 y Fs(of)g(the)g(probabilit)m(y)-118 5197 y(estimate)32 b(ab)s(o)m(v)m(e.)44 b(This)33 b(yields)f(\(2.8\))g(and)h(completes)f (the)h(pro)s(of)f(of)g(Prop)s(osition)f(2.1.)p 4063 5197 4 66 v 4067 5135 59 4 v 4067 5197 V 4125 5197 4 66 v -118 5313 a Fw(Pro)s(of)37 b(of)h(Lemma)f(2.1.)44 b Fs(Recall)30 b(that)1454 5501 y Fq(')1518 5516 y Fp(j)1582 5501 y Fs(=)1686 5365 y Fn(Z)1741 5591 y Fl(T)1791 5572 y Fd(\003)1854 5501 y Fs(~)-61 b Fq(\037)1903 5516 y Fp(p)1939 5525 y Fc(0)1978 5501 y Fs(\()p Fq(\022)s Fs(\))p Fq(')2166 5516 y Fp(p)2202 5525 y Fc(0)2240 5501 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\))p Fq(d\022)s(:)1969 5690 y Fg(12)p eop %%Page: 13 13 13 12 bop -118 241 a Fs(where)45 b(~)-60 b Fq(\037)225 256 y Fp(p)261 265 y Fc(0)327 241 y Fs(=)27 b Fw(1)486 256 y Fm(j)p Fp(\022)r Fm(\000)p Fp(\022)629 266 y Fk(j)661 256 y Fm(j\024)p Fi(1)p Fp(=l)854 241 y Fo(\001)22 b Fq(\037)965 256 y Fp(p)1001 265 y Fc(0)1072 241 y Fs(\(see)34 b(\(2.19\))o(\).)43 b(Using)33 b(the)g(p)s(erio)s(dic)e(comp)s(onen)m (ts,)i(w)m(e)g(write)442 480 y Fq(')506 495 y Fp(j)570 480 y Fs(=)674 339 y Fn(\022)747 344 y(Z)803 570 y Fl(T)853 551 y Fd(\003)915 480 y Fs(~)-60 b Fq(\037)965 495 y Fp(p)1001 504 y Fc(0)1039 480 y Fs(\()p Fq(\022)s Fs(\))p Fq(e)1208 438 y Fp(i)p Fm(\001\001)p Fp(\022)1311 480 y Fq(d\022)1410 339 y Fn(\023)1499 480 y Fq( )1562 495 y Fp(p)1598 504 y Fc(0)1637 480 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)1792 495 y Fp(j)1828 480 y Fs(\))22 b(+)1986 344 y Fn(Z)2042 570 y Fl(T)2092 551 y Fd(\003)2154 480 y Fs(~)-60 b Fq(\037)2204 495 y Fp(p)2240 504 y Fc(0)2278 480 y Fs(\()p Fq(\022)s Fs(\))p Fq(e)2447 438 y Fp(i)p Fm(\001\001)p Fp(\022)2550 480 y Fs(\()p Fq( )2651 495 y Fp(p)2687 504 y Fc(0)2725 480 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\))22 b Fo(\000)h Fq( )3106 495 y Fp(p)3142 504 y Fc(0)3180 480 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)3335 495 y Fp(j)3372 480 y Fs(\)\))p Fq(d\022)s(:)-118 708 y Fs(As)34 b(discussed)h(in)e(section)g(5.1,)g(under)h(our)g (assumptions,)f(for)g Fq(\022)k Fs(close)c(to)g Fq(\022)2743 723 y Fp(j)2780 708 y Fs(,)g(the)h(function)f(\()p Fq(x;)17 b(\022)s Fs(\))29 b Fo(7!)g Fq( )3836 723 y Fp(p)3872 732 y Fc(0)3911 708 y Fs(\()p Fq(x;)17 b(\022)s Fs(\))-118 826 y(is)28 b(analytic)f(in)h Fq(\022)j Fs(v)-5 b(alued)28 b(in)g(the)h Fj(Z)1174 790 y Fp(d)1212 826 y Fs(-p)s(erio)s(dic,)e(lo)s (cally)f(square)k(in)m(tegrable)d(functions)h(in)g Fq(x)p Fs(;)i(hence,)h(w)m(e)f(compute)589 921 y Fn(\015)589 981 y(\015)589 1041 y(\015)589 1101 y(\015)644 930 y(Z)700 1156 y Fl(T)750 1137 y Fd(\003)812 1066 y Fs(~)-60 b Fq(\037)862 1081 y Fp(p)898 1090 y Fc(0)936 1066 y Fs(\()p Fq(\022)s Fs(\))p Fq(e)1105 1025 y Fp(i)p Fm(\001\001)p Fp(\022)1207 1066 y Fs(\()p Fq( )1308 1081 y Fp(p)1344 1090 y Fc(0)1383 1066 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\))22 b Fo(\000)g Fq( )1763 1081 y Fp(p)1799 1090 y Fc(0)1838 1066 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)1993 1081 y Fp(j)2029 1066 y Fs(\)\))p Fq(d\022)2204 921 y Fn(\015)2204 981 y(\015)2204 1041 y(\015)2204 1101 y(\015)2259 948 y Fi(2)2259 1165 y Fp(L)2307 1146 y Fc(2)2342 1165 y Fi(\()p Fl(R)2417 1146 y Fk(d)2454 1165 y Fi(\))600 1380 y Fs(=)715 1285 y Fn(X)704 1504 y Fp(\015)t Fm(2)p Fl(Z)841 1486 y Fk(d)888 1244 y Fn(Z)943 1469 y Fp(C)993 1478 y Fk(\015)s(;)p Fc(0)1103 1235 y Fn(\014)1103 1295 y(\014)1103 1355 y(\014)1103 1414 y(\014)1137 1244 y(Z)1192 1469 y Fl(T)1242 1451 y Fd(\003)1305 1380 y Fs(~)-61 b Fq(\037)1354 1395 y Fp(p)1390 1404 y Fc(0)1428 1380 y Fs(\()p Fq(\022)s Fs(\))p Fq(e)1597 1338 y Fp(ix)p Fm(\001)p Fp(\022)1720 1380 y Fs(\()p Fq( )1821 1395 y Fp(p)1857 1404 y Fc(0)1896 1380 y Fs(\()p Fq(x;)17 b(\022)s Fs(\))22 b Fo(\000)h Fq( )2304 1395 y Fp(p)2340 1404 y Fc(0)2378 1380 y Fs(\()p Fq(x;)17 b(\022)2560 1395 y Fp(j)2597 1380 y Fs(\)\))p Fq(d\022)2772 1235 y Fn(\014)2772 1295 y(\014)2772 1355 y(\014)2772 1414 y(\014)2805 1261 y Fi(2)2861 1380 y Fq(dx)600 1726 y Fs(=)715 1631 y Fn(X)704 1851 y Fp(\015)t Fm(2)p Fl(Z)841 1832 y Fk(d)888 1590 y Fn(Z)943 1816 y Fp(C)993 1825 y Fc(0)p Fk(;)p Fc(0)1098 1581 y Fn(\014)1098 1641 y(\014)1098 1701 y(\014)1098 1761 y(\014)1131 1590 y(Z)1187 1816 y Fl(T)1237 1797 y Fd(\003)1299 1726 y Fs(~)-60 b Fq(\037)1349 1741 y Fp(p)1385 1750 y Fc(0)1423 1726 y Fs(\()p Fq(\022)s Fs(\))p Fq(e)1592 1685 y Fp(ix\022)1695 1726 y Fq(e)1740 1685 y Fp(i\015)t(\022)1844 1726 y Fs(\()p Fq( )1945 1741 y Fp(p)1981 1750 y Fc(0)2019 1726 y Fs(\()p Fq(x)23 b Fs(+)f Fq(\015)5 b(;)17 b(\022)s Fs(\))22 b Fo(\000)g Fq( )2603 1741 y Fp(p)2639 1750 y Fc(0)2678 1726 y Fs(\()p Fq(x)h Fs(+)f Fq(\015)5 b(;)17 b(\022)3037 1741 y Fp(j)3073 1726 y Fs(\)\))p Fq(d\022)3248 1581 y Fn(\014)3248 1641 y(\014)3248 1701 y(\014)3248 1761 y(\014)3281 1607 y Fi(2)3337 1726 y Fq(dx)-118 2015 y Fs(In)37 b(the)g(\014rst)g(step,)h (w)m(e)g(rewrote)f(the)g Fq(x)p Fs(-in)m(tegral)e(o)m(v)m(er)j Fj(R)2025 1979 y Fp(d)2108 2015 y Fs(as)f(the)g(sum)f(of)g(the)h(in)m (tegrals)f(o)m(v)m(er)h(cub)s(es)h(co)m(v)m(ering)-118 2131 y Fj(R)-52 2095 y Fp(d)-6 2131 y Fs(;)33 b(then,)g(w)m(e)h (shifted)e(the)h(argumen)m(t)g Fq(x)g Fs(so)f(as)h(to)f(cen)m(ter)i (the)f(cub)s(e)h(at)e(0.)-118 2247 y(In)23 b(the)g(next)g(step,)i(w)m (e)f(use)f(the)g(p)s(erio)s(dicit)m(y)e(of)h(the)h(p)s(erio)s(dic)d (comp)s(onen)m(ts,)25 b(and)e(P)m(arsev)-5 b(al's)23 b(form)m(ula)e(to)h(compute)-118 2363 y(the)33 b Fq(\022)s Fs(-in)m(tegral.)678 2458 y Fn(\015)678 2518 y(\015)678 2578 y(\015)678 2638 y(\015)733 2467 y(Z)789 2693 y Fl(T)839 2674 y Fd(\003)901 2603 y Fs(~)-60 b Fq(\037)951 2618 y Fp(p)987 2627 y Fc(0)1025 2603 y Fs(\()p Fq(\022)s Fs(\))p Fq(e)1194 2562 y Fp(i)p Fm(\001\001)p Fp(\022)1296 2603 y Fs(\()p Fq( )1397 2618 y Fp(p)1433 2627 y Fc(0)1472 2603 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\))22 b Fo(\000)g Fq( )1852 2618 y Fp(p)1888 2627 y Fc(0)1927 2603 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)2082 2618 y Fp(j)2118 2603 y Fs(\)\))p Fq(d\022)2293 2458 y Fn(\015)2293 2518 y(\015)2293 2578 y(\015)2293 2638 y(\015)2348 2485 y Fi(2)2348 2702 y Fp(L)2396 2683 y Fc(2)2431 2702 y Fi(\()p Fl(R)2506 2683 y Fk(d)2542 2702 y Fi(\))689 2960 y Fs(=)793 2824 y Fn(Z)848 3050 y Fp(C)898 3059 y Fc(0)p Fk(;)p Fc(0)1003 2760 y Fn(0)1003 2939 y(@)1102 2865 y(X)1090 3085 y Fp(\015)t Fm(2)p Fl(Z)1228 3066 y Fk(d)1274 2815 y Fn(\014)1274 2875 y(\014)1274 2935 y(\014)1274 2995 y(\014)1308 2824 y(Z)1363 3050 y Fl(T)1413 3031 y Fd(\003)1476 2960 y Fs(~)-61 b Fq(\037)1525 2975 y Fp(p)1561 2984 y Fc(0)1599 2960 y Fs(\()p Fq(\022)s Fs(\))p Fq(e)1768 2919 y Fp(ix\022)1871 2960 y Fq(e)1916 2919 y Fp(i\015)t(\022)2020 2960 y Fs(\()p Fq( )2121 2975 y Fp(p)2157 2984 y Fc(0)2196 2960 y Fs(\()p Fq(x;)17 b(\022)s Fs(\))22 b Fo(\000)g Fq( )2603 2975 y Fp(p)2639 2984 y Fc(0)2678 2960 y Fs(\()p Fq(x;)17 b(\022)2860 2975 y Fp(j)2897 2960 y Fs(\)\))p Fq(d\022)3072 2815 y Fn(\014)3072 2875 y(\014)3072 2935 y(\014)3072 2995 y(\014)3105 2842 y Fi(2)3145 2760 y Fn(1)3145 2939 y(A)3248 2960 y Fq(dx)689 3287 y Fs(=)793 3152 y Fn(Z)848 3377 y Fp(C)898 3386 y Fc(0)p Fk(;)p Fc(0)1003 3152 y Fn(Z)1058 3377 y Fl(T)1108 3358 y Fd(\003)1159 3287 y Fo(j)11 b Fs(~)-60 b Fq(\037)1248 3302 y Fp(p)1284 3311 y Fc(0)1322 3287 y Fs(\()p Fq(\022)s Fs(\)\()p Fq( )1547 3302 y Fp(p)1583 3311 y Fc(0)1622 3287 y Fs(\()p Fq(x;)17 b(\022)s Fs(\))22 b Fo(\000)h Fq( )2030 3302 y Fp(p)2066 3311 y Fc(0)2105 3287 y Fs(\()p Fq(x;)17 b(\022)2287 3302 y Fp(j)2324 3287 y Fs(\)\))p Fo(j)2427 3239 y Fi(2)2483 3287 y Fq(d\022)s(dx)689 3608 y Fs(=)793 3472 y Fn(Z)848 3698 y Fl(T)898 3679 y Fd(\003)949 3608 y Fo(j)11 b Fs(~)-60 b Fq(\037)1038 3623 y Fp(p)1074 3632 y Fc(0)1112 3608 y Fs(\()p Fq(\022)s Fs(\))p Fo(j)1264 3559 y Fi(2)1320 3437 y Fn( )1399 3472 y(Z)1454 3698 y Fp(C)1504 3707 y Fc(0)p Fk(;)p Fc(0)1609 3608 y Fo(j)p Fq( )1700 3623 y Fp(p)1736 3632 y Fc(0)1774 3608 y Fs(\()p Fq(x;)17 b(\022)s Fs(\))23 b Fo(\000)f Fq( )2182 3623 y Fp(p)2218 3632 y Fc(0)2257 3608 y Fs(\()p Fq(x;)17 b(\022)2439 3623 y Fp(j)2476 3608 y Fs(\))p Fo(j)2542 3567 y Fi(2)2581 3608 y Fq(dx)2687 3437 y Fn(!)2783 3608 y Fq(d\022)30 b Fo(\024)3024 3540 y Fq(C)p 3024 3585 77 4 v 3027 3676 a(l)3058 3647 y Fi(2)3111 3608 y Fq(:)-118 3866 y Fs(T)-8 b(o)33 b(conclude,)g(w)m(e)g(used)h(the)f(analyticit)m(y)e(of)h Fq(\022)f Fo(7!)c Fq( )1850 3881 y Fp(p)1886 3890 y Fc(0)1925 3866 y Fs(\()p Fo(\001)p Fq(;)17 b(\022)s Fs(\).)-118 3982 y(So)32 b(w)m(e)i(no)m(w)f(are)g(left)f(with)g(pro)m(ving)g(Lemma) f(2.1)h(when)i Fq(')2096 3997 y Fp(j)2165 3982 y Fs(is)e(replaced)h (with)f(the)h(function)1269 4214 y Fq(x)28 b Fo(7!)1479 4073 y Fn(\022)1553 4078 y(Z)1608 4304 y Fl(T)1658 4285 y Fd(\003)1721 4214 y Fs(~)-61 b Fq(\037)1770 4229 y Fp(p)1806 4238 y Fc(0)1845 4214 y Fs(\()p Fq(\022)s Fs(\))p Fq(e)2014 4172 y Fp(ix)p Fm(\001)p Fp(\022)2136 4214 y Fq(d\022)2235 4073 y Fn(\023)2325 4214 y Fq( )2388 4229 y Fp(p)2424 4238 y Fc(0)2463 4214 y Fs(\()p Fq(x;)17 b(\022)2645 4229 y Fp(j)2682 4214 y Fs(\))p Fq(:)-118 4442 y Fs(This)29 b(is)g(an)g(immediate)d(consequence)32 b(of)d(Lemma)f(5.1)g(when)j(one)e(pic)m(ks)h Fq(")d Fs(=)h(1)p Fq(=l)j Fs(and)e Fq(\021)i Fs(=)d(\(2)p Fq(l)3444 4406 y Fm(0)3482 4442 y Fs(+)15 b(1\))p Fq(=)p Fs(\()p Fq(\031)t(l)r Fs(\).)42 b(This)-118 4558 y(completes)32 b(the)h(pro)s(of)f(of)g (Lemma)f(2.1.)p 4063 4558 4 66 v 4067 4496 59 4 v 4067 4558 V 4125 4558 4 66 v 1270 4785 a(3.)54 b Fr(The)38 b(pr)n(oof)g(of)g(Theorem)g(1.3)94 4959 y Fs(Theorem)31 b(1.3)e(is)h(deriv)m(ed)h(from)e(Theorem)h(1.1)g(using)f(the)i(m)m (ultiscale)d(analysis)h(done)i(in)e([30,)h(8].)42 b(In)31 b(order)-118 5075 y(to)h(apply)g(the)h(results)g(of)f([30,)h(8],)f(w)m (e)i(ha)m(v)m(e)g(to)e(c)m(hec)m(k)j(t)m(w)m(o)e(assumptions:)8 5217 y Fo(\017)41 b Fs(the)33 b(W)-8 b(egner)33 b(estimate;)8 5333 y Fo(\017)41 b Fs(the)33 b(initial)c(length)j(scale)g(estimate.) -118 5475 y(W)-8 b(e)38 b(\014rst)h(state)f(the)h(W)-8 b(egner)39 b(estimate.)59 b(This)38 b(estimate)f(is)h(an)g(estimate)f (of)h(the)g(probabilit)m(y)e(of)i(presence)i(of)-118 5591 y(eigen)m(v)-5 b(alues)32 b(in)g(a)h(giv)m(en)f(in)m(terv)-5 b(al.)42 b(More)33 b(precisely)-8 b(,)33 b(w)m(e)h(pro)m(v)m(e)1969 5690 y Fg(13)p eop %%Page: 14 14 14 13 bop -118 241 a Fw(Prop)s(osition)35 b(3.1.)50 b Ff(Fix)38 b Fq(\034)46 b Fo(2)36 b Fs(\(0)p Fq(;)17 b Fs(1\))p Ff(.)56 b(Then,)39 b(ther)-5 b(e)38 b(exists)h Fq(\025)2245 256 y Fi(0)2319 241 y Fq(>)c Fs(0)k Ff(and)f Fq(c)2753 256 y Fi(0)2828 241 y Fq(>)d Fs(0)j Ff(such)h(that,)h(for)f Fq(\025)c Fo(2)g Fs(\(0)p Fq(;)17 b(\025)4027 256 y Fi(0)4066 241 y Fs(\))p Ff(,)-118 362 y(one)34 b(has,)g(for)h Fq(n)28 b Fo(\025)g Fs(1)35 b Ff(and)f Fq(\022)d Fo(2)d Fj(T)1123 326 y Fm(\003)1123 387 y Fi(2)p Fp(n)p Fi(+1)1299 362 y Ff(,)35 b(for)f Fq(I)8 b Ff(,)35 b(an)f(interval)h(in)f Fs([)p Fq(E)2350 377 y Fm(\000)2410 362 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)p 2587 282 79 4 v 17 w(E)5 b Fs(\()p Fq(\025)p 2759 307 65 4 v(!)s Fs(\))22 b(+)g Fq(c)3023 377 y Fi(0)3063 362 y Fq(\025)p Fs(])p Ff(,)35 b(one)f(has)168 547 y Fj(P)244 466 y Fn(\000)291 547 y Fo(f)p Fq(H)430 506 y Fp(n)422 572 y(!)r(;\025)533 547 y Fs(\()p Fq(\022)s Fs(\))h Ff(has)f(an)h(eigenvalue)e(in)i Fq(I)8 b Fo(g)1697 466 y Fn(\001)1770 547 y Fo(\024)28 b Fj(E)1953 466 y Fn(\000)2004 547 y Fs(#)p Fo(f)p Ff(eigenvalues)34 b(of)g Fq(H)2849 506 y Fp(n)2841 572 y(!)r(;\025)2952 547 y Fs(\()p Fq(\022)s Fs(\))h Ff(in)g Fq(I)8 b Fo(g)3332 466 y Fn(\001)3405 547 y Fo(\024)28 b Fq(C)7 b(\025)3644 506 y Fm(\000)p Fi(1)3738 547 y Fq(n)3796 506 y Fi(2)p Fp(d)3872 547 y Fo(j)p Fq(I)h Fo(j)3979 506 y Fp(\034)4021 547 y Fq(:)-4166 b Fs(\(3.1\))94 731 y(Prop)s(osition)30 b(3.1)g(is)g(pro)m(v)m(ed)j(in)d(section)h(4.)43 b(It)31 b(do)s(es)g(not)g(imply)e(Theorem)i(1.2.)42 b(The)32 b(v)m(olume)e(dep)s(endence)-118 848 y(in)j(\(3.1\))g(is)h(not)f (optimal.)45 b(But)34 b(it)e(is)i(su\016cien)m(t)h(for)e(our)h(purp)s (ose.)48 b(In)34 b([11],)g(the)g(optimal)d(v)m(olume)i(dep)s(endence) -118 964 y(w)m(as)38 b(obtained)f(but)g(for)g(an)g(appro)m(ximation)e (sc)m(heme)j(di\013eren)m(t)f(from)f(the)i(p)s(erio)s(dic)d(one)j(used) g(in)f(the)g(presen)m(t)-118 1080 y(pap)s(er.)94 1196 y(W)-8 b(e)33 b(no)m(w)h(state)f(the)g(initial)28 b(length)33 b(scale)f(estimate;)g(it)g(is)g(a)g(consequence)k(of)c(Theorem)h(1.1.) -118 1380 y Fw(Prop)s(osition)i(3.2.)50 b Ff(Fix)40 b Fq(\021)j Fo(2)d Fs(\(0)p Fq(;)17 b(d=)p Fs(\(4)p Fq(d)25 b Fs(+)i(4\)\))41 b Ff(and)g Fq(\032)e(>)h(d)h Ff(su\016ciently)g(lar) -5 b(ge.)63 b(Then,)42 b(ther)-5 b(e)41 b(exists)g Fq(a)f(>)f Fs(0)p Ff(,)-118 1497 y Fq(")-72 1512 y Fi(0)3 1497 y Fq(>)c Fs(0)40 b Ff(and)e Fq(\025)453 1512 y Fi(0)528 1497 y Fq(>)e Fs(0)j Ff(such)g(that,)i(for)e Fs(0)c Fq(<)h(\025)g(<)g (\025)1807 1512 y Fi(0)1885 1497 y Ff(and)j Fs(0)c Fq(<)h(")g(<)f(") 2514 1512 y Fi(0)2553 1497 y Ff(,)41 b(for)e Fq(\025)2841 1461 y Fm(\000)p Fp(\032)2972 1497 y Fq(<)c(n)h(<)g(e)3334 1461 y Fp(\025)3375 1437 y Fk(")3413 1497 y Ff(,)k(with)f(pr)-5 b(ob)g(ability)-118 1616 y Fs(1)22 b Fo(\000)g Fq(e)97 1580 y Fm(\000)p Fp(\015)192 1556 y Fd(\000)p Fk(")278 1616 y Ff(,)35 b(for)g Fq(E)e Fo(2)c Fq(I)742 1631 y Fp(\021)r(;\025)879 1616 y Ff(and)34 b Fq(\022)d Fo(2)d Fj(T)1301 1580 y Fm(\003)1301 1640 y Fi(2)p Fp(n)p Fi(+1)1477 1616 y Ff(,)35 b(one)f(has)911 1829 y Fo(k)p Fw(1)1017 1844 y Fp(C)1067 1853 y Fc(0)p Fk(;)p Fc(2)p Fk(n)p Fc(+1)1266 1844 y Fm(n)p Fp(C)1351 1853 y Fc(0)p Fk(;)p Fc(2)p Fk(n)p Fd(\000)p Fc(1)1557 1829 y Fs(\()p Fq(E)28 b Fo(\000)23 b Fq(H)1884 1788 y Fp(n)1876 1854 y(!)r(;\025)1987 1829 y Fs(\()p Fq(\022)s Fs(\)\))2149 1788 y Fm(\000)p Fi(1)2243 1829 y Fw(1)2299 1844 y Fp(C)2349 1853 y Fc(0)p Fk(;n)2445 1829 y Fo(k)28 b(\024)g Fq(e)2673 1788 y Fp(a)2710 1722 y Fo(p)p 2794 1722 237 4 v 2794 1788 a Fm(j)p Fp(E)t Fm(\000)p Fp(\025)p 2966 1750 47 3 v(!)q Fm(j)p Fp(n)3078 1829 y Fq(:)-3223 b Fs(\(3.2\))-118 2013 y(Using)29 b(Prop)s(ositions)e (3.1)i(and)g(3.2)g(for)f Fq(\022)j Fs(=)c(0,)j(Theorem)f(1.2)g(is)f(an) h(immediate)e(consequence)32 b(of)c(Theorem)h(12.2)-118 2130 y(and)k(Prop)s(osition)d(13.1)i(of)g([30],)h(and)g(Theorem)f(3.8)h (of)f([8].)-118 2338 y(3.1.)56 b Fw(The)34 b(pro)s(of)g(of)g(the)f (initial)e(length)i(scale)g(estimate.)48 b Fs(W)-8 b(e)29 b(no)m(w)h(pro)m(v)m(e)h(Prop)s(osition)c(3.2.)42 b(Fix)29 b Fq(\021)t(;)17 b(\021)3995 2302 y Fm(0)4047 2338 y Fs(as)-118 2455 y(in)32 b(Prop)s(osition)f(3.2)h(i.e.)44 b Fq(\021)31 b(<)d(\021)1082 2418 y Fm(0)1133 2455 y Fq(<)g(d=)p Fs(\(4)p Fq(d)21 b Fs(+)h(4\))32 b(and)h(\014x)h Fq(\032)28 b(>)g(d)p Fs(.)43 b(De\014ne)34 b(the)f(ev)m(en)m(t)h(\012) 3143 2470 y Fp(\015)t(;\021)3240 2451 y Fd(0)3264 2470 y Fp(;n)3358 2455 y Fs(=)28 b Fo(f)p Fs(there)33 b(exists)h(an)-118 2579 y(eigen)m(v)-5 b(alue)30 b(of)h Fq(H)545 2543 y Fp(n)537 2605 y(!)r(;\025)679 2579 y Fs(in)f([)p Fq(E)890 2594 y Fm(\000)949 2579 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)p 1126 2499 79 4 v 17 w(E)6 b Fs(\()p Fq(\025)p 1299 2524 65 4 v(!)s Fs(\))19 b Fo(\000)g Fq(\025)1573 2543 y Fi(1+)p Fp(\021)1700 2519 y Fd(0)1727 2579 y Fs(])p Fo(g)p Fs(.)43 b(Using)31 b(Theorem)g(2.1)f(in)h(conjunction)f(with)h(Theorem)g(1.1,) -118 2723 y(w)m(e)36 b(obtain)e(that,)h(there)h(exists)f Fq(\015)1149 2738 y Fp(\021)1223 2723 y Fq(>)c Fs(0)k(and)g Fq(")c(>)h Fs(0)i(suc)m(h)j(that,)e(for)f(0)e Fq(<)f(\025)h(<)f(\025) 2930 2738 y Fp(\021)3007 2723 y Fs(and)k Fq(\025)3256 2687 y Fm(\000)p Fp(\032)3383 2723 y Fo(\024)d Fq(n)g Fo(\024)g Fq(e)3736 2687 y Fp(\025)3777 2663 y Fd(\000)p Fk("=)p Fc(2)3925 2723 y Fs(,)k(one)-118 2839 y(has)1238 3013 y Fj(P)p Fs(\(\012)1405 3028 y Fp(\025;\021)1503 3009 y Fd(0)1529 3028 y Fp(;n)1595 3013 y Fs(\))28 b Fo(\024)g Fq(C)7 b(e)1888 2972 y Fp(d\025)1965 2949 y Fd(\000)p Fk("=)p Fc(2)2113 3013 y Fq(e)2158 2972 y Fm(\000)p Fp(\025)2254 2949 y Fd(\000)p Fk(")2368 3013 y Fo(\024)28 b Fq(e)2518 2972 y Fm(\000)2583 2945 y Fc(1)p 2583 2957 31 3 v 2583 2998 a(2)2623 2972 y Fp(\025)2664 2949 y Fd(\000)p Fk(")2750 3013 y Fq(:)-118 3193 y Fs(By)38 b(a)g(Com)m(b)s(es-Thomas)f(estimate)g(\(see)i(e.g.)f([10])f(and)h (references)i(therein\),)f(for)e Fq(E)43 b Fo(2)37 b Fq(I)3310 3208 y Fp(\021)r(;\025)3450 3193 y Fs(and)h Fq(!)i Fo(62)d Fs(\012)3919 3208 y Fp(\025;\021)4017 3189 y Fd(0)4040 3208 y Fp(;n)4107 3193 y Fs(,)-118 3309 y(one)c(has)622 3382 y Fn(\015)622 3442 y(\015)622 3501 y(\015)678 3496 y Fw(1)734 3511 y Fp(C)784 3520 y Fk(\015)s(;)p Fc(0)877 3496 y Fs(\()p Fq(E)28 b Fo(\000)23 b Fq(H)1204 3455 y Fp(n)1196 3521 y(!)r(;\025)1307 3496 y Fs(\()p Fq(\022)s Fs(\)\))1469 3455 y Fm(\000)p Fi(1)1563 3496 y Fw(1)1619 3511 y Fp(C)1669 3530 y Fk(\015)1704 3516 y Fd(0)1728 3530 y Fk(;)p Fc(0)1785 3382 y Fn(\015)1785 3442 y(\015)1785 3501 y(\015)1868 3496 y Fo(\024)29 b Fq(C)7 b(\025)2108 3455 y Fm(\000)p Fi(1)p Fm(\000)p Fp(\021)2294 3496 y Fq(e)2339 3455 y Fm(\000)2394 3383 y Fo(p)p 2478 3383 581 4 v 2478 3455 a Fm(j)p Fp(E)t Fm(\000)p 2609 3401 56 3 v Fp(E)r Fi(\()p Fp(\025)p 2731 3418 47 3 v(!)s Fi(\)+)p Fp(\025)2901 3436 y Fk(\021)2935 3422 y Fd(0)2958 3436 y Fc(+1)3039 3455 y Fm(j)o(j)p Fp(\015)t Fm(\000)p Fp(\015)3213 3432 y Fd(0)3236 3455 y Fm(j)p Fp(=C)3350 3496 y Fq(;)-3495 b Fs(\(3.3\))-118 3757 y(for)26 b(some)h(constan)m(t)h Fq(C)34 b Fs(indep)s(enden)m(t)29 b(of)d Fq(\025)h Fs(and)g Fq(\021)t Fs(.)42 b(De\014ne)27 b Fq(\016)t Fs(\()p Fq(E)6 b Fs(\))28 b(:=)2454 3635 y Fn(q)p 2553 3635 862 4 v 2553 3757 a Fo(j)p Fq(E)g Fo(\000)p 2781 3677 79 4 v 23 w Fq(E)6 b Fs(\()p Fq(\025)p 2954 3702 65 4 v(!)s Fs(\))22 b(+)g Fq(\025)3233 3728 y Fi(1+)p Fp(\021)3360 3709 y Fd(0)3387 3757 y Fo(j)p Fs(.)42 b(W)-8 b(e)27 b(notice)g(that,)-118 3907 y(for)32 b Fq(E)i Fo(2)28 b Fq(I)274 3922 y Fp(\021)r(;\025)376 3907 y Fs(,)33 b Fq(E)28 b Fo(\000)p 636 3827 79 4 v 23 w Fq(E)6 b Fs(\()p Fq(\025)p 809 3852 65 4 v(!)s Fs(\))28 b Fo(\025)g Fq(\025)1101 3871 y Fi(1+)p Fp(\021)1233 3907 y Fs(;)33 b(as)f Fq(\021)g(<)27 b(\021)1647 3871 y Fm(0)1670 3907 y Fs(,)33 b(for)f Fq(\025)g Fs(su\016cien)m(tly)i (small,)c(one)j(has)1478 4136 y Fq(\016)t Fs(\()p Fq(E)6 b Fs(\))28 b Fo(\025)1822 4068 y Fs(1)p 1822 4113 49 4 v 1822 4204 a(2)1881 4009 y Fn(q)p 1980 4009 531 4 v 1980 4136 a Fo(j)p Fq(E)g Fo(\000)p 2208 4056 79 4 v 23 w Fq(E)6 b Fs(\()p Fq(\025)p 2381 4081 65 4 v(!)s Fs(\))p Fo(j)o Fq(:)-118 4345 y Fs(Pic)m(k)39 b(0)e Fq(<)g(")351 4360 y Fi(0)428 4345 y Fq(<)g(")p Fs(.)61 b(Summing)37 b(\(3.3\))h(o)m(v)m(er)i Fq(\015)i Fo(2)c Fq(C)1836 4360 y Fi(0)p Fp(;)p Fi(2)p Fp(n)p Fi(+1)2089 4345 y Fo(n)26 b Fq(C)2235 4360 y Fi(0)p Fp(;)p Fi(2)p Fp(n)p Fm(\000)p Fi(1)2501 4345 y Fs(and)38 b Fq(\015)2752 4309 y Fm(0)2813 4345 y Fo(2)g Fq(C)2987 4360 y Fi(0)p Fp(;n)3127 4345 y Fs(and)g(using)g(the)h(fact)f(that)-118 4472 y Fq(\025)-61 4436 y Fm(\000)p Fp(\032)63 4472 y Fq(<)29 b(n)g(<)g(e)405 4436 y Fp(\025)446 4413 y Fd(\000)p Fk(")523 4428 y Fc(0)567 4472 y Fs(,)k(w)m(e)i(get)e(that,)g(for)g Fq(!)g Fo(62)c Fs(\012)1583 4487 y Fp(\015)t(;\021)1680 4468 y Fd(0)1703 4487 y Fp(;n)1803 4472 y Fs(and)34 b Fq(E)h Fo(2)29 b Fq(I)2239 4487 y Fp(\021)r(;\025)2342 4472 y Fs(,)34 b(estimate)e(\(3.2\))h(holds.)46 b(This)33 b(completes)g(the)-118 4589 y(pro)s(of)f(of)g(Theorem)h(3.2.)1145 4835 y(4.)55 b Fr(Pr)n(oof)39 b(of)f(the)f(Wegner)g(estima)-7 b(te)94 5010 y Fs(The)40 b(pro)s(of)d(of)h(Prop)s(osition)f(3.1)h(follo)m(ws)f (the)i(philosoph)m(y)f(in)m(tro)s(duced)h(in)e([17])h(and)h(is)f(quite) g(similar)d(to)-118 5126 y(the)30 b(pro)s(of)f(of)h(Theorem)g(1.2)f(in) g([11].)43 b(F)-8 b(or)29 b(the)h(reader's)h(con)m(v)m(enience,)i(w)m (e)e(nev)m(ertheless)h(repro)s(duce)f(the)f(details)-118 5242 y(here.)94 5358 y(As)45 b(ab)s(o)m(v)m(e,)i(w)m(e)e(\014x)f(a)g (band)g(edge)g Fq(E)1524 5373 y Fm(\000)1584 5358 y Fs(\(0\))f(and)h Fq(\022)50 b Fo(2)d Fj(T)2224 5322 y Fm(\003)2224 5383 y Fi(2)p Fp(n)p Fi(+1)2400 5358 y Fs(.)77 b(All)42 b(the)i(op)s (erators)g(w)m(e)g(no)m(w)h(discuss)g(are)-118 5475 y(considered)e (with)f Fq(\022)s Fs(-quasi-p)s(erio)s(dic)e(b)s(oundary)j(condition)d (in)i(the)h(sense)h(explained)e(in)f(section)i(2.2;)j(in)c(our)-118 5591 y(notations,)d(w)m(e)h(forget)e(ab)s(out)g(the)h(parameter)f Fq(\022)k Fs(i.e.)61 b(w)m(e)39 b(write)g Fq(E)2461 5606 y Fp(k)2542 5591 y Fs(instead)f(of)h Fq(E)3074 5606 y Fp(k)3116 5591 y Fs(\()p Fq(\022)s Fs(\),)i Fq(H)46 b Fs(instead)38 b(of)g Fq(H)8 b Fs(\()p Fq(\022)s Fs(\),)1969 5690 y Fg(14)p eop %%Page: 15 15 15 14 bop -118 241 a Fs(etc.)60 b(Our)38 b(statemen)m(t)g(are)g (uniform)e(in)h(the)i(parameter)e Fq(\022)s Fs(.)60 b(Recall)36 b(that)i(the)g(Flo)s(quet)f(eigen)m(v)-5 b(alues)38 b(of)f Fq(H)46 b Fs(are)-118 357 y(denoted)33 b(b)m(y)h(\()p Fq(E)496 372 y Fp(k)539 357 y Fs(\))577 372 y Fp(k)r Fm(\025)p Fi(1)742 357 y Fs(and)f(ordered)g(increasingly)-8 b(.)42 b(De\014ne)33 b(\005)2223 372 y Fi(0)2290 357 y Fs(=)28 b(\005)2467 321 y Fp(n)2467 387 y()27 b Fs(0)32 b(suc)m(h)i(that,)f(for)f Fq(\025)g Fs(su\016cien)m(tly)i (small,)p 1474 2118 79 4 v 1474 2198 a Fq(E)6 b Fs(\()p Fq(\025)p 1647 2143 65 4 v(!)s Fs(\))22 b Fo(\000)p 1871 2118 79 4 v 23 w Fq(E)6 b Fs(\()p Fq(\025!)2109 2157 y Fi(+)2167 2198 y Fs(\))28 b Fo(\025)g Fq(\025=C)r(:)-2661 b Fs(\(4.2\))-118 2403 y(F)-8 b(or)42 b(more)g(details,)i(w)m(e)g (refer)g(to)e(section)h(5.1.)74 b(W)-8 b(e)43 b(rewrite)g Fq(H)2351 2418 y Fp(!)r(;\025)2507 2403 y Fs(=)p 2628 2323 89 4 v 45 w Fq(H)2717 2419 y Fp(\025!)2804 2400 y Fc(+)2888 2403 y Fs(+)29 b Fq(\025V)3112 2418 y Fi(~)-40 b Fp(!)3200 2403 y Fs(where)44 b(\()8 b(~)-57 b Fq(!)3591 2418 y Fp(\015)3636 2403 y Fs(\))3674 2418 y Fp(\015)3763 2403 y Fs(=)45 b(\()p Fq(!)3983 2418 y Fp(\015)4056 2403 y Fo(\000)-118 2527 y Fq(!)-53 2491 y Fi(+)5 2527 y Fs(\))43 2542 y Fp(\015)88 2527 y Fs(.)75 b(So,)45 b(for)e Fq(\025)g Fs(su\016cien)m(tly)h(small,)f(the)h(op)s(erator)p 2001 2447 V 42 w Fq(H)2090 2543 y Fp(\025!)2177 2524 y Fc(+)2275 2527 y Fs(has)g(no)f(sp)s(ectrum)g(in)f(the)i(in)m(terv)-5 b(al)42 b([\()p Fq(E)3845 2542 y Fm(\000)3904 2527 y Fs(\(0\))29 b(+)-118 2653 y(2)p Fq(E)3 2668 y Fi(+)62 2653 y Fs(\(0\)\))p Fq(=)p Fs(3)p Fq(;)p 367 2573 79 4 v 17 w(E)5 b Fs(\()p Fq(\025)p 539 2598 65 4 v(!)s Fs(\))32 b(+)g Fq(C)7 b(\025)p Fs(])47 b(\(for)g(some)g Fq(C)59 b(>)53 b Fs(0\).)87 b(Hence,)52 b(for)47 b(an)m(y)h Fq(n)k Fo(\025)h Fs(1,)e(the)d(op)s(erator)p 3564 2573 89 4 v 46 w Fq(H)3653 2592 y Fp(n)3653 2678 y(\025!)3740 2659 y Fc(+)3842 2653 y Fs(has)g(no)-118 2774 y(sp)s(ectrum)37 b(in)e([\()p Fq(E)566 2789 y Fm(\000)626 2774 y Fs(\(0\))24 b(+)h(2)p Fq(E)997 2789 y Fi(+)1056 2774 y Fs(\(0\)\))p Fq(=)p Fs(3)p Fq(;)p 1361 2694 79 4 v 17 w(E)5 b Fs(\()p Fq(\025)p 1533 2720 65 4 v(!)s Fs(\))25 b(+)f Fq(C)7 b(\025)p Fs(].)55 b(W)-8 b(e)37 b(decomp)s(ose)g(\005)2743 2789 y Fi(0)2817 2774 y Fs(=)d(\005)3000 2733 y Fi(+)3000 2799 y(0)3084 2774 y Fs(+)25 b(\005)3258 2733 y Fm(\000)3258 2799 y Fi(0)3353 2774 y Fs(where)38 b(\005)3712 2733 y Fm(\000)3712 2799 y Fi(0)3805 2774 y Fs(=)c(\005)3988 2738 y Fp(n)3988 2800 y()g Fs(0)33 b(suc)m(h)i(that)d([)p Fq(E)2143 5490 y Fi(0)2206 5475 y Fo(\000)23 b Fq(";)17 b(E)2468 5490 y Fi(0)2529 5475 y Fs(+)22 b Fq(")p Fs(])29 b Fo(\032)f Fs([)p Fq(E)2933 5490 y Fi(0)2973 5475 y Fq(;)p 3017 5395 79 4 v 17 w(E)6 b Fs(\()p Fq(\025)p 3190 5420 65 4 v(!)s Fs(\))22 b(+)h Fq(C)7 b(\025=)p Fs(2],)32 b(if)g Fq(E)39 b Fs(is)33 b(an)-118 5591 y(eigen)m(v)-5 b(alue)23 b(in)f([)p Fq(E)542 5606 y Fi(0)585 5591 y Fo(\000)s Fq(";)17 b(E)827 5606 y Fi(0)869 5591 y Fs(+)s Fq(")p Fs(],)25 b(then,)h(b)m(y)f(\(4.5\),)g Fq(G)p Fs(\()p Fq(E)1882 5606 y Fi(0)1922 5591 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(has)j(an)f(eigen)m(v)-5 b(alue)23 b(in)f([)p Fo(\000)p Fs(1)s Fo(\000)s Fq(C)7 b("\025)3459 5555 y Fm(\000)p Fi(1)3554 5591 y Fq(;)17 b Fo(\000)p Fs(1)s(+)s Fq(C)7 b("\025)3986 5555 y Fm(\000)p Fi(1)4080 5591 y Fs(].)1969 5690 y Fg(15)p eop %%Page: 16 16 16 15 bop -118 241 a Fs(This)33 b(yields)-35 431 y(#)p Fo(f)p Fs(eigen)m(v)-5 b(alues)33 b(of)f Fq(H)801 390 y Fp(n)793 455 y(!)r(;\025)936 431 y Fs(in)g([)p Fq(E)1149 446 y Fi(0)1211 431 y Fo(\000)23 b Fq(";)17 b(E)1473 446 y Fi(0)1534 431 y Fs(+)22 b Fq(")p Fs(])p Fo(g)1346 591 y(\024)28 b Fs(#)p Fo(f)p Fs(eigen)m(v)-5 b(alues)33 b(of)f Fq(G)p Fs(\()p Fq(E)2385 606 y Fi(0)2424 591 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))32 b(in)f([)p Fo(\000)p Fs(1)23 b Fo(\000)f Fq(C)7 b("\025)3272 550 y Fm(\000)p Fi(1)3366 591 y Fq(;)17 b Fo(\000)p Fs(1)22 b(+)g Fq(C)7 b("\025)3836 550 y Fm(\000)p Fi(1)3930 591 y Fs(])p Fo(g)p Fq(;)-118 752 y Fs(the)33 b(eigen)m(v)-5 b(alues)32 b(b)s(eing)g(coun)m (ted)i(with)e(m)m(ultiplicit)m(y)-8 b(.)-118 868 y(Hence,)34 b(one)f(has)-118 1058 y(\(4.6\))82 b Fj(E)13 b Fs(\(#)p Fo(f)p Fs(eigen)m(v)-5 b(alues)38 b(of)33 b Fq(H)1106 1017 y Fp(n)1098 1083 y(!)r(;\025)1241 1058 y Fs(in)f([)p Fq(E)1454 1073 y Fi(0)1516 1058 y Fo(\000)22 b Fq(";)17 b(E)1777 1073 y Fi(0)1839 1058 y Fs(+)22 b Fq(")p Fs(])p Fo(g)p Fs(\))1220 1219 y Fo(\024)28 b Fj(E)13 b Fs(\(#)p Fo(f)p Fs(eigen)m(v)-5 b(alues)38 b(of)33 b Fq(G)p Fs(\()p Fq(E)2364 1234 y Fi(0)2403 1219 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))31 b(in)h([)p Fo(\000)p Fs(1)23 b Fo(\000)f Fq(C)7 b("\025)3251 1178 y Fm(\000)p Fi(1)3345 1219 y Fq(;)17 b Fo(\000)p Fs(1)22 b(+)g Fq(C)7 b("\025)3815 1178 y Fm(\000)p Fi(1)3909 1219 y Fs(])p Fo(g)p Fs(\))p Fq(:)-118 1385 y Fs(T)-8 b(o)29 b(estimate)g(the)h(last)f(exp)s(ectation,)h(w)m (e)h(use)f(the)g(computations)e(done)i(in)f([11].)42 b(De\014ne)30 b Fq(I)3286 1400 y Fp(")3351 1385 y Fs(=)d([)p Fo(\000)p Fs(1)16 b Fo(\000)g Fq(\024;)h Fo(\000)p Fs(1)f(+)g Fq(\024)p Fs(])-118 1502 y(where)25 b Fq(\024)j Fs(=)g Fq(C)7 b("\025)523 1465 y Fm(\000)p Fi(1)617 1502 y Fs(.)40 b(Let)25 b Fq(\032)g Fs(b)s(e)f(a)g(nonnegativ)m(e,)j(smo)s(oth,)e (monotone)e(decreasing)i(function)f(suc)m(h)i(that)e Fq(\032)p Fs(\()p Fq(x)p Fs(\))k(=)g(1,)-118 1618 y(for)45 b Fq(x)50 b(<)f Fo(\000)p Fq(\024=)p Fs(2,)g(and)d Fq(\032)p Fs(\()p Fq(x)p Fs(\))k(=)f(0,)g(for)c Fq(x)50 b Fo(\025)g Fq(\024=)p Fs(2.)81 b(W)-8 b(e)46 b(can)g(assume)g(that)f Fq(\032)h Fs(has)g(compact)f(supp)s(ort)g(since)-118 1734 y Fq(G)p Fs(\()p Fq(E)69 1749 y Fi(0)108 1734 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))31 b(is)i(lo)m(w)m(er)f(semib)s(ounded)h (indep)s(enden)m(tly)g(of)f Fq(n)p Fs(.)44 b(Then,)34 b(one)f(has)612 1887 y Fj(E)13 b Fs(\(#)p Fo(f)p Fs(eigen)m(v)-5 b(alues)38 b(of)33 b Fq(G)p Fs(\()p Fq(E)1651 1902 y Fi(0)1690 1887 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))31 b(in)h([)p Fo(\000)p Fs(1)22 b Fo(\000)h Fq(\024;)17 b Fo(\000)p Fs(1)22 b(+)g Fq(\024)p Fs(])p Fo(g)p Fs(\))640 2038 y Fo(\024)28 b Fj(E)13 b Fo(f)p Fs(tr)5 b([)p Fq(\032)p Fs(\()p Fq(\025G)p Fs(\()p Fq(E)1296 2053 y Fi(0)1336 2038 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h(1)g Fo(\000)g Fs(3)p Fq(\024=)p Fs(2\))g Fo(\000)h Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)2511 2053 y Fi(0)2550 2038 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h(1)g(+)g(3)p Fq(\024=)p Fs(2\)])p Fo(g)640 2288 y(\024)28 b Fj(E)823 2118 y Fn(\()909 2288 y Fs(tr)1001 2118 y Fn(")1059 2153 y(Z)1159 2179 y Fi(3)p Fp(\024=)p Fi(2)1114 2378 y Fm(\000)p Fi(3)p Fp(\024=)p Fi(2)1364 2221 y Fq(d)p 1347 2266 86 4 v 1347 2357 a(dt)1442 2288 y(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)1717 2303 y Fi(0)1757 2288 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h(1)g Fo(\000)h Fq(t)p Fs(\))k Fq(dt)2481 2118 y Fn(#\))2636 2288 y Fq(:)-118 2137 y Fs(\(4.7\))-118 2541 y(In)33 b(order)g(to)f(ev)-5 b(aluate)32 b(the)h Fq(\032)978 2505 y Fm(0)1034 2541 y Fs(term)f(in)g(\(4.7\))o(,)h(de\014ne)h(the)f (v)m(ector)g(\014eld)1636 2723 y Fo(V)j Fs(=)1906 2629 y Fn(X)1837 2852 y Fp(\015)t Fm(2)p Fl(Z)1974 2829 y Fk(d)1974 2873 y Fc(2)p Fk(n)p Fc(+1)2143 2723 y Fs(~)-57 b Fq(!)2196 2738 y Fp(\015)2240 2723 y Fq(@)2291 2738 y Fp(!)2335 2746 y Fk(\015)-118 3012 y Fs(and)33 b(compute)1090 3173 y Fo(V)8 b Fq(G)p Fs(\()p Fq(E)1346 3188 y Fi(0)1386 3173 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))26 b(=)h Fq(G)p Fs(\()p Fq(E)1950 3188 y Fi(0)1990 3173 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h Fq(\025G)2491 3188 y Fi(1)2530 3173 y Fs(\()p Fq(E)2640 3188 y Fi(0)2679 3173 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))-118 3353 y(where)29 b Fq(G)236 3368 y Fi(1)275 3353 y Fs(\()p Fq(E)385 3368 y Fi(0)425 3353 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))26 b(is)h(b)s(ounded)h(uniformly)d(in)i Fq(!)t Fs(,)h Fq(\025)g Fs(and)f Fq(E)2194 3368 y Fi(0)2262 3353 y Fo(2)h Fs([)p Fq(E)2455 3368 y Fi(0)2494 3353 y Fq(;)p 2538 3273 79 4 v 17 w(E)6 b Fs(\()p Fq(\025)p 2711 3298 65 4 v(!)s Fs(\))12 b(+)g Fq(C)7 b(\025=)p Fs(2].)41 b(This)28 b(follo)m(ws)e(from)g(the)-118 3477 y(fact)36 b(that)g(\005)366 3435 y Fi(+)366 3501 y(0)p 425 3397 89 4 v 425 3477 a Fq(H)514 3415 y Fp(n)514 3501 y(\025!)601 3482 y Fc(+)656 3477 y Fs(\005)729 3435 y Fi(+)729 3501 y(0)824 3477 y Fs(do)s(es)h(not)f(dep)s(end)h(on)g Fq(!)1768 3492 y Fp(\015)1812 3477 y Fs(,)g(that)f Fo(V)8 b Fq(V)2239 3440 y Fp(n)2222 3503 y Fi(~)-40 b Fp(!)r(;\025)2362 3477 y Fs(=)34 b Fq(V)2550 3440 y Fp(n)2534 3503 y Fi(~)-40 b Fp(!)r(;\025)2640 3477 y Fs(,)37 b(that)f Fo(V)8 b Fs(\000)3049 3440 y Fi(0)3089 3477 y Fs(\()p Fq(!)t(;)17 b(E)3308 3492 y Fi(0)3346 3477 y Fs(\))36 b(and)h Fo(V)8 b Fs(\000)3744 3440 y Fi(0+)3838 3477 y Fs(\()p Fq(!)t(;)17 b(E)4057 3492 y Fi(0)4096 3477 y Fs(\))-118 3612 y(sta)m(y)33 b(b)s(ounded,)h(and)e(that)h(for)f Fq(E)1136 3627 y Fi(0)1203 3612 y Fo(2)c Fs([)p Fq(E)1396 3627 y Fi(0)1436 3612 y Fq(;)p 1480 3532 79 4 v 17 w(E)6 b Fs(\()p Fq(\025)p 1653 3557 65 4 v(!)s Fs(\))22 b(+)g Fq(C)7 b(\025=)p Fs(2],)32 b(dist\()p Fq(E)6 b(;)17 b(\033)t Fs(\()p 2608 3532 89 4 v Fq(H)2696 3627 y Fp(\025)p 2737 3589 47 3 v(!)2788 3612 y Fs(\)\))27 b Fo(\025)h Fq(\025=C)39 b Fs(for)32 b(some)h Fq(C)i(>)27 b Fs(1.)-118 3728 y(W)-8 b(e)33 b(no)m(w)g(write)f(the)h Fq(\032)720 3692 y Fm(0)777 3728 y Fs(term)f(in)f(\(4.7\))h(as)531 3884 y Fo(V)8 b Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)875 3899 y Fi(0)915 3884 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h(1)g Fo(\000)h Fq(t)p Fs(\))k(=)h Fq(\032)1707 3843 y Fm(0)1730 3884 y Fs(\()p Fq(G)p Fs(\()p Fq(E)1955 3899 y Fi(0)1995 3884 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h(1)g Fo(\000)g Fq(t)p Fs(\))p Fo(V)8 b Fq(G)p Fs(\()p Fq(E)2861 3899 y Fi(0)2901 3884 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))1553 4038 y(=)28 b Fq(\032)1707 3997 y Fm(0)1730 4038 y Fs(\()p Fq(G)p Fs(\()p Fq(E)1955 4053 y Fi(0)1995 4038 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h(1)g Fo(\000)g Fq(t)p Fs(\)\()p Fq(G)p Fs(\()p Fq(E)2830 4053 y Fi(0)2870 4038 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h Fq(O)s Fs(\()p Fq(\025)p Fs(\)\))-118 4205 y(W)-8 b(e)30 b(no)m(w)h(note)f(that)g Fq(\032)721 4169 y Fm(0)772 4205 y Fo(\024)e Fs(0,)j(and)f(that)f(on)h (supp)p Fq(\032)1762 4169 y Fm(0)1787 4205 y Fs(,)h(one)f(has)g Fq(G)p Fs(\()p Fq(E)2379 4220 y Fi(0)2419 4205 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))26 b Fo(\024)i Fs(\()p Fo(\000)p Fs(1)17 b(+)g(2)p Fq(\024)p Fs(\).)42 b(So,)31 b(for)e Fq(\025)h Fs(su\016cien)m(tly)-118 4321 y(small,)g(w)m(e)k(obtain)425 4530 y Fo(\000)p Fq(\032)552 4489 y Fm(0)576 4530 y Fs(\()p Fq(G)p Fs(\()p Fq(E)801 4545 y Fi(0)840 4530 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h(1)g Fo(\000)h Fq(t)p Fs(\))k Fo(\024)i(\000)1847 4463 y Fs(1)p 1671 4507 401 4 v 1671 4598 a(2\(1)22 b Fo(\000)g Fs(2)p Fq(\024)p Fs(\))2170 4435 y Fn(X)2098 4659 y Fp(!)r Fm(2)p Fl(Z)2241 4636 y Fk(d)2241 4680 y Fc(2)p Fk(n)p Fc(+1)2410 4530 y Fs(~)-57 b Fq(!)2463 4545 y Fp(\015)2544 4463 y Fq(@)5 b(\032)p 2517 4507 163 4 v 2517 4598 a(@)g(!)2634 4613 y Fp(\015)2689 4530 y Fs(\()p Fq(G)p Fs(\()p Fq(E)2914 4545 y Fi(0)2953 4530 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h(1)g Fo(\000)h Fq(t)p Fs(\))p Fq(:)-3709 b Fs(\(4.8\))-118 4825 y(With)37 b(this)h(estimate,)h(and)f(the)g(fact)g(that)g Fq(d\032)p Fs(\()p Fq(x)26 b Fs(+)g(1)g Fo(\000)g Fq(t)p Fs(\))p Fq(=dt)37 b Fs(=)g Fo(\000)p Fq(\032)2528 4789 y Fm(0)2552 4825 y Fs(\()p Fq(x)26 b Fs(+)g(1)f Fo(\000)i Fq(t)p Fs(\),)39 b(the)g(righ)m(t)e(side)h(of)45 b(\(4.7\))37 b(is)-118 4941 y(b)s(ounded)c(ab)s(o)m(v)m(e)h(b)m(y)652 5172 y Fo(\000)915 5105 y Fs(1)p 739 5150 401 4 v 739 5241 a(2\(1)22 b Fo(\000)h Fs(2)p Fq(\024)p Fs(\))1235 5078 y Fn(X)1166 5301 y Fp(\015)t Fm(2)p Fl(Z)1304 5278 y Fk(d)1304 5322 y Fc(2)p Fk(n)p Fc(+1)1465 5037 y Fn(Z)1564 5063 y Fi(3)p Fp(\024=)p Fi(2)1520 5262 y Fm(\000)p Fi(3)p Fp(\024=)p Fi(2)1742 5172 y Fj(E)12 b Fo(f)c Fs(~)-57 b Fq(!)1913 5187 y Fp(\015)2026 5105 y Fq(@)p 1973 5150 163 4 v 1973 5241 a(@)5 b(!)2090 5256 y Fp(\015)2145 5172 y Fs(tr[)p Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)2523 5187 y Fi(0)2563 5172 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h(1)g Fo(\000)g Fq(t)p Fs(\)])p Fo(g)p Fq(dt:)-3481 b Fs(\(4.9\))-118 5475 y(In)38 b(order)g(to)f(ev)-5 b(aluate)37 b(the)h(exp)s(ectation,)h (w)m(e)g(select)f(one)g(random)f(v)-5 b(ariable,)37 b(sa)m(y)i Fq(!)3113 5490 y Fp(\015)3195 5475 y Fs(\()p Fq(\015)i Fo(2)c Fj(Z)3497 5438 y Fp(d)3497 5499 y Fi(2)p Fp(n)p Fi(+1)3667 5475 y Fs(\),)i(and)e(\014rst)-118 5591 y(in)m(tegrate)d (with)g(resp)s(ect)h(to)f(this)g(v)-5 b(ariable)32 b(using)i(h)m(yp)s (othesis)i(\(H3\).)48 b(Let)35 b Fq(h)2778 5606 y Fi(0)2851 5591 y Fs(b)s(e)g(the)f(common)f(densit)m(y)j(of)d(the)1969 5690 y Fg(16)p eop %%Page: 17 17 17 16 bop -118 244 a Fs(random)29 b(v)-5 b(ariables)29 b(\()p Fq(!)738 259 y Fp(\015)782 244 y Fs(\))820 264 y Fp(\015)t Fm(2)p Fl(Z)957 245 y Fk(d)992 244 y Fs(;)i(b)m(y)g (\(H3\),)f(there)h(is)e(a)h(decomp)s(osition)e(supp\()p Fq(!)2798 259 y Fi(0)2839 244 y Fs(\))f(=)h Fo([)3074 203 y Fp(N)7 b Fm(\000)p Fi(1)3074 272 y Fp(l)q Fi(=0)3232 244 y Fs(\()p Fq(M)3364 259 y Fp(l)3390 244 y Fq(;)17 b(M)3528 259 y Fp(l)q Fi(+1)3644 244 y Fs(\))30 b(so)g(that)g Fq(h)4094 259 y Fi(0)-118 377 y Fs(is)e(absolutely)f(con)m(tin)m(uous)i (on)f(eac)m(h)h(subin)m(terv)-5 b(al.)41 b(Let)1972 351 y(~)1971 377 y Fq(h)2027 392 y Fi(0)2094 377 y Fs(b)s(e)29 b(the)f(function)2765 351 y(~)2764 377 y Fq(h)2820 392 y Fi(0)2860 377 y Fs(\()p Fq(x)p Fs(\))g(:=)f Fq(xh)3260 392 y Fi(0)3300 377 y Fs(\()p Fq(x)p Fs(\).)42 b(As)3641 351 y(~)3640 377 y Fq(h)3696 392 y Fi(0)3764 377 y Fs(is)27 b(lo)s(cally)-118 493 y(absolutely)32 b(con)m(tin)m(uous,)h(w)m(e)h (can)f(in)m(tegrate)f(b)m(y)h(parts)g(and)g(obtain)223 587 y Fn(\014)223 646 y(\014)223 706 y(\014)223 766 y(\014)257 595 y(Z)312 821 y Fl(R)381 731 y Fq(d!)493 746 y Fp(\015)538 705 y Fs(~)537 731 y Fq(h)593 746 y Fi(0)632 731 y Fs(\()p Fq(!)731 746 y Fp(\015)775 731 y Fs(\))876 664 y Fq(@)p 823 708 163 4 v 823 799 a(@)5 b(!)940 814 y Fp(\015)995 731 y Fs(tr)p Fo(f)p Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)1396 746 y Fi(0)1436 731 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))j(+)i(1)g Fo(\000)h Fq(t)p Fs(\))f Fo(\000)h Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)2443 746 y Fi(0)2483 731 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))2731 690 y Fp(M)2799 699 y Fc(0)2832 690 y Fp(;\015)2918 731 y Fs(+)22 b(1)g Fo(\000)g Fq(t)p Fs(\))p Fo(g)3309 587 y Fn(\014)3309 646 y(\014)3309 706 y(\014)3309 766 y(\014)235 1045 y Fs(=)338 870 y Fn(\014)338 930 y(\014)338 990 y(\014)338 1050 y(\014)338 1109 y(\014)371 920 y Fp(N)7 b Fm(\000)p Fi(1)376 950 y Fn(X)392 1162 y Fp(l)q Fi(=0)541 909 y Fn(Z)641 935 y Fp(M)709 947 y Fk(l)p Fc(+1)597 1134 y Fp(M)665 1146 y Fk(l)831 1045 y Fq(d!)943 1060 y Fp(\015)987 1018 y Fs(~)986 1045 y Fq(h)1042 1060 y Fi(0)1082 1045 y Fs(\()p Fq(!)1181 1060 y Fp(\015)1225 1045 y Fs(\))1326 977 y Fq(@)p 1273 1022 V 1273 1113 a(@)e(!)1390 1128 y Fp(\015)1445 1045 y Fs(tr)p Fo(f)p Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)1846 1060 y Fi(0)1885 1045 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h(1)g Fo(\000)h Fq(t)p Fs(\))f Fo(\000)h Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)2893 1060 y Fi(0)2932 1045 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))3180 1003 y Fp(M)3248 1012 y Fc(0)3281 1003 y Fp(;\015)3368 1045 y Fs(+)22 b(1)f Fo(\000)i Fq(t)p Fs(\))p Fo(g)3759 870 y Fn(\014)3759 930 y(\014)3759 990 y(\014)3759 1050 y(\014)3759 1109 y(\014)235 1302 y Fo(\024)28 b(k)391 1275 y Fs(~)390 1302 y Fq(h)446 1317 y Fi(0)485 1302 y Fo(k)535 1317 y Fm(1)610 1302 y Fo(j)p Fs(tr)o Fo(f)p Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)1038 1317 y Fi(0)1078 1302 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))1326 1261 y Fp(M)1394 1272 y Fk(N)1450 1261 y Fp(;\015)1536 1302 y Fs(+)22 b(1)g Fo(\000)h Fq(t)p Fs(\))f Fo(\000)g Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)2274 1317 y Fi(0)2314 1302 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))2562 1261 y Fp(M)2630 1270 y Fc(0)2663 1261 y Fp(;\015)2749 1302 y Fs(+)22 b(1)g Fo(\000)h Fq(t)p Fs(\))p Fo(gj)229 1471 y Fs(+)f Fo(k)378 1444 y Fs(~)377 1471 y Fq(h)433 1429 y Fm(0)433 1495 y Fi(0)472 1471 y Fo(k)522 1486 y Fm(1)679 1471 y Fs(sup)614 1551 y Fp(x)p Fm(2)p Fi(supp)5 b(~)-40 b Fp(!)909 1471 y Fo(j)p Fs(tr)o Fo(f)p Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)1337 1486 y Fi(0)1377 1471 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))1625 1429 y Fp(x;\015)1749 1471 y Fs(+)22 b(1)g Fo(\000)h Fq(t)p Fs(\))f Fo(\000)h Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)2488 1486 y Fi(0)2528 1471 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))2776 1429 y Fp(M)2844 1438 y Fc(0)2876 1429 y Fp(;\015)2963 1471 y Fs(+)22 b(1)g Fo(\000)g Fq(t)p Fs(\))p Fo(gj)p Fq(;)-118 1730 y Fs(where)38 b Fq(G)p Fs(\()p Fq(E)355 1745 y Fi(0)394 1730 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))642 1694 y Fp(x;\015)781 1730 y Fs(is)36 b(the)h(op)s(erator)f Fq(G)p Fs(\()p Fq(E)1639 1745 y Fi(0)1679 1730 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))35 b(with)h(the)h(coupling)e(constan)m(t)j Fq(!)3213 1745 y Fp(\015)3293 1730 y Fs(at)e(the)h Fq(\015)3644 1694 y Fp(th)3715 1730 y Fs(-site)f(\014xed)-118 1846 y(at)i(the)h(v)-5 b(alue)39 b Fq(!)501 1861 y Fp(\015)583 1846 y Fs(=)f Fq(x)p Fs(.)62 b(Similarly)-8 b(,)36 b(the)k(v)-5 b(alue)38 b(0)g(or)h Fq(M)49 b Fs(denotes)40 b(the)f(coupling)e (constan)m(t)j Fq(!)3461 1861 y Fp(\015)3544 1846 y Fs(\014xed)g(at)e (those)-118 1965 y(v)-5 b(alues.)43 b(No)m(w,)34 b(as)e Fq(G)p Fs(\()p Fq(E)766 1980 y Fi(0)806 1965 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))31 b(is)h(of)g(rank)h(at)f(most)g Fq(C)7 b(n)2012 1929 y Fp(d)2053 1965 y Fs(,)33 b(w)m(e)g(get)g(that,)f (for)g(some)h Fq(C)h(>)28 b Fs(0,)k(one)h(has)405 2064 y Fn(\014)405 2123 y(\014)405 2183 y(\014)405 2243 y(\014)438 2072 y(Z)494 2298 y Fl(R)563 2208 y Fq(d!)675 2223 y Fp(\015)719 2182 y Fs(~)718 2208 y Fq(h)774 2223 y Fi(0)814 2208 y Fs(\()p Fq(!)913 2223 y Fp(\015)957 2208 y Fs(\))1058 2141 y Fq(@)p 1005 2185 V 1005 2276 a(@)5 b(!)1122 2291 y Fp(\015)1177 2208 y Fs(tr)p Fo(f)p Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)1578 2223 y Fi(0)1617 2208 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))k(+)h(1)g Fo(\000)h Fq(t)p Fs(\))f Fo(\000)h Fq(\032)p Fs(\()p Fq(G)p Fs(\()p Fq(E)2625 2223 y Fi(0)2664 2208 y Fq(;)17 b(!)t(;)g(\025)p Fs(\))2912 2167 y Fp(M)2980 2176 y Fc(0)3013 2167 y Fp(;\015)3100 2208 y Fs(+)22 b(1)f Fo(\000)i Fq(t)p Fs(\))p Fo(g)3491 2064 y Fn(\014)3491 2123 y(\014)3491 2183 y(\014)3491 2243 y(\014)3552 2208 y Fo(\024)28 b Fq(C)7 b(n)3792 2167 y Fp(d)3833 2208 y Fq(:)-118 2453 y Fs(Pluging)31 b(this)h(in)g(turn)h(in)m(to)f(\(4.9\))o(,)h(\(4.8\))o(,)g(\(4.7\))o(,) g(and)g(\014nally)f(\(4.6\),)g(for)g Fq(\025)h Fs(su\016cien)m(tly)g (small,)e(w)m(e)i(obtain)559 2643 y Fj(E)12 b Fs(\(#)q Fo(f)p Fs(eigen)m(v)-5 b(alues)38 b(of)32 b Fq(H)1499 2602 y Fp(n)1491 2667 y(!)r(;\025)1635 2643 y Fs(in)g([)p Fq(E)1848 2658 y Fi(0)1909 2643 y Fo(\000)23 b Fq(";)17 b(E)2171 2658 y Fi(0)2232 2643 y Fs(+)22 b Fq(")p Fs(])p Fo(g)p Fs(\))27 b Fo(\024)h Fq(C)7 b(n)2758 2602 y Fi(2)p Fp(d)2834 2643 y Fq(\024)28 b Fs(=)3044 2618 y(~)3022 2643 y Fq(C)7 b(n)3157 2602 y Fi(2)p Fp(d)3233 2643 y Fq("\025)3336 2602 y Fm(\000)p Fi(1)3430 2643 y Fq(:)-118 2825 y Fs(This)33 b(completes)f(the)h(pro)s(of)f(of)g(Prop)s(osition)f (3.1.)p 4063 2825 4 66 v 4067 2762 59 4 v 4067 2825 V 4125 2825 4 66 v 1711 3094 a(5.)55 b Fr(Appendix)-118 3268 y Fs(5.1.)h Fw(The)35 b(dep)s(endence)h(of)g Fs(\006)1115 3283 y Fp(\025)1195 3268 y Fw(on)f Fq(\025)p Fw(.)49 b Fs(In)31 b(this)f(section,)h(w)m(e)g(study)h(the)f(dep)s(endence)h (on)f(\006)3442 3283 y Fp(\025)3518 3268 y Fs(\(i.e.)42 b(of)30 b Fq(E)3904 3283 y Fm(\000)3963 3268 y Fs(\()p Fq(\025)p Fs(\)\))-118 3384 y(in)35 b Fq(\025)g Fs(in)g(a)h(neigh)m(b)s (orho)s(o)s(d)e(of)h(a)h(gap)f(of)h(\006)1479 3399 y Fi(0)1518 3384 y Fs(.)53 b(In)36 b(the)g(case)h(of)e(a)h(nonnegativ)m (e)g(single)e(site)i(p)s(oten)m(tial)e Fq(V)21 b Fs(,)37 b(suc)m(h)g(a)-118 3500 y(study)d(w)m(as)f(done)g(in)f([15].)-118 3617 y(As)42 b Fq(E)6 b Fs(\(0\))42 b(is)g(simple,)g(there)h(exists)g (a)e(unique)i(Flo)s(quet)e(eigen)m(v)-5 b(alue)42 b(of)f Fq(H)8 b Fs(,)44 b(sa)m(y)f Fq(E)3062 3632 y Fp(n)3109 3617 y Fs(\()p Fo(\001)p Fs(\),)h(suc)m(h)f(that,)i(for)c(some)-118 3733 y Fq(\022)f Fo(2)e Fj(T)134 3697 y Fm(\003)177 3733 y Fs(,)h Fq(E)315 3748 y Fm(\000)375 3733 y Fs(\(0\))e(=)g Fq(E)722 3748 y Fp(n)769 3733 y Fs(\()p Fq(\022)s Fs(\).)60 b(Let)39 b Fq(Z)44 b Fo(\032)38 b Fj(T)1450 3697 y Fm(\003)1531 3733 y Fs(b)s(e)g(the)h(set)g(of)e(p)s(oin)m(ts)h Fq(\022)j Fs(suc)m(h)f(that)e Fq(E)3017 3748 y Fp(n)3064 3733 y Fs(\()p Fq(\022)s Fs(\))g(=)f Fq(E)3411 3748 y Fm(\000)3470 3733 y Fs(\(0\).)60 b(This)38 b(set)h(is)-118 3849 y(discrete)34 b(b)m(y)h(assumption)e(\(H1\),)g(th)m(us,)i(\014nite,)f(as)g Fj(T)1858 3813 y Fm(\003)1934 3849 y Fs(is)f(compact.)46 b(T)-8 b(o)34 b(\014x)g(ideas,)g(set)g Fq(Z)i Fs(=)30 b Fo(f)p Fq(\022)3478 3864 y Fp(j)3514 3849 y Fs(;)51 b(1)29 b Fo(\024)h Fq(j)35 b Fo(\024)30 b Fq(n)4017 3864 y Fp(z)4057 3849 y Fo(g)p Fs(.)-118 3965 y(As)45 b Fq(E)110 3980 y Fm(\000)169 3965 y Fs(\(0\))f(is)g(simple,)i(for)e(1)j Fo(\024)h Fq(j)54 b Fo(\024)48 b Fq(n)1453 3980 y Fp(z)1493 3965 y Fs(,)f(the)e(Flo)s(quet)f(eigenspace)h(asso)s(ciated)f(to)g Fq(E)3289 3980 y Fm(\000)3348 3965 y Fs(\(0\))g(and)h Fq(\022)3764 3980 y Fp(j)3845 3965 y Fs(is)f(one-)-118 4081 y(dimensional.)c(Hence,)33 b(b)m(y)f(standard)g(analytic)d(p)s (erturbation)h(theory)i(\(cf)f([13,)g(28)o(]\),)h(for)e Fq(\022)k Fs(su\016cien)m(tly)e(close)f(to)-118 4198 y Fq(\022)-73 4213 y Fp(j)-36 4198 y Fs(,)j(the)h(Flo)s(quet)e(eigen)m (v)-5 b(alue)33 b Fq(E)1097 4213 y Fp(n)1145 4198 y Fs(\()p Fq(\022)s Fs(\))h(is)f(analytic)g(in)g Fq(\022)s Fs(,)i(and)f(one)g (can)g(\014nd)h(a)f(Flo)s(quet)f(eigen)m(v)m(ector)i(asso)s(ciated)-118 4314 y(to)d Fq(E)73 4329 y Fp(n)120 4314 y Fs(\()p Fq(\022)s Fs(\),)h(sa)m(y)g Fq(')536 4329 y Fp(n)583 4314 y Fs(\()p Fq(x;)17 b(\022)s Fs(\),)33 b(that)g(is)f(normalized)e(and)j(analytic)e (in)h Fq(\022)s Fs(.)-118 4435 y(Applying)g(no)m(w)i(analytic)e(p)s (erturbation)g(theory)i(to)p 1879 4355 89 4 v 32 w Fq(H)1968 4450 y Fp(\025)2013 4435 y Fs(\()p Fq(\022)s Fs(\))f(\(i.e.)p 2378 4355 V 45 w Fq(H)2466 4450 y Fp(\025)2544 4435 y Fs(with)g Fq(\022)s Fs(-p)s(erio)s(dic)e(b)s(oundary)j(conditions\)) -118 4551 y(for)e(small)e Fq(\025)p Fs(,)j(w)m(e)g(obtain)f(that,)g (there)i(exists)f Fq(\016)f(>)27 b Fs(0)32 b(and)h Fq(\025)2113 4566 y Fi(0)2180 4551 y Fq(>)28 b Fs(0)k(suc)m(h)i(that,)e(for)g Fo(j)p Fq(\025)p Fo(j)27 b Fq(<)h(\025)3273 4566 y Fi(0)3345 4551 y Fs(and)k(1)c Fo(\024)g Fq(j)34 b Fo(\024)28 b Fq(n)3953 4566 y Fp(z)3993 4551 y Fs(,)8 4705 y Fo(\017)41 b Fs(in)36 b(the)h(in)m(terv)-5 b(al)36 b(])p Fq(E)845 4720 y Fm(\000)904 4705 y Fs(\(0\))25 b Fo(\000)h Fq(\016)n(;)17 b(E)1314 4720 y Fm(\000)1373 4705 y Fs(\(0\))25 b(+)g Fq(\016)t Fs([,)p 1763 4625 V 38 w Fq(H)1851 4720 y Fp(\025)1897 4705 y Fs(\()p Fq(\022)s Fs(\))36 b(has)i(a)e(unique)i(Flo)s(quet)e (eigen)m(v)-5 b(alue)36 b(for)g(the)i(Flo)s(quet)99 4822 y(parameter)32 b Fo(j)p Fq(\022)25 b Fo(\000)e Fq(\022)808 4837 y Fp(j)845 4822 y Fo(j)k Fq(<)g(\016)t Fs(;)33 b(let)f Fq(E)1323 4837 y Fp(n)1370 4822 y Fs(\()p Fq(\022)s(;)17 b(\025)p Fs(\))32 b(b)s(e)h(this)f(eigen)m(v)-5 b(alue;)8 4938 y Fo(\017)41 b Fq(E)171 4953 y Fp(n)218 4938 y Fs(\()p Fq(\022)s(;)17 b(\025)p Fs(\))37 b(is)f(real)h(analytic)e(in)i(\()p Fq(\022)s(;)17 b(\025)p Fs(\))35 b Fo(2)h(fj)p Fq(\022)28 b Fo(\000)d Fq(\022)1931 4953 y Fp(j)1968 4938 y Fo(j)36 b Fq(<)f(\016)t Fo(g\002)p Fs(])p Fq(E)2416 4953 y Fm(\000)2475 4938 y Fs(\(0\))25 b Fo(\000)h Fq(\016)n(;)17 b(E)2885 4953 y Fm(\000)2944 4938 y Fs(\(0\))25 b(+)g Fq(\016)t Fs([,)39 b(and,)f(there)g(exists)g(a)99 5054 y(Flo)s(quet)32 b(eigen)m(v)m(ector,)h(sa)m(y)h Fq(')1227 5069 y Fp(n)1274 5054 y Fs(\()p Fq(x;)17 b(\022)s(;)g(\025)p Fs(\),)32 b(that)h(is)f(normalized)e(and)j(analytic)e(in)h(\()p Fq(\022)s(;)17 b(\025)p Fs(\);)8 5175 y Fo(\017)41 b Fs(the)33 b(rest)g(of)f(the)h(sp)s(ectrum)g(of)p 1273 5095 V 32 w Fq(H)1362 5190 y Fp(\025)1407 5175 y Fs(\()p Fq(\022)s Fs(\))g(lies)e(outside)i(of)f(])p Fq(E)2279 5190 y Fi(0)2319 5175 y Fq(;)17 b(E)2435 5190 y Fm(\000)2494 5175 y Fs(\(0\))k(+)h Fq(\016)t Fs([.)-118 5334 y(This)43 b(pro)m(v)m(es)i(that)p 649 5254 79 4 v 43 w Fq(E)6 b Fs(\()p Fq(\025)p Fs(\))42 b(is)h(equal)g(to)f(one)i(of)e(the)i(n)m(um) m(b)s(ers)f(\()p Fq(E)2411 5349 y Fp(n)2459 5334 y Fs(\()2505 5307 y(~)2497 5334 y Fq(\022)2542 5349 y Fp(j)2578 5334 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)17 b(\025)p Fs(\)\))2888 5349 y Fi(1)p Fm(\024)p Fp(j)t Fm(\024)p Fp(n)3109 5357 y Fk(z)3191 5334 y Fs(where)3491 5307 y(~)3483 5334 y Fq(\022)3528 5349 y Fp(j)3565 5334 y Fs(\()p Fq(\025)p Fs(\))43 b(is)f(unique)-118 5462 y(minim)m(um)29 b(of)j Fq(E)501 5477 y Fp(n)548 5462 y Fs(\()p Fq(\022)s(;)17 b(\025)p Fs(\))32 b(in)g Fo(fj)p Fq(\022)24 b Fo(\000)e Fq(\022)1210 5477 y Fp(j)1247 5462 y Fo(j)27 b Fq(<)h(\016)t Fo(g)p Fs(.)43 b(The)33 b(p)s(oin)m(ts)2074 5436 y(~)2066 5462 y Fq(\022)2111 5477 y Fp(j)2148 5462 y Fs(\()p Fq(\025)p Fs(\))f(are)h(analytic)e(in)g Fq(\025)p Fs(;)i(they)g(satisfy)f(the)h (equation)-118 5591 y Fo(r)p Fq(E)37 5606 y Fp(n)84 5591 y Fs(\()130 5565 y(~)122 5591 y Fq(\022)167 5606 y Fp(j)204 5591 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)17 b(\025)p Fs(\))27 b(=)h(0)g(and)h(the)h(Hessian)f(matrix)e(of)i Fq(\022)h Fo(7!)e Fq(E)2083 5606 y Fp(n)2130 5591 y Fs(\()p Fq(\022)s(;)17 b(\025)p Fs(\))28 b(is)h(non)g(degenerate)h(in)e(a)h(neigh)m(b)s(orho)s (o)s(d)e(of)i Fq(\022)4097 5606 y Fp(j)1969 5690 y Fg(17)p eop %%Page: 18 18 18 17 bop -118 241 a Fs(for)33 b Fq(\025)g Fs(small.)45 b(This)33 b(is)g(a)h(consequence)i(of)e(p)s(erturbation)e(theory)i(as)g (it)f(holds)g(for)g Fq(\025)c Fs(=)h(0)j(b)m(y)i(assumption.)45 b(One)-118 357 y(computes)356 556 y Fq(@)407 571 y Fp(\025)453 556 y Fq(E)525 571 y Fp(n)572 556 y Fs(\()618 529 y(~)610 556 y Fq(\022)655 571 y Fp(j)692 556 y Fq(;)17 b(\025)p Fs(\))831 571 y Fb(\026)p Fp(\025)p Fi(=0)1023 556 y Fs(=)1127 445 y Fn(\020)1186 556 y Fo(h)p Fq(V)22 b(')1368 571 y Fp(n)1415 556 y Fs(\()p Fq(x;)1559 529 y Fs(~)1552 556 y Fq(\022)1597 571 y Fp(j)1634 556 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)17 b(\025)p Fs(\))p Fq(;)g(')2014 571 y Fp(n)2059 556 y Fs(\()p Fq(x;)2204 529 y Fs(~)2196 556 y Fq(\022)2241 571 y Fp(j)2279 556 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)g(\025)p Fs(\))p Fo(i)k Fs(+)h Fo(r)2792 571 y Fp(\022)2831 556 y Fq(E)2903 571 y Fp(n)2950 556 y Fs(\()2996 529 y(~)2988 556 y Fq(\022)s Fs(\()p Fq(\025)p Fs(\))p Fq(;)17 b(\025)p Fs(\))p Fq(@)3359 571 y Fp(\025)3412 529 y Fs(~)3404 556 y Fq(\022)3449 571 y Fp(j)3486 556 y Fs(\()p Fq(\025)p Fs(\))3619 445 y Fn(\021)3678 624 y Fb(\026)p Fp(\025)p Fi(=0)1023 810 y Fs(=)1127 675 y Fn(Z)1182 900 y Fl(R)1230 881 y Fk(d)1287 810 y Fq(V)22 b Fs(\()p Fq(x)p Fs(\))p Fo(j)p Fq(')1589 825 y Fp(n)1635 810 y Fs(\()p Fq(x;)17 b(\022)1817 825 y Fp(j)1855 810 y Fs(\))p Fo(j)1921 769 y Fi(2)1960 810 y Fq(dx:)-118 695 y Fs(\(5.1\))-118 1039 y(Hence,)34 b(assumption)e(\(H2\))g(is)g (satis\014ed)h(if)f(and)g(only)g(if)1160 1265 y Fo(9)p Fs(1)c Fo(\024)g Fq(j)34 b Fo(\024)28 b Fq(n)1634 1280 y Fp(z)1674 1265 y Fq(;)1815 1129 y Fn(Z)1871 1355 y Fl(R)1919 1336 y Fk(d)1976 1265 y Fq(V)21 b Fs(\()p Fq(x)p Fs(\))p Fo(j)p Fq(')2277 1280 y Fp(n)2324 1265 y Fs(\()p Fq(x;)c(\022)2506 1280 y Fp(j)2543 1265 y Fs(\))p Fo(j)2609 1223 y Fi(2)2676 1265 y Fo(6)p Fs(=)27 b(0)p Fq(:)-2973 b Fs(\(5.2\))-118 1494 y(F)-8 b(or)24 b(a)g(giv)m(en)g(op)s(erator)g Fq(H)8 b Fs(,)26 b(b)m(y)f(the)g(Unique)g(Con)m(tin)m(uation)f (Principle)f(\(see)j(e.g.)e([12]\),)i(this)e(condition)f(is)h (satis\014ed)-118 1610 y(for)32 b(a)g(generic)h Fq(V)21 b Fs(.)94 1730 y(The)43 b(computation)c(\(5.1\))i(and)g(the)h (analyticit)m(y)d(of)i(the)h(\()p Fq(E)2398 1745 y Fp(n)2445 1730 y Fs(\()2491 1704 y(~)2483 1730 y Fq(\022)2528 1745 y Fp(j)2565 1730 y Fs(\()p Fq(\025)p Fs(\))p Fq(;)17 b(\025)p Fs(\)\))2875 1745 y Fi(1)p Fm(\024)p Fp(j)t Fm(\024)p Fp(n)3096 1753 y Fk(z)3175 1730 y Fs(implies)39 b(that,)k(for)e(some)-118 1846 y(1)27 b Fo(\024)h Fq(j)34 b Fo(\024)28 b Fq(n)300 1861 y Fp(z)340 1846 y Fs(,)p 1011 1986 79 4 v 1011 2066 a Fq(E)6 b Fs(\()p Fq(\025)p Fs(\))27 b(=)h Fq(E)1425 2081 y Fm(\000)1484 2066 y Fs(\(0\))22 b(+)g Fq(\025)1803 1930 y Fn(Z)1858 2156 y Fl(R)1906 2137 y Fk(d)1963 2066 y Fq(V)f Fs(\()p Fq(x)p Fs(\))p Fo(j)p Fq(')2264 2081 y Fp(n)2311 2066 y Fs(\()p Fq(x;)c(\022)2493 2081 y Fp(j)2530 2066 y Fs(\))p Fo(j)2596 2025 y Fi(2)2657 2066 y Fs(+)22 b Fq(O)s Fs(\()p Fq(\025)2928 2025 y Fi(2)2967 2066 y Fs(\))-3123 b(\(5.3\))94 2290 y(On)24 b(the)g(other)f(hand,)i (using)e(the)h(c)m(haracterization)f(of)f(\006)2195 2305 y Fp(\025)2241 2290 y Fs(,)j(the)f(almost)e(sure)i(sp)s(ectrum)f(of)g Fq(H)3554 2305 y Fp(!)r(;\025)3689 2290 y Fs(in)f(terms)h(of)-118 2406 y(admissible)28 b(p)s(erio)s(dic)h(sp)s(ectra)i(\(see)g([14,)f (27]\),)h(w)m(e)g(kno)m(w)g(that,)g(for)f Fq(\025)g Fs(su\016cien)m (tly)h(small)d(and)j Fq(t)c Fo(2)p Fs(ess-supp\()p Fq(!)4027 2421 y Fi(0)4069 2406 y Fs(\),)-118 2522 y(w)m(e)34 b(ha)m(v)m(e)1228 2651 y(1)p 1228 2696 49 4 v 1228 2787 a(2)1287 2719 y(\()p Fq(E)1397 2734 y Fm(\000)1456 2719 y Fs(\(0\))22 b(+)g Fq(E)1773 2734 y Fi(+)1832 2719 y Fs(\(0\)\))27 b Fo(\024)i Fq(E)2200 2734 y Fm(\000)2259 2719 y Fs(\()p Fq(\025)p Fs(\))e Fo(\024)p 2524 2638 79 4 v 28 w Fq(E)6 b Fs(\()p Fq(\025t)p Fs(\))p Fq(:)-118 2926 y Fs(Let)26 b Fq(!)111 2941 y Fi(+)195 2926 y Fs(and)f Fq(!)438 2941 y Fm(\000)523 2926 y Fs(resp)s(ectiv)m(ely)h(b)s(e)g(the)g(essen)m(tial)g(suprem)m (um)f(and)h(in\014m)m(um)e(of)h(the)h(random)f(v)-5 b(ariables)24 b(\()p Fq(!)3853 2941 y Fp(\015)3897 2926 y Fs(\))3935 2945 y Fp(\015)t Fm(2)p Fl(Z)4072 2926 y Fk(d)s Fs(;)-118 3042 y(as)i(the)h(random)f(v)-5 b(ariables)25 b(are)h(not)g(trivial,)f (using)j(\(5.2\))e(and)g(the)h(computation)e(\(5.1\))o(,)j(one)f(sees)h (that,)f(for)f(some)-118 3159 y Fq(C)35 b(>)27 b Fs(0)32 b(and)h(for)f Fq(\025)g Fs(su\016cien)m(tly)i(small)732 3331 y Fo(j)p 760 3251 V Fq(E)6 b Fs(\()p Fq(\025)p 933 3276 65 4 v(!)s Fs(\))22 b Fo(\000)p 1157 3251 79 4 v 23 w Fq(E)6 b Fs(\()p Fq(\025!)1391 3346 y Fi(+)1450 3331 y Fs(\))p Fo(j)27 b(\025)h(j)p Fq(\025)p Fo(j)p Fq(=C)38 b Fs(and)33 b Fo(j)p 2136 3251 V Fq(E)6 b Fs(\()p Fq(\025)p 2309 3276 65 4 v(!)s Fs(\))22 b Fo(\000)p 2533 3251 79 4 v 23 w Fq(E)6 b Fs(\()p Fq(\025!)2767 3346 y Fm(\000)2825 3331 y Fs(\))p Fo(j)28 b(\025)g(j)p Fq(\025)p Fo(j)p Fq(=C)r(:)-118 3510 y Fs(This)33 b(implies)d(that)i(\(0.2\))g (holds)g(for)g(some)h Fq(C)h(>)28 b Fs(0)k(and)h Fq(\025)f Fs(su\016cien)m(tly)i(small.)-118 3715 y(5.2.)56 b Fw(A)37 b(useful)g(lemma.)48 b Fs(W)-8 b(e)33 b(pro)m(v)m(e)-118 3899 y Fw(Lemma)k(5.1.)49 b Ff(Pick)37 b Fq(")31 b(>)h Fs(0)37 b Ff(and)f Fq(u)31 b Fo(2)i Fq(L)1439 3862 y Fi(2)1478 3899 y Fs(\()p Fj(R)1582 3862 y Fp(d)1629 3899 y Fs(\))k Ff(such)g(that)g(supp)p Fs(\()p Fq(u)p Fs(\))31 b Fo(\032)h(fj)p Fq(x)p Fo(j)g(\024)g Fq(")p Fo(g)p Ff(.)51 b(Then,)36 b(for)h(any)g Fq(\021)f Fo(2)c Fs(\(0)p Fq(;)17 b Fs(1\))p Ff(,)-118 4015 y(ther)-5 b(e)35 b(exists)40 b Fs(~)-55 b Fq(u)27 b Fo(2)i Fq(L)635 3979 y Fi(2)674 4015 y Fs(\()p Fj(R)778 3979 y Fp(d)825 4015 y Fs(\))34 b Ff(such)h(that)8 4159 y Fo(\017)41 b(k)6 b Fs(~)-55 b Fq(u)o Fo(k)254 4176 y Fp(L)302 4157 y Fc(2)368 4159 y Fs(=)28 b Fo(k)p Fq(u)p Fo(k)628 4176 y Fp(L)676 4157 y Fc(2)714 4159 y Ff(,)8 4275 y Fo(\017)41 b(k)p Fq(u)21 b Fo(\000)29 b Fs(~)-55 b Fq(u)p Fo(k)432 4292 y Fp(L)480 4273 y Fc(2)546 4275 y Fo(\024)28 b Fq(C)7 b(\021)t Fo(k)p Fq(u)p Fo(k)936 4292 y Fp(L)984 4273 y Fc(2)1021 4275 y Ff(,)8 4392 y Fo(\017)47 b Fs(^)-55 b Fq(u)155 4407 y Fp(\021)231 4392 y Ff(is)35 b(c)-5 b(onstant)34 b(on)h(e)-5 b(ach)34 b(cub)-5 b(e)35 b Fq(C)1370 4410 y Fp(\015)t(;)1452 4379 y Fk(\021)p 1439 4394 60 3 v 1439 4436 a Fc(2)p Fk(")1513 4392 y Ff(,)g Fq(\015)e Fo(2)28 b Fj(Z)1825 4355 y Fp(d)1897 4392 y Ff(wher)-5 b(e)924 4575 y Fq(C)994 4590 y Fp(\015)t(;r)1120 4575 y Fs(=)27 b Fo(f)p Fq(x)h Fs(=)g(\()p Fq(x)1553 4590 y Fi(1)1592 4575 y Fq(;)17 b(:)g(:)g(:)f(;)h(x)1866 4590 y Fp(d)1907 4575 y Fs(\);)51 b Fo(\000)p Fq(\031)t(r)31 b Fo(\024)d Fq(x)2394 4590 y Fp(i)2445 4575 y Fo(\000)23 b Fs(2)p Fq(\031)t(r)s(\015)2751 4590 y Fp(i)2805 4575 y Fq(<)28 b(\031)t(r)s Fo(g)p Fq(:)-118 4759 y Fs(Lemma)34 b(5.1)g(is)h(a)g(v)m(ery)i(simple)c(quan)m(titativ)m (e)i(v)m(ersion)h(of)f(the)g(Uncertain)m(t)m(y)i(Principle.)50 b(It)35 b(is)g(the)g(analogue)f(of)-118 4875 y(Lemma)d(6.2)h(in)g([22]) g(dev)m(elop)s(ed)i(for)e(the)h(discrete)g(setting.)-118 4991 y Fw(Pro)s(of.)56 b Fs(Pic)m(k)37 b Fq(")p Fs(,)g Fq(\021)k Fs(and)36 b Fq(u)h Fs(as)g(in)f(Lemma)f(5.1.)55 b(Consider)38 b Fq(u)e Fs(as)h(a)f(\(2)p Fq("=\021)t Fs(\))p Fj(Z)2803 4955 y Fp(d)2840 4991 y Fs(-p)s(erio)s(dic)e (function)j(\(con)m(tin)m(ue)g(it)-118 5107 y(b)m(y)c(0)e(on)h(the)g (fundamen)m(tal)f(cell)g(of)g(\(2)p Fq("=\021)t Fs(\))p Fj(Z)1586 5071 y Fp(d)1655 5107 y Fs(and)h(p)s(erio)s(dically)c(to)k (the)g(rest)h(of)e Fj(R)3023 5071 y Fp(d)3069 5107 y Fs(\).)44 b(Expand)33 b(it)d(in)h(a)h(F)-8 b(ourier)-118 5223 y(series)33 b(to)f(get)776 5443 y Fq(u)p Fs(\()p Fq(x)p Fs(\))c(=)1106 5348 y Fn(X)1094 5568 y Fp(\015)t Fm(2)p Fl(Z)1232 5549 y Fk(d)1284 5443 y Fs(^)-55 b Fq(u)1334 5458 y Fp(\015)1378 5443 y Fq(e)1423 5402 y Fp(i)1457 5371 y Fk(\031)r(\021)p 1458 5387 72 3 v 1479 5428 a(")1539 5402 y Fp(\015)t(x)1656 5443 y Fs(where)40 b(^)-55 b Fq(u)1994 5458 y Fp(\015)2065 5443 y Fs(=)2169 5332 y Fn(\020)2260 5376 y Fq(\021)p 2238 5420 95 4 v 2238 5511 a Fs(2)p Fq(")2343 5332 y Fn(\021)2402 5355 y Fp(d)2459 5307 y Fn(Z)2515 5533 y Fl(R)2563 5514 y Fk(d)2620 5443 y Fq(u)p Fs(\()p Fq(x)p Fs(\))p Fq(e)2852 5402 y Fm(\000)p Fp(i)2941 5371 y Fk(\031)r(\021)p 2941 5387 72 3 v 2962 5428 a(")3022 5402 y Fp(\015)t(x)3107 5443 y Fq(dx:)1969 5690 y Fg(18)p eop %%Page: 19 19 19 18 bop -118 241 a Fs(P)m(arsev)-5 b(al's)33 b(iden)m(tit)m(y)g(then) g(reads)1459 476 y Fo(k)p Fq(u)p Fo(k)1615 435 y Fi(2)1615 502 y Fp(L)1663 483 y Fc(2)1729 476 y Fs(=)1844 381 y Fn(X)1832 601 y Fp(\015)t Fm(2)p Fl(Z)1970 582 y Fk(d)2017 335 y Fn(\022)2100 408 y Fs(2)p Fq(")p 2100 453 95 4 v 2121 544 a(\021)2204 335 y Fn(\023)2278 358 y Fp(d)2335 476 y Fo(j)6 b Fs(^)-55 b Fq(u)2419 491 y Fp(\015)2462 476 y Fo(j)2490 435 y Fi(2)2529 476 y Fq(:)-2674 b Fs(\(5.4\))-118 757 y(De\014ne)33 b(the)g(function)f Fq(v)f Fs(:)61 b Fj(R)966 721 y Fp(d)1040 757 y Fo(!)27 b Fj(R)1233 721 y Fp(d)1312 757 y Fs(b)m(y)1170 992 y Fq(v)t Fs(\()p Fq(\030)5 b Fs(\))27 b(=)1475 852 y Fn(\022)1559 925 y Fs(2)p Fq(")p 1559 969 V 1580 1061 a(\021)1663 852 y Fn(\023)1736 874 y Fp(d)1800 992 y Fs(^)-55 b Fq(u)1850 1007 y Fp(\015)1926 992 y Fs(for)32 b Fq(\030)g Fo(2)c Fq(C)2314 1010 y Fp(\015)t(;)2397 979 y Fk(\021)p 2384 995 60 3 v 2384 1036 a Fc(2)p Fk(")2458 992 y Fq(;)49 b(\015)33 b Fo(2)28 b Fj(Z)2781 951 y Fp(d)2818 992 y Fq(:)-118 1220 y Fs(By)40 b(\(5.4\))o(,)g Fq(v)g Fo(2)d Fq(L)565 1184 y Fi(2)605 1220 y Fs(\()p Fj(R)709 1184 y Fp(d)755 1220 y Fs(\).)60 b(Let)44 b(~)-55 b Fq(u)37 b Fs(b)s(e)i(the)f(in)m(v)m(erse)h(F)-8 b(ourier)37 b(transform)g(of)g Fq(v)t Fs(.)60 b(Chec)m(k)40 b(that)d(it)g(satis\014es)i(the)f(the)-118 1337 y(prop)s(erties)32 b(stated)i(in)d(Lemma)h(5.1.)43 b(First,)31 b(\(5.4\))h(yields)760 1579 y Fo(k)6 b Fs(~)-55 b Fq(u)o Fo(k)915 1538 y Fi(2)915 1605 y Fp(L)963 1586 y Fc(2)1029 1579 y Fs(=)1231 1512 y(1)p 1143 1556 225 4 v 1143 1648 a(\(2)p Fq(\031)t Fs(\))1327 1619 y Fp(d)1377 1579 y Fo(k)p Fq(v)t Fo(k)1528 1538 y Fi(2)1528 1605 y Fp(L)1576 1586 y Fc(2)1642 1579 y Fs(=)1745 1439 y Fn(\022)1837 1512 y Fs(2)p Fq(")1932 1476 y Fi(2)p 1829 1556 151 4 v 1829 1648 a Fq(\031)t(\021)1940 1619 y Fi(2)1989 1439 y Fn(\023)2062 1459 y Fp(d)2131 1485 y Fn(X)2119 1704 y Fp(\015)t Fm(2)p Fl(Z)2257 1685 y Fk(d)2303 1444 y Fn(Z)2359 1669 y Fp(C)2409 1693 y Fc(0)p Fk(;)2481 1668 y(\021)p 2468 1683 60 3 v 2468 1717 a Fc(2)p Fk(")2563 1579 y Fo(j)6 b Fs(^)-55 b Fq(u)2647 1594 y Fp(\015)2690 1579 y Fo(j)2718 1538 y Fi(2)2758 1579 y Fq(d\030)31 b Fs(=)d Fo(k)p Fq(u)p Fo(k)3143 1538 y Fi(2)3143 1605 y Fp(L)3191 1586 y Fc(2)3229 1579 y Fq(:)-118 1847 y Fs(Let)39 b(^)-55 b Fq(u)32 b Fs(b)s(e)g(the)h(F)-8 b(ourier)32 b(transform)f(of)i Fq(u)p Fs(;)f(w)m(e)h(compute)670 1973 y Fn(Z)725 2199 y Fl(R)773 2180 y Fk(d)830 2109 y Fo(j)6 b Fs(^)-55 b Fq(u)o Fs(\()p Fq(\030)5 b Fs(\))22 b Fo(\000)g Fq(v)t Fs(\()p Fq(\030)5 b Fs(\))p Fo(j)1361 2068 y Fi(2)1400 2109 y Fq(d\030)31 b Fs(=)1641 2014 y Fn(X)1629 2234 y Fp(\015)t Fm(2)p Fl(Z)1767 2215 y Fk(d)1813 1973 y Fn(Z)1869 2199 y Fp(C)1919 2223 y Fc(0)p Fk(;)1991 2198 y(\021)p 1978 2213 V 1978 2247 a Fc(2)p Fk(")2073 1935 y Fn(\014)2073 1994 y(\014)2073 2054 y(\014)2073 2114 y(\014)2073 2174 y(\014)2112 2109 y Fs(^)-55 b Fq(u)p Fs(\()p Fq(\030)26 b Fs(+)c Fq(\015)2433 2042 y(\031)t(\021)p 2433 2086 111 4 v 2465 2177 a(")2554 2109 y Fs(\))g Fo(\000)2713 1969 y Fn(\022)2797 2042 y Fs(2)p Fq(")p 2797 2086 95 4 v 2818 2177 a(\021)2901 1969 y Fn(\023)2974 1991 y Fp(d)3037 2109 y Fs(^)-55 b Fq(u)3087 2124 y Fp(\015)3131 1935 y Fn(\014)3131 1994 y(\014)3131 2054 y(\014)3131 2114 y(\014)3131 2174 y(\014)3165 1961 y Fi(2)3221 2109 y Fq(d\030)5 b(:)-3465 b Fs(\(5.5\))-118 2377 y(On)32 b(the)h(other)g(hand,)g(w)m(e)h(note)849 2612 y(^)-55 b Fq(u)o Fs(\()p Fq(\030)27 b Fs(+)22 b Fq(\015)1170 2545 y(\031)t(\021)p 1170 2589 111 4 v 1202 2681 a(")1290 2612 y Fs(\))h Fo(\000)1450 2472 y Fn(\022)1533 2545 y Fs(2)p Fq(")p 1533 2589 95 4 v 1555 2681 a(\021)1638 2472 y Fn(\023)1711 2494 y Fp(d)1774 2612 y Fs(^)-55 b Fq(u)1824 2627 y Fp(\015)1896 2612 y Fs(=)1999 2477 y Fn(Z)2055 2702 y Fl(R)2103 2683 y Fk(d)2160 2612 y Fq(u)p Fs(\()p Fq(x)p Fs(\)\()p Fq(e)2430 2571 y Fp(ix\030)2553 2612 y Fo(\000)23 b Fs(1\))p Fq(e)2785 2571 y Fm(\000)p Fp(i)2874 2540 y Fk(\031)r(\021)p 2874 2556 72 3 v 2895 2597 a(")2956 2571 y Fp(\015)t(x)3040 2612 y Fq(dx:)-118 2841 y Fs(As)40 b(w)m(e)g(did)e(for)h Fq(u)p Fs(,)h(w)m(e)g(consider)g Fq(x)f Fo(7!)f Fq(u)p Fs(\()p Fq(x)p Fs(\)\()p Fq(e)1675 2805 y Fp(ix\030)1803 2841 y Fo(\000)27 b Fs(1\))39 b(as)g(a)g(\(2)p Fq("=\021)t Fs(\))p Fj(Z)2588 2805 y Fp(d)2625 2841 y Fs(-p)s(erio)s(dic)e(function;)42 b(then,)f(P)m(arsev)-5 b(al's)-118 2957 y(iden)m(tit)m(y)32 b(yields)626 3124 y Fn(X)614 3343 y Fp(\015)t Fm(2)p Fl(Z)751 3324 y Fk(d)798 3044 y Fn(\014)798 3104 y(\014)798 3164 y(\014)798 3223 y(\014)798 3283 y(\014)837 3218 y Fs(^)-55 b Fq(u)p Fs(\()p Fq(\030)26 b Fs(+)c Fq(\015)1158 3151 y(\031)t(\021)p 1158 3196 111 4 v 1191 3287 a(")1279 3218 y Fs(\))g Fo(\000)1439 3078 y Fn(\022)1522 3151 y Fs(2)p Fq(")p 1522 3196 95 4 v 1543 3287 a(\021)1626 3078 y Fn(\023)1700 3100 y Fp(d)1763 3218 y Fs(^)-55 b Fq(u)1813 3233 y Fp(\015)1857 3044 y Fn(\014)1857 3104 y(\014)1857 3164 y(\014)1857 3223 y(\014)1857 3283 y(\014)1890 3070 y Fi(2)1957 3218 y Fs(=)2061 3078 y Fn(\022)2144 3151 y Fs(2)p Fq(")p 2144 3196 V 2165 3287 a(\021)2248 3078 y Fn(\023)2322 3100 y Fp(d)2379 3083 y Fn(Z)2434 3308 y Fm(j)p Fp(x)p Fm(j\024)p Fp(")2621 3218 y Fo(j)p Fq(u)p Fs(\()p Fq(x)p Fs(\)\()p Fq(e)2919 3177 y Fp(ix\030)3042 3218 y Fo(\000)23 b Fs(1\))p Fo(j)3257 3177 y Fi(2)3296 3218 y Fq(dx)-118 3492 y Fs(Substituting)32 b(in)f(\(5.5\),)i(w)m(e)g(obtain)574 3607 y Fn(Z)629 3833 y Fl(R)677 3814 y Fk(d)734 3743 y Fo(j)6 b Fs(^)-55 b Fq(u)o Fs(\()p Fq(\030)5 b Fs(\))22 b Fo(\000)g Fq(v)t Fs(\()p Fq(\030)5 b Fs(\))p Fo(j)1265 3702 y Fi(2)1304 3743 y Fq(d\030)31 b Fs(=)1533 3607 y Fn(Z)1588 3833 y Fm(j)p Fp(x)p Fm(j\024)p Fp(")1775 3743 y Fo(j)p Fq(u)p Fs(\()p Fq(x)p Fs(\))p Fo(j)2018 3702 y Fi(2)2074 3573 y Fn( )2152 3602 y(\022)2236 3676 y Fs(2)p Fq(")p 2236 3720 V 2257 3811 a(\021)2340 3602 y Fn(\023)2413 3625 y Fp(d)2471 3607 y Fn(Z)2526 3833 y Fp(C)2576 3857 y Fc(0)p Fk(;)2648 3831 y(\021)p 2636 3846 60 3 v 2636 3881 a Fc(2)p Fk(")2730 3743 y Fo(j)p Fq(e)2803 3702 y Fp(ix\030)2927 3743 y Fo(\000)22 b Fs(1)p Fo(j)3103 3702 y Fi(2)3142 3743 y Fq(d\030)3241 3573 y Fn(!)3336 3743 y Fq(dx)-118 4001 y Fs(that)32 b(is)836 4052 y Fn(Z)891 4278 y Fl(R)939 4259 y Fk(d)996 4188 y Fo(j)6 b Fs(^)-55 b Fq(u)o Fs(\()p Fq(\030)5 b Fs(\))22 b Fo(\000)g Fq(v)t Fs(\()p Fq(\030)5 b Fs(\))p Fo(j)1527 4147 y Fi(2)1566 4188 y Fq(d\030)31 b Fo(\024)e Fq(C)7 b(\021)1926 4147 y Fi(2)1981 4052 y Fn(Z)2037 4278 y Fm(j)p Fp(x)p Fm(j\024)p Fp(")2224 4188 y Fo(j)p Fq(u)p Fs(\()p Fq(x)p Fs(\))p Fo(j)2467 4147 y Fi(2)2505 4188 y Fq(dx)28 b Fs(=)g Fq(C)7 b(\021)2872 4147 y Fi(2)2911 4188 y Fo(k)p Fq(u)p Fo(k)3067 4147 y Fi(2)3067 4214 y Fp(L)3115 4195 y Fc(2)3153 4188 y Fq(:)-118 4415 y Fs(This)33 b(completes)f(the)h(pro)s(of)f(of)g(Lemma)f(5.1.)p 4063 4531 4 66 v 4067 4469 59 4 v 4067 4531 V 4125 4531 4 66 v 1717 4736 a Fr(References)-77 4893 y Fv([1])42 b(M.)35 b(Sh.)h(Birman.)f(P)n(erturbations)e(of)i(p)r(erio)r(dic)h(Sc)n (hr\177)-42 b(odinger)33 b(op)r(erators.)h(Lectures)g(giv)n(en)h(at)g (the)h(Mittag-Le\017er)e(Insitute)53 4993 y(during)27 b(the)h(programm)d(\\Sp)r(ectral)i(Problems)g(in)g(Mathematical)h(Ph)n (ysics",)d(1992.)-77 5093 y([2])42 b(J.)23 b(M.)h(Com)n(b)r(es,)h(P)-7 b(.)23 b(D.)i(Hislop,)f(and)g(E.)f(Mourre.)g(Sp)r(ectral)h(a)n(v)n (eraging,)d(p)r(erturbation)j(of)f(singular)g(sp)r(ectra)g(and)h(lo)r (calization.)53 5192 y Fh(T)-6 b(r)l(ansactions)30 b(of)g(the)g(A)n (meric)l(an)g(Mathematic)l(al)i(So)l(ciety)p Fv(,)c(348:4883{4895,)22 b(1996.)-77 5292 y([3])42 b(H.L.)27 b(Cycon,)h(R.G.)g(F)-7 b(ro)r(ese,)26 b(W.)j(Kirsc)n(h,)d(and)h(B.)h(Simon.)g Fh(Schr\177)-42 b(odinger)31 b(Op)l(er)l(ators)p Fv(.)d(Springer)f(V)-7 b(erlag,)26 b(Berlin,)h(1987.)-77 5392 y([4])42 b(Y)32 b(Colin)f(de)h(V)-7 b(erdi)n(\022)-39 b(ere.)30 b(Sur)h(les)h (singularit)n(\023)-39 b(es)29 b(de)j(V)-7 b(an)31 b(Ho)n(v)n(e)g(g)n (\023)-39 b(en)n(\023)g(eriques.)28 b(In)k Fh(A)n(nalyse)i(glob)l(ale)h (et)e(physique)i(mathematique)53 5491 y(\(Lyon,)c(1989\))p Fv(,)g(v)n(olume)d(46)g(of)h Fh(M)n(\023)-40 b(emoir)l(e)32 b(de)f(la)h(So)l(ci)n(\023)-40 b(et)n(\023)g(e)31 b(Math)n(\023)-40 b(ematique)32 b(de)g(F)-6 b(r)l(anc)l(e)p Fv(,)29 b(pages)e(99{110,)f (1991.)h(Collo)r(quium)i(en)53 5591 y(l'honneur)e(d'E.)g(Com)n(b)r(et.) 1969 5690 y Fg(19)p eop %%Page: 20 20 20 19 bop -77 241 a Fv([5])42 b(A.)27 b(Dem)n(b)r(o)h(and)f(O.)g (Zeitouni.)g Fh(L)l(ar)l(ge)j(deviation)i(te)l(chniques)d(and)h(applic) l(ations)p Fv(.)g(Jones)c(and)i(Bartlett)f(Publi-shers,)f(Boston,)53 340 y(1992.)-77 440 y([6])42 b(J.-M.)26 b(Deusc)n(hel)h(and)g(D.)g (Stro)r(o)r(c)n(k.)f Fh(L)l(ar)l(ge)k(deviations)p Fv(,)e(v)n(olume)f (137)e(of)i Fh(Pur)l(e)i(and)h(applie)l(d)h(Mathematics)p Fv(.)e(Academic)d(Press,)53 540 y(1989.)-77 639 y([7])42 b(M.)27 b(Eastham.)g Fh(The)k(sp)l(e)l(ctr)l(al)f(the)l(ory)g(of)h(p)l (erio)l(dic)h(di\013er)l(ential)f(op)l(er)l(ators)p Fv(.)d(Scottish)g (Academic)f(Press,)g(Edin)n(burgh,)f(1973.)-77 739 y([8])42 b(F.)29 b(Germinet)g(and)h(A.)f(Klein.)g(Bo)r(otstrap)f(m)n(ultiscale)h (analysis)f(and)h(Hilb)r(ert-Sc)n(hmidt)h(dynamical)e(lo)r(calization.) h(T)-7 b(ec)n(hnical)53 839 y(rep)r(ort,)26 b(UCI,)i(2001.)e(to)i(app)r (ear)e(in)i(Comm.)g(Math.)f(Ph)n(ys.)-77 938 y([9])42 b(F.)32 b(Ghribi.)g(Asymptotique)g(de)g(Lifshitz)g(p)r(our)f(des)h(op)n (\023)-39 b(erateurs)29 b(de)j(Sc)n(hr\177)-42 b(odinger)30 b(\022)-42 b(a)31 b(c)n(hamp)h(magn)n(\023)-39 b(etique)30 b(al)n(\023)-39 b(eatoire.)29 b(Thesis)53 1038 y(Univ)n(ersit)n(\023) -39 b(e)26 b(P)n(aris)f(13,)i(2000.)f(in)i(preparation.)-118 1137 y([10])41 b(P)-7 b(.)27 b(Hislop.)g(Exp)r(onen)n(tial)g(deca)n(y)g (of)g(t)n(w)n(o-b)r(o)r(dy)g(eigenfunctions:)37 b(A)28 b(review.)e(Av)-5 b(ailable)28 b(on)f(mp-arc,)g(2001.)-118 1237 y([11])41 b(P)-7 b(.)25 b(Hislop)h(and)g(F.)h(Klopp.)e(The)h(in)n (tegrated)f(densit)n(y)h(of)g(states)g(for)g(some)f(random)g(op)r (erators)f(with)j(nonsign)e(de\014nite)i(p)r(oten-)53 1337 y(tials.)g(2001.)-118 1436 y([12])41 b(D.)d(Jerison)e(and)i(C.)f (Kenig.)g(Unique)h(con)n(tin)n(uation)f(and)h(absence)f(of)g(p)r (ositiv)n(e)g(eigen)n(v)-5 b(alues)37 b(for)g(Sc)n(hr\177)-42 b(odinger)36 b(op)r(erators.)53 1536 y Fh(A)n(nnals)29 b(of)h(Mathematics)p Fv(,)g(121:463{494,)23 b(1984.)-118 1636 y([13])41 b(T.)27 b(Kato.)g Fh(Perturb)l(ation)j(The)l(ory)h(for)g (Line)l(ar)f(Op)l(er)l(ators)p Fv(.)e(Springer)e(V)-7 b(erlag,)27 b(Berlin,)g(1980.)-118 1735 y([14])41 b(W.)21 b(Kirsc)n(h)f(and)h(F.)h(Martinelli.)f(On)g(the)h(sp)r(ectrum)f(of)g (Sc)n(hr\177)-42 b(odinger)20 b(op)r(erators)f(with)j(a)f(random)f(p)r (oten)n(tial.)h Fh(Communic)l(ations)53 1835 y(in)29 b(Mathematic)l(al)j(Physics)p Fv(,)d(85:329{350,)24 b(1982.)-118 1934 y([15])41 b(W.)26 b(Kirsc)n(h,)f(P)-7 b(.)26 b(Stollmann,)h(and)f (G.)h(Stolz.)f(Lo)r(calization)f(for)g(random)h(p)r(erturbations)f(of)h (p)r(erio)r(dic)g(Sc)n(hr\177)-42 b(odinger)25 b(op)r(erators.)53 2034 y Fh(R)l(andom)k(Op)l(er.)i(Sto)l(chastic)f(Equations)p Fv(,)e(6\(3\):241{268,)c(1998.)-118 2134 y([16])41 b(M.)27 b(Klaus.)g(Some)h(applications)e(of)i(the)g(Birman-Sc)n(h)n(winger)d (principle.)j Fh(Helv.)i(Phys.)h(A)l(cta)p Fv(,)d(55\(1\):49{68,)c (1982/83.)-118 2233 y([17])41 b(F.)d(Klopp.)f(Lo)r(calization)f(for)i (some)f(con)n(tin)n(uous)f(random)h(Sc)n(hr\177)-42 b(odinger)36 b(op)r(erators.)g Fh(Communic)l(ations)k(in)f(Mathematic)l(al)53 2333 y(Physics)p Fv(,)29 b(167:553{570,)23 b(1995.)-118 2433 y([18])41 b(F.)29 b(Klopp.)f(Lifshitz)i(tails)e(for)h(random)e(p)r (erturbations)i(of)f(p)r(erio)r(dic)h(sc)n(hr\177)-42 b(odinger)27 b(op)r(erators.)g(T)-7 b(ec)n(hnical)28 b(rep)r(ort,)g(Univ)n(ersit)n(\023)-39 b(e)53 2532 y(P)n(aris-Nord,)24 b(2001.)-118 2632 y([19])41 b(F.)32 b(Klopp)g(and)g(J.)g(Ralston.)f (Endp)r(oin)n(ts)h(of)g(the)h(sp)r(ectrum)f(of)g(p)r(erio)r(dic)g(op)r (erators)e(are)h(generically)g(simple.)h Fh(Metho)l(ds)j(and)53 2731 y(Applic)l(ations)c(of)g(Analysis)p Fv(,)d(7\(3\):459{464,)c (2000.)-118 2831 y([20])41 b(F.)e(Klopp.)f(In)n(ternal)h(Lifshits)g (tails)g(for)f(random)g(p)r(erturbations)g(of)h(p)r(erio)r(dic)g(Sc)n (hr\177)-42 b(odinger)37 b(op)r(erators.)g Fh(Duke)j(Math.)i(J.)p Fv(,)53 2931 y(98\(2\):335{396,)23 b(1999.)-118 3030 y([21])41 b(F.)22 b(Klopp.)g(In)n(ternal)f(Lifshitz)i(tails)f(for)f (long)h(range)e(single)i(site)g(p)r(oten)n(tials.)g(T)-7 b(ec)n(hnical)22 b(rep)r(ort,)g(Univ)n(ersit)n(\023)-39 b(e)21 b(P)n(aris)f(Nord,)j(2000.)53 3130 y(Av)-5 b(ailable)27 b(on)g Fa(http://zeus.math.)o(un)o(iv-)o(pa)o(ri)o(s13)o(.f)o(r/~)o(kl) o(opp)o(/p)o(ub)o(li.)o(ht)o(ml)p Fv(.)-118 3230 y([22])41 b(F.)27 b(Klopp.)h(W)-7 b(eak)27 b(disorder)f(lo)r(calization)h(and)g (Lifshitz)h(tails.)g(T)-7 b(ec)n(hnical)27 b(rep)r(ort,)f(Univ)n(ersit) n(\023)-39 b(e)26 b(P)n(aris-Nord,)f(2001.)-118 3329 y([23])41 b(F.)25 b(Klopp)f(and)h(L.)g(P)n(astur.)f(Lifshitz)h(tails)g (for)f(random)g(Sc)n(hr\177)-42 b(odinger)24 b(op)r(erators)f(with)i (negativ)n(e)f(singular)g(Poisson)f(p)r(oten)n(tial.)53 3429 y Fh(Comm.)30 b(Math.)h(Phys.)p Fv(,)f(206\(1\):57{103,)23 b(1999.)-118 3528 y([24])41 b(P)-7 b(.)38 b(Kuc)n(hmen)n(t.)h Fh(Flo)l(quet)h(the)l(ory)g(for)h(p)l(artial)h(di\013er)l(ential)f(e)l (quations)p Fv(,)h(v)n(olume)c(60)g(of)h Fh(Op)l(er)l(ator)h(The)l (ory:)61 b(A)l(dvanc)l(es)40 b(and)53 3628 y(Applic)l(ations)p Fv(.)29 b(Birkh\177)-42 b(auser,)26 b(Basel,)h(1993.)-118 3728 y([25])41 b(I.)31 b(M.)g(Lifshitz.)h(Structure)f(of)g(the)h (energy)e(sp)r(ectrum)i(of)f(impurit)n(y)g(bands)g(in)g(disordered)f (solid)h(solutions.)g Fh(Soviet)i(Physics)53 3827 y(JETP)p Fv(,)28 b(17:1159{1170,)22 b(1963.)-118 3927 y([26])41 b(I.M.)22 b(Lifshitz,)i(S.A.)f(Gredeskul,)g(and)f(L.A.)h(P)n(astur.)e Fh(Intr)l(o)l(duction)j(to)h(the)g(the)l(ory)g(of)h(disor)l(der)l(e)l (d)h(systems)p Fv(.)22 b(Wiley)-7 b(,)24 b(New-Y)-7 b(ork,)53 4027 y(1988.)-118 4126 y([27])41 b(L.)27 b(P)n(astur)f(and)i(A.)g (Figotin.)f Fh(Sp)l(e)l(ctr)l(a)j(of)g(R)l(andom)g(and)g(A)n (lmost-Perio)l(dic)i(Op)l(er)l(ators)p Fv(.)c(Springer)e(V)-7 b(erlag,)27 b(Berlin,)g(1992.)-118 4226 y([28])41 b(M.)c(Reed)h(and)f (B.)g(Simon.)g Fh(Metho)l(ds)j(of)g(Mo)l(dern)f(Mathematic)l(al)i (Physics,)i(V)-6 b(ol)39 b(IV:)f(Analysis)i(of)f(Op)l(er)l(ators)p Fv(.)f(Academic)53 4325 y(Press,)26 b(New-Y)-7 b(ork,)26 b(1978.)-118 4425 y([29])41 b(J.)26 b(Sj\177)-42 b(ostrand.)25 b(Microlo)r(cal)g(analysis)g(for)h(p)r(erio)r(dic)g(magnetic)g(Sc)n (hr\177)-42 b(odinger)25 b(equation)g(and)i(related)e(questions.)h(In)h Fh(Micr)l(olo)l(c)l(al)53 4525 y(analysis)k(and)f(applic)l(ations)p Fv(,)g(v)n(olume)d(1495)f(of)h Fh(L)l(e)l(ctur)l(e)i(Notes)h(in)g (Mathematics)p Fv(,)f(Berlin,)e(1991.)f(Springer)g(V)-7 b(erlag.)-118 4624 y([30])41 b(P)-7 b(.)27 b(Stollman.)g Fh(Caught)k(by)f(disor)l(der)p Fv(.)f(Birkh\177)-42 b(auser,)26 b(2001.)-118 4724 y([31])41 b(E.C.)27 b(Titsc)n(hmarc)n(h.)h Fh(Eigenfunction)j(exp)l(ansions)f(asso)l(ciate)l(d)i(with)f(se)l(c)l (ond-or)l(der)g(di\013er)l(ential)h(e)l(quations.)f(Part)g(II)p Fv(.)d(Claren-)53 4824 y(don)f(Press,)f(Oxford,)h(1958.)94 5010 y(\(F)-7 b(r)n(\023)-39 b(ed)n(\023)g(eric)27 b(Klopp\))i Fu(D)800 5003 y(\023)800 5010 y(ep)-6 b(ar)g(tement)35 b(de)e(Ma)-6 b(th)1677 5003 y(\023)1677 5010 y(ema)g(tique,)34 b(Institut)e(Galil)2726 5003 y(\023)2726 5010 y(ee,)h(U.M.R.)e(7539)i (C.N.R.S,)e(Univer-)-118 5110 y(sit)-6 5103 y(\023)-6 5110 y(e)h(de)f(P)-7 b(aris-Nord,)30 b(99)h(venue)h(J.-B.)f(Cl)1466 5103 y(\023)1466 5110 y(ement,)g(F-93430)g(Villet)-6 b(aneuse,)31 b(France)94 5210 y Fh(E-mail)g(addr)l(ess)7 b Fv(:)38 b Fa(klopp@math.univ-p)o(ar)o(is)o(13.)o(fr)1969 5690 y Fg(20)p eop %%Trailer end userdict /end-hook known{end-hook}if %%EOF ---------------0110080658492--